|
| 1 | +# Data sources |
| 2 | +database( |
| 3 | + thermoLibraries=['electrocatLiThermo','primaryThermoLibrary', 'LithiumPrimaryThermo', 'LithiumAdditionalThermo', 'thermo_DFT_CCSDTF12_BAC','DFT_QCI_thermo'], # 'surfaceThermoPt' is the default. Thermo data is derived using bindingEnergies for other metals |
| 4 | + reactionLibraries = ['LithiumPrimaryKinetics','LithiumAnalogyKinetics'], # when Ni is used change the library to Surface/Deutschmann_Ni |
| 5 | + seedMechanisms = [], |
| 6 | + kineticsDepositories = ['training'], |
| 7 | + kineticsFamilies = ['surface','electrochem', |
| 8 | + '1+2_Cycloaddition', |
| 9 | + '1,2-Birad_to_alkene', |
| 10 | + '1,2_Insertion_CO', |
| 11 | + '1,2_Insertion_carbene', |
| 12 | + '1,2_shiftS', |
| 13 | + '1,3_Insertion_CO2', |
| 14 | + '1,3_Insertion_ROR', |
| 15 | + '1,3_Insertion_RSR', |
| 16 | + '1,4_Cyclic_birad_scission', |
| 17 | + '1,4_Linear_birad_scission', |
| 18 | + '2+2_cycloaddition', |
| 19 | + 'Birad_recombination', |
| 20 | + 'CO_Disproportionation', |
| 21 | + 'Birad_R_Recombination', |
| 22 | + 'Cyclic_Ether_Formation', |
| 23 | + 'Cyclic_Thioether_Formation', |
| 24 | + 'Diels_alder_addition', |
| 25 | + 'Diels_alder_addition_Aromatic', |
| 26 | + #'Disproportionation', |
| 27 | + 'HO2_Elimination_from_PeroxyRadical', |
| 28 | + 'H_Abstraction', |
| 29 | + 'Intra_Retro_Diels_alder_bicyclic', |
| 30 | + 'Intra_Disproportionation', |
| 31 | + 'Intra_R_Add_Endocyclic', |
| 32 | + 'Intra_R_Add_Exocyclic', |
| 33 | + 'R_Addition_COm', |
| 34 | + 'R_Addition_MultipleBond', |
| 35 | + 'R_Recombination', |
| 36 | + 'intra_H_migration', |
| 37 | + 'intra_NO2_ONO_conversion', |
| 38 | + 'intra_OH_migration', |
| 39 | + 'intra_substitutionCS_cyclization', |
| 40 | + 'intra_substitutionCS_isomerization', |
| 41 | + 'intra_substitutionS_cyclization', |
| 42 | + 'intra_substitutionS_isomerization', |
| 43 | + #'ketoenol', |
| 44 | + 'Singlet_Carbene_Intra_Disproportionation', |
| 45 | + 'Singlet_Val6_to_triplet', |
| 46 | + 'Intra_5_membered_conjugated_C=C_C=C_addition', |
| 47 | + 'Intra_Diels_alder_monocyclic', |
| 48 | + 'Concerted_Intra_Diels_alder_monocyclic_1,2_shiftH', |
| 49 | + 'Intra_2+2_cycloaddition_Cd', |
| 50 | + 'Intra_ene_reaction', |
| 51 | + 'Cyclopentadiene_scission', |
| 52 | + '6_membered_central_C-C_shift', |
| 53 | + 'Intra_R_Add_Exo_scission', |
| 54 | + '1,2_shiftC', |
| 55 | + '1,2_NH3_elimination', |
| 56 | + '1,3_NH3_elimination', |
| 57 | + 'Retroene',], |
| 58 | + kineticsEstimator = 'rate rules', |
| 59 | + adsorptionGroups='adsorptionLi', |
| 60 | +) |
| 61 | + |
| 62 | +catalystProperties( |
| 63 | + metal = 'Li110' |
| 64 | +) |
| 65 | + |
| 66 | +# List of species |
| 67 | +species( |
| 68 | + label="Lip", |
| 69 | + reactive=True, |
| 70 | + structure=SMILES("[Li+]"), |
| 71 | +) |
| 72 | + |
| 73 | +species( |
| 74 | + label='ethylene-carbonate', |
| 75 | + reactive=True, |
| 76 | + structure=SMILES("C1COC(=O)O1"), |
| 77 | +) |
| 78 | + |
| 79 | +species( |
| 80 | + label='vacantX', |
| 81 | + reactive=True, |
| 82 | + structure=adjacencyList("1 X u0"), |
| 83 | +) |
| 84 | + |
| 85 | +species( |
| 86 | + label="Li", |
| 87 | + reactive=True, |
| 88 | + structure=SMILES("[Li]"), |
| 89 | +) |
| 90 | + |
| 91 | +species( |
| 92 | + label='[Li]O[C]1OCCO1', |
| 93 | + reactive=True, |
| 94 | + structure=SMILES("[Li]O[C]1OCCO1"), |
| 95 | +) |
| 96 | + |
| 97 | +species( |
| 98 | + label='[Li]OC(=O)OC[CH2]', |
| 99 | + reactive=True, |
| 100 | + structure=SMILES("[Li]OC(=O)OC[CH2]"), |
| 101 | +) |
| 102 | + |
| 103 | +#species( |
| 104 | +# label='[Li]OC(=O)O[Li]', |
| 105 | +# reactive=True, |
| 106 | +# structure=SMILES("[Li]OC(=O)O[Li]"), |
| 107 | +# ) |
| 108 | + |
| 109 | +#species( |
| 110 | +# label='[Li]OC(=O)OCCOC(=O)OC[CH2]', |
| 111 | +# reactive=True, |
| 112 | +# structure=SMILES("[Li]OC(=O)OCCOC(=O)OC[CH2]"), |
| 113 | +# ) |
| 114 | + |
| 115 | +#species( |
| 116 | +# label='[Li]OC(=O)OCCOC(=O)O[Li]', |
| 117 | +# reactive=True, |
| 118 | +# structure=SMILES("[Li]OC(=O)OCCOC(=O)O[Li]"), |
| 119 | +# ) |
| 120 | + |
| 121 | +#species( |
| 122 | +# label='[Li]OC(=O)OCCCCOC(=O)O[Li]', |
| 123 | +# reactive=True, |
| 124 | +# structure=SMILES("[Li]OC(=O)OCCCCOC(=O)O[Li]"),) |
| 125 | + |
| 126 | +#species( |
| 127 | +# label='[Li]OCCOC(=O)CCOC(=O)O[Li]', |
| 128 | +# reactive=True, |
| 129 | +# structure=SMILES("[Li]OCCOC(=O)CCOC(=O)O[Li]"), |
| 130 | +# ) |
| 131 | + |
| 132 | +#species( |
| 133 | +# label='[Li]OCCOC(=O)OC(=O)O[Li]', |
| 134 | +# reactive=True, |
| 135 | +# structure=SMILES("[Li]OCCOC(=O)OC(=O)O[Li]"), |
| 136 | +#) |
| 137 | + |
| 138 | +#species( |
| 139 | +# label='C2H4', |
| 140 | +# reactive=True, |
| 141 | +# structure=SMILES("C=C"), |
| 142 | +#) |
| 143 | + |
| 144 | +#species( |
| 145 | +# label='O=[C]OCCO[Li]', |
| 146 | +# reactive=True, |
| 147 | +# structure=SMILES("O=[C]OCCO[Li]"), |
| 148 | +#) |
| 149 | + |
| 150 | +#species( |
| 151 | +# label='CO2', |
| 152 | +# reactive=True, |
| 153 | +# structure=SMILES("O=C=O"), |
| 154 | +#) |
| 155 | + |
| 156 | +#species( |
| 157 | +# label='[Li]OC[CH2]', |
| 158 | +# reactive=True, |
| 159 | +# structure=SMILES("[Li]OC[CH2]"), |
| 160 | +#) |
| 161 | + |
| 162 | +#species( |
| 163 | +# label='O1CCO[C]1OC2(O[Li])OCCO2', |
| 164 | +# reactive=True, |
| 165 | +# structure=SMILES("O1CCO[C]1OC2(O[Li])OCCO2"), |
| 166 | +#) |
| 167 | + |
| 168 | +#species( |
| 169 | +# label='O1CCOC1(O[Li])OC(=O)OC[CH2]', |
| 170 | +# reactive=True, |
| 171 | +# structure=SMILES("O1CCOC1(O[Li])OC(=O)OC[CH2]"), |
| 172 | +#) |
| 173 | + |
| 174 | +#species( |
| 175 | +# label='O1CCOC1(O[Li])OC(=O)OCCOC(=O)O[Li]', |
| 176 | +# reactive=True, |
| 177 | +# structure=SMILES("O1CCOC1(O[Li])OC(=O)OCCOC(=O)O[Li]"), |
| 178 | +#) |
| 179 | + |
| 180 | +species( |
| 181 | + label='CO3X2', |
| 182 | + reactive=True, |
| 183 | + structure=adjacencyList("""1 O u0 p2 {2,D} |
| 184 | +2 C u0 p0 {1,D} {3,S} {4,S} |
| 185 | +3 O u0 p2 {2,S} {5,S} |
| 186 | +4 O u0 p2 {2,S} {6,S} |
| 187 | +5 X u0 p0 c0 {3,S} |
| 188 | +6 X u0 p0 c0 {4,S} |
| 189 | +"""), |
| 190 | +) |
| 191 | + |
| 192 | + |
| 193 | +#species( |
| 194 | +# label="CO", |
| 195 | +# reactive=True, |
| 196 | +# structure=SMILES("[C-]#[O+]"), |
| 197 | +#) |
| 198 | + |
| 199 | +#species( |
| 200 | +# label='[Li]OC(=O)OCCX', |
| 201 | +# reactive=True, |
| 202 | +# structure=adjacencyList("""1 O u0 p2 c0 {2,S} {7,S} |
| 203 | +# 2 C u0 p0 c0 {1,S} {3,D} {4,S} |
| 204 | +# 3 O u0 p2 c0 {2,D} |
| 205 | +# 4 O u0 p2 c0 {2,S} {5,S} |
| 206 | +# 5 C u0 p0 c0 {4,S} {6,S} {8,S} {9,S} |
| 207 | +# 6 C u0 p0 c0 {5,S} {10,S} {11,S} {12,S} |
| 208 | +# 7 Li u0 p0 c0 {1,S} |
| 209 | +# 8 H u0 p0 c0 {5,S} |
| 210 | +# 9 H u0 p0 c0 {5,S} |
| 211 | +# 10 H u0 p0 c0 {6,S} |
| 212 | +# 11 H u0 p0 c0 {6,S} |
| 213 | +# 12 X u0 p0 c0 {6,S} |
| 214 | +# """), |
| 215 | +#) |
| 216 | +#species( |
| 217 | +# label='O=C(X)OCCO[Li]', |
| 218 | +# reactive=True, |
| 219 | +# structure=adjacencyList("""1 O u0 p2 c0 {2,D} |
| 220 | +# 2 C u0 p0 c0 {1,D} {3,S} {12,S} |
| 221 | +# 3 O u0 p2 c0 {2,S} {4,S} |
| 222 | +# 4 C u0 p0 c0 {3,S} {5,S} {7,S} {8,S} |
| 223 | +# 5 C u0 p0 c0 {4,S} {6,S} {9,S} {10,S} |
| 224 | +# 6 O u0 p2 c0 {5,S} {11,S} |
| 225 | +# 7 H u0 p0 c0 {4,S} |
| 226 | +# 8 H u0 p0 c0 {4,S} |
| 227 | +# 9 H u0 p0 c0 {5,S} |
| 228 | +# 10 H u0 p0 c0 {5,S} |
| 229 | +# 11 Li u0 p0 c0 {6,S} |
| 230 | +# 12 X u0 p0 c0 {2,S} |
| 231 | +# """), |
| 232 | +#) |
| 233 | + |
| 234 | +liquidSurfaceReactor( |
| 235 | + temperature=(298.15,'K'), |
| 236 | + liqPotential=(-1.0,'V'), |
| 237 | + surfPotential=(0.0,'V'), |
| 238 | + initialConcentrations={ |
| 239 | + "ethylene-carbonate": (7.585e-3*2.0,'mol/cm^3'), |
| 240 | + "Lip": (15.0,'mol/m^3'), |
| 241 | + }, |
| 242 | + initialSurfaceCoverages={ |
| 243 | + "vacantX": 1.0, |
| 244 | + }, |
| 245 | + surfaceVolumeRatio=(1.0e5, 'm^-1'), |
| 246 | + terminationTime=(1.0e3,'sec'), |
| 247 | + constantSpecies=["ethylene-carbonate","Lip"], |
| 248 | +) |
| 249 | + |
| 250 | +solvation( |
| 251 | + solvent='ethylene carbonate' |
| 252 | +) |
| 253 | + |
| 254 | +simulator( |
| 255 | + atol=1e-16, |
| 256 | + rtol=1e-6, |
| 257 | +) |
| 258 | + |
| 259 | +model( |
| 260 | + toleranceKeepInEdge=1E-20, |
| 261 | + toleranceMoveToCore=0.000001, |
| 262 | + toleranceRadMoveToCore=0.00000000001, |
| 263 | + toleranceInterruptSimulation=1e10, |
| 264 | + maximumEdgeSpecies=100000, |
| 265 | + filterReactions=False, |
| 266 | + maxNumObjsPerIter=1, |
| 267 | + terminateAtMaxObjects=True, |
| 268 | + toleranceBranchReactionToCore=0.000001, |
| 269 | + branchingIndex=0.3, |
| 270 | + branchingRatioMax=1.0, |
| 271 | +) |
| 272 | + |
| 273 | +options( |
| 274 | + units='si', |
| 275 | + saveEdgeSpecies=False, |
| 276 | +) |
| 277 | + |
| 278 | +generatedSpeciesConstraints( |
| 279 | + allowed=['input species','reaction libraries'], |
| 280 | + maximumSurfaceSites=1, |
| 281 | + explicitlyForbiddenGroups=[groupAdjacencyList(""" |
| 282 | +1 Xv u0 p0 c0 |
| 283 | +""")], |
| 284 | + maximumCarbonAtoms=8, |
| 285 | + maximumOxygenAtoms=8, |
| 286 | + maximumRadicalElectrons=1, |
| 287 | +) |
| 288 | + |
0 commit comments