diff --git a/LICENSES/BSD-3-Clause.txt b/LICENSES/BSD-3-Clause.txt new file mode 100644 index 000000000..ea890afbc --- /dev/null +++ b/LICENSES/BSD-3-Clause.txt @@ -0,0 +1,11 @@ +Copyright (c) . + +Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: + +1. Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. + +2. Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. + +3. Neither the name of the copyright holder nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/LICENSES/GPL-3.0-or-later.txt b/LICENSES/GPL-3.0-or-later.txt new file mode 100644 index 000000000..f6cdd22a6 --- /dev/null +++ b/LICENSES/GPL-3.0-or-later.txt @@ -0,0 +1,232 @@ +GNU GENERAL PUBLIC LICENSE +Version 3, 29 June 2007 + +Copyright © 2007 Free Software Foundation, Inc. + +Everyone is permitted to copy and distribute verbatim copies of this license document, but changing it is not allowed. + +Preamble + +The GNU General Public License is a free, copyleft license for software and other kinds of works. + +The licenses for most software and other practical works are designed to take away your freedom to share and change the works. By contrast, the GNU General Public License is intended to guarantee your freedom to share and change all versions of a program--to make sure it remains free software for all its users. We, the Free Software Foundation, use the GNU General Public License for most of our software; it applies also to any other work released this way by its authors. You can apply it to your programs, too. + +When we speak of free software, we are referring to freedom, not price. Our General Public Licenses are designed to make sure that you have the freedom to distribute copies of free software (and charge for them if you wish), that you receive source code or can get it if you want it, that you can change the software or use pieces of it in new free programs, and that you know you can do these things. + +To protect your rights, we need to prevent others from denying you these rights or asking you to surrender the rights. Therefore, you have certain responsibilities if you distribute copies of the software, or if you modify it: responsibilities to respect the freedom of others. + +For example, if you distribute copies of such a program, whether gratis or for a fee, you must pass on to the recipients the same freedoms that you received. You must make sure that they, too, receive or can get the source code. And you must show them these terms so they know their rights. + +Developers that use the GNU GPL protect your rights with two steps: (1) assert copyright on the software, and (2) offer you this License giving you legal permission to copy, distribute and/or modify it. + +For the developers' and authors' protection, the GPL clearly explains that there is no warranty for this free software. For both users' and authors' sake, the GPL requires that modified versions be marked as changed, so that their problems will not be attributed erroneously to authors of previous versions. + +Some devices are designed to deny users access to install or run modified versions of the software inside them, although the manufacturer can do so. This is fundamentally incompatible with the aim of protecting users' freedom to change the software. The systematic pattern of such abuse occurs in the area of products for individuals to use, which is precisely where it is most unacceptable. Therefore, we have designed this version of the GPL to prohibit the practice for those products. If such problems arise substantially in other domains, we stand ready to extend this provision to those domains in future versions of the GPL, as needed to protect the freedom of users. + +Finally, every program is threatened constantly by software patents. States should not allow patents to restrict development and use of software on general-purpose computers, but in those that do, we wish to avoid the special danger that patents applied to a free program could make it effectively proprietary. To prevent this, the GPL assures that patents cannot be used to render the program non-free. + +The precise terms and conditions for copying, distribution and modification follow. + +TERMS AND CONDITIONS + +0. Definitions. + +“This License” refers to version 3 of the GNU General Public License. + +“Copyright” also means copyright-like laws that apply to other kinds of works, such as semiconductor masks. + +“The Program” refers to any copyrightable work licensed under this License. Each licensee is addressed as “you”. “Licensees” and “recipients” may be individuals or organizations. + +To “modify” a work means to copy from or adapt all or part of the work in a fashion requiring copyright permission, other than the making of an exact copy. The resulting work is called a “modified version” of the earlier work or a work “based on” the earlier work. + +A “covered work” means either the unmodified Program or a work based on the Program. + +To “propagate” a work means to do anything with it that, without permission, would make you directly or secondarily liable for infringement under applicable copyright law, except executing it on a computer or modifying a private copy. Propagation includes copying, distribution (with or without modification), making available to the public, and in some countries other activities as well. + +To “convey” a work means any kind of propagation that enables other parties to make or receive copies. Mere interaction with a user through a computer network, with no transfer of a copy, is not conveying. + +An interactive user interface displays “Appropriate Legal Notices” to the extent that it includes a convenient and prominently visible feature that (1) displays an appropriate copyright notice, and (2) tells the user that there is no warranty for the work (except to the extent that warranties are provided), that licensees may convey the work under this License, and how to view a copy of this License. If the interface presents a list of user commands or options, such as a menu, a prominent item in the list meets this criterion. + +1. Source Code. +The “source code” for a work means the preferred form of the work for making modifications to it. “Object code” means any non-source form of a work. + +A “Standard Interface” means an interface that either is an official standard defined by a recognized standards body, or, in the case of interfaces specified for a particular programming language, one that is widely used among developers working in that language. + +The “System Libraries” of an executable work include anything, other than the work as a whole, that (a) is included in the normal form of packaging a Major Component, but which is not part of that Major Component, and (b) serves only to enable use of the work with that Major Component, or to implement a Standard Interface for which an implementation is available to the public in source code form. A “Major Component”, in this context, means a major essential component (kernel, window system, and so on) of the specific operating system (if any) on which the executable work runs, or a compiler used to produce the work, or an object code interpreter used to run it. + +The “Corresponding Source” for a work in object code form means all the source code needed to generate, install, and (for an executable work) run the object code and to modify the work, including scripts to control those activities. However, it does not include the work's System Libraries, or general-purpose tools or generally available free programs which are used unmodified in performing those activities but which are not part of the work. For example, Corresponding Source includes interface definition files associated with source files for the work, and the source code for shared libraries and dynamically linked subprograms that the work is specifically designed to require, such as by intimate data communication or control flow between those subprograms and other parts of the work. + +The Corresponding Source need not include anything that users can regenerate automatically from other parts of the Corresponding Source. + +The Corresponding Source for a work in source code form is that same work. + +2. Basic Permissions. +All rights granted under this License are granted for the term of copyright on the Program, and are irrevocable provided the stated conditions are met. This License explicitly affirms your unlimited permission to run the unmodified Program. The output from running a covered work is covered by this License only if the output, given its content, constitutes a covered work. This License acknowledges your rights of fair use or other equivalent, as provided by copyright law. + +You may make, run and propagate covered works that you do not convey, without conditions so long as your license otherwise remains in force. You may convey covered works to others for the sole purpose of having them make modifications exclusively for you, or provide you with facilities for running those works, provided that you comply with the terms of this License in conveying all material for which you do not control copyright. Those thus making or running the covered works for you must do so exclusively on your behalf, under your direction and control, on terms that prohibit them from making any copies of your copyrighted material outside their relationship with you. + +Conveying under any other circumstances is permitted solely under the conditions stated below. Sublicensing is not allowed; section 10 makes it unnecessary. + +3. Protecting Users' Legal Rights From Anti-Circumvention Law. +No covered work shall be deemed part of an effective technological measure under any applicable law fulfilling obligations under article 11 of the WIPO copyright treaty adopted on 20 December 1996, or similar laws prohibiting or restricting circumvention of such measures. + +When you convey a covered work, you waive any legal power to forbid circumvention of technological measures to the extent such circumvention is effected by exercising rights under this License with respect to the covered work, and you disclaim any intention to limit operation or modification of the work as a means of enforcing, against the work's users, your or third parties' legal rights to forbid circumvention of technological measures. + +4. Conveying Verbatim Copies. +You may convey verbatim copies of the Program's source code as you receive it, in any medium, provided that you conspicuously and appropriately publish on each copy an appropriate copyright notice; keep intact all notices stating that this License and any non-permissive terms added in accord with section 7 apply to the code; keep intact all notices of the absence of any warranty; and give all recipients a copy of this License along with the Program. + +You may charge any price or no price for each copy that you convey, and you may offer support or warranty protection for a fee. + +5. Conveying Modified Source Versions. +You may convey a work based on the Program, or the modifications to produce it from the Program, in the form of source code under the terms of section 4, provided that you also meet all of these conditions: + + a) The work must carry prominent notices stating that you modified it, and giving a relevant date. + + b) The work must carry prominent notices stating that it is released under this License and any conditions added under section 7. This requirement modifies the requirement in section 4 to “keep intact all notices”. + + c) You must license the entire work, as a whole, under this License to anyone who comes into possession of a copy. This License will therefore apply, along with any applicable section 7 additional terms, to the whole of the work, and all its parts, regardless of how they are packaged. This License gives no permission to license the work in any other way, but it does not invalidate such permission if you have separately received it. + + d) If the work has interactive user interfaces, each must display Appropriate Legal Notices; however, if the Program has interactive interfaces that do not display Appropriate Legal Notices, your work need not make them do so. + +A compilation of a covered work with other separate and independent works, which are not by their nature extensions of the covered work, and which are not combined with it such as to form a larger program, in or on a volume of a storage or distribution medium, is called an “aggregate” if the compilation and its resulting copyright are not used to limit the access or legal rights of the compilation's users beyond what the individual works permit. Inclusion of a covered work in an aggregate does not cause this License to apply to the other parts of the aggregate. + +6. Conveying Non-Source Forms. +You may convey a covered work in object code form under the terms of sections 4 and 5, provided that you also convey the machine-readable Corresponding Source under the terms of this License, in one of these ways: + + a) Convey the object code in, or embodied in, a physical product (including a physical distribution medium), accompanied by the Corresponding Source fixed on a durable physical medium customarily used for software interchange. + + b) Convey the object code in, or embodied in, a physical product (including a physical distribution medium), accompanied by a written offer, valid for at least three years and valid for as long as you offer spare parts or customer support for that product model, to give anyone who possesses the object code either (1) a copy of the Corresponding Source for all the software in the product that is covered by this License, on a durable physical medium customarily used for software interchange, for a price no more than your reasonable cost of physically performing this conveying of source, or (2) access to copy the Corresponding Source from a network server at no charge. + + c) Convey individual copies of the object code with a copy of the written offer to provide the Corresponding Source. This alternative is allowed only occasionally and noncommercially, and only if you received the object code with such an offer, in accord with subsection 6b. + + d) Convey the object code by offering access from a designated place (gratis or for a charge), and offer equivalent access to the Corresponding Source in the same way through the same place at no further charge. You need not require recipients to copy the Corresponding Source along with the object code. If the place to copy the object code is a network server, the Corresponding Source may be on a different server (operated by you or a third party) that supports equivalent copying facilities, provided you maintain clear directions next to the object code saying where to find the Corresponding Source. Regardless of what server hosts the Corresponding Source, you remain obligated to ensure that it is available for as long as needed to satisfy these requirements. + + e) Convey the object code using peer-to-peer transmission, provided you inform other peers where the object code and Corresponding Source of the work are being offered to the general public at no charge under subsection 6d. + +A separable portion of the object code, whose source code is excluded from the Corresponding Source as a System Library, need not be included in conveying the object code work. + +A “User Product” is either (1) a “consumer product”, which means any tangible personal property which is normally used for personal, family, or household purposes, or (2) anything designed or sold for incorporation into a dwelling. In determining whether a product is a consumer product, doubtful cases shall be resolved in favor of coverage. For a particular product received by a particular user, “normally used” refers to a typical or common use of that class of product, regardless of the status of the particular user or of the way in which the particular user actually uses, or expects or is expected to use, the product. A product is a consumer product regardless of whether the product has substantial commercial, industrial or non-consumer uses, unless such uses represent the only significant mode of use of the product. + +“Installation Information” for a User Product means any methods, procedures, authorization keys, or other information required to install and execute modified versions of a covered work in that User Product from a modified version of its Corresponding Source. The information must suffice to ensure that the continued functioning of the modified object code is in no case prevented or interfered with solely because modification has been made. + +If you convey an object code work under this section in, or with, or specifically for use in, a User Product, and the conveying occurs as part of a transaction in which the right of possession and use of the User Product is transferred to the recipient in perpetuity or for a fixed term (regardless of how the transaction is characterized), the Corresponding Source conveyed under this section must be accompanied by the Installation Information. But this requirement does not apply if neither you nor any third party retains the ability to install modified object code on the User Product (for example, the work has been installed in ROM). + +The requirement to provide Installation Information does not include a requirement to continue to provide support service, warranty, or updates for a work that has been modified or installed by the recipient, or for the User Product in which it has been modified or installed. Access to a network may be denied when the modification itself materially and adversely affects the operation of the network or violates the rules and protocols for communication across the network. + +Corresponding Source conveyed, and Installation Information provided, in accord with this section must be in a format that is publicly documented (and with an implementation available to the public in source code form), and must require no special password or key for unpacking, reading or copying. + +7. Additional Terms. +“Additional permissions” are terms that supplement the terms of this License by making exceptions from one or more of its conditions. Additional permissions that are applicable to the entire Program shall be treated as though they were included in this License, to the extent that they are valid under applicable law. If additional permissions apply only to part of the Program, that part may be used separately under those permissions, but the entire Program remains governed by this License without regard to the additional permissions. + +When you convey a copy of a covered work, you may at your option remove any additional permissions from that copy, or from any part of it. (Additional permissions may be written to require their own removal in certain cases when you modify the work.) You may place additional permissions on material, added by you to a covered work, for which you have or can give appropriate copyright permission. + +Notwithstanding any other provision of this License, for material you add to a covered work, you may (if authorized by the copyright holders of that material) supplement the terms of this License with terms: + + a) Disclaiming warranty or limiting liability differently from the terms of sections 15 and 16 of this License; or + + b) Requiring preservation of specified reasonable legal notices or author attributions in that material or in the Appropriate Legal Notices displayed by works containing it; or + + c) Prohibiting misrepresentation of the origin of that material, or requiring that modified versions of such material be marked in reasonable ways as different from the original version; or + + d) Limiting the use for publicity purposes of names of licensors or authors of the material; or + + e) Declining to grant rights under trademark law for use of some trade names, trademarks, or service marks; or + + f) Requiring indemnification of licensors and authors of that material by anyone who conveys the material (or modified versions of it) with contractual assumptions of liability to the recipient, for any liability that these contractual assumptions directly impose on those licensors and authors. + +All other non-permissive additional terms are considered “further restrictions” within the meaning of section 10. If the Program as you received it, or any part of it, contains a notice stating that it is governed by this License along with a term that is a further restriction, you may remove that term. If a license document contains a further restriction but permits relicensing or conveying under this License, you may add to a covered work material governed by the terms of that license document, provided that the further restriction does not survive such relicensing or conveying. + +If you add terms to a covered work in accord with this section, you must place, in the relevant source files, a statement of the additional terms that apply to those files, or a notice indicating where to find the applicable terms. + +Additional terms, permissive or non-permissive, may be stated in the form of a separately written license, or stated as exceptions; the above requirements apply either way. + +8. Termination. +You may not propagate or modify a covered work except as expressly provided under this License. Any attempt otherwise to propagate or modify it is void, and will automatically terminate your rights under this License (including any patent licenses granted under the third paragraph of section 11). + +However, if you cease all violation of this License, then your license from a particular copyright holder is reinstated (a) provisionally, unless and until the copyright holder explicitly and finally terminates your license, and (b) permanently, if the copyright holder fails to notify you of the violation by some reasonable means prior to 60 days after the cessation. + +Moreover, your license from a particular copyright holder is reinstated permanently if the copyright holder notifies you of the violation by some reasonable means, this is the first time you have received notice of violation of this License (for any work) from that copyright holder, and you cure the violation prior to 30 days after your receipt of the notice. + +Termination of your rights under this section does not terminate the licenses of parties who have received copies or rights from you under this License. If your rights have been terminated and not permanently reinstated, you do not qualify to receive new licenses for the same material under section 10. + +9. Acceptance Not Required for Having Copies. +You are not required to accept this License in order to receive or run a copy of the Program. Ancillary propagation of a covered work occurring solely as a consequence of using peer-to-peer transmission to receive a copy likewise does not require acceptance. However, nothing other than this License grants you permission to propagate or modify any covered work. These actions infringe copyright if you do not accept this License. Therefore, by modifying or propagating a covered work, you indicate your acceptance of this License to do so. + +10. Automatic Licensing of Downstream Recipients. +Each time you convey a covered work, the recipient automatically receives a license from the original licensors, to run, modify and propagate that work, subject to this License. You are not responsible for enforcing compliance by third parties with this License. + +An “entity transaction” is a transaction transferring control of an organization, or substantially all assets of one, or subdividing an organization, or merging organizations. If propagation of a covered work results from an entity transaction, each party to that transaction who receives a copy of the work also receives whatever licenses to the work the party's predecessor in interest had or could give under the previous paragraph, plus a right to possession of the Corresponding Source of the work from the predecessor in interest, if the predecessor has it or can get it with reasonable efforts. + +You may not impose any further restrictions on the exercise of the rights granted or affirmed under this License. For example, you may not impose a license fee, royalty, or other charge for exercise of rights granted under this License, and you may not initiate litigation (including a cross-claim or counterclaim in a lawsuit) alleging that any patent claim is infringed by making, using, selling, offering for sale, or importing the Program or any portion of it. + +11. Patents. +A “contributor” is a copyright holder who authorizes use under this License of the Program or a work on which the Program is based. The work thus licensed is called the contributor's “contributor version”. + +A contributor's “essential patent claims” are all patent claims owned or controlled by the contributor, whether already acquired or hereafter acquired, that would be infringed by some manner, permitted by this License, of making, using, or selling its contributor version, but do not include claims that would be infringed only as a consequence of further modification of the contributor version. For purposes of this definition, “control” includes the right to grant patent sublicenses in a manner consistent with the requirements of this License. + +Each contributor grants you a non-exclusive, worldwide, royalty-free patent license under the contributor's essential patent claims, to make, use, sell, offer for sale, import and otherwise run, modify and propagate the contents of its contributor version. + +In the following three paragraphs, a “patent license” is any express agreement or commitment, however denominated, not to enforce a patent (such as an express permission to practice a patent or covenant not to sue for patent infringement). To “grant” such a patent license to a party means to make such an agreement or commitment not to enforce a patent against the party. + +If you convey a covered work, knowingly relying on a patent license, and the Corresponding Source of the work is not available for anyone to copy, free of charge and under the terms of this License, through a publicly available network server or other readily accessible means, then you must either (1) cause the Corresponding Source to be so available, or (2) arrange to deprive yourself of the benefit of the patent license for this particular work, or (3) arrange, in a manner consistent with the requirements of this License, to extend the patent license to downstream recipients. “Knowingly relying” means you have actual knowledge that, but for the patent license, your conveying the covered work in a country, or your recipient's use of the covered work in a country, would infringe one or more identifiable patents in that country that you have reason to believe are valid. + +If, pursuant to or in connection with a single transaction or arrangement, you convey, or propagate by procuring conveyance of, a covered work, and grant a patent license to some of the parties receiving the covered work authorizing them to use, propagate, modify or convey a specific copy of the covered work, then the patent license you grant is automatically extended to all recipients of the covered work and works based on it. + +A patent license is “discriminatory” if it does not include within the scope of its coverage, prohibits the exercise of, or is conditioned on the non-exercise of one or more of the rights that are specifically granted under this License. You may not convey a covered work if you are a party to an arrangement with a third party that is in the business of distributing software, under which you make payment to the third party based on the extent of your activity of conveying the work, and under which the third party grants, to any of the parties who would receive the covered work from you, a discriminatory patent license (a) in connection with copies of the covered work conveyed by you (or copies made from those copies), or (b) primarily for and in connection with specific products or compilations that contain the covered work, unless you entered into that arrangement, or that patent license was granted, prior to 28 March 2007. + +Nothing in this License shall be construed as excluding or limiting any implied license or other defenses to infringement that may otherwise be available to you under applicable patent law. + +12. No Surrender of Others' Freedom. +If conditions are imposed on you (whether by court order, agreement or otherwise) that contradict the conditions of this License, they do not excuse you from the conditions of this License. If you cannot convey a covered work so as to satisfy simultaneously your obligations under this License and any other pertinent obligations, then as a consequence you may not convey it at all. For example, if you agree to terms that obligate you to collect a royalty for further conveying from those to whom you convey the Program, the only way you could satisfy both those terms and this License would be to refrain entirely from conveying the Program. + +13. Use with the GNU Affero General Public License. +Notwithstanding any other provision of this License, you have permission to link or combine any covered work with a work licensed under version 3 of the GNU Affero General Public License into a single combined work, and to convey the resulting work. The terms of this License will continue to apply to the part which is the covered work, but the special requirements of the GNU Affero General Public License, section 13, concerning interaction through a network will apply to the combination as such. + +14. Revised Versions of this License. +The Free Software Foundation may publish revised and/or new versions of the GNU General Public License from time to time. Such new versions will be similar in spirit to the present version, but may differ in detail to address new problems or concerns. + +Each version is given a distinguishing version number. If the Program specifies that a certain numbered version of the GNU General Public License “or any later version” applies to it, you have the option of following the terms and conditions either of that numbered version or of any later version published by the Free Software Foundation. If the Program does not specify a version number of the GNU General Public License, you may choose any version ever published by the Free Software Foundation. + +If the Program specifies that a proxy can decide which future versions of the GNU General Public License can be used, that proxy's public statement of acceptance of a version permanently authorizes you to choose that version for the Program. + +Later license versions may give you additional or different permissions. However, no additional obligations are imposed on any author or copyright holder as a result of your choosing to follow a later version. + +15. Disclaimer of Warranty. +THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM “AS IS” WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + +16. Limitation of Liability. +IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGES. + +17. Interpretation of Sections 15 and 16. +If the disclaimer of warranty and limitation of liability provided above cannot be given local legal effect according to their terms, reviewing courts shall apply local law that most closely approximates an absolute waiver of all civil liability in connection with the Program, unless a warranty or assumption of liability accompanies a copy of the Program in return for a fee. + +END OF TERMS AND CONDITIONS + +How to Apply These Terms to Your New Programs + +If you develop a new program, and you want it to be of the greatest possible use to the public, the best way to achieve this is to make it free software which everyone can redistribute and change under these terms. + +To do so, attach the following notices to the program. It is safest to attach them to the start of each source file to most effectively state the exclusion of warranty; and each file should have at least the “copyright” line and a pointer to where the full notice is found. + + + Copyright (C) + + This program is free software: you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. + + You should have received a copy of the GNU General Public License along with this program. If not, see . + +Also add information on how to contact you by electronic and paper mail. + +If the program does terminal interaction, make it output a short notice like this when it starts in an interactive mode: + + Copyright (C) + This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the appropriate parts of the General Public License. Of course, your program's commands might be different; for a GUI interface, you would use an “about box”. + +You should also get your employer (if you work as a programmer) or school, if any, to sign a “copyright disclaimer” for the program, if necessary. For more information on this, and how to apply and follow the GNU GPL, see . + +The GNU General Public License does not permit incorporating your program into proprietary programs. If your program is a subroutine library, you may consider it more useful to permit linking proprietary applications with the library. If this is what you want to do, use the GNU Lesser General Public License instead of this License. But first, please read . diff --git a/LICENSES/ISC.txt b/LICENSES/ISC.txt new file mode 100644 index 000000000..b9c199c98 --- /dev/null +++ b/LICENSES/ISC.txt @@ -0,0 +1,8 @@ +ISC License: + +Copyright (c) 2004-2010 by Internet Systems Consortium, Inc. ("ISC") +Copyright (c) 1995-2003 by Internet Software Consortium + +Permission to use, copy, modify, and/or distribute this software for any purpose with or without fee is hereby granted, provided that the above copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND ISC DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL ISC BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/LICENSES/LGPL-3.0-or-later.txt b/LICENSES/LGPL-3.0-or-later.txt new file mode 100644 index 000000000..0a041280b --- /dev/null +++ b/LICENSES/LGPL-3.0-or-later.txt @@ -0,0 +1,165 @@ + GNU LESSER GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + + This version of the GNU Lesser General Public License incorporates +the terms and conditions of version 3 of the GNU General Public +License, supplemented by the additional permissions listed below. + + 0. Additional Definitions. + + As used herein, "this License" refers to version 3 of the GNU Lesser +General Public License, and the "GNU GPL" refers to version 3 of the GNU +General Public License. + + "The Library" refers to a covered work governed by this License, +other than an Application or a Combined Work as defined below. + + An "Application" is any work that makes use of an interface provided +by the Library, but which is not otherwise based on the Library. +Defining a subclass of a class defined by the Library is deemed a mode +of using an interface provided by the Library. + + A "Combined Work" is a work produced by combining or linking an +Application with the Library. The particular version of the Library +with which the Combined Work was made is also called the "Linked +Version". + + The "Minimal Corresponding Source" for a Combined Work means the +Corresponding Source for the Combined Work, excluding any source code +for portions of the Combined Work that, considered in isolation, are +based on the Application, and not on the Linked Version. + + The "Corresponding Application Code" for a Combined Work means the +object code and/or source code for the Application, including any data +and utility programs needed for reproducing the Combined Work from the +Application, but excluding the System Libraries of the Combined Work. + + 1. Exception to Section 3 of the GNU GPL. + + You may convey a covered work under sections 3 and 4 of this License +without being bound by section 3 of the GNU GPL. + + 2. Conveying Modified Versions. + + If you modify a copy of the Library, and, in your modifications, a +facility refers to a function or data to be supplied by an Application +that uses the facility (other than as an argument passed when the +facility is invoked), then you may convey a copy of the modified +version: + + a) under this License, provided that you make a good faith effort to + ensure that, in the event an Application does not supply the + function or data, the facility still operates, and performs + whatever part of its purpose remains meaningful, or + + b) under the GNU GPL, with none of the additional permissions of + this License applicable to that copy. + + 3. Object Code Incorporating Material from Library Header Files. + + The object code form of an Application may incorporate material from +a header file that is part of the Library. You may convey such object +code under terms of your choice, provided that, if the incorporated +material is not limited to numerical parameters, data structure +layouts and accessors, or small macros, inline functions and templates +(ten or fewer lines in length), you do both of the following: + + a) Give prominent notice with each copy of the object code that the + Library is used in it and that the Library and its use are + covered by this License. + + b) Accompany the object code with a copy of the GNU GPL and this license + document. + + 4. Combined Works. + + You may convey a Combined Work under terms of your choice that, +taken together, effectively do not restrict modification of the +portions of the Library contained in the Combined Work and reverse +engineering for debugging such modifications, if you also do each of +the following: + + a) Give prominent notice with each copy of the Combined Work that + the Library is used in it and that the Library and its use are + covered by this License. + + b) Accompany the Combined Work with a copy of the GNU GPL and this license + document. + + c) For a Combined Work that displays copyright notices during + execution, include the copyright notice for the Library among + these notices, as well as a reference directing the user to the + copies of the GNU GPL and this license document. + + d) Do one of the following: + + 0) Convey the Minimal Corresponding Source under the terms of this + License, and the Corresponding Application Code in a form + suitable for, and under terms that permit, the user to + recombine or relink the Application with a modified version of + the Linked Version to produce a modified Combined Work, in the + manner specified by section 6 of the GNU GPL for conveying + Corresponding Source. + + 1) Use a suitable shared library mechanism for linking with the + Library. A suitable mechanism is one that (a) uses at run time + a copy of the Library already present on the user's computer + system, and (b) will operate properly with a modified version + of the Library that is interface-compatible with the Linked + Version. + + e) Provide Installation Information, but only if you would otherwise + be required to provide such information under section 6 of the + GNU GPL, and only to the extent that such information is + necessary to install and execute a modified version of the + Combined Work produced by recombining or relinking the + Application with a modified version of the Linked Version. (If + you use option 4d0, the Installation Information must accompany + the Minimal Corresponding Source and Corresponding Application + Code. If you use option 4d1, you must provide the Installation + Information in the manner specified by section 6 of the GNU GPL + for conveying Corresponding Source.) + + 5. Combined Libraries. + + You may place library facilities that are a work based on the +Library side by side in a single library together with other library +facilities that are not Applications and are not covered by this +License, and convey such a combined library under terms of your +choice, if you do both of the following: + + a) Accompany the combined library with a copy of the same work based + on the Library, uncombined with any other library facilities, + conveyed under the terms of this License. + + b) Give prominent notice with the combined library that part of it + is a work based on the Library, and explaining where to find the + accompanying uncombined form of the same work. + + 6. Revised Versions of the GNU Lesser General Public License. + + The Free Software Foundation may publish revised and/or new versions +of the GNU Lesser General Public License from time to time. Such new +versions will be similar in spirit to the present version, but may +differ in detail to address new problems or concerns. + + Each version is given a distinguishing version number. If the +Library as you received it specifies that a certain numbered version +of the GNU Lesser General Public License "or any later version" +applies to it, you have the option of following the terms and +conditions either of that published version or of any later version +published by the Free Software Foundation. If the Library as you +received it does not specify a version number of the GNU Lesser +General Public License, you may choose any version of the GNU Lesser +General Public License ever published by the Free Software Foundation. + + If the Library as you received it specifies that a proxy can decide +whether future versions of the GNU Lesser General Public License shall +apply, that proxy's public statement of acceptance of any version is +permanent authorization for you to choose that version for the +Library. diff --git a/LICENSES/MPL-2.0.txt b/LICENSES/MPL-2.0.txt new file mode 100644 index 000000000..ee6256cdb --- /dev/null +++ b/LICENSES/MPL-2.0.txt @@ -0,0 +1,373 @@ +Mozilla Public License Version 2.0 +================================== + +1. Definitions +-------------- + +1.1. "Contributor" + means each individual or legal entity that creates, contributes to + the creation of, or owns Covered Software. + +1.2. "Contributor Version" + means the combination of the Contributions of others (if any) used + by a Contributor and that particular Contributor's Contribution. + +1.3. "Contribution" + means Covered Software of a particular Contributor. + +1.4. "Covered Software" + means Source Code Form to which the initial Contributor has attached + the notice in Exhibit A, the Executable Form of such Source Code + Form, and Modifications of such Source Code Form, in each case + including portions thereof. + +1.5. "Incompatible With Secondary Licenses" + means + + (a) that the initial Contributor has attached the notice described + in Exhibit B to the Covered Software; or + + (b) that the Covered Software was made available under the terms of + version 1.1 or earlier of the License, but not also under the + terms of a Secondary License. + +1.6. "Executable Form" + means any form of the work other than Source Code Form. + +1.7. "Larger Work" + means a work that combines Covered Software with other material, in + a separate file or files, that is not Covered Software. + +1.8. "License" + means this document. + +1.9. "Licensable" + means having the right to grant, to the maximum extent possible, + whether at the time of the initial grant or subsequently, any and + all of the rights conveyed by this License. + +1.10. "Modifications" + means any of the following: + + (a) any file in Source Code Form that results from an addition to, + deletion from, or modification of the contents of Covered + Software; or + + (b) any new file in Source Code Form that contains any Covered + Software. + +1.11. "Patent Claims" of a Contributor + means any patent claim(s), including without limitation, method, + process, and apparatus claims, in any patent Licensable by such + Contributor that would be infringed, but for the grant of the + License, by the making, using, selling, offering for sale, having + made, import, or transfer of either its Contributions or its + Contributor Version. + +1.12. "Secondary License" + means either the GNU General Public License, Version 2.0, the GNU + Lesser General Public License, Version 2.1, the GNU Affero General + Public License, Version 3.0, or any later versions of those + licenses. + +1.13. "Source Code Form" + means the form of the work preferred for making modifications. + +1.14. "You" (or "Your") + means an individual or a legal entity exercising rights under this + License. For legal entities, "You" includes any entity that + controls, is controlled by, or is under common control with You. For + purposes of this definition, "control" means (a) the power, direct + or indirect, to cause the direction or management of such entity, + whether by contract or otherwise, or (b) ownership of more than + fifty percent (50%) of the outstanding shares or beneficial + ownership of such entity. + +2. License Grants and Conditions +-------------------------------- + +2.1. Grants + +Each Contributor hereby grants You a world-wide, royalty-free, +non-exclusive license: + +(a) under intellectual property rights (other than patent or trademark) + Licensable by such Contributor to use, reproduce, make available, + modify, display, perform, distribute, and otherwise exploit its + Contributions, either on an unmodified basis, with Modifications, or + as part of a Larger Work; and + +(b) under Patent Claims of such Contributor to make, use, sell, offer + for sale, have made, import, and otherwise transfer either its + Contributions or its Contributor Version. + +2.2. Effective Date + +The licenses granted in Section 2.1 with respect to any Contribution +become effective for each Contribution on the date the Contributor first +distributes such Contribution. + +2.3. Limitations on Grant Scope + +The licenses granted in this Section 2 are the only rights granted under +this License. No additional rights or licenses will be implied from the +distribution or licensing of Covered Software under this License. +Notwithstanding Section 2.1(b) above, no patent license is granted by a +Contributor: + +(a) for any code that a Contributor has removed from Covered Software; + or + +(b) for infringements caused by: (i) Your and any other third party's + modifications of Covered Software, or (ii) the combination of its + Contributions with other software (except as part of its Contributor + Version); or + +(c) under Patent Claims infringed by Covered Software in the absence of + its Contributions. + +This License does not grant any rights in the trademarks, service marks, +or logos of any Contributor (except as may be necessary to comply with +the notice requirements in Section 3.4). + +2.4. Subsequent Licenses + +No Contributor makes additional grants as a result of Your choice to +distribute the Covered Software under a subsequent version of this +License (see Section 10.2) or under the terms of a Secondary License (if +permitted under the terms of Section 3.3). + +2.5. Representation + +Each Contributor represents that the Contributor believes its +Contributions are its original creation(s) or it has sufficient rights +to grant the rights to its Contributions conveyed by this License. + +2.6. Fair Use + +This License is not intended to limit any rights You have under +applicable copyright doctrines of fair use, fair dealing, or other +equivalents. + +2.7. Conditions + +Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted +in Section 2.1. + +3. Responsibilities +------------------- + +3.1. Distribution of Source Form + +All distribution of Covered Software in Source Code Form, including any +Modifications that You create or to which You contribute, must be under +the terms of this License. You must inform recipients that the Source +Code Form of the Covered Software is governed by the terms of this +License, and how they can obtain a copy of this License. You may not +attempt to alter or restrict the recipients' rights in the Source Code +Form. + +3.2. Distribution of Executable Form + +If You distribute Covered Software in Executable Form then: + +(a) such Covered Software must also be made available in Source Code + Form, as described in Section 3.1, and You must inform recipients of + the Executable Form how they can obtain a copy of such Source Code + Form by reasonable means in a timely manner, at a charge no more + than the cost of distribution to the recipient; and + +(b) You may distribute such Executable Form under the terms of this + License, or sublicense it under different terms, provided that the + license for the Executable Form does not attempt to limit or alter + the recipients' rights in the Source Code Form under this License. + +3.3. Distribution of a Larger Work + +You may create and distribute a Larger Work under terms of Your choice, +provided that You also comply with the requirements of this License for +the Covered Software. If the Larger Work is a combination of Covered +Software with a work governed by one or more Secondary Licenses, and the +Covered Software is not Incompatible With Secondary Licenses, this +License permits You to additionally distribute such Covered Software +under the terms of such Secondary License(s), so that the recipient of +the Larger Work may, at their option, further distribute the Covered +Software under the terms of either this License or such Secondary +License(s). + +3.4. Notices + +You may not remove or alter the substance of any license notices +(including copyright notices, patent notices, disclaimers of warranty, +or limitations of liability) contained within the Source Code Form of +the Covered Software, except that You may alter any license notices to +the extent required to remedy known factual inaccuracies. + +3.5. Application of Additional Terms + +You may choose to offer, and to charge a fee for, warranty, support, +indemnity or liability obligations to one or more recipients of Covered +Software. However, You may do so only on Your own behalf, and not on +behalf of any Contributor. You must make it absolutely clear that any +such warranty, support, indemnity, or liability obligation is offered by +You alone, and You hereby agree to indemnify every Contributor for any +liability incurred by such Contributor as a result of warranty, support, +indemnity or liability terms You offer. You may include additional +disclaimers of warranty and limitations of liability specific to any +jurisdiction. + +4. Inability to Comply Due to Statute or Regulation +--------------------------------------------------- + +If it is impossible for You to comply with any of the terms of this +License with respect to some or all of the Covered Software due to +statute, judicial order, or regulation then You must: (a) comply with +the terms of this License to the maximum extent possible; and (b) +describe the limitations and the code they affect. Such description must +be placed in a text file included with all distributions of the Covered +Software under this License. Except to the extent prohibited by statute +or regulation, such description must be sufficiently detailed for a +recipient of ordinary skill to be able to understand it. + +5. Termination +-------------- + +5.1. The rights granted under this License will terminate automatically +if You fail to comply with any of its terms. However, if You become +compliant, then the rights granted under this License from a particular +Contributor are reinstated (a) provisionally, unless and until such +Contributor explicitly and finally terminates Your grants, and (b) on an +ongoing basis, if such Contributor fails to notify You of the +non-compliance by some reasonable means prior to 60 days after You have +come back into compliance. Moreover, Your grants from a particular +Contributor are reinstated on an ongoing basis if such Contributor +notifies You of the non-compliance by some reasonable means, this is the +first time You have received notice of non-compliance with this License +from such Contributor, and You become compliant prior to 30 days after +Your receipt of the notice. + +5.2. If You initiate litigation against any entity by asserting a patent +infringement claim (excluding declaratory judgment actions, +counter-claims, and cross-claims) alleging that a Contributor Version +directly or indirectly infringes any patent, then the rights granted to +You by any and all Contributors for the Covered Software under Section +2.1 of this License shall terminate. + +5.3. In the event of termination under Sections 5.1 or 5.2 above, all +end user license agreements (excluding distributors and resellers) which +have been validly granted by You or Your distributors under this License +prior to termination shall survive termination. + +************************************************************************ +* * +* 6. Disclaimer of Warranty * +* ------------------------- * +* * +* Covered Software is provided under this License on an "as is" * +* basis, without warranty of any kind, either expressed, implied, or * +* statutory, including, without limitation, warranties that the * +* Covered Software is free of defects, merchantable, fit for a * +* particular purpose or non-infringing. The entire risk as to the * +* quality and performance of the Covered Software is with You. * +* Should any Covered Software prove defective in any respect, You * +* (not any Contributor) assume the cost of any necessary servicing, * +* repair, or correction. This disclaimer of warranty constitutes an * +* essential part of this License. No use of any Covered Software is * +* authorized under this License except under this disclaimer. * +* * +************************************************************************ + +************************************************************************ +* * +* 7. Limitation of Liability * +* -------------------------- * +* * +* Under no circumstances and under no legal theory, whether tort * +* (including negligence), contract, or otherwise, shall any * +* Contributor, or anyone who distributes Covered Software as * +* permitted above, be liable to You for any direct, indirect, * +* special, incidental, or consequential damages of any character * +* including, without limitation, damages for lost profits, loss of * +* goodwill, work stoppage, computer failure or malfunction, or any * +* and all other commercial damages or losses, even if such party * +* shall have been informed of the possibility of such damages. This * +* limitation of liability shall not apply to liability for death or * +* personal injury resulting from such party's negligence to the * +* extent applicable law prohibits such limitation. Some * +* jurisdictions do not allow the exclusion or limitation of * +* incidental or consequential damages, so this exclusion and * +* limitation may not apply to You. * +* * +************************************************************************ + +8. Litigation +------------- + +Any litigation relating to this License may be brought only in the +courts of a jurisdiction where the defendant maintains its principal +place of business and such litigation shall be governed by laws of that +jurisdiction, without reference to its conflict-of-law provisions. +Nothing in this Section shall prevent a party's ability to bring +cross-claims or counter-claims. + +9. Miscellaneous +---------------- + +This License represents the complete agreement concerning the subject +matter hereof. If any provision of this License is held to be +unenforceable, such provision shall be reformed only to the extent +necessary to make it enforceable. Any law or regulation which provides +that the language of a contract shall be construed against the drafter +shall not be used to construe this License against a Contributor. + +10. Versions of the License +--------------------------- + +10.1. New Versions + +Mozilla Foundation is the license steward. Except as provided in Section +10.3, no one other than the license steward has the right to modify or +publish new versions of this License. Each version will be given a +distinguishing version number. + +10.2. Effect of New Versions + +You may distribute the Covered Software under the terms of the version +of the License under which You originally received the Covered Software, +or under the terms of any subsequent version published by the license +steward. + +10.3. Modified Versions + +If you create software not governed by this License, and you want to +create a new license for such software, you may create and use a +modified version of this License if you rename the license and remove +any references to the name of the license steward (except to note that +such modified license differs from this License). + +10.4. Distributing Source Code Form that is Incompatible With Secondary +Licenses + +If You choose to distribute Source Code Form that is Incompatible With +Secondary Licenses under the terms of this version of the License, the +notice described in Exhibit B of this License must be attached. + +Exhibit A - Source Code Form License Notice +------------------------------------------- + + This Source Code Form is subject to the terms of the Mozilla Public + License, v. 2.0. If a copy of the MPL was not distributed with this + file, You can obtain one at https://mozilla.org/MPL/2.0/. + +If it is not possible or desirable to put the notice in a particular +file, then You may include the notice in a location (such as a LICENSE +file in a relevant directory) where a recipient would be likely to look +for such a notice. + +You may add additional accurate notices of copyright ownership. + +Exhibit B - "Incompatible With Secondary Licenses" Notice +--------------------------------------------------------- + + This Source Code Form is "Incompatible With Secondary Licenses", as + defined by the Mozilla Public License, v. 2.0. diff --git a/REUSE.toml b/REUSE.toml index 390add692..ff36ecb88 100644 --- a/REUSE.toml +++ b/REUSE.toml @@ -6,7 +6,7 @@ SPDX-PackageSupplier = "Nextcloud " SPDX-PackageDownloadLocation = "https://github.com/nextcloud/logreader" [[annotations]] -path = [".github/issue_template.md", ".github/CODEOWNERS", "package-lock.json", "package.json", "composer.json", "composer.lock", "**/composer.json", "**/composer.lock", ".jshintrc", ".l10nignore", ".tx/config", "tsconfig.json", "js/vendor.LICENSE.txt", "krankerl.toml", ".nextcloudignore", ".devcontainer/devcontainer.json", ".scrutinizer.yml", ".tx/backport"] +path = [".github/issue_template.md", ".github/CODEOWNERS", "package-lock.json", "package.json", "**/package.json", "**/package-lock.json", "composer.json", "composer.lock", "**/composer.json", "**/composer.lock", ".jshintrc", ".l10nignore", ".tx/config", "tsconfig.json", "js/vendor.LICENSE.txt", "krankerl.toml", ".nextcloudignore", ".devcontainer/devcontainer.json", ".scrutinizer.yml", ".tx/backport"] precedence = "aggregate" SPDX-FileCopyrightText = "none" SPDX-License-Identifier = "CC0-1.0" diff --git a/css/logreader-main.css b/css/logreader-main.css index 26b0d09c2..69ff783df 100644 --- a/css/logreader-main.css +++ b/css/logreader-main.css @@ -1,2 +1,2 @@ /* extracted by css-entry-points-plugin */ -@import './main-DSR2r8Ux.chunk.css'; \ No newline at end of file +@import './main-Bl6dXpK2.chunk.css'; \ No newline at end of file diff --git a/css/main-Bl6dXpK2.chunk.css b/css/main-Bl6dXpK2.chunk.css new file mode 100644 index 000000000..4636e987e --- /dev/null +++ b/css/main-Bl6dXpK2.chunk.css @@ -0,0 +1,16 @@ +@charset "UTF-8";.material-design-icon[data-v-e4697e39]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.button-vue[data-v-e4697e39]{--button-size: var(--default-clickable-area);--button-inner-size: calc(var(--button-size) - 4px);--button-radius: var(--border-radius-element);--button-padding-default: calc(var(--default-grid-baseline) + var(--button-radius));--button-padding: var(--default-grid-baseline) var(--button-padding-default);color:var(--color-primary-element-light-text);background-color:var(--color-primary-element-light);border:1px solid var(--color-primary-element-light-hover);border-bottom-width:2px;border-radius:var(--button-radius);box-sizing:border-box;position:relative;width:fit-content;overflow:hidden;padding-block:1px 0;padding-inline:var(--button-padding);min-height:var(--button-size);min-width:var(--button-size);display:flex;align-items:center;justify-content:center;transition-property:color,border-color,background-color;transition-duration:.1s;transition-timing-function:linear;cursor:pointer;font-size:var(--default-font-size);font-weight:700}.button-vue--size-small[data-v-e4697e39]{--button-size: var(--clickable-area-small);--button-radius: var(--border-radius-small)}.button-vue--size-large[data-v-e4697e39]{--button-size: var(--clickable-area-large)}.button-vue[data-v-e4697e39] *{cursor:pointer}.button-vue[data-v-e4697e39]:focus{outline:none}.button-vue[data-v-e4697e39]:disabled{filter:saturate(.7);opacity:.5;cursor:default}.button-vue[data-v-e4697e39]:disabled *{cursor:default}.button-vue[data-v-e4697e39]:hover:not(:disabled){background-color:var(--color-primary-element-light-hover)}.button-vue[data-v-e4697e39]:active{background-color:var(--color-primary-element-light)}.button-vue__wrapper[data-v-e4697e39]{display:inline-flex;align-items:center;justify-content:center;width:100%}.button-vue--end .button-vue__wrapper[data-v-e4697e39]{justify-content:end}.button-vue--start .button-vue__wrapper[data-v-e4697e39]{justify-content:start}.button-vue--reverse .button-vue__wrapper[data-v-e4697e39]{flex-direction:row-reverse}.button-vue--reverse[data-v-e4697e39]{--button-padding: var(--button-padding-default) var(--default-grid-baseline)}.button-vue__icon[data-v-e4697e39]{--default-clickable-area: var(--button-inner-size);height:var(--button-inner-size);width:var(--button-inner-size);min-height:var(--button-inner-size);min-width:var(--button-inner-size);display:flex;justify-content:center;align-items:center}.button-vue__icon[data-v-e4697e39]:empty{display:none}.button-vue--size-small .button-vue__icon[data-v-e4697e39]>*{max-height:16px;max-width:16px}.button-vue--size-small .button-vue__icon[data-v-e4697e39] svg{height:16px;width:16px}.button-vue__text[data-v-e4697e39]{font-weight:700;margin-bottom:1px;padding:2px 0;white-space:nowrap;text-overflow:ellipsis;overflow:hidden}.button-vue__text[data-v-e4697e39]:empty{display:none}.button-vue[data-v-e4697e39]:has(.button-vue__text:empty){--button-padding: var(--button-radius);line-height:1;width:var(--button-size)!important}.button-vue[data-v-e4697e39]:has(.button-vue__icon:empty){--button-padding: var(--button-padding-default)}.button-vue:has(.button-vue__icon:empty) .button-vue__text[data-v-e4697e39]{padding-inline:var(--default-grid-baseline)}.button-vue--wide[data-v-e4697e39]{width:100%}.button-vue[data-v-e4697e39]:focus-visible{outline:2px solid var(--color-main-text)!important;box-shadow:0 0 0 4px var(--color-main-background)!important}.button-vue:focus-visible.button-vue--vue-tertiary-on-primary[data-v-e4697e39]{outline:2px solid var(--color-primary-element-text);border-radius:var(--border-radius-element);background-color:transparent}.button-vue--primary[data-v-e4697e39]{background-color:var(--color-primary-element);border-color:var(--color-primary-element-hover);color:var(--color-primary-element-text)}.button-vue--primary[data-v-e4697e39]:hover:not(:disabled){background-color:var(--color-primary-element-hover)}.button-vue--primary[data-v-e4697e39]:active{background-color:var(--color-primary-element)}.button-vue--secondary[data-v-e4697e39]{background-color:var(--color-primary-element-light);border-color:var(--color-primary-element-light-hover);color:var(--color-primary-element-light-text)}.button-vue--secondary[data-v-e4697e39]:hover:not(:disabled){color:var(--color-primary-element-light-text);background-color:var(--color-primary-element-light-hover)}.button-vue--tertiary[data-v-e4697e39]{background-color:transparent;border-color:transparent;color:var(--color-main-text)}.button-vue--tertiary[data-v-e4697e39]:hover:not(:disabled){background-color:var(--color-background-hover)}.button-vue--tertiary-no-background[data-v-e4697e39]:hover:not(:disabled){background-color:transparent}.button-vue--tertiary-on-primary[data-v-e4697e39]{color:var(--color-primary-element-text)}.button-vue--tertiary-on-primary[data-v-e4697e39]:hover:not(:disabled){background-color:transparent}.button-vue--success[data-v-e4697e39]{border-color:var(--color-success-hover);background-color:var(--color-success);color:var(--color-success-text)}.button-vue--success[data-v-e4697e39]:hover:not(:disabled){background-color:var(--color-success-hover)}.button-vue--success[data-v-e4697e39]:active{background-color:var(--color-success)}.button-vue--warning[data-v-e4697e39]{border-color:var(--color-warning-hover);background-color:var(--color-warning);color:var(--color-warning-text)}.button-vue--warning[data-v-e4697e39]:hover:not(:disabled){background-color:var(--color-warning-hover)}.button-vue--warning[data-v-e4697e39]:active{background-color:var(--color-warning)}.button-vue--error[data-v-e4697e39]{border-color:var(--color-error-hover);background-color:var(--color-error);color:var(--color-error-text)}.button-vue--error[data-v-e4697e39]:hover:not(:disabled){background-color:var(--color-error-hover)}.button-vue--error[data-v-e4697e39]:active{background-color:var(--color-error)}.button-vue--legacy[data-v-e4697e39]{--button-inner-size: var(--button-size);border:none;padding-block:0}.button-vue--legacy.button-vue--error[data-v-e4697e39],.button-vue--legacy.button-vue--success[data-v-e4697e39],.button-vue--legacy.button-vue--warning[data-v-e4697e39]{color:#fff}.material-design-icon[data-v-b101d636]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.empty-content[data-v-b101d636]{display:flex;align-items:center;flex-direction:column;justify-content:center;flex-grow:1;padding:var(--default-grid-baseline)}.modal-wrapper .empty-content[data-v-b101d636]{margin-top:5vh;margin-bottom:5vh}.empty-content__icon[data-v-b101d636]{display:flex;align-items:center;justify-content:center;width:64px;height:64px;margin:0 auto 15px;opacity:.4;background-repeat:no-repeat;background-position:center;background-size:64px}.empty-content__icon[data-v-b101d636] svg{width:64px!important;height:64px!important;max-width:64px!important;max-height:64px!important}.empty-content__name[data-v-b101d636]{margin-bottom:10px;text-align:center;font-weight:700;font-size:20px;line-height:30px}.empty-content__description[data-v-b101d636]{color:var(--color-text-maxcontrast);text-align:center;text-wrap-style:balance}.empty-content__action[data-v-b101d636]{margin-top:8px}.modal-wrapper .empty-content__action[data-v-b101d636]{margin-top:20px;display:flex}.material-design-icon[data-v-7e4656f9]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.notecard[data-v-7e4656f9]{--note-card-icon-size: 20px;--note-card-padding: calc(2 * var(--default-grid-baseline));color:var(--color-main-text)!important;background-color:var(--note-background)!important;border-inline-start:var(--default-grid-baseline) solid var(--note-theme);border-radius:var(--border-radius-small);margin:1rem 0;padding:var(--note-card-padding);display:flex;flex-direction:row;gap:var(--note-card-padding)}.notecard__heading[data-v-7e4656f9]{font-size:var(--note-card-icon-size);font-weight:600}.notecard__icon[data-v-7e4656f9]{color:var(--note-theme)}.notecard__icon--heading[data-v-7e4656f9]{font-size:var(--note-card-icon-size);margin-block:calc((1lh - 1em)/2) auto}.notecard--success[data-v-7e4656f9]{--note-background: var(--color-success);--note-theme: var(--color-success-text)}.notecard--info[data-v-7e4656f9]{--note-background: var(--color-info);--note-theme: var(--color-info-text)}.notecard--error[data-v-7e4656f9]{--note-background: var(--color-error);--note-theme: var(--color-error-text)}.notecard--warning[data-v-7e4656f9]{--note-background: var(--color-warning);--note-theme: var(--color-warning-text)}.notecard--legacy[data-v-7e4656f9]{background-color:color-mix(in srgb,var(--note-background),var(--color-main-background) 80%)!important;color:var(--color-main-text)!important}.material-design-icon[data-v-aaedb1c3]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.icon-vue[data-v-aaedb1c3]{display:flex;justify-content:center;align-items:center;min-width:var(--default-clickable-area);min-height:var(--default-clickable-area);opacity:1}.icon-vue.icon-vue--inline[data-v-aaedb1c3]{display:inline-flex!important;min-width:fit-content;min-height:fit-content;vertical-align:text-bottom}.icon-vue span[data-v-aaedb1c3]{line-height:0}.icon-vue[data-v-aaedb1c3] svg{fill:currentColor;width:var(--fb515064);height:var(--fb515064);max-width:var(--fb515064);max-height:var(--fb515064)}.icon-vue--directional[data-v-aaedb1c3] svg:dir(rtl){transform:scaleX(-1)}._material-design-icon_pq4io_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._appSettingsDialogVersion_pq4io_20{--form-element-label-offset: calc(var(--border-radius-element) + var(--default-grid-baseline));color:var(--color-text-maxcontrast);margin-block-end:calc(8 * var(--default-grid-baseline));margin-inline:var(--form-element-label-offset)}._appSettingsDialogVersion__legacy_pq4io_27{margin-inline:0}.material-design-icon[data-v-aed04601]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-settings[data-v-aed04601] .app-settings__navigation{min-width:200px;margin-inline-end:calc(4 * var(--default-grid-baseline));overflow-x:hidden;overflow-y:auto;position:relative}.app-settings[data-v-aed04601] .app-settings__content{padding-inline:calc(4 * var(--default-grid-baseline))}.navigation-list[data-v-aed04601]{height:100%;overflow-y:auto;padding:calc(3 * var(--default-grid-baseline))}.navigation-list__link[data-v-aed04601]{display:flex;align-content:center;font-size:16px;height:var(--default-clickable-area);margin:4px 0;line-height:var(--default-clickable-area);border-radius:var(--border-radius-element);font-weight:700;padding:0 calc(4 * var(--default-grid-baseline));cursor:pointer;white-space:nowrap;text-overflow:ellipsis;overflow:hidden;background-color:transparent;border:none}.navigation-list__link[data-v-aed04601]:hover,.navigation-list__link[data-v-aed04601]:focus{background-color:var(--color-background-hover)}.navigation-list__link--active[data-v-aed04601]{background-color:var(--color-primary-element-light)!important}.navigation-list__link--icon[data-v-aed04601]{padding-inline-start:calc(2 * var(--default-grid-baseline));gap:var(--default-grid-baseline)}.navigation-list__link-icon[data-v-aed04601]{display:flex;justify-content:center;align-content:center;width:calc(var(--default-clickable-area) - 2 * var(--default-grid-baseline));max-width:calc(var(--default-clickable-area) - 2 * var(--default-grid-baseline))}@media only screen and (max-width: 512px){.app-settings[data-v-aed04601] .dialog__name{padding-inline-start:16px}}@media only screen and (max-width: 512px){.dialog__modal .modal-wrapper--small .modal-container{width:fit-content;height:unset;max-height:90%;position:relative;top:unset;border-radius:var(--border-radius-element)}}.material-design-icon[data-v-ca0b8eba]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.dialog[data-v-ca0b8eba]{height:100%;width:100%;display:flex;flex-direction:column;justify-content:space-between;overflow:hidden}.dialog__modal[data-v-ca0b8eba] .modal-wrapper .modal-container{display:flex!important;padding-block:4px 0;padding-inline:12px 0}.dialog__modal[data-v-ca0b8eba] .modal-wrapper .modal-container__content{display:flex;flex-direction:column;overflow:hidden}.dialog__wrapper[data-v-ca0b8eba]{display:flex;flex-direction:row;flex:1;min-height:0;overflow:hidden}.dialog__wrapper--collapsed[data-v-ca0b8eba]{flex-direction:column}.dialog__navigation[data-v-ca0b8eba]{display:flex;flex-shrink:0}.dialog__wrapper:not(.dialog__wrapper--collapsed) .dialog__navigation[data-v-ca0b8eba]{flex-direction:column;overflow:hidden auto;height:100%;min-width:200px;margin-inline-end:20px}.dialog__wrapper.dialog__wrapper--collapsed .dialog__navigation[data-v-ca0b8eba]{flex-direction:row;justify-content:space-between;overflow:auto hidden;width:100%;min-width:100%}.dialog__name[data-v-ca0b8eba]{font-size:21px;text-align:center;height:fit-content;min-height:var(--default-clickable-area);line-height:var(--default-clickable-area);overflow-wrap:break-word;margin-block:0 12px}.dialog__content[data-v-ca0b8eba]{flex:1;min-height:0;overflow:auto;padding-inline-end:12px}.dialog__text[data-v-ca0b8eba]{padding-block-end:6px}.dialog__actions[data-v-ca0b8eba]{display:flex;gap:6px;align-content:center;justify-content:end;width:100%;max-width:100%;padding-inline:0 12px;margin-inline:0;margin-block:0}.dialog__actions[data-v-ca0b8eba]:not(:empty){margin-block:6px 12px}@media only screen and (max-width: 512px){.dialog__name[data-v-ca0b8eba]{text-align:start;margin-inline-end:var(--default-clickable-area)}}.material-design-icon[data-v-cf399190]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.loading-icon[data-v-cf399190]{overflow:hidden}.loading-icon svg[data-v-cf399190]{animation:rotate var(--animation-duration, .8s) linear infinite}.material-design-icon[data-v-70dc2566]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.modal-mask[data-v-70dc2566]{position:fixed;z-index:9998;top:0;inset-inline-start:0;display:block;width:100%;height:100%;--backdrop-color: 0, 0, 0;background-color:rgba(var(--backdrop-color),.5)}.modal-mask[data-v-70dc2566],.modal-mask[data-v-70dc2566] *{box-sizing:border-box}.modal-mask--opaque[data-v-70dc2566]{background-color:rgba(var(--backdrop-color),.92)}.modal-mask--light[data-v-70dc2566]{--backdrop-color: 255, 255, 255}.modal-header[data-v-70dc2566]{position:absolute;z-index:10001;top:0;inset-inline:0 0;display:flex!important;align-items:center;justify-content:center;width:100%;height:var(--header-height);overflow:hidden;transition:opacity .25s,visibility .25s}.modal-header__name[data-v-70dc2566]{overflow-x:hidden;width:100%;padding:0 calc(var(--default-clickable-area) * 3) 0 12px;transition:padding ease .1s;white-space:nowrap;text-overflow:ellipsis;font-size:16px;margin-block:0}@media only screen and (min-width: 1024px){.modal-header__name[data-v-70dc2566]{padding-inline-start:calc(var(--default-clickable-area) * 3);text-align:center}}.modal-header .icons-menu[data-v-70dc2566]{position:absolute;inset-inline-end:0;display:flex;align-items:center;justify-content:flex-end}.modal-header .icons-menu .header-close[data-v-70dc2566]{display:flex;align-items:center;justify-content:center;margin:calc((var(--header-height) - var(--default-clickable-area)) / 2);padding:0}.modal-header .icons-menu .play-pause-icons[data-v-70dc2566]{position:relative;width:var(--header-height);height:var(--header-height);margin:0;padding:0;cursor:pointer;border:none;background-color:transparent}.modal-header .icons-menu .play-pause-icons:hover .play-pause-icons__play[data-v-70dc2566],.modal-header .icons-menu .play-pause-icons:hover .play-pause-icons__pause[data-v-70dc2566],.modal-header .icons-menu .play-pause-icons:focus .play-pause-icons__play[data-v-70dc2566],.modal-header .icons-menu .play-pause-icons:focus .play-pause-icons__pause[data-v-70dc2566]{opacity:1;border-radius:calc(var(--default-clickable-area) / 2);background-color:#7f7f7f40}.modal-header .icons-menu .play-pause-icons__play[data-v-70dc2566],.modal-header .icons-menu .play-pause-icons__pause[data-v-70dc2566]{width:var(--default-clickable-area);height:var(--default-clickable-area);margin:calc((var(--header-height) - var(--default-clickable-area)) / 2);cursor:pointer;opacity:.7}.modal-header .icons-menu[data-v-70dc2566] .action-item{margin:calc((var(--header-height) - var(--default-clickable-area)) / 2)}.modal-header .icons-menu[data-v-70dc2566] .action-item--single{width:var(--default-clickable-area);height:var(--default-clickable-area);cursor:pointer;background-position:center;background-size:22px}.modal-header .icons-menu .header-actions[data-v-70dc2566] button:focus-visible{box-shadow:none!important;outline:2px solid #fff!important}.modal-header .icons-menu[data-v-70dc2566] .action-item__menutoggle{padding:0}.modal-header .icons-menu[data-v-70dc2566] .action-item__menutoggle span,.modal-header .icons-menu[data-v-70dc2566] .action-item__menutoggle svg{width:var(--icon-size);height:var(--icon-size)}.modal-wrapper[data-v-70dc2566]{display:flex;align-items:center;justify-content:center;width:100%;height:100%}.modal-wrapper .prev[data-v-70dc2566],.modal-wrapper .next[data-v-70dc2566]{z-index:10000;height:35vh;min-height:300px;position:absolute;transition:opacity .25s;color:#fff}.modal-wrapper .prev[data-v-70dc2566]:focus-visible,.modal-wrapper .next[data-v-70dc2566]:focus-visible{box-shadow:0 0 0 2px var(--color-primary-element-text);background-color:var(--color-box-shadow)}.modal-wrapper .prev[data-v-70dc2566]{inset-inline-start:2px}.modal-wrapper .next[data-v-70dc2566]{inset-inline-end:2px}.modal-wrapper .modal-container[data-v-70dc2566]{position:relative;display:flex;padding:0;transition:transform .3s ease;border-radius:var(--border-radius-container);background-color:var(--color-main-background);color:var(--color-main-text);box-shadow:0 0 40px #0003}.modal-wrapper .modal-container__close[data-v-70dc2566]{z-index:1;position:absolute;top:4px;inset-inline-end:var(--default-grid-baseline)}.modal-wrapper .modal-container__content[data-v-70dc2566]{width:100%;min-height:52px;overflow:auto}.modal-wrapper--small>.modal-container[data-v-70dc2566]{width:400px;max-width:90%;max-height:min(90%,100% - 2 * var(--header-height))}.modal-wrapper--normal>.modal-container[data-v-70dc2566]{max-width:90%;width:600px;max-height:min(90%,100% - 2 * var(--header-height))}.modal-wrapper--large>.modal-container[data-v-70dc2566]{max-width:90%;width:900px;max-height:min(90%,100% - 2 * var(--header-height))}.modal-wrapper--full>.modal-container[data-v-70dc2566]{width:100%;height:calc(100% - var(--header-height));position:absolute;top:var(--header-height);border-radius:0}@media only screen and ((max-width: 512px) or (max-height: 400px)){.modal-wrapper .modal-container[data-v-70dc2566]{max-width:initial;width:100%;max-height:initial;height:calc(100% - var(--header-height));position:absolute;top:var(--header-height);border-radius:0}}.fade-enter-active[data-v-70dc2566],.fade-leave-active[data-v-70dc2566]{transition:opacity .25s}.fade-enter-from[data-v-70dc2566],.fade-leave-to[data-v-70dc2566]{opacity:0}.fade-visibility-enter-from[data-v-70dc2566],.fade-visibility-leave-to[data-v-70dc2566]{visibility:hidden;opacity:0}.modal-in-enter-active[data-v-70dc2566],.modal-in-leave-active[data-v-70dc2566],.modal-out-enter-active[data-v-70dc2566],.modal-out-leave-active[data-v-70dc2566]{transition:opacity .25s}.modal-in-enter-from[data-v-70dc2566],.modal-in-leave-to[data-v-70dc2566],.modal-out-enter-from[data-v-70dc2566],.modal-out-leave-to[data-v-70dc2566]{opacity:0}.modal-in-enter .modal-container[data-v-70dc2566],.modal-in-leave-to .modal-container[data-v-70dc2566]{transform:scale(.9)}.modal-out-enter .modal-container[data-v-70dc2566],.modal-out-leave-to .modal-container[data-v-70dc2566]{transform:scale(1.1)}.modal-mask .play-pause-icons .progress-ring[data-v-70dc2566]{position:absolute;top:0;inset-inline-start:0;transform:rotate(-90deg)}.modal-mask .play-pause-icons .progress-ring .progress-ring__circle[data-v-70dc2566]{transition:.1s stroke-dashoffset;transform-origin:50% 50%;animation:progressring-70dc2566 linear var(--slideshow-duration) infinite;stroke-linecap:round;stroke-dashoffset:94.2477796077;stroke-dasharray:94.2477796077}.modal-mask .play-pause-icons--paused .icon-pause[data-v-70dc2566]{animation:breath-70dc2566 2s cubic-bezier(.4,0,.2,1) infinite}.modal-mask .play-pause-icons--paused .progress-ring__circle[data-v-70dc2566]{animation-play-state:paused!important}@keyframes progressring-70dc2566{0%{stroke-dashoffset:94.2477796077}to{stroke-dashoffset:0}}@keyframes breath-70dc2566{0%{opacity:1}50%{opacity:0}to{opacity:1}}.material-design-icon[data-v-6c109b7a]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.action-items[data-v-6c109b7a]{display:flex;align-items:center;gap:calc((var(--default-clickable-area) - 16px) / 2 / 2)}.action-item[data-v-6c109b7a]{--open-background-color: var(--color-background-hover, $action-background-hover);position:relative;display:inline-block}.action-item.action-item--primary[data-v-6c109b7a]{--open-background-color: var(--color-primary-element-hover)}.action-item.action-item--secondary[data-v-6c109b7a]{--open-background-color: var(--color-primary-element-light-hover)}.action-item.action-item--error[data-v-6c109b7a]{--open-background-color: var(--color-error-hover)}.action-item.action-item--warning[data-v-6c109b7a]{--open-background-color: var(--color-warning-hover)}.action-item.action-item--success[data-v-6c109b7a]{--open-background-color: var(--color-success-hover)}.action-item.action-item--tertiary-no-background[data-v-6c109b7a]{--open-background-color: transparent}.action-item.action-item--open .action-item__menutoggle[data-v-6c109b7a]{background-color:var(--open-background-color)}.action-item__menutoggle__icon[data-v-6c109b7a]{width:20px;height:20px;object-fit:contain}.v-popper--theme-nc-popover-9.v-popper__popper.action-item__popper .v-popper__wrapper{border-radius:var(--border-radius-element)}.v-popper--theme-nc-popover-9.v-popper__popper.action-item__popper .v-popper__wrapper .v-popper__inner{border-radius:var(--border-radius-element);padding:4px;max-height:calc(100vh - var(--header-height));overflow:auto}._material-design-icon_wpltc_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9,._ncPopover_wpltc_20.v-popper--theme-nc-popover-9 *{box-sizing:border-box}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9 .resize-observer{position:absolute;top:0;left:0;z-index:-1;width:100%;height:100%;border:none;background-color:transparent;pointer-events:none;display:block;overflow:hidden;opacity:0}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9 .resize-observer object{display:block;position:absolute;top:0;left:0;height:100%;width:100%;overflow:hidden;pointer-events:none;z-index:-1}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper{z-index:100000;top:0;left:0;display:block!important}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper .v-popper__wrapper{box-shadow:0 1px 10px var(--color-box-shadow);border-radius:var(--border-radius-element)}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper .v-popper__inner{padding:0;color:var(--color-main-text);border-radius:var(--border-radius-element);overflow:hidden;background:var(--color-main-background)}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper .v-popper__arrow-container{position:absolute;z-index:1;width:0;height:0;border-style:solid;border-color:transparent;border-width:10px}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper[data-popper-placement^=top] .v-popper__arrow-container{bottom:-9px;border-bottom-width:0;border-top-color:var(--color-main-background)}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper[data-popper-placement^=bottom] .v-popper__arrow-container{top:-9px;border-top-width:0;border-bottom-color:var(--color-main-background)}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper[data-popper-placement^=right] .v-popper__arrow-container{left:-9px;border-left-width:0;border-right-color:var(--color-main-background)}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper[data-popper-placement^=left] .v-popper__arrow-container{right:-9px;border-right-width:0;border-left-color:var(--color-main-background)}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper[aria-hidden=true]{visibility:hidden;transition:opacity var(--animation-quick),visibility var(--animation-quick);opacity:0}._ncPopover_wpltc_20.v-popper--theme-nc-popover-9.v-popper__popper[aria-hidden=false]{visibility:visible;transition:opacity var(--animation-quick);opacity:1}.material-design-icon[data-v-4095bb7f]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-settings-section[data-v-4095bb7f]{--form-element-label-offset: calc(var(--border-radius-element) + var(--default-grid-baseline));--app-settings-section-text-offset: var(--form-element-label-offset);--app-settings-section-content-gap: calc(6 * var(--default-grid-baseline));margin-block-end:calc(8 * var(--default-grid-baseline))}.app-settings-section__name[data-v-4095bb7f]{margin:0;padding-inline:var(--app-settings-section-text-offset);padding-block:0;font-size:20px;font-weight:700}.app-settings-section__description[data-v-4095bb7f]{padding-inline:var(--app-settings-section-text-offset);color:var(--color-text-maxcontrast)}.app-settings-section__content[data-v-4095bb7f]{margin-block-start:calc(2 * var(--default-grid-baseline));display:flex;flex-direction:column;justify-content:stretch;gap:var(--app-settings-section-content-gap)}.app-settings-section__legacy[data-v-4095bb7f]{--app-settings-section-text-offset: 0;--app-settings-section-content-gap: 0}.material-design-icon[data-v-330b5e3e]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}li.action[data-v-330b5e3e]:hover,li.action.active[data-v-330b5e3e]{border-radius:6px;padding:0}li.action[data-v-330b5e3e]:hover{background-color:var(--color-background-hover)}.action--disabled[data-v-330b5e3e]{pointer-events:none;opacity:.5}.action--disabled[data-v-330b5e3e]:hover,.action--disabled[data-v-330b5e3e]:focus{cursor:default;opacity:.5}.action--disabled[data-v-330b5e3e] *{opacity:1!important}.action-button[data-v-330b5e3e]{display:flex;align-items:flex-start;width:100%;height:auto;margin:0;padding:0;padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2);box-sizing:border-box;cursor:pointer;white-space:nowrap;color:var(--color-main-text);border:0;border-radius:0;background-color:transparent;box-shadow:none;font-weight:400;font-size:var(--default-font-size);line-height:var(--default-clickable-area)}.action-button>span[data-v-330b5e3e]{cursor:pointer;white-space:nowrap}.action-button__icon[data-v-330b5e3e]{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1;background-position:calc((var(--default-clickable-area) - 16px) / 2) center;background-size:16px;background-repeat:no-repeat}.action-button[data-v-330b5e3e] .material-design-icon{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1}.action-button[data-v-330b5e3e] .material-design-icon .material-design-icon__svg{vertical-align:middle}.action-button__longtext-wrapper[data-v-330b5e3e],.action-button__longtext[data-v-330b5e3e]{max-width:220px;line-height:1.6em;padding:calc((var(--default-clickable-area) - 1.6em) / 2) 0;cursor:pointer;text-align:start;overflow:hidden;text-overflow:ellipsis}.action-button__longtext[data-v-330b5e3e]{cursor:pointer;white-space:pre-wrap!important}.action-button__name[data-v-330b5e3e]{font-weight:700;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;max-width:100%;display:block}.action-button__description[data-v-330b5e3e]{display:block;white-space:pre-wrap;font-size:var(--font-size-small);line-height:var(--default-line-height);color:var(--color-text-maxcontrast);cursor:pointer}.action-button__menu-icon[data-v-330b5e3e],.action-button__pressed-icon[data-v-330b5e3e]{margin-inline:auto calc((var(--default-clickable-area) - 16px) / 2 * -1)}.action-button[data-v-330b5e3e] *{cursor:pointer}.material-design-icon[data-v-f57c2142]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.nc-button-group-base>div[data-v-f57c2142]{text-align:center;color:var(--color-text-maxcontrast)}.nc-button-group-base ul.nc-button-group-content[data-v-f57c2142]{display:flex;gap:4px;justify-content:space-between}.nc-button-group-base ul.nc-button-group-content li[data-v-f57c2142-s]{flex:1 1}.nc-button-group-base ul.nc-button-group-content[data-v-f57c2142] .action-button{padding:0!important;width:100%;display:flex;justify-content:center}.nc-button-group-base ul.nc-button-group-content[data-v-f57c2142] .action-button.action-button--active{background-color:var(--color-primary-element);border-radius:var(--border-radius-element);color:var(--color-primary-element-text)}.nc-button-group-base ul.nc-button-group-content[data-v-f57c2142] .action-button.action-button--active:hover,.nc-button-group-base ul.nc-button-group-content[data-v-f57c2142] .action-button.action-button--active:focus,.nc-button-group-base ul.nc-button-group-content[data-v-f57c2142] .action-button.action-button--active:focus-within{background-color:var(--color-primary-element-hover)}.nc-button-group-base ul.nc-button-group-content[data-v-f57c2142] .action-button .action-button__pressed-icon{display:none}.material-design-icon[data-v-1009e96c]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-caption[data-v-1009e96c]{color:var(--color-text-maxcontrast);line-height:var(--default-clickable-area);white-space:nowrap;text-overflow:ellipsis;box-shadow:none!important;-webkit-user-select:none;user-select:none;pointer-events:none;margin-inline-start:12px;padding-inline-end:14px;height:var(--default-clickable-area);display:flex;align-items:center}.material-design-icon[data-v-6099342c]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}li.action[data-v-6099342c]:hover,li.action.active[data-v-6099342c]{border-radius:6px;padding:0}li.action[data-v-6099342c]:hover{background-color:var(--color-background-hover)}.action--disabled[data-v-6099342c]{pointer-events:none;opacity:.5}.action--disabled[data-v-6099342c]:hover,.action--disabled[data-v-6099342c]:focus{cursor:default;opacity:.5}.action--disabled[data-v-6099342c] *{opacity:1!important}.action-checkbox[data-v-6099342c]{display:flex;align-items:flex-start;width:100%;height:auto;margin:0;padding:0;cursor:pointer;white-space:nowrap;color:var(--color-main-text);border:0;border-radius:0;background-color:transparent;box-shadow:none;font-weight:400;line-height:var(--default-clickable-area)}.action-checkbox__checkbox[data-v-6099342c]{position:absolute;inset-inline-start:0!important;z-index:-1;opacity:0}.action-checkbox__label[data-v-6099342c]{display:flex;align-items:center;width:100%;padding:0!important;padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2)!important}.action-checkbox__label[data-v-6099342c]:before{margin-block:0!important;margin-inline:calc((var(--default-clickable-area) - 14px) / 2)!important}.action-checkbox--disabled[data-v-6099342c],.action-checkbox--disabled .action-checkbox__label[data-v-6099342c]{cursor:pointer}.material-design-icon[data-v-0fc02b30]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}button[data-v-0fc02b30]:not(.button-vue),input[data-v-0fc02b30]:not([type=range]),textarea[data-v-0fc02b30]{margin:0;padding:7px 6px;cursor:text;color:var(--color-main-text);border:1px solid var(--color-border-dark);border-radius:var(--border-radius-element);outline:none;background-color:var(--color-main-background);font-size:13px}button[data-v-0fc02b30]:not(.button-vue):not(:disabled):not(.primary):hover,button[data-v-0fc02b30]:not(.button-vue):not(:disabled):not(.primary):focus,button:not(.button-vue):not(:disabled):not(.primary).active[data-v-0fc02b30],input[data-v-0fc02b30]:not([type=range]):not(:disabled):not(.primary):hover,input[data-v-0fc02b30]:not([type=range]):not(:disabled):not(.primary):focus,input:not([type=range]):not(:disabled):not(.primary).active[data-v-0fc02b30],textarea[data-v-0fc02b30]:not(:disabled):not(.primary):hover,textarea[data-v-0fc02b30]:not(:disabled):not(.primary):focus,textarea:not(:disabled):not(.primary).active[data-v-0fc02b30]{border-color:var(--color-primary-element);outline:none}button[data-v-0fc02b30]:not(.button-vue):not(:disabled):not(.primary):active,input[data-v-0fc02b30]:not([type=range]):not(:disabled):not(.primary):active,textarea[data-v-0fc02b30]:not(:disabled):not(.primary):active{color:var(--color-main-text);outline:none;background-color:var(--color-main-background)}button[data-v-0fc02b30]:not(.button-vue):disabled,input[data-v-0fc02b30]:not([type=range]):disabled,textarea[data-v-0fc02b30]:disabled{cursor:default;opacity:.5;color:var(--color-text-maxcontrast);background-color:var(--color-background-dark)}button[data-v-0fc02b30]:not(.button-vue):required,input[data-v-0fc02b30]:not([type=range]):required,textarea[data-v-0fc02b30]:required{box-shadow:none}button[data-v-0fc02b30]:not(.button-vue):invalid,input[data-v-0fc02b30]:not([type=range]):invalid,textarea[data-v-0fc02b30]:invalid{border-color:var(--color-border-error, var(--color-error));box-shadow:none!important}button:not(.button-vue).primary[data-v-0fc02b30],input:not([type=range]).primary[data-v-0fc02b30],textarea.primary[data-v-0fc02b30]{cursor:pointer;color:var(--color-primary-element-text);border-color:var(--color-primary-element);background-color:var(--color-primary-element)}button:not(.button-vue).primary[data-v-0fc02b30]:not(:disabled):hover,button:not(.button-vue).primary[data-v-0fc02b30]:not(:disabled):focus,button:not(.button-vue).primary[data-v-0fc02b30]:not(:disabled):active,input:not([type=range]).primary[data-v-0fc02b30]:not(:disabled):hover,input:not([type=range]).primary[data-v-0fc02b30]:not(:disabled):focus,input:not([type=range]).primary[data-v-0fc02b30]:not(:disabled):active,textarea.primary[data-v-0fc02b30]:not(:disabled):hover,textarea.primary[data-v-0fc02b30]:not(:disabled):focus,textarea.primary[data-v-0fc02b30]:not(:disabled):active{border-color:var(--color-primary-element-light);background-color:var(--color-primary-element-light)}button:not(.button-vue).primary[data-v-0fc02b30]:not(:disabled):active,input:not([type=range]).primary[data-v-0fc02b30]:not(:disabled):active,textarea.primary[data-v-0fc02b30]:not(:disabled):active{color:var(--color-primary-element-text-dark)}button:not(.button-vue).primary[data-v-0fc02b30]:disabled,input:not([type=range]).primary[data-v-0fc02b30]:disabled,textarea.primary[data-v-0fc02b30]:disabled{cursor:default;color:var(--color-primary-element-text-dark);background-color:var(--color-primary-element)}li.action[data-v-0fc02b30]:hover,li.action.active[data-v-0fc02b30]{border-radius:6px;padding:0}li.action[data-v-0fc02b30]:hover{background-color:var(--color-background-hover)}.action--disabled[data-v-0fc02b30]{pointer-events:none;opacity:.5}.action--disabled[data-v-0fc02b30]:hover,.action--disabled[data-v-0fc02b30]:focus{cursor:default;opacity:.5}.action--disabled[data-v-0fc02b30] *{opacity:1!important}.action-input[data-v-0fc02b30]{display:flex;align-items:flex-start;width:100%;height:auto;margin:0;padding:0;cursor:pointer;white-space:nowrap;color:var(--color-main-text);border:0;border-radius:0;background-color:transparent;box-shadow:none;font-weight:400}.action-input__icon-wrapper[data-v-0fc02b30]{display:flex;align-self:center;align-items:center;justify-content:center}.action-input__icon-wrapper[data-v-0fc02b30] .material-design-icon{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1}.action-input__icon-wrapper[data-v-0fc02b30] .material-design-icon .material-design-icon__svg{vertical-align:middle}.action-input>span[data-v-0fc02b30]{cursor:pointer;white-space:nowrap}.action-input__icon[data-v-0fc02b30]{min-width:0;min-height:0;padding:calc(var(--default-clickable-area) / 2) 0 calc(var(--default-clickable-area) / 2) var(--default-clickable-area);background-position:calc((var(--default-clickable-area) - 16px) / 2) center;background-size:16px}.action-input__form[data-v-0fc02b30]{display:flex;align-items:center;flex:1 1 auto;margin:4px 0;padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2)}.action-input__container[data-v-0fc02b30]{position:relative;width:100%}.action-input__input-container[data-v-0fc02b30]{display:flex}.action-input__input-container .colorpicker__trigger[data-v-0fc02b30],.action-input__input-container .colorpicker__preview[data-v-0fc02b30]{width:100%}.action-input__input-container .colorpicker__preview[data-v-0fc02b30]{width:100%;height:36px;border-radius:var(--border-radius-element);border:2px solid var(--color-border-maxcontrast);box-shadow:none!important}.action-input__text-label[data-v-0fc02b30]{padding:4px 0;display:block}.action-input__text-label--hidden[data-v-0fc02b30]{position:absolute;inset-inline-start:0;width:1px;height:1px;overflow:hidden;z-index:-1;opacity:0}.action-input__datetimepicker[data-v-0fc02b30]{width:100%}.action-input__datetimepicker[data-v-0fc02b30] .mx-input{margin:0}.action-input__multi[data-v-0fc02b30]{width:100%}li:last-child>.action-input[data-v-0fc02b30]{padding-bottom:calc((var(--default-clickable-area) - 16px) / 2 - 4px)}li:first-child>.action-input[data-v-0fc02b30]:not(.action-input--visible-label){padding-top:calc((var(--default-clickable-area) - 16px) / 2 - 4px)}.material-design-icon[data-v-b97e1f7a]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.native-datetime-picker[data-v-b97e1f7a]{display:flex;flex-direction:column}.native-datetime-picker .native-datetime-picker__label[data-v-b97e1f7a]{margin-block-end:2px}.native-datetime-picker .native-datetime-picker__input[data-v-b97e1f7a]{--input-border-width-offset: calc(var(--border-width-input-focused, 2px) - var(--border-width-input, 2px));width:100%;flex:0 0 auto;margin:0;padding-inline-start:calc(var(--border-radius-element) + var(--input-border-width-offset));padding-inline-end:calc(var(--default-grid-baseline) + var(--input-border-width-offset));border:var(--border-width-input, 2px) solid var(--color-border-maxcontrast)}.native-datetime-picker .native-datetime-picker__input[data-v-b97e1f7a]:active:not([disabled]),.native-datetime-picker .native-datetime-picker__input[data-v-b97e1f7a]:hover:not([disabled]),.native-datetime-picker .native-datetime-picker__input[data-v-b97e1f7a]:focus:not([disabled]),.native-datetime-picker .native-datetime-picker__input[data-v-b97e1f7a]:focus-within:not([disabled]){border-color:var(--color-main-text);border-width:var(--border-width-input-focused, 2px);box-shadow:0 0 0 2px var(--color-main-background)!important;--input-border-width-offset: 0px}[data-theme-light] .native-datetime-picker__input[data-v-b97e1f7a],[data-themes*=light] .native-datetime-picker__input[data-v-b97e1f7a]{color-scheme:light}[data-theme-dark] .native-datetime-picker__input[data-v-b97e1f7a],[data-themes*=dark] .native-datetime-picker__input[data-v-b97e1f7a]{color-scheme:dark}@media (prefers-color-scheme: light){[data-theme-default] .native-datetime-picker__input[data-v-b97e1f7a],[data-themes*=default] .native-datetime-picker__input[data-v-b97e1f7a]{color-scheme:light}}@media (prefers-color-scheme: dark){[data-theme-default] .native-datetime-picker__input[data-v-b97e1f7a],[data-themes*=default] .native-datetime-picker__input[data-v-b97e1f7a]{color-scheme:dark}}.material-design-icon[data-v-b2684de6]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}[data-v-b2684de6] .password-field__input--secure-text{-webkit-text-security:disc}.material-design-icon[data-v-3487c05a]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.input-field[data-v-3487c05a]{--input-border-color: var(--color-border-maxcontrast);--input-border-radius: var(--border-radius-element);--input-border-width-offset: calc(var(--border-width-input-focused, 2px) - var(--border-width-input, 2px));--input-padding-start: var(--border-radius-element);--input-padding-end: var(--border-radius-element);position:relative;width:100%;margin-block-start:6px}.input-field--disabled[data-v-3487c05a]{opacity:.4;filter:saturate(.4)}.input-field--label-outside[data-v-3487c05a]{margin-block-start:0}.input-field--leading-icon[data-v-3487c05a]{--input-padding-start: calc(var(--default-clickable-area) - var(--default-grid-baseline))}.input-field--trailing-icon[data-v-3487c05a]{--input-padding-end: calc(var(--default-clickable-area) - var(--default-grid-baseline))}.input-field--pill[data-v-3487c05a]{--input-border-radius: var(--border-radius-pill)}.input-field__main-wrapper[data-v-3487c05a]{height:var(--default-clickable-area);padding:var(--border-width-input, 2px);position:relative}.input-field__main-wrapper[data-v-3487c05a]:not(:has([disabled])):has(input:focus),.input-field__main-wrapper[data-v-3487c05a]:not(:has([disabled])):has(input:active){padding:0}.input-field__input[data-v-3487c05a]{background-color:var(--color-main-background);color:var(--color-main-text);border:none;border-radius:var(--input-border-radius);box-shadow:0 -1px var(--input-border-color),0 0 0 1px color-mix(in srgb,var(--input-border-color),65% transparent);cursor:pointer;-webkit-appearance:textfield!important;-moz-appearance:textfield!important;appearance:textfield!important;font-size:var(--default-font-size);text-overflow:ellipsis;height:100%!important;min-height:unset;width:100%;padding-block:var(--input-border-width-offset);padding-inline:calc(var(--input-padding-start) + var(--input-border-width-offset)) calc(var(--input-padding-end) + var(--input-border-width-offset))}.input-field__input[data-v-3487c05a]::placeholder{color:var(--color-text-maxcontrast)}.input-field__input[data-v-3487c05a]::-webkit-search-cancel-button{display:none}.input-field__input[data-v-3487c05a]::-webkit-search-decoration,.input-field__input[data-v-3487c05a]::-webkit-search-results-button,.input-field__input[data-v-3487c05a]::-webkit-search-results-decoration,.input-field__input[data-v-3487c05a]::-ms-clear{display:none}.input-field__input[data-v-3487c05a]:hover:not([disabled]){box-shadow:0 0 0 1px var(--input-border-color)}.input-field__input[data-v-3487c05a]:active:not([disabled]),.input-field__input[data-v-3487c05a]:focus:not([disabled]){--input-border-color: var(--color-main-text);--input-border-width-offset: 0px;border:var(--border-width-input-focused, 2px) solid var(--input-border-color);box-shadow:0 0 0 2px var(--color-main-background)!important}.input-field__input:focus+.input-field__label[data-v-3487c05a],.input-field__input:hover:not(:placeholder-shown)+.input-field__label[data-v-3487c05a]{color:var(--color-main-text)}.input-field__input[data-v-3487c05a]:focus{cursor:text}.input-field__input[data-v-3487c05a]:disabled{cursor:default}.input-field__input[data-v-3487c05a]:focus-visible{box-shadow:unset!important}.input-field:not(.input-field--label-outside) .input-field__input[data-v-3487c05a]:not(:focus)::placeholder{opacity:0}.input-field__label[data-v-3487c05a]{--input-label-font-size: var(--default-font-size);font-size:var(--input-label-font-size);position:absolute;margin-inline:var(--input-padding-start) var(--input-padding-end);max-width:fit-content;inset-block-start:calc((var(--default-clickable-area) - 1lh) / 2);inset-inline:var(--border-width-input-focused, 2px);color:var(--color-text-maxcontrast);white-space:nowrap;overflow:hidden;text-overflow:ellipsis;pointer-events:none;transition:height var(--animation-quick),inset-block-start var(--animation-quick),font-size var(--animation-quick),color var(--animation-quick),background-color var(--animation-quick) var(--animation-slow)}.input-field__input:focus+.input-field__label[data-v-3487c05a],.input-field__input:not(:placeholder-shown)+.input-field__label[data-v-3487c05a]{--input-label-font-size: 13px;line-height:1.5;inset-block-start:calc(-1.5 * var(--input-label-font-size) / 2);font-weight:500;border-radius:var(--default-grid-baseline) var(--default-grid-baseline) 0 0;background-color:var(--color-main-background);padding-inline:var(--default-grid-baseline);margin-inline:calc(var(--input-padding-start) - var(--default-grid-baseline)) calc(var(--input-padding-end) - var(--default-grid-baseline));transition:height var(--animation-quick),inset-block-start var(--animation-quick),font-size var(--animation-quick),color var(--animation-quick)}.input-field__icon[data-v-3487c05a]{position:absolute;height:var(--default-clickable-area);width:var(--default-clickable-area);display:flex;align-items:center;justify-content:center;opacity:.7;inset-block-end:0}.input-field__icon--leading[data-v-3487c05a]{inset-inline-start:0px}.input-field__icon--trailing[data-v-3487c05a]{inset-inline-end:0px}.input-field__trailing-button[data-v-3487c05a]{--button-size: calc(var(--default-clickable-area) - 2 * var(--border-width-input-focused, 2px)) !important;--button-radius: calc(var(--input-border-radius) - var(--border-width-input-focused, 2px))}.input-field__trailing-button.button-vue[data-v-3487c05a]{position:absolute;top:var(--border-width-input-focused, 2px);inset-inline-end:var(--border-width-input-focused, 2px)}.input-field__trailing-button.button-vue[data-v-3487c05a]:focus-visible{box-shadow:none!important}.input-field__helper-text-message[data-v-3487c05a]{padding-block:4px;padding-inline:var(--border-radius-element);display:flex;align-items:center;color:var(--color-text-maxcontrast)}.input-field__helper-text-message__icon[data-v-3487c05a]{margin-inline-end:8px}.input-field--error .input-field__helper-text-message[data-v-3487c05a],.input-field--error .input-field__icon--trailing[data-v-3487c05a]{color:var(--color-text-error, var(--color-error))}.input-field--error .input-field__input[data-v-3487c05a],.input-field__input[data-v-3487c05a]:user-invalid{--input-border-color: var(--color-border-error, var(--color-error)) !important}.input-field--error .input-field__input[data-v-3487c05a]:focus-visible,.input-field__input[data-v-3487c05a]:user-invalid:focus-visible{box-shadow:#f8fafc 0 0 0 2px,var(--color-primary-element) 0 0 0 4px,#0000000d 0 1px 2px}.input-field--success .input-field__input[data-v-3487c05a]{--input-border-color: var(--color-border-success, var(--color-success)) !important}.input-field--success .input-field__input[data-v-3487c05a]:focus-visible{box-shadow:#f8fafc 0 0 0 2px,var(--color-primary-element) 0 0 0 4px,#0000000d 0 1px 2px}.input-field--success .input-field__helper-text-message__icon[data-v-3487c05a]{color:var(--color-border-success, var(--color-success))}.input-field--legacy .input-field__input[data-v-3487c05a]{box-shadow:0 0 0 1px var(--input-border-color) inset}.input-field--legacy .input-field__main-wrapper[data-v-3487c05a]:hover:not(:has([disabled])){padding:0}.input-field--legacy .input-field__main-wrapper:hover:not(:has([disabled])) .input-field__input[data-v-3487c05a]{--input-border-color: var(--color-main-text);--input-border-width-offset: 0px;border:var(--border-width-input-focused, 2px) solid var(--input-border-color);box-shadow:0 0 0 2px var(--color-main-background)!important}.material-design-icon[data-v-9e538838]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}li.action[data-v-9e538838]:hover,li.action.active[data-v-9e538838]{border-radius:6px;padding:0}li.action[data-v-9e538838]:hover{background-color:var(--color-background-hover)}.action-link[data-v-9e538838]{display:flex;align-items:flex-start;width:100%;height:auto;margin:0;padding:0;padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2);box-sizing:border-box;cursor:pointer;white-space:nowrap;color:var(--color-main-text);border:0;border-radius:0;background-color:transparent;box-shadow:none;font-weight:400;font-size:var(--default-font-size);line-height:var(--default-clickable-area)}.action-link>span[data-v-9e538838]{cursor:pointer;white-space:nowrap}.action-link__icon[data-v-9e538838]{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1;background-position:calc((var(--default-clickable-area) - 16px) / 2) center;background-size:16px;background-repeat:no-repeat}.action-link[data-v-9e538838] .material-design-icon{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1}.action-link[data-v-9e538838] .material-design-icon .material-design-icon__svg{vertical-align:middle}.action-link__longtext-wrapper[data-v-9e538838],.action-link__longtext[data-v-9e538838]{max-width:220px;line-height:1.6em;padding:calc((var(--default-clickable-area) - 1.6em) / 2) 0;cursor:pointer;text-align:start;overflow:hidden;text-overflow:ellipsis}.action-link__longtext[data-v-9e538838]{cursor:pointer;white-space:pre-wrap!important}.action-link__name[data-v-9e538838]{font-weight:700;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;max-width:100%;display:block}.action-link__description[data-v-9e538838]{display:block;white-space:pre-wrap;font-size:var(--font-size-small);line-height:var(--default-line-height);color:var(--color-text-maxcontrast);cursor:pointer}.action-link__menu-icon[data-v-9e538838]{margin-inline:auto calc((var(--default-clickable-area) - 16px) / 2 * -1)}.material-design-icon[data-v-9e878692]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}li.action[data-v-9e878692]:hover,li.action.active[data-v-9e878692]{border-radius:6px;padding:0}li.action[data-v-9e878692]:hover{background-color:var(--color-background-hover)}.action--disabled[data-v-9e878692]{pointer-events:none;opacity:.5}.action--disabled[data-v-9e878692]:hover,.action--disabled[data-v-9e878692]:focus{cursor:default;opacity:.5}.action--disabled[data-v-9e878692] *{opacity:1!important}.action-radio[data-v-9e878692]{display:flex;align-items:flex-start;width:100%;height:auto;margin:0;padding:0;cursor:pointer;white-space:nowrap;color:var(--color-main-text);border:0;border-radius:0;background-color:transparent;box-shadow:none;font-weight:400;line-height:var(--default-clickable-area)}.action-radio__radio[data-v-9e878692]{position:absolute;inset-inline-start:0!important;z-index:-1;opacity:0}.action-radio__label[data-v-9e878692]{display:flex;align-items:center;width:100%;padding:0!important;padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2)!important}.action-radio__label[data-v-9e878692]:before{margin:calc((var(--default-clickable-area) - 14px) / 2)!important}.action-radio--disabled[data-v-9e878692],.action-radio--disabled .action-radio__label[data-v-9e878692]{cursor:pointer}.material-design-icon[data-v-87267750]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}li.action[data-v-87267750]:hover,li.action.active[data-v-87267750]{border-radius:6px;padding:0}li.action[data-v-87267750]:hover{background-color:var(--color-background-hover)}.action-router[data-v-87267750]{display:flex;align-items:flex-start;width:100%;height:auto;margin:0;padding:0;padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2);box-sizing:border-box;cursor:pointer;white-space:nowrap;color:var(--color-main-text);border:0;border-radius:0;background-color:transparent;box-shadow:none;font-weight:400;font-size:var(--default-font-size);line-height:var(--default-clickable-area)}.action-router>span[data-v-87267750]{cursor:pointer;white-space:nowrap}.action-router__icon[data-v-87267750]{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1;background-position:calc((var(--default-clickable-area) - 16px) / 2) center;background-size:16px;background-repeat:no-repeat}.action-router[data-v-87267750] .material-design-icon{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1}.action-router[data-v-87267750] .material-design-icon .material-design-icon__svg{vertical-align:middle}.action-router__longtext-wrapper[data-v-87267750],.action-router__longtext[data-v-87267750]{max-width:220px;line-height:1.6em;padding:calc((var(--default-clickable-area) - 1.6em) / 2) 0;cursor:pointer;text-align:start;overflow:hidden;text-overflow:ellipsis}.action-router__longtext[data-v-87267750]{cursor:pointer;white-space:pre-wrap!important}.action-router__name[data-v-87267750]{font-weight:700;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;max-width:100%;display:block}.action-router__description[data-v-87267750]{display:block;white-space:pre-wrap;font-size:var(--font-size-small);line-height:var(--default-line-height);color:var(--color-text-maxcontrast);cursor:pointer}.action-router__menu-icon[data-v-87267750]{margin-inline:auto calc((var(--default-clickable-area) - 16px) / 2 * -1)}.action--disabled[data-v-87267750]{pointer-events:none;opacity:.5}.action--disabled[data-v-87267750]:hover,.action--disabled[data-v-87267750]:focus{cursor:default;opacity:.5}.action--disabled[data-v-87267750] *{opacity:1!important}.material-design-icon[data-v-3e2324b7]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.action-separator[data-v-3e2324b7]{height:0;margin:5px 10px 5px 15px;border-bottom:1px solid var(--color-border-dark);cursor:default}.material-design-icon[data-v-fa684b48]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}li.action[data-v-fa684b48]:hover,li.action.active[data-v-fa684b48]{border-radius:6px;padding:0}li.action[data-v-fa684b48]:hover{background-color:var(--color-background-hover)}.action-text[data-v-fa684b48]{display:flex;align-items:flex-start;width:100%;height:auto;margin:0;padding:0;padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2);box-sizing:border-box;cursor:pointer;white-space:nowrap;color:var(--color-main-text);border:0;border-radius:0;background-color:transparent;box-shadow:none;font-weight:400;font-size:var(--default-font-size);line-height:var(--default-clickable-area)}.action-text>span[data-v-fa684b48]{cursor:pointer;white-space:nowrap}.action-text__icon[data-v-fa684b48]{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1;background-position:calc((var(--default-clickable-area) - 16px) / 2) center;background-size:16px;background-repeat:no-repeat}.action-text[data-v-fa684b48] .material-design-icon{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1}.action-text[data-v-fa684b48] .material-design-icon .material-design-icon__svg{vertical-align:middle}.action-text__longtext-wrapper[data-v-fa684b48],.action-text__longtext[data-v-fa684b48]{max-width:220px;line-height:1.6em;padding:calc((var(--default-clickable-area) - 1.6em) / 2) 0;cursor:pointer;text-align:start;overflow:hidden;text-overflow:ellipsis}.action-text__longtext[data-v-fa684b48]{cursor:pointer;white-space:pre-wrap!important}.action-text__name[data-v-fa684b48]{font-weight:700;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;max-width:100%;display:block}.action-text__description[data-v-fa684b48]{display:block;white-space:pre-wrap;font-size:var(--font-size-small);line-height:var(--default-line-height);color:var(--color-text-maxcontrast);cursor:pointer}.action-text__menu-icon[data-v-fa684b48]{margin-inline:auto calc((var(--default-clickable-area) - 16px) / 2 * -1)}.action--disabled[data-v-fa684b48]{pointer-events:none;opacity:.5}.action--disabled[data-v-fa684b48]:hover,.action--disabled[data-v-fa684b48]:focus{cursor:default;opacity:.5}.action--disabled[data-v-fa684b48] *{opacity:1!important}.action-text[data-v-fa684b48],.action-text span[data-v-fa684b48]{cursor:default}.material-design-icon[data-v-c537247a]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}button[data-v-c537247a]:not(.button-vue),input[data-v-c537247a]:not([type=range]),textarea[data-v-c537247a]{margin:0;padding:7px 6px;cursor:text;color:var(--color-main-text);border:1px solid var(--color-border-dark);border-radius:var(--border-radius-element);outline:none;background-color:var(--color-main-background);font-size:13px}button[data-v-c537247a]:not(.button-vue):not(:disabled):not(.primary):hover,button[data-v-c537247a]:not(.button-vue):not(:disabled):not(.primary):focus,button:not(.button-vue):not(:disabled):not(.primary).active[data-v-c537247a],input[data-v-c537247a]:not([type=range]):not(:disabled):not(.primary):hover,input[data-v-c537247a]:not([type=range]):not(:disabled):not(.primary):focus,input:not([type=range]):not(:disabled):not(.primary).active[data-v-c537247a],textarea[data-v-c537247a]:not(:disabled):not(.primary):hover,textarea[data-v-c537247a]:not(:disabled):not(.primary):focus,textarea:not(:disabled):not(.primary).active[data-v-c537247a]{border-color:var(--color-primary-element);outline:none}button[data-v-c537247a]:not(.button-vue):not(:disabled):not(.primary):active,input[data-v-c537247a]:not([type=range]):not(:disabled):not(.primary):active,textarea[data-v-c537247a]:not(:disabled):not(.primary):active{color:var(--color-main-text);outline:none;background-color:var(--color-main-background)}button[data-v-c537247a]:not(.button-vue):disabled,input[data-v-c537247a]:not([type=range]):disabled,textarea[data-v-c537247a]:disabled{cursor:default;opacity:.5;color:var(--color-text-maxcontrast);background-color:var(--color-background-dark)}button[data-v-c537247a]:not(.button-vue):required,input[data-v-c537247a]:not([type=range]):required,textarea[data-v-c537247a]:required{box-shadow:none}button[data-v-c537247a]:not(.button-vue):invalid,input[data-v-c537247a]:not([type=range]):invalid,textarea[data-v-c537247a]:invalid{border-color:var(--color-border-error, var(--color-error));box-shadow:none!important}button:not(.button-vue).primary[data-v-c537247a],input:not([type=range]).primary[data-v-c537247a],textarea.primary[data-v-c537247a]{cursor:pointer;color:var(--color-primary-element-text);border-color:var(--color-primary-element);background-color:var(--color-primary-element)}button:not(.button-vue).primary[data-v-c537247a]:not(:disabled):hover,button:not(.button-vue).primary[data-v-c537247a]:not(:disabled):focus,button:not(.button-vue).primary[data-v-c537247a]:not(:disabled):active,input:not([type=range]).primary[data-v-c537247a]:not(:disabled):hover,input:not([type=range]).primary[data-v-c537247a]:not(:disabled):focus,input:not([type=range]).primary[data-v-c537247a]:not(:disabled):active,textarea.primary[data-v-c537247a]:not(:disabled):hover,textarea.primary[data-v-c537247a]:not(:disabled):focus,textarea.primary[data-v-c537247a]:not(:disabled):active{border-color:var(--color-primary-element-light);background-color:var(--color-primary-element-light)}button:not(.button-vue).primary[data-v-c537247a]:not(:disabled):active,input:not([type=range]).primary[data-v-c537247a]:not(:disabled):active,textarea.primary[data-v-c537247a]:not(:disabled):active{color:var(--color-primary-element-text-dark)}button:not(.button-vue).primary[data-v-c537247a]:disabled,input:not([type=range]).primary[data-v-c537247a]:disabled,textarea.primary[data-v-c537247a]:disabled{cursor:default;color:var(--color-primary-element-text-dark);background-color:var(--color-primary-element)}li.action[data-v-c537247a]:hover,li.action.active[data-v-c537247a]{border-radius:6px;padding:0}li.action[data-v-c537247a]:hover{background-color:var(--color-background-hover)}.action--disabled[data-v-c537247a]{pointer-events:none;opacity:.5}.action--disabled[data-v-c537247a]:hover,.action--disabled[data-v-c537247a]:focus{cursor:default;opacity:.5}.action--disabled[data-v-c537247a] *{opacity:1!important}.action-text-editable[data-v-c537247a]{display:flex;align-items:flex-start;width:100%;height:auto;margin:0;padding:0;cursor:pointer;white-space:nowrap;color:var(--color-main-text);border:0;border-radius:0;background-color:transparent;box-shadow:none;font-weight:400;line-height:var(--default-clickable-area)}.action-text-editable>span[data-v-c537247a]{cursor:pointer;white-space:nowrap}.action-text-editable__icon[data-v-c537247a]{min-width:0;min-height:0;padding:calc(var(--default-clickable-area) / 2) 0 calc(var(--default-clickable-area) / 2) var(--default-clickable-area);background-position:calc((var(--default-clickable-area) - 16px) / 2) center;background-size:16px}.action-text-editable[data-v-c537247a] .material-design-icon{width:var(--default-clickable-area);height:var(--default-clickable-area);opacity:1}.action-text-editable[data-v-c537247a] .material-design-icon .material-design-icon__svg{vertical-align:middle}.action-text-editable__form[data-v-c537247a]{display:flex;flex:1 1 auto;flex-direction:column;position:relative;margin:4px 0;padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2)}.action-text-editable__submit[data-v-c537247a]{position:absolute;inset-inline-start:0;top:auto;width:1px;height:1px;overflow:hidden;z-index:-1;opacity:0}.action-text-editable__label[data-v-c537247a]{display:flex;align-items:center;justify-content:center;position:absolute;inset-inline-end:calc((var(--default-clickable-area) - 16px) / 2 + 1px);bottom:1px;width:calc(var(--default-clickable-area) - 8px);height:calc(var(--default-clickable-area) - 8px);box-sizing:border-box;margin:0;padding:7px 6px;border:0;border-radius:50%;background-color:var(--color-main-background);background-clip:padding-box}.action-text-editable__label[data-v-c537247a],.action-text-editable__label[data-v-c537247a] *{cursor:pointer}.action-text-editable__textarea[data-v-c537247a]{flex:1 1 auto;color:inherit;border-color:var(--color-border-maxcontrast);min-height:calc(var(--default-clickable-area) * 2 - 8px);max-height:calc(var(--default-clickable-area) * 3 - 8px);min-width:calc(var(--default-clickable-area) * 4);width:100%!important;margin:0}.action-text-editable__textarea[data-v-c537247a]:disabled{cursor:default}.action-text-editable__textarea:not(:active):not(:hover):not(:focus):invalid+.action-text-editable__label[data-v-c537247a]{background-color:var(--color-error)}.action-text-editable__textarea:not(:active):not(:hover):not(:focus):not(:disabled)+.action-text-editable__label[data-v-c537247a]:active,.action-text-editable__textarea:not(:active):not(:hover):not(:focus):not(:disabled)+.action-text-editable__label[data-v-c537247a]:hover,.action-text-editable__textarea:not(:active):not(:hover):not(:focus):not(:disabled)+.action-text-editable__label[data-v-c537247a]:focus{background-color:var(--color-primary-element);color:var(--color-primary-element-text)}.action-text-editable__textarea:active:not(:disabled)+.action-text-editable__label[data-v-c537247a],.action-text-editable__textarea:hover:not(:disabled)+.action-text-editable__label[data-v-c537247a],.action-text-editable__textarea:focus:not(:disabled)+.action-text-editable__label[data-v-c537247a]{z-index:2;border-color:var(--color-primary-element);border-inline-start-color:transparent}li:last-child>.action-text-editable[data-v-c537247a]{margin-bottom:calc((var(--default-clickable-area) - 16px) / 2 - 4px)}li:first-child>.action-text-editable[data-v-c537247a]{margin-top:calc((var(--default-clickable-area) - 16px) / 2 - 4px)}.material-design-icon[data-v-a28923a1]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-details-toggle[data-v-a28923a1]{position:sticky;width:var(--default-clickable-area);height:var(--default-clickable-area);padding:calc((var(--default-clickable-area) - 16px) / 2);cursor:pointer;opacity:.6;transform:rotate(180deg);background-color:var(--color-main-background);z-index:2000;top:var(--app-navigation-padding);inset-inline-start:calc(var(--default-clickable-area) + var(--app-navigation-padding) * 2)}.app-details-toggle--mobile[data-v-a28923a1]{inset-inline-start:var(--app-navigation-padding)}.app-details-toggle[data-v-a28923a1]:active,.app-details-toggle[data-v-a28923a1]:hover,.app-details-toggle[data-v-a28923a1]:focus{opacity:1}.material-design-icon[data-v-a2641cc2]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-content[data-v-a2641cc2]{position:initial;z-index:1000;flex-basis:100vw;height:100%;margin:0!important;background-color:var(--color-main-background);min-width:0}.app-content[data-v-a2641cc2]:not(.app-content--has-list){overflow:auto}.app-content-wrapper[data-v-a2641cc2]{position:relative;width:100%;height:100%}.app-content-wrapper--no-split.app-content-wrapper--show-list[data-v-a2641cc2] .app-content-list{display:flex}.app-content-wrapper--no-split.app-content-wrapper--show-list[data-v-a2641cc2] .app-content-details,.app-content-wrapper--no-split.app-content-wrapper--show-details[data-v-a2641cc2] .app-content-list{display:none}.app-content-wrapper--no-split.app-content-wrapper--show-details[data-v-a2641cc2] .app-content-details{display:block}[data-v-a2641cc2] .splitpanes.default-theme .app-content-list{max-width:none;scrollbar-width:auto}[data-v-a2641cc2] .splitpanes.default-theme .splitpanes__pane{background-color:transparent;transition:none}[data-v-a2641cc2] .splitpanes.default-theme .splitpanes__pane-list{min-width:300px;position:sticky}@media only screen and (width < 1024px){[data-v-a2641cc2] .splitpanes.default-theme .splitpanes__pane-list{display:none}}[data-v-a2641cc2] .splitpanes.default-theme .splitpanes__pane-details{overflow-y:auto}@media only screen and (width < 1024px){[data-v-a2641cc2] .splitpanes.default-theme .splitpanes__pane-details{min-width:100%}}[data-v-a2641cc2] .splitpanes.default-theme .splitpanes__splitter{background-color:var(--color-main-background)}[data-v-a2641cc2] .splitpanes.default-theme .splitpanes__splitter:before,[data-v-a2641cc2] .splitpanes.default-theme .splitpanes__splitter:after{background-color:var(--color-border)}[data-v-a2641cc2] .splitpanes.default-theme.splitpanes--vertical .splitpanes__splitter{border-inline-start:1px solid var(--color-border)}[data-v-a2641cc2] .splitpanes.default-theme.splitpanes--horizontal .splitpanes__splitter{border-top:1px solid var(--color-border)}.app-content-wrapper--show-list[data-v-a2641cc2] .app-content-list{max-width:none}.splitpanes{display:flex;width:100%;height:100%}.splitpanes--vertical{flex-direction:row}.splitpanes--horizontal{flex-direction:column}.splitpanes--dragging .splitpanes__pane,*:has(.splitpanes--dragging){-webkit-user-select:none;user-select:none;pointer-events:none}.splitpanes__pane{width:100%;height:100%;overflow:hidden}.splitpanes--vertical .splitpanes__pane{transition:width .2s ease-out;will-change:width}.splitpanes--horizontal .splitpanes__pane{transition:height .2s ease-out;will-change:height}.splitpanes--dragging .splitpanes__pane{transition:none}.splitpanes__splitter{touch-action:none}.splitpanes--vertical>.splitpanes__splitter{min-width:1px;cursor:col-resize}.splitpanes--horizontal>.splitpanes__splitter{min-height:1px;cursor:row-resize}.default-theme.splitpanes .splitpanes__pane{background-color:#f2f2f2}.default-theme.splitpanes .splitpanes__splitter{background-color:#fff;box-sizing:border-box;position:relative;flex-shrink:0}.default-theme.splitpanes .splitpanes__splitter:before,.default-theme.splitpanes .splitpanes__splitter:after{content:"";position:absolute;top:50%;left:50%;background-color:#00000026;transition:background-color .3s}.default-theme.splitpanes .splitpanes__splitter:hover:before,.default-theme.splitpanes .splitpanes__splitter:hover:after{background-color:#00000040}.default-theme.splitpanes .splitpanes__splitter:first-child{cursor:auto}.default-theme.splitpanes .splitpanes .splitpanes__splitter{z-index:1}.default-theme.splitpanes--vertical>.splitpanes__splitter,.default-theme .splitpanes--vertical>.splitpanes__splitter{width:7px;border-left:1px solid #eee;margin-left:-1px}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{transform:translateY(-50%);width:1px;height:30px}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:before{margin-left:-2px}.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{margin-left:1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter,.default-theme .splitpanes--horizontal>.splitpanes__splitter{height:7px;border-top:1px solid #eee;margin-top:-1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{transform:translate(-50%);width:30px;height:1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before{margin-top:-2px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{margin-top:1px}.material-design-icon[data-v-5a15295d]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-toggle-wrapper[data-v-5a15295d]{position:absolute;top:var(--app-navigation-padding);inset-inline-end:calc(0px - var(--app-navigation-padding));margin-inline-end:calc(-1 * var(--default-clickable-area))}button.app-navigation-toggle[data-v-5a15295d]{background-color:var(--color-main-background)}.app-navigation,.app-content{--app-navigation-padding: calc(var(--default-grid-baseline, 4px) * 2)}.material-design-icon[data-v-d5ce90cd]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation[data-v-d5ce90cd]{--color-text-maxcontrast: var(--color-text-maxcontrast-background-blur, var(--color-text-maxcontrast-default));transition:transform var(--animation-quick),margin var(--animation-quick);width:300px;--app-navigation-max-width: calc(100vw - (var(--app-navigation-padding) + var(--default-clickable-area) + var(--default-grid-baseline)));max-width:var(--app-navigation-max-width);position:relative;top:0;inset-inline-start:0;padding:0;z-index:1800;height:100%;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;flex-grow:0;flex-shrink:0;background-color:var(--color-main-background-blur, var(--color-main-background));-webkit-backdrop-filter:var(--filter-background-blur, none);backdrop-filter:var(--filter-background-blur, none)}.app-navigation--closed[data-v-d5ce90cd]{margin-inline-start:calc(-1*min(300px,var(--app-navigation-max-width)))}.app-navigation__search[data-v-d5ce90cd]{width:100%}.app-navigation__body[data-v-d5ce90cd]{overflow-y:scroll}.app-navigation__content>ul[data-v-d5ce90cd]{position:relative;width:100%;overflow-x:hidden;overflow-y:auto;display:flex;flex-direction:column;gap:var(--default-grid-baseline, 4px);padding:var(--app-navigation-padding)}.app-navigation .app-navigation__list[data-v-d5ce90cd]{height:100%}.app-navigation__body--no-list[data-v-d5ce90cd]{flex:1 1 auto;overflow:auto;height:100%}.app-navigation__content[data-v-d5ce90cd]{height:100%;display:flex;flex-direction:column}[data-themes*=highcontrast] .app-navigation[data-v-d5ce90cd]{border-inline-end:1px solid var(--color-border)}@media only screen and (max-width: 1024px){.app-navigation[data-v-d5ce90cd]{position:absolute;border-inline-end:1px solid var(--color-border)}}@media only screen and (max-width: 512px){.app-navigation[data-v-d5ce90cd]{z-index:1400}}.material-design-icon[data-v-d72957ed]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-list[data-v-d72957ed]{position:relative;width:100%;overflow-x:hidden;overflow-y:auto;display:flex;flex-direction:column;gap:var(--default-grid-baseline, 4px);padding:var(--app-navigation-padding)}.material-design-icon[data-v-21e6b451]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-caption[data-v-21e6b451]{display:flex;justify-content:space-between}.app-navigation-caption--heading[data-v-21e6b451]{padding:var(--app-navigation-padding)}.app-navigation-caption--heading[data-v-21e6b451]:not(:first-child):not(:last-child){padding:0 var(--app-navigation-padding)}.app-navigation-caption__name[data-v-21e6b451]{font-weight:700;color:var(--color-main-text);font-size:var(--default-font-size);line-height:var(--default-clickable-area);white-space:nowrap;overflow:hidden;text-overflow:ellipsis;box-shadow:none!important;flex-shrink:0;padding-block:0;padding-inline:calc(var(--default-grid-baseline, 4px) * 2) 0;margin-top:0;margin-bottom:var(--default-grid-baseline)}.app-navigation-caption__actions[data-v-21e6b451]{flex:0 0 var(--default-clickable-area)}.app-navigation-caption[data-v-21e6b451]:not(:first-child){margin-top:calc(var(--default-clickable-area) / 2)}.material-design-icon[data-v-04a313f4]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-entry__icon-bullet[data-v-04a313f4]{display:block;padding:calc((var(--default-clickable-area) - 16px) / 2 + 1px)}.app-navigation-entry__icon-bullet div[data-v-04a313f4]{width:14px;height:14px;cursor:pointer;transition:background .1s ease-in-out;border:none;border-radius:50%}.material-design-icon[data-v-e6236e50]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.icon-collapse[data-v-e6236e50]{position:relative;inset-inline-end:0}.icon-collapse[data-v-e6236e50]:hover{background-color:var(--color-background-dark)!important}.icon-collapse--active[data-v-e6236e50]:hover{background-color:var(--color-primary-element)!important}.material-design-icon[data-v-d600f829]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-entry[data-v-d600f829]{position:relative;display:flex;flex-shrink:0;flex-wrap:wrap;width:100%;min-height:var(--default-clickable-area);transition:background-color var(--animation-quick) ease-in-out;transition:background-color .2s ease-in-out;border-radius:var(--border-radius-element)}.app-navigation-entry-wrapper[data-v-d600f829]{position:relative;display:flex;flex-shrink:0;flex-wrap:wrap;width:100%}.app-navigation-entry-wrapper.app-navigation-entry--collapsible:not(.app-navigation-entry--opened)>ul[data-v-d600f829]{display:none}.app-navigation-entry.active[data-v-d600f829]{background-color:var(--color-primary-element)!important}.app-navigation-entry.active[data-v-d600f829]:hover{background-color:var(--color-primary-element-hover)!important}.app-navigation-entry.active .app-navigation-entry-link[data-v-d600f829],.app-navigation-entry.active .app-navigation-entry-button[data-v-d600f829]{color:var(--color-primary-element-text)!important}.app-navigation-entry[data-v-d600f829]:focus-within,.app-navigation-entry[data-v-d600f829]:hover{background-color:var(--color-background-hover)}.app-navigation-entry.active .app-navigation-entry__children[data-v-d600f829],.app-navigation-entry:focus-within .app-navigation-entry__children[data-v-d600f829],.app-navigation-entry:hover .app-navigation-entry__children[data-v-d600f829]{background-color:var(--color-main-background)}.app-navigation-entry.active .app-navigation-entry__utils .app-navigation-entry__actions[data-v-d600f829],.app-navigation-entry.app-navigation-entry--deleted .app-navigation-entry__utils .app-navigation-entry__actions[data-v-d600f829],.app-navigation-entry:focus .app-navigation-entry__utils .app-navigation-entry__actions[data-v-d600f829],.app-navigation-entry:focus-within .app-navigation-entry__utils .app-navigation-entry__actions[data-v-d600f829],.app-navigation-entry:hover .app-navigation-entry__utils .app-navigation-entry__actions[data-v-d600f829]{display:inline-block}.app-navigation-entry .app-navigation-entry__actions[data-v-d600f829]:hover .button-vue{background-color:var(--color-background-dark)!important}.app-navigation-entry.active .app-navigation-entry__actions[data-v-d600f829]:hover .button-vue{background-color:var(--color-primary-element)!important}.app-navigation-entry.app-navigation-entry--deleted>ul[data-v-d600f829]{display:none}.app-navigation-entry:not(.app-navigation-entry--editing) .app-navigation-entry-link[data-v-d600f829],.app-navigation-entry:not(.app-navigation-entry--editing) .app-navigation-entry-button[data-v-d600f829]{padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2)}.app-navigation-entry .app-navigation-entry-link[data-v-d600f829],.app-navigation-entry .app-navigation-entry-button[data-v-d600f829]{z-index:100;display:flex;overflow:hidden;flex:1 1 0;min-height:var(--default-clickable-area);padding:0;white-space:nowrap;color:var(--color-main-text);background-repeat:no-repeat;background-position:calc((var(--default-clickable-area) - 16px) / 2) center;background-size:16px 16px;line-height:var(--default-clickable-area)}.app-navigation-entry .app-navigation-entry-link .app-navigation-entry-icon[data-v-d600f829],.app-navigation-entry .app-navigation-entry-button .app-navigation-entry-icon[data-v-d600f829]{display:flex;align-items:center;flex:0 0 var(--default-clickable-area);justify-content:center;width:var(--default-clickable-area);height:var(--default-clickable-area);background-size:16px 16px;background-repeat:no-repeat;background-position:calc((var(--default-clickable-area) - 16px) / 2) center}.app-navigation-entry .app-navigation-entry-link .app-navigation-entry__name[data-v-d600f829],.app-navigation-entry .app-navigation-entry-button .app-navigation-entry__name[data-v-d600f829]{overflow:hidden;max-width:100%;white-space:nowrap;text-overflow:ellipsis}.app-navigation-entry .app-navigation-entry-link .editingContainer[data-v-d600f829],.app-navigation-entry .app-navigation-entry-button .editingContainer[data-v-d600f829]{width:calc(100% - var(--default-clickable-area));margin:auto}.app-navigation-entry .app-navigation-entry-link[data-v-d600f829]:focus-visible,.app-navigation-entry .app-navigation-entry-button[data-v-d600f829]:focus-visible{box-shadow:0 0 0 4px var(--color-main-background);outline:2px solid var(--color-main-text);border-radius:var(--border-radius-element)}.app-navigation-entry__children[data-v-d600f829]{--app-navigation-item-child-offset: 10px;position:relative;display:flex;flex:0 1 auto;flex-direction:column;width:100%;gap:var(--default-grid-baseline, 4px);padding-inline-start:var(--app-navigation-item-child-offset)}.app-navigation-entry__children .app-navigation-entry[data-v-d600f829]{display:inline-flex;flex-wrap:wrap}.app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children[data-v-d600f829]{--app-navigation-item-child-offset: 0}.app-navigation-entry__deleted[data-v-d600f829]{display:inline-flex;flex:1 1 0;padding-inline-start:calc(var(--default-clickable-area) - (var(--default-clickable-area) - 16px) / 2)!important}.app-navigation-entry__deleted .app-navigation-entry__deleted-description[data-v-d600f829]{position:relative;overflow:hidden;flex:1 1 0;white-space:nowrap;text-overflow:ellipsis;line-height:var(--default-clickable-area)}.app-navigation-entry__utils[data-v-d600f829]{display:flex;min-width:var(--default-clickable-area);align-items:center;flex:0 1 auto;justify-content:flex-end}.app-navigation-entry__utils.app-navigation-entry__utils--display-actions .action-item.app-navigation-entry__actions[data-v-d600f829]{display:inline-block}.app-navigation-entry__utils .app-navigation-entry__counter-wrapper[data-v-d600f829]{margin-inline-end:calc(var(--default-grid-baseline) * 2);display:flex;align-items:center;flex:0 1 auto}.app-navigation-entry__utils .action-item.app-navigation-entry__actions[data-v-d600f829]{display:none}.app-navigation-entry--editing .app-navigation-entry-edit[data-v-d600f829]{z-index:250;opacity:1}.app-navigation-entry--deleted .app-navigation-entry-deleted[data-v-d600f829]{z-index:250;transform:translate(0)}.app-navigation-entry--pinned[data-v-d600f829]{order:2;margin-top:auto}.app-navigation-entry--pinned~.app-navigation-entry--pinned[data-v-d600f829]{margin-top:0}[data-themes*=highcontrast] .app-navigation-entry[data-v-d600f829]:active{background-color:var(--color-primary-element-light-hover)!important}.material-design-icon[data-v-dd457d48]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-input-confirm[data-v-dd457d48]{flex:1 0 100%;width:100%}.app-navigation-input-confirm form[data-v-dd457d48]{display:flex}.app-navigation-input-confirm__input[data-v-dd457d48]{height:34px;flex:1 1 100%;font-size:100%!important;margin:5px!important;margin-inline-start:-8px!important;padding:7px!important}.app-navigation-input-confirm__input[data-v-dd457d48]:active,.app-navigation-input-confirm__input[data-v-dd457d48]:focus,.app-navigation-input-confirm__input[data-v-dd457d48]:hover{outline:none;background-color:var(--color-main-background);color:var(--color-main-text);border-color:var(--color-primary-element)}.material-design-icon[data-v-0ba6c9df]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-new[data-v-0ba6c9df]{display:block;padding:calc(var(--default-grid-baseline, 4px) * 2)}.app-navigation-new button[data-v-0ba6c9df]{width:100%}.material-design-icon[data-v-ee07f8f8]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-entry[data-v-ee07f8f8]{position:relative;display:flex;flex-shrink:0;flex-wrap:wrap;width:100%;min-height:var(--default-clickable-area);transition:background-color var(--animation-quick) ease-in-out;transition:background-color .2s ease-in-out;border-radius:var(--border-radius-element)}.app-navigation-entry-wrapper[data-v-ee07f8f8]{position:relative;display:flex;flex-shrink:0;flex-wrap:wrap;width:100%}.app-navigation-entry-wrapper.app-navigation-entry--collapsible:not(.app-navigation-entry--opened)>ul[data-v-ee07f8f8]{display:none}.app-navigation-entry.active[data-v-ee07f8f8]{background-color:var(--color-primary-element)!important}.app-navigation-entry.active[data-v-ee07f8f8]:hover{background-color:var(--color-primary-element-hover)!important}.app-navigation-entry.active .app-navigation-entry-link[data-v-ee07f8f8],.app-navigation-entry.active .app-navigation-entry-button[data-v-ee07f8f8]{color:var(--color-primary-element-text)!important}.app-navigation-entry[data-v-ee07f8f8]:focus-within,.app-navigation-entry[data-v-ee07f8f8]:hover{background-color:var(--color-background-hover)}.app-navigation-entry.active .app-navigation-entry__children[data-v-ee07f8f8],.app-navigation-entry:focus-within .app-navigation-entry__children[data-v-ee07f8f8],.app-navigation-entry:hover .app-navigation-entry__children[data-v-ee07f8f8]{background-color:var(--color-main-background)}.app-navigation-entry.active .app-navigation-entry__utils .app-navigation-entry__actions[data-v-ee07f8f8],.app-navigation-entry.app-navigation-entry--deleted .app-navigation-entry__utils .app-navigation-entry__actions[data-v-ee07f8f8],.app-navigation-entry:focus .app-navigation-entry__utils .app-navigation-entry__actions[data-v-ee07f8f8],.app-navigation-entry:focus-within .app-navigation-entry__utils .app-navigation-entry__actions[data-v-ee07f8f8],.app-navigation-entry:hover .app-navigation-entry__utils .app-navigation-entry__actions[data-v-ee07f8f8]{display:inline-block}.app-navigation-entry .app-navigation-entry__actions[data-v-ee07f8f8]:hover .button-vue{background-color:var(--color-background-dark)!important}.app-navigation-entry.active .app-navigation-entry__actions[data-v-ee07f8f8]:hover .button-vue{background-color:var(--color-primary-element)!important}.app-navigation-entry.app-navigation-entry--deleted>ul[data-v-ee07f8f8]{display:none}.app-navigation-entry:not(.app-navigation-entry--editing) .app-navigation-entry-link[data-v-ee07f8f8],.app-navigation-entry:not(.app-navigation-entry--editing) .app-navigation-entry-button[data-v-ee07f8f8]{padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2)}.app-navigation-entry .app-navigation-entry-link[data-v-ee07f8f8],.app-navigation-entry .app-navigation-entry-button[data-v-ee07f8f8]{z-index:100;display:flex;overflow:hidden;flex:1 1 0;min-height:var(--default-clickable-area);padding:0;white-space:nowrap;color:var(--color-main-text);background-repeat:no-repeat;background-position:calc((var(--default-clickable-area) - 16px) / 2) center;background-size:16px 16px;line-height:var(--default-clickable-area)}.app-navigation-entry .app-navigation-entry-link .app-navigation-entry-icon[data-v-ee07f8f8],.app-navigation-entry .app-navigation-entry-button .app-navigation-entry-icon[data-v-ee07f8f8]{display:flex;align-items:center;flex:0 0 var(--default-clickable-area);justify-content:center;width:var(--default-clickable-area);height:var(--default-clickable-area);background-size:16px 16px;background-repeat:no-repeat;background-position:calc((var(--default-clickable-area) - 16px) / 2) center}.app-navigation-entry .app-navigation-entry-link .app-navigation-entry__name[data-v-ee07f8f8],.app-navigation-entry .app-navigation-entry-button .app-navigation-entry__name[data-v-ee07f8f8]{overflow:hidden;max-width:100%;white-space:nowrap;text-overflow:ellipsis}.app-navigation-entry .app-navigation-entry-link .editingContainer[data-v-ee07f8f8],.app-navigation-entry .app-navigation-entry-button .editingContainer[data-v-ee07f8f8]{width:calc(100% - var(--default-clickable-area));margin:auto}.app-navigation-entry .app-navigation-entry-link[data-v-ee07f8f8]:focus-visible,.app-navigation-entry .app-navigation-entry-button[data-v-ee07f8f8]:focus-visible{box-shadow:0 0 0 4px var(--color-main-background);outline:2px solid var(--color-main-text);border-radius:var(--border-radius-element)}.app-navigation-entry__children[data-v-ee07f8f8]{--app-navigation-item-child-offset: 10px;position:relative;display:flex;flex:0 1 auto;flex-direction:column;width:100%;gap:var(--default-grid-baseline, 4px);padding-inline-start:var(--app-navigation-item-child-offset)}.app-navigation-entry__children .app-navigation-entry[data-v-ee07f8f8]{display:inline-flex;flex-wrap:wrap}.app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children .app-navigation-entry__children[data-v-ee07f8f8]{--app-navigation-item-child-offset: 0}.app-navigation-entry__deleted[data-v-ee07f8f8]{display:inline-flex;flex:1 1 0;padding-inline-start:calc(var(--default-clickable-area) - (var(--default-clickable-area) - 16px) / 2)!important}.app-navigation-entry__deleted .app-navigation-entry__deleted-description[data-v-ee07f8f8]{position:relative;overflow:hidden;flex:1 1 0;white-space:nowrap;text-overflow:ellipsis;line-height:var(--default-clickable-area)}.app-navigation-entry__utils[data-v-ee07f8f8]{display:flex;min-width:var(--default-clickable-area);align-items:center;flex:0 1 auto;justify-content:flex-end}.app-navigation-entry__utils.app-navigation-entry__utils--display-actions .action-item.app-navigation-entry__actions[data-v-ee07f8f8]{display:inline-block}.app-navigation-entry__utils .app-navigation-entry__counter-wrapper[data-v-ee07f8f8]{margin-inline-end:calc(var(--default-grid-baseline) * 2);display:flex;align-items:center;flex:0 1 auto}.app-navigation-entry__utils .action-item.app-navigation-entry__actions[data-v-ee07f8f8]{display:none}.app-navigation-entry--editing .app-navigation-entry-edit[data-v-ee07f8f8]{z-index:250;opacity:1}.app-navigation-entry--deleted .app-navigation-entry-deleted[data-v-ee07f8f8]{z-index:250;transform:translate(0)}.app-navigation-entry--pinned[data-v-ee07f8f8]{order:2;margin-top:auto}.app-navigation-entry--pinned~.app-navigation-entry--pinned[data-v-ee07f8f8]{margin-top:0}[data-themes*=highcontrast] .app-navigation-entry[data-v-ee07f8f8]:active{background-color:var(--color-primary-element-light-hover)!important}.app-navigation-new-item__name[data-v-ee07f8f8]{overflow:hidden;max-width:100%;white-space:nowrap;text-overflow:ellipsis;padding-inline-start:7px;font-size:14px}.newItemContainer[data-v-ee07f8f8]{width:calc(100% - var(--default-clickable-area));margin:auto}.material-design-icon[data-v-f37737bd]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-navigation-search[data-v-f37737bd]{display:flex;gap:var(--app-navigation-padding);padding:var(--app-navigation-padding)}.app-navigation-search--has-actions .app-navigation-search__input[data-v-f37737bd]{flex-grow:1;z-index:3}.app-navigation-search__actions[data-v-f37737bd]{display:flex;gap:var(--default-grid-baseline);margin-inline-start:0;max-width:calc(2 * var(--default-clickable-area) + var(--default-grid-baseline));max-height:var(--default-clickable-area);transition:margin-inline-start var(--animation-quick)}.app-navigation-search__actions--hidden[data-v-f37737bd]{margin-inline-start:calc(-1 * var(--default-clickable-area))}._container_fpy51_2{margin-top:auto;padding:var(--default-grid-baseline)}._header_fpy51_7{margin-block:0 var(--default-grid-baseline);margin-inline:var(--default-grid-baseline)}._button_fpy51_13{padding-inline:0 calc((var(--default-clickable-area) - 16px) / 2)!important}._button_fpy51_13 .button-vue__text{font-weight:400}._content_fpy51_21{display:block;padding:10px;margin-bottom:calc(-1 * var(--default-grid-baseline));max-height:300px;overflow-y:auto}._animationActive_fpy51_33{transition-duration:var(--animation-slow);transition-property:max-height,padding;overflow-y:hidden!important}._animationStop_fpy51_39{max-height:0!important;padding:0 10px!important}.app-navigation-spacer[data-v-277fa710]{flex-shrink:0;height:22px}._appSettingsSectionShortcuts_1trvh_2{display:flex;flex-direction:column;gap:calc(4 * var(--default-grid-baseline))}._material-design-icon_1y2dv_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._sidebarTabsButton_1y2dv_20{border:none;border-bottom:var(--default-grid-baseline) solid transparent!important;border-radius:var(--border-radius-small);background-color:var(--color-main-background);color:var(--color-main-text);font-size:var(--default-font-size);cursor:pointer;display:flex;flex-direction:column;gap:var(--default-grid-baseline);padding:var(--border-radius-small);transition:background-color var(--animation-quick),border-bottom-color var(--animation-quick);min-width:var(--default-clickable-area)}._sidebarTabsButton_1y2dv_20:hover{background-color:var(--color-background-hover)!important}._sidebarTabsButton_1y2dv_20:active,._sidebarTabsButton_1y2dv_20:focus{background-color:var(--color-main-background)!important}._sidebarTabsButton_1y2dv_20 *{cursor:pointer}._sidebarTabsButton_selected_1y2dv_45{border-bottom-color:var(--color-primary-element)!important;border-bottom-left-radius:0;border-bottom-right-radius:0;cursor:default}._sidebarTabsButton_selected_1y2dv_45:hover{background-color:var(--color-primary-element-light-hover)!important;color:var(--color-primary-element-light-text)!important}._sidebarTabsButton_selected_1y2dv_45 *{cursor:default}._sidebarTabsButton__name_1y2dv_59{font-weight:400;overflow:hidden;text-overflow:ellipsis;text-wrap:nowrap}._sidebarTabsButton_selected_1y2dv_45 ._sidebarTabsButton__name_1y2dv_59{font-weight:700}._sidebarTabsButton__icon_1y2dv_70{display:inline-flex;align-items:center;justify-content:center}._sidebarTabsButton__legacyIcon_1y2dv_76{background-size:20px;display:flex;align-items:center;justify-content:center}.material-design-icon[data-v-1e2d5bfb]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-sidebar-tabs[data-v-1e2d5bfb]{display:flex;flex-direction:column;min-height:0;flex:1 1 100%}.app-sidebar-tabs__nav[data-v-1e2d5bfb]{display:flex;justify-content:stretch;margin:10px 8px 0;border-bottom:1px solid var(--color-border)}.app-sidebar-tabs__tab[data-v-1e2d5bfb]{flex:1 1 1px}.app-sidebar-tabs__content[data-v-1e2d5bfb]{position:relative;min-height:256px;height:100%}.app-sidebar-tabs__content--multiple[data-v-1e2d5bfb]>:not(section){display:none}@property --app-sidebar-offset{syntax: ""; initial-value: 0; inherits: true;}body{--app-sidebar-padding: calc(var(--default-grid-baseline, 4px) * 2);--app-sidebar-offset: 0;transition:--app-sidebar-offset 0ms!important}body:has(.app-sidebar.slide-right-enter-active),body:has(.app-sidebar.slide-right-leave-active){transition:--app-sidebar-offset var(--animation-quick)}body:has(.app-sidebar__toggle){--app-sidebar-offset: calc(var(--app-sidebar-padding) + var(--default-clickable-area))}.material-design-icon[data-v-104e67d6]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-sidebar[data-v-104e67d6]{--app-sidebar-width: clamp(300px, 27vw, 500px);--app-sidebar-padding: calc(var(--default-grid-baseline, 4px) * 2);width:var(--app-sidebar-width);z-index:1500;top:0;inset-inline-end:0;display:flex;overflow-x:hidden;overflow-y:auto;flex-direction:column;flex-shrink:0;height:100%;border-inline-start:1px solid var(--color-border);background:var(--color-main-background);position:relative}.app-sidebar__toggle[data-v-104e67d6]{position:absolute!important;inset-block-start:var(--app-sidebar-padding);inset-inline-end:var(--app-sidebar-padding);z-index:1001}.app-sidebar .app-sidebar-header[data-v-104e67d6]{--app-sidebar-close-button-offset: calc(var(--default-clickable-area) + var(--app-sidebar-padding))}.app-sidebar .app-sidebar-header>.app-sidebar__close[data-v-104e67d6]{position:absolute;z-index:100;top:var(--app-sidebar-padding);inset-inline-end:var(--app-sidebar-padding);width:var(--default-clickable-area);height:var(--default-clickable-area)}.app-sidebar .app-sidebar-header--compact.app-sidebar-header--with-figure .app-sidebar-header__info[data-v-104e67d6]{flex-direction:row}.app-sidebar .app-sidebar-header--compact.app-sidebar-header--with-figure .app-sidebar-header__info .app-sidebar-header__figure[data-v-104e67d6]{--figure-size: calc($desc-height + var(--app-sidebar-padding));z-index:2;width:var(--figure-size);height:var(--figure-size);margin:calc(var(--app-sidebar-padding) / 2);border-radius:3px;flex:0 0 auto}.app-sidebar .app-sidebar-header--compact.app-sidebar-header--with-figure .app-sidebar-header__info .app-sidebar-header__desc[data-v-104e67d6]{padding-inline-start:0;flex:1 1 auto;min-width:0;padding-inline-end:calc(var(--default-clickable-area) + var(--app-sidebar-close-button-offset));padding-top:var(--app-sidebar-padding)}.app-sidebar .app-sidebar-header--compact.app-sidebar-header--with-figure .app-sidebar-header__info .app-sidebar-header__desc.app-sidebar-header__desc--without-actions[data-v-104e67d6]{padding-inline-end:var(--app-sidebar-close-button-offset)}.app-sidebar .app-sidebar-header--compact.app-sidebar-header--with-figure .app-sidebar-header__info .app-sidebar-header__desc .app-sidebar-header__tertiary-actions[data-v-104e67d6]{z-index:3;position:absolute;top:calc(var(--app-sidebar-padding) / 2);inset-inline-start:calc(-1 * var(--default-clickable-area));gap:0}.app-sidebar .app-sidebar-header--compact.app-sidebar-header--with-figure .app-sidebar-header__info .app-sidebar-header__desc .app-sidebar-header__menu[data-v-104e67d6]{top:var(--app-sidebar-padding);inset-inline-end:var(--app-sidebar-close-button-offset);position:absolute}.app-sidebar .app-sidebar-header:not(.app-sidebar-header--with-figure) .app-sidebar-header__menu[data-v-104e67d6]{position:absolute;top:var(--app-sidebar-padding);inset-inline-end:var(--app-sidebar-close-button-offset)}.app-sidebar .app-sidebar-header:not(.app-sidebar-header--with-figure) .app-sidebar-header__desc[data-v-104e67d6]{padding-inline-end:calc(var(--default-clickable-area) + var(--app-sidebar-close-button-offset))}.app-sidebar .app-sidebar-header:not(.app-sidebar-header--with-figure) .app-sidebar-header__desc.app-sidebar-header__desc--without-actions[data-v-104e67d6]{padding-inline-end:var(--app-sidebar-close-button-offset)}.app-sidebar .app-sidebar-header .app-sidebar-header__info[data-v-104e67d6]{display:flex;flex-direction:column}.app-sidebar .app-sidebar-header__figure[data-v-104e67d6]{width:100%;height:250px;max-height:250px;background-repeat:no-repeat;background-position:center;background-size:contain}.app-sidebar .app-sidebar-header__figure--with-action[data-v-104e67d6]{cursor:pointer}.app-sidebar .app-sidebar-header__desc[data-v-104e67d6]{position:relative;display:flex;flex-direction:row;justify-content:center;align-items:center;padding-inline:var(--app-sidebar-padding);padding-block:var(--app-sidebar-padding) calc(var(--app-sidebar-padding) / 2);gap:0 4px}.app-sidebar .app-sidebar-header__desc--with-tertiary-action[data-v-104e67d6]{padding-inline-start:6px}.app-sidebar .app-sidebar-header__desc--editable .app-sidebar-header__mainname-form[data-v-104e67d6],.app-sidebar .app-sidebar-header__desc--with-subname--editable .app-sidebar-header__mainname-form[data-v-104e67d6]{margin-top:-2px;margin-bottom:-2px}.app-sidebar .app-sidebar-header__desc--with-subname--editable .app-sidebar-header__subname[data-v-104e67d6]{margin-top:-2px}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__tertiary-actions[data-v-104e67d6]{display:flex;height:var(--default-clickable-area);width:var(--default-clickable-area);justify-content:center;flex:0 0 auto}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__tertiary-actions .app-sidebar-header__star[data-v-104e67d6]{box-shadow:none}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__tertiary-actions .app-sidebar-header__star[data-v-104e67d6]:not([aria-pressed=true]):hover{box-shadow:none;background-color:var(--color-background-hover)}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container[data-v-104e67d6]{flex:1 1 auto;display:flex;flex-direction:column;justify-content:center;min-width:0}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__mainname-container[data-v-104e67d6]{display:flex;align-items:center;min-height:var(--default-clickable-area)}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__mainname-container .app-sidebar-header__mainname[data-v-104e67d6]{padding:0;min-height:30px;font-size:20px;line-height:30px}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__mainname-container .app-sidebar-header__mainname[data-v-104e67d6] .linkified{cursor:pointer;text-decoration:underline;margin:0}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__mainname-container .app-sidebar-header__mainname-form[data-v-104e67d6]{display:flex;flex:1 1 auto;align-items:center}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__mainname-container .app-sidebar-header__mainname-form input.app-sidebar-header__mainname-input[data-v-104e67d6]{flex:1 1 auto;margin:0;padding:7px;font-size:20px;font-weight:700}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__mainname-container .app-sidebar-header__menu[data-v-104e67d6]{margin-inline-start:5px}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__mainname[data-v-104e67d6],.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__subname[data-v-104e67d6]{overflow:hidden;width:100%;margin:0;white-space:nowrap;text-overflow:ellipsis}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__subname[data-v-104e67d6]{color:var(--color-text-maxcontrast);font-size:var(--default-font-size);padding:0}.app-sidebar .app-sidebar-header__desc .app-sidebar-header__name-container .app-sidebar-header__subname[data-v-104e67d6] *{vertical-align:text-bottom}.app-sidebar .app-sidebar-header .app-sidebar-header__mainname--hidden[data-v-104e67d6]{position:absolute;top:0;inset-inline-start:0;margin:0;width:1px;height:1px;overflow:hidden}.app-sidebar .app-sidebar-header__description[data-v-104e67d6]{display:flex;align-items:center;margin:0 10px}@media only screen and (max-width: 512px){.app-sidebar[data-v-104e67d6]{position:absolute;--app-sidebar-width: 100vw}}.slide-right-leave-active[data-v-104e67d6],.slide-right-enter-active[data-v-104e67d6]{transition-duration:var(--animation-quick);transition-property:margin-inline-end}.slide-right-enter-to[data-v-104e67d6],.slide-right-leave[data-v-104e67d6]{margin-inline-end:0}.slide-right-enter-from[data-v-104e67d6],.slide-right-leave-to[data-v-104e67d6]{margin-inline-end:calc(-1 * var(--app-sidebar-width))}.material-design-icon[data-v-dba10798]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.app-sidebar__tab[data-v-dba10798]{display:none;padding:10px;min-height:100%;max-height:100%;height:100%;overflow:auto}.app-sidebar__tab[data-v-dba10798]:focus{border-color:var(--color-primary-element);box-shadow:0 0 .2em var(--color-primary-element);outline:0}.app-sidebar__tab--active[data-v-dba10798]{display:block}._material-design-icon_1xe1x_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._assistantButton_1xe1x_20{--assistant-button-color: var(--color-element-assistant, linear-gradient(238deg, #A569D3 12%, #00679E 39%, #422083 86%));--assistant-button-background-color: var(--color-background-assistant, #F6F5FF);background-image:var(--color-border-assistant, linear-gradient(125deg, #7398FE 50%, #6104A4 125%));border-radius:var(--border-radius-element);height:var(--default-clickable-area);width:fit-content;padding-inline:1px;padding-block:1px 2px}._assistantButton_disabled_1xe1x_30{filter:saturate(.5);opacity:.5}._assistantButton_primary_1xe1x_34{--assistant-button-color: white;--assistant-button-background-color: var(--color-element-assistant,linear-gradient(238deg, #A569D3 12%, #00679E 39%, #422083 86%))}._assistantButton_primary_1xe1x_34 ._assistantButton__icon_1xe1x_38,._assistantButton_primary_1xe1x_34 ._assistantButton__text_1xe1x_39{color:#fff!important}._assistantButton__button_1xe1x_42{--button-size: calc(var(--default-clickable-area) - 3px) !important;background-color:var(--assistant-button-background-color)!important;background-image:var(--assistant-button-background-color)!important;border:none!important}._assistantButton__button_1xe1x_42:hover{filter:brightness(120%)}._assistantButton__text_1xe1x_39{background-image:var(--assistant-button-color);color:transparent!important;-webkit-background-clip:text;background-clip:text}._material-design-icon_1ndue_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._assistantIcon_1ndue_20{display:inline-flex;align-items:center;justify-content:center}._assistantIcon_1ndue_20:not(._assistantIcon_inline_1ndue_25){display:flex;min-height:var(--default-clickable-area);min-width:var(--default-clickable-area)}._assistantIcon__svg_1ndue_30{display:inline-block;width:var(--6629513e);height:var(--6629513e);max-width:var(--6629513e);max-height:var(--6629513e)}._material-design-icon_ri18g_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._assistantContent_ri18g_20{background-image:var(--color-border-assistant, linear-gradient(125deg, #7398FE 50%, #6104A4 125%));border-radius:var(--border-radius-container);padding:2px}._assistantContent__inner_ri18g_25{background-color:var(--color-background-assistant, #F6F5FF);border-radius:calc(var(--border-radius-container) - 1px);color:var(--color-main-text);padding:calc(var(--border-radius-container) - 1px);height:100%;width:100%}.material-design-icon[data-v-d7dc2a1f]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.avatardiv[data-v-d7dc2a1f]{position:relative;display:inline-block;width:var(--avatar-size);height:var(--avatar-size)}.avatardiv--unknown[data-v-d7dc2a1f]{position:relative;background-color:var(--color-main-background);white-space:normal}.avatardiv[data-v-d7dc2a1f]:not(.avatardiv--unknown){background-color:var(--color-main-background)!important;box-shadow:0 0 5px #0000000d inset}.avatardiv--with-menu[data-v-d7dc2a1f]{cursor:pointer}.avatardiv--with-menu .action-item[data-v-d7dc2a1f]{position:absolute;top:0;inset-inline-start:0}.avatardiv--with-menu[data-v-d7dc2a1f] .action-item__menutoggle{cursor:pointer;opacity:0}.avatardiv--with-menu[data-v-d7dc2a1f]:focus-within .action-item__menutoggle,.avatardiv--with-menu[data-v-d7dc2a1f]:hover .action-item__menutoggle,.avatardiv--with-menu.avatardiv--with-menu-loading[data-v-d7dc2a1f] .action-item__menutoggle{opacity:1}.avatardiv--with-menu:focus-within img[data-v-d7dc2a1f],.avatardiv--with-menu:hover img[data-v-d7dc2a1f],.avatardiv--with-menu.avatardiv--with-menu-loading img[data-v-d7dc2a1f]{opacity:.3}.avatardiv--with-menu[data-v-d7dc2a1f] .action-item__menutoggle,.avatardiv--with-menu img[data-v-d7dc2a1f]{transition:opacity var(--animation-quick)}.avatardiv--with-menu[data-v-d7dc2a1f] .button-vue,.avatardiv--with-menu[data-v-d7dc2a1f] .button-vue__icon{height:var(--avatar-size);min-height:var(--avatar-size);width:var(--avatar-size)!important;min-width:var(--avatar-size)}.avatardiv--with-menu[data-v-d7dc2a1f]>.button-vue,.avatardiv--with-menu[data-v-d7dc2a1f]>.action-item .button-vue{--button-radius: calc(var(--avatar-size) / 2)}.avatardiv .avatardiv__initials-wrapper[data-v-d7dc2a1f]{display:block;height:var(--avatar-size);width:var(--avatar-size);background-color:var(--color-main-background);border-radius:calc(var(--avatar-size) / 2)}.avatardiv .avatardiv__initials-wrapper .avatardiv__initials[data-v-d7dc2a1f]{position:absolute;top:0;inset-inline-start:0;display:block;width:100%;text-align:center;font-weight:400}.avatardiv img[data-v-d7dc2a1f]{width:100%;height:100%;object-fit:cover}.avatardiv .material-design-icon[data-v-d7dc2a1f]{width:var(--avatar-size);height:var(--avatar-size)}.avatardiv .avatardiv__user-status[data-v-d7dc2a1f]{--avatar-status-size-orbital: calc(var(--avatar-size) * (1 - 1 / sqrt(2)));--avatar-status-size-min: var(--font-size-small);--avatar-status-size: max(var(--avatar-status-size-orbital), var(--avatar-status-size-min));box-sizing:border-box;position:absolute;inset-inline-end:0;inset-block-end:0;height:var(--avatar-status-size);width:var(--avatar-status-size);line-height:1;font-size:calc(var(--avatar-status-size) / 1.2);background-color:var(--color-main-background);background-repeat:no-repeat;background-size:var(--avatar-status-size);background-position:center;border-radius:50%;display:flex;align-items:center;justify-content:center}.acli:hover .avatardiv .avatardiv__user-status[data-v-d7dc2a1f]{border-color:var(--color-background-hover);background-color:var(--color-background-hover)}.acli.active .avatardiv .avatardiv__user-status[data-v-d7dc2a1f]{border-color:var(--color-primary-element-light);background-color:var(--color-primary-element-light)}.avatardiv .avatardiv__user-status--icon[data-v-d7dc2a1f]{border:none;background-color:transparent}.avatardiv .popovermenu-wrapper[data-v-d7dc2a1f]{position:relative;display:inline-block}.avatar-class-icon[data-v-d7dc2a1f]{display:block;border-radius:calc(var(--avatar-size) / 2);background-color:var(--color-background-darker);height:100%}.material-design-icon[data-v-45238efd]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.mention-bubble--primary .mention-bubble__content[data-v-45238efd]{color:var(--color-primary-element-text);background-color:var(--color-primary-element)}.mention-bubble__wrapper[data-v-45238efd]{position:relative;max-width:150px;height:18px;vertical-align:text-bottom;display:inline-flex;align-items:center}.mention-bubble__content[data-v-45238efd]{display:inline-flex;overflow:hidden;align-items:center;max-width:100%;height:20px;-webkit-user-select:none;user-select:none;padding-inline:2px 6px;border-radius:10px;background-color:var(--color-background-dark)}.mention-bubble__icon[data-v-45238efd]{position:relative;width:16px;height:16px;border-radius:8px;background-color:var(--color-background-darker);background-repeat:no-repeat;background-position:center;background-size:12px}.mention-bubble__icon--with-avatar[data-v-45238efd]{color:inherit;background-size:cover}.mention-bubble__title[data-v-45238efd]{overflow:hidden;margin-inline-start:2px;white-space:nowrap;text-overflow:ellipsis}.mention-bubble__title[data-v-45238efd]:before{content:attr(title)}.mention-bubble__select[data-v-45238efd]{position:absolute;z-index:-1;inset-inline-start:-100vw;width:1px;height:1px;overflow:hidden}.material-design-icon[data-v-881a79fb]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.user-status-icon[data-v-881a79fb]{--user-status-color-online: #2D7B41;--user-status-color-busy: #DB0606;--user-status-color-away: #C88800;--user-status-color-offline: #6B6B6B;display:flex;justify-content:center;align-items:center}.user-status-icon--invisible[data-v-881a79fb]{filter:var(--background-invert-if-dark)}.user-status-icon[data-v-881a79fb] svg{width:100%;height:100%}._fadeTransition_13rtj_2{transition:all var(--animation-quick) ease}._fadeTransitionActive_13rtj_6{opacity:0;position:absolute}.material-design-icon[data-v-28ef52a4]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.vue-crumb[data-v-28ef52a4]{background-image:none;display:inline-flex;height:var(--default-clickable-area);padding:0}.vue-crumb[data-v-28ef52a4]:last-child{min-width:0}.vue-crumb:last-child .vue-crumb__separator[data-v-28ef52a4]{display:none}.vue-crumb--hidden[data-v-28ef52a4]{display:none}.vue-crumb__separator[data-v-28ef52a4]{padding:0;color:var(--color-text-maxcontrast)}.vue-crumb.vue-crumb--hovered[data-v-28ef52a4] .button-vue{background-color:var(--color-background-dark);color:var(--color-main-text)}.vue-crumb[data-v-28ef52a4]:not(:last-child) .button-vue{color:var(--color-text-maxcontrast)}.vue-crumb[data-v-28ef52a4]:not(:last-child) .button-vue:hover,.vue-crumb[data-v-28ef52a4]:not(:last-child) .button-vue:focus{background-color:var(--color-background-dark);color:var(--color-main-text)}.vue-crumb[data-v-28ef52a4]:not(:last-child) .button-vue__text{font-weight:400}.vue-crumb[data-v-28ef52a4] .button-vue__text{margin:0}.vue-crumb[data-v-28ef52a4]:not(.dropdown) .action-item{max-width:100%}.vue-crumb[data-v-28ef52a4]:not(.dropdown) .action-item .button-vue{padding:0 4px 0 16px;max-width:100%}.vue-crumb[data-v-28ef52a4]:not(.dropdown) .action-item .button-vue__wrapper{flex-direction:row-reverse}.vue-crumb[data-v-28ef52a4]:not(.dropdown) .action-item.action-item--open .action-item__menutoggle{background-color:var(--color-background-dark);color:var(--color-main-text)}.material-design-icon[data-v-af2b1226]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.breadcrumb[data-v-af2b1226]{width:100%;flex-grow:1;display:inline-flex;align-items:center}.breadcrumb--collapsed[data-v-af2b1226] .vue-crumb:last-child{min-width:100px}.breadcrumb nav[data-v-af2b1226]{flex-shrink:1;min-width:0}.breadcrumb .breadcrumb__crumbs[data-v-af2b1226]{max-width:100%}.breadcrumb .breadcrumb__crumbs[data-v-af2b1226],.breadcrumb .breadcrumb__actions[data-v-af2b1226]{display:inline-flex}.material-design-icon[data-v-a1ac280f]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.checkbox-content[data-v-a1ac280f]{display:flex;align-items:center;flex-direction:row;gap:var(--default-grid-baseline);-webkit-user-select:none;user-select:none;min-height:var(--default-clickable-area);border-radius:var(--checkbox-radio-switch--border-radius);padding:var(--default-grid-baseline) calc((var(--default-clickable-area) - var(--icon-height)) / 2);width:100%;max-width:fit-content}.checkbox-content__wrapper[data-v-a1ac280f]{flex:1 0 0;max-width:100%}.checkbox-content__text[data-v-a1ac280f]:empty{display:none}.checkbox-content-checkbox:not(.checkbox-content--button-variant) .checkbox-content__icon[data-v-a1ac280f],.checkbox-content-radio:not(.checkbox-content--button-variant) .checkbox-content__icon[data-v-a1ac280f],.checkbox-content-switch:not(.checkbox-content--button-variant) .checkbox-content__icon[data-v-a1ac280f]{margin-block:calc((var(--default-clickable-area) - 2 * var(--default-grid-baseline) - var(--icon-height)) / 2) auto}.checkbox-content-checkbox:not(.checkbox-content--button-variant) .checkbox-content__icon--has-description[data-v-a1ac280f],.checkbox-content-radio:not(.checkbox-content--button-variant) .checkbox-content__icon--has-description[data-v-a1ac280f],.checkbox-content-switch:not(.checkbox-content--button-variant) .checkbox-content__icon--has-description[data-v-a1ac280f]{display:flex;align-items:center;margin-block-end:0;align-self:start}.checkbox-content__icon[data-v-a1ac280f]>*{width:var(--icon-size);height:var(--icon-height);color:var(--color-primary-element)}.checkbox-content__description[data-v-a1ac280f]{display:block;color:var(--color-text-maxcontrast)}.checkbox-content--button-variant .checkbox-content__icon[data-v-a1ac280f]:not(.checkbox-content__icon--checked)>*{color:var(--color-primary-element)}.checkbox-content--button-variant .checkbox-content__icon--checked[data-v-a1ac280f]>*{color:var(--color-primary-element-text)}.checkbox-content--has-text[data-v-a1ac280f]{padding-inline-end:calc((var(--default-clickable-area) - 16px) / 2)}.checkbox-content[data-v-a1ac280f],.checkbox-content[data-v-a1ac280f] *{cursor:pointer;flex-shrink:0}.material-design-icon[data-v-0dcb138a]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.checkbox-radio-switch[data-v-0dcb138a]{--icon-size: var(--65a7082e);--icon-height: var(--20f7d30f);--checkbox-radio-switch--border-radius: var(--border-radius-element);--checkbox-radio-switch--border-radius-outer: calc(var(--checkbox-radio-switch--border-radius) + 2px);display:flex;align-items:center;color:var(--color-main-text);background-color:transparent;font-size:var(--default-font-size);line-height:var(--default-line-height);padding:0;position:relative}.checkbox-radio-switch__input[data-v-0dcb138a]{position:absolute;z-index:-1;opacity:0!important;width:var(--icon-size);height:var(--icon-size)}.checkbox-radio-switch__input:focus-visible+.checkbox-radio-switch__content[data-v-0dcb138a],.checkbox-radio-switch__input[data-v-0dcb138a]:focus-visible{outline:2px solid var(--color-main-text);border-color:var(--color-main-background);outline-offset:-2px}.checkbox-radio-switch--disabled .checkbox-radio-switch__content[data-v-0dcb138a]{opacity:.5}.checkbox-radio-switch--disabled .checkbox-radio-switch__content[data-v-0dcb138a] .checkbox-radio-switch__icon>*{color:var(--color-main-text)}.checkbox-radio-switch--disabled .checkbox-radio-switch__content.checkbox-content[data-v-0dcb138a],.checkbox-radio-switch--disabled .checkbox-radio-switch__content.checkbox-content[data-v-0dcb138a] *:not(a){cursor:default!important}.checkbox-radio-switch:not(.checkbox-radio-switch--disabled,.checkbox-radio-switch--checked):focus-within .checkbox-radio-switch__content[data-v-0dcb138a],.checkbox-radio-switch:not(.checkbox-radio-switch--disabled,.checkbox-radio-switch--checked) .checkbox-radio-switch__content[data-v-0dcb138a]:hover{background-color:var(--color-background-hover)}.checkbox-radio-switch--checked:not(.checkbox-radio-switch--disabled):focus-within .checkbox-radio-switch__content[data-v-0dcb138a],.checkbox-radio-switch--checked:not(.checkbox-radio-switch--disabled) .checkbox-radio-switch__content[data-v-0dcb138a]:hover{background-color:var(--color-primary-element-hover)}.checkbox-radio-switch--checked:not(.checkbox-radio-switch--button-variant):not(.checkbox-radio-switch--disabled):focus-within .checkbox-radio-switch__content[data-v-0dcb138a],.checkbox-radio-switch--checked:not(.checkbox-radio-switch--button-variant):not(.checkbox-radio-switch--disabled) .checkbox-radio-switch__content[data-v-0dcb138a]:hover{background-color:var(--color-primary-element-light-hover)}.checkbox-radio-switch-switch[data-v-0dcb138a]:not(.checkbox-radio-switch--checked) .checkbox-radio-switch__icon>*{color:var(--color-text-maxcontrast)}.checkbox-radio-switch-switch.checkbox-radio-switch--disabled.checkbox-radio-switch--checked[data-v-0dcb138a] .checkbox-radio-switch__icon>*{color:var(--color-primary-element-light)}.checkbox-radio-switch--button-variant.checkbox-radio-switch[data-v-0dcb138a]{background-color:var(--color-main-background);border:2px solid var(--color-border-maxcontrast);overflow:hidden}.checkbox-radio-switch--button-variant.checkbox-radio-switch--checked[data-v-0dcb138a]{font-weight:700}.checkbox-radio-switch--button-variant.checkbox-radio-switch--checked .checkbox-radio-switch__content[data-v-0dcb138a]{background-color:var(--color-primary-element);color:var(--color-primary-element-text)}.checkbox-radio-switch--button-variant[data-v-0dcb138a] .checkbox-radio-switch__text{overflow:hidden;text-overflow:ellipsis;white-space:nowrap;width:100%}.checkbox-radio-switch--button-variant[data-v-0dcb138a]:not(.checkbox-radio-switch--checked) .checkbox-radio-switch__icon>*{color:var(--color-main-text)}.checkbox-radio-switch--button-variant[data-v-0dcb138a] .checkbox-radio-switch__icon:empty{display:none}.checkbox-radio-switch--button-variant[data-v-0dcb138a]:not(.checkbox-radio-switch--button-variant-v-grouped):not(.checkbox-radio-switch--button-variant-h-grouped),.checkbox-radio-switch--button-variant .checkbox-radio-switch__content[data-v-0dcb138a]{border-radius:var(--checkbox-radio-switch--border-radius)}.checkbox-radio-switch--button-variant-v-grouped .checkbox-radio-switch__content[data-v-0dcb138a]{flex-basis:100%;max-width:unset}.checkbox-radio-switch--button-variant-v-grouped[data-v-0dcb138a]:first-of-type{border-start-start-radius:var(--checkbox-radio-switch--border-radius-outer);border-start-end-radius:var(--checkbox-radio-switch--border-radius-outer)}.checkbox-radio-switch--button-variant-v-grouped[data-v-0dcb138a]:last-of-type{border-end-start-radius:var(--checkbox-radio-switch--border-radius-outer);border-end-end-radius:var(--checkbox-radio-switch--border-radius-outer)}.checkbox-radio-switch--button-variant-v-grouped[data-v-0dcb138a]:not(:last-of-type){border-bottom:0!important}.checkbox-radio-switch--button-variant-v-grouped:not(:last-of-type) .checkbox-radio-switch__content[data-v-0dcb138a]{margin-bottom:2px}.checkbox-radio-switch--button-variant-v-grouped[data-v-0dcb138a]:not(:first-of-type){border-top:0!important}.checkbox-radio-switch--button-variant-h-grouped[data-v-0dcb138a]:first-of-type{border-start-start-radius:var(--checkbox-radio-switch--border-radius-outer);border-end-start-radius:var(--checkbox-radio-switch--border-radius-outer)}.checkbox-radio-switch--button-variant-h-grouped[data-v-0dcb138a]:last-of-type{border-start-end-radius:var(--checkbox-radio-switch--border-radius-outer);border-end-end-radius:var(--checkbox-radio-switch--border-radius-outer)}.checkbox-radio-switch--button-variant-h-grouped[data-v-0dcb138a]:not(:last-of-type){border-inline-end:0!important}.checkbox-radio-switch--button-variant-h-grouped:not(:last-of-type) .checkbox-radio-switch__content[data-v-0dcb138a]{margin-inline-end:2px}.checkbox-radio-switch--button-variant-h-grouped[data-v-0dcb138a]:not(:first-of-type){border-inline-start:0!important}.checkbox-radio-switch--button-variant-h-grouped[data-v-0dcb138a] .checkbox-radio-switch__text{text-align:center;display:flex;align-items:center}.checkbox-radio-switch--button-variant-h-grouped .checkbox-radio-switch__content[data-v-0dcb138a]{flex-direction:column;justify-content:center;width:100%;margin:0;gap:0}.material-design-icon[data-v-2aa1d7ea]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.nc-chip[data-v-2aa1d7ea]{--chip-size: 24px;--chip-radius: calc(var(--chip-size) / 2);height:var(--chip-size);max-width:fit-content;display:flex;flex-direction:row;align-items:center;border-radius:var(--chip-radius);background-color:var(--color-background-hover)}.nc-chip--primary[data-v-2aa1d7ea]{background-color:var(--color-primary-element);color:var(--color-primary-element-text)}.nc-chip--secondary[data-v-2aa1d7ea]{background-color:var(--color-primary-element-light);color:var(--color-primary-element-light-text)}.nc-chip--error[data-v-2aa1d7ea]{background-color:var(--color-error);color:var(--color-error-text)}.nc-chip--warning[data-v-2aa1d7ea]{background-color:var(--color-warning);color:var(--color-warning-text)}.nc-chip--success[data-v-2aa1d7ea]{background-color:var(--color-success);color:var(--color-success-text)}.nc-chip--no-actions .nc-chip__text[data-v-2aa1d7ea]{padding-inline-end:calc(2 * var(--default-grid-baseline))}.nc-chip--no-icon .nc-chip__text[data-v-2aa1d7ea]{padding-inline-start:calc(2 * var(--default-grid-baseline))}.nc-chip__text[data-v-2aa1d7ea]{flex:1 auto;overflow:hidden;text-overflow:ellipsis;text-wrap:nowrap}.nc-chip__icon[data-v-2aa1d7ea]{flex:0 0 var(--chip-size);margin-inline-end:var(--default-grid-baseline);line-height:1;display:flex;align-items:center;justify-content:center;overflow:hidden;height:var(--chip-size);width:var(--chip-size)}.nc-chip__actions[data-v-2aa1d7ea]{flex:0 0 var(--chip-size);--default-clickable-area: var(--chip-size);--border-radius-element: var(--chip-radius)}.material-design-icon[data-v-52d18b4a]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.fade-enter-active[data-v-52d18b4a],.fade-leave-active[data-v-52d18b4a]{transition:opacity .3s ease}.fade-enter[data-v-52d18b4a],.fade-leave-to[data-v-52d18b4a]{opacity:0}.linked-icons[data-v-52d18b4a]{display:flex}.linked-icons img[data-v-52d18b4a]{padding:12px;height:var(--default-clickable-area);display:block;background-repeat:no-repeat;background-position:center;opacity:.7}.linked-icons img[data-v-52d18b4a]:hover{opacity:1}.popovermenu[data-v-52d18b4a]{display:none}.popovermenu.open[data-v-52d18b4a]{display:block}li.collection-list-item[data-v-52d18b4a]{flex-wrap:wrap;height:auto;cursor:pointer;margin-bottom:0!important}li.collection-list-item .collection-avatar[data-v-52d18b4a]{margin-top:0}li.collection-list-item form[data-v-52d18b4a],li.collection-list-item .collection-item-name[data-v-52d18b4a]{flex-basis:10%;flex-grow:1;display:flex}li.collection-list-item .collection-item-name[data-v-52d18b4a]{padding:12px 9px}li.collection-list-item input[data-v-52d18b4a]{margin-top:4px;border-color:var(--color-border-maxcontrast)}li.collection-list-item input[type=text][data-v-52d18b4a]{flex-grow:1}li.collection-list-item .error[data-v-52d18b4a],li.collection-list-item .resource-list-details[data-v-52d18b4a]{flex-basis:100%;width:100%}li.collection-list-item .resource-list-details li[data-v-52d18b4a]{display:flex;margin-inline-start:var(--default-clickable-area);border-radius:3px;cursor:pointer}li.collection-list-item .resource-list-details li[data-v-52d18b4a]:hover{background-color:var(--color-background-dark)}li.collection-list-item .resource-list-details li a[data-v-52d18b4a]{flex-grow:1;padding:3px;max-width:calc(100% - 30px);display:flex}li.collection-list-item .resource-list-details span[data-v-52d18b4a]{display:inline-block;vertical-align:top;margin-inline-end:10px}li.collection-list-item .resource-list-details span.resource-name[data-v-52d18b4a]{text-overflow:ellipsis;overflow:hidden;position:relative;vertical-align:top;white-space:nowrap;flex-grow:1;padding:4px}li.collection-list-item .resource-list-details img[data-v-52d18b4a]{width:24px;height:24px}li.collection-list-item .resource-list-details .icon-close[data-v-52d18b4a]{opacity:.7}li.collection-list-item .resource-list-details .icon-close[data-v-52d18b4a]:hover,li.collection-list-item .resource-list-details .icon-close[data-v-52d18b4a]:focus{opacity:1}.should-shake[data-v-52d18b4a]{animation:shake-52d18b4a .6s 1 linear}@keyframes shake-52d18b4a{0%{transform:translate(15px)}20%{transform:translate(-15px)}40%{transform:translate(7px)}60%{transform:translate(-7px)}80%{transform:translate(3px)}to{transform:translate(0)}}.material-design-icon[data-v-d175e795]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.collection-list[data-v-d175e795] *{box-sizing:border-box}.collection-list>li[data-v-d175e795]{display:flex;align-items:center;gap:12px}.collection-list>li>.avatar[data-v-d175e795]{margin-top:0}#collection-select-container[data-v-d175e795]{display:flex;flex-direction:column}.v-select span.avatar[data-v-d175e795]{display:block;padding:16px;opacity:.7;background-repeat:no-repeat;background-position:center}.v-select span.avatar[data-v-d175e795]:hover{opacity:1}p.hint[data-v-d175e795]{z-index:1;margin-top:-16px;padding:8px;color:var(--color-text-maxcontrast);line-height:normal}div.avatar[data-v-d175e795]{width:32px;height:32px;margin:30px 0 0;padding:8px;background-color:var(--color-background-dark)}.icon-projects[data-v-d175e795]{display:block;padding:8px;background-repeat:no-repeat;background-position:center}.option__wrapper[data-v-d175e795]{display:flex}.option__wrapper .avatar[data-v-d175e795]{display:block;width:32px;height:32px;background-color:var(--color-background-darker)!important}.option__wrapper .option__title[data-v-d175e795]{padding:4px}.fade-enter-active[data-v-d175e795],.fade-leave-active[data-v-d175e795]{transition:opacity .5s}.fade-enter[data-v-d175e795],.fade-leave-to[data-v-d175e795]{opacity:0}body{--vs-search-input-color: var(--color-main-text);--vs-search-input-bg: var(--color-main-background);--vs-search-input-placeholder-color: var(--color-text-maxcontrast);--vs-font-size: var(--default-font-size);--vs-line-height: var(--default-line-height);--vs-state-disabled-bg: var(--color-background-hover);--vs-state-disabled-color: var(--color-text-maxcontrast);--vs-state-disabled-controls-color: var(--color-text-maxcontrast);--vs-state-disabled-cursor: not-allowed;--vs-disabled-bg: var(--color-background-hover);--vs-disabled-color: var(--color-text-maxcontrast);--vs-disabled-cursor: not-allowed;--vs-border-color: var(--color-border-maxcontrast);--vs-border-width: var(--border-width-input, 2px) !important;--vs-border-style: solid;--vs-border-radius: var(--border-radius-element);--vs-controls-color: var(--color-main-text);--vs-selected-bg: var(--color-background-hover);--vs-selected-color: var(--color-main-text);--vs-selected-border-color: var(--vs-border-color);--vs-selected-border-style: var(--vs-border-style);--vs-selected-border-width: var(--vs-border-width);--vs-dropdown-bg: var(--color-main-background);--vs-dropdown-color: var(--color-main-text);--vs-dropdown-z-index: 9999;--vs-dropdown-box-shadow: 0px 2px 2px 0px var(--color-box-shadow);--vs-dropdown-option-padding: 8px 20px;--vs-dropdown-option--active-bg: var(--color-background-hover);--vs-dropdown-option--active-color: var(--color-main-text);--vs-dropdown-option--kb-focus-box-shadow: inset 0px 0px 0px 2px var(--vs-border-color);--vs-dropdown-option--deselect-bg: var(--color-error);--vs-dropdown-option--deselect-color: #fff;--vs-transition-duration: 0ms;--vs-actions-padding: 0 8px 0 4px}.v-select.select{min-height:var(--default-clickable-area);min-width:260px;margin:0 0 var(--default-grid-baseline)}.v-select.select.vs--open{--vs-border-width: var(--border-width-input-focused, 2px)}.v-select.select .select__label{display:block;margin-bottom:2px}.v-select.select .vs__selected{height:calc(var(--default-clickable-area) - 2 * var(--vs-border-width) - var(--default-grid-baseline));margin:calc(var(--default-grid-baseline) / 2);padding-block:0;padding-inline:12px 8px;border-radius:16px!important;background:var(--color-primary-element-light);border:none}.v-select.select.vs--open .vs__selected:first-of-type{margin-inline-start:calc(var(--default-grid-baseline) / 2 - (var(--border-width-input-focused, 2px) - var(--border-width-input, 2px)))!important}.v-select.select .vs__search{text-overflow:ellipsis;color:var(--color-main-text);min-height:unset!important;height:calc(var(--default-clickable-area) - 2 * var(--vs-border-width))!important}.v-select.select .vs__search::placeholder{color:var(--color-text-maxcontrast)}.v-select.select .vs__search,.v-select.select .vs__search:focus{margin:0}.v-select.select .vs__dropdown-toggle{position:relative;max-height:100px;padding:0;overflow-y:auto}.v-select.select .vs__actions{position:sticky;top:0}.v-select.select .vs__clear{margin-inline-end:2px}.v-select.select.vs--open .vs__dropdown-toggle{border-width:var(--border-width-input-focused);outline:2px solid var(--color-main-background);border-color:var(--color-main-text);border-bottom-color:transparent}.v-select.select:not(.vs--disabled,.vs--open) .vs__dropdown-toggle:hover{outline:2px solid var(--color-main-background);border-color:var(--color-main-text)}.v-select.select.vs--disabled .vs__search,.v-select.select.vs--disabled .vs__selected{color:var(--color-text-maxcontrast)}.v-select.select.vs--disabled .vs__clear,.v-select.select.vs--disabled .vs__deselect{display:none}.v-select.select--no-wrap .vs__selected-options{flex-wrap:nowrap;overflow:auto;min-width:unset}.v-select.select--no-wrap .vs__selected-options .vs__selected{min-width:unset}.v-select.select--drop-up.vs--open .vs__dropdown-toggle{border-radius:0 0 var(--vs-border-radius) var(--vs-border-radius);border-top-color:transparent;border-bottom-color:var(--color-main-text)}.v-select.select .vs__selected-options{min-height:calc(var(--default-clickable-area) - 2 * var(--vs-border-width))}.v-select.select .vs__selected-options .vs__selected~.vs__search[readonly]{position:absolute}.v-select.select .vs__selected-options{padding:0 5px}.v-select.select.vs--single.vs--loading .vs__selected,.v-select.select.vs--single.vs--open .vs__selected{max-width:100%;opacity:1;color:var(--color-text-maxcontrast)}.v-select.select.vs--single .vs__selected-options{flex-wrap:nowrap}.v-select.select.vs--single .vs__selected{background:unset!important}.vs__dropdown-menu{border-width:var(--border-width-input-focused)!important;border-color:var(--color-main-text)!important;outline:none!important;box-shadow:-2px 0 0 var(--color-main-background),0 2px 0 var(--color-main-background),2px 0 0 var(--color-main-background),!important;padding:4px!important}.vs__dropdown-menu--floating{width:max-content;position:absolute;top:0;inset-inline-start:0}.vs__dropdown-menu--floating-placement-top{border-radius:var(--vs-border-radius) var(--vs-border-radius) 0 0!important;border-top-style:var(--vs-border-style)!important;border-bottom-style:none!important;box-shadow:0 -2px 0 var(--color-main-background),-2px 0 0 var(--color-main-background),2px 0 0 var(--color-main-background),!important}.vs__dropdown-menu .vs__dropdown-option{border-radius:6px!important}.vs__dropdown-menu .vs__no-options{color:var(--color-text-maxcontrast)!important}.material-design-icon[data-v-a612f185]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.name-parts[data-v-a612f185]{display:flex;max-width:100%;cursor:inherit}.name-parts__first[data-v-a612f185]{overflow:hidden;text-overflow:ellipsis}.name-parts__first[data-v-a612f185],.name-parts__last[data-v-a612f185]{white-space:pre;cursor:inherit}.name-parts__first strong[data-v-a612f185],.name-parts__last strong[data-v-a612f185]{font-weight:700}:root{--vs-colors--lightest: rgba(60, 60, 60, .26);--vs-colors--light: rgba(60, 60, 60, .5);--vs-colors--dark: #333;--vs-colors--darkest: rgba(0, 0, 0, .15);--vs-search-input-color: inherit;--vs-search-input-placeholder-color: inherit;--vs-font-size: 1rem;--vs-line-height: 1.4;--vs-state-disabled-bg: rgb(248, 248, 248);--vs-state-disabled-color: var(--vs-colors--light);--vs-state-disabled-controls-color: var(--vs-colors--light);--vs-state-disabled-cursor: not-allowed;--vs-border-color: var(--vs-colors--lightest);--vs-border-width: 1px;--vs-border-style: solid;--vs-border-radius: 4px;--vs-actions-padding: 4px 6px 0 3px;--vs-controls-color: var(--vs-colors--light);--vs-controls-size: 1;--vs-controls--deselect-text-shadow: 0 1px 0 #fff;--vs-selected-bg: #f0f0f0;--vs-selected-color: var(--vs-colors--dark);--vs-selected-border-color: var(--vs-border-color);--vs-selected-border-style: var(--vs-border-style);--vs-selected-border-width: var(--vs-border-width);--vs-dropdown-bg: #fff;--vs-dropdown-color: inherit;--vs-dropdown-z-index: 1000;--vs-dropdown-min-width: 160px;--vs-dropdown-max-height: 350px;--vs-dropdown-box-shadow: 0px 3px 6px 0px var(--vs-colors--darkest);--vs-dropdown-option-bg: #000;--vs-dropdown-option-color: var(--vs-dropdown-color);--vs-dropdown-option-padding: 3px 20px;--vs-dropdown-option--active-bg: #5897fb;--vs-dropdown-option--active-color: #fff;--vs-dropdown-option--deselect-bg: #fb5858;--vs-dropdown-option--deselect-color: #fff;--vs-transition-timing-function: cubic-bezier(1, -.115, .975, .855);--vs-transition-duration: .15s}.v-select{position:relative;font-family:inherit}.v-select,.v-select *{box-sizing:border-box}:root{--vs-transition-timing-function: cubic-bezier(1, .5, .8, 1);--vs-transition-duration: .15s}@-webkit-keyframes vSelectSpinner{0%{transform:rotate(0)}to{transform:rotate(360deg)}}@keyframes vSelectSpinner{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.vs__fade-enter-active,.vs__fade-leave-active{pointer-events:none;transition:opacity var(--vs-transition-duration) var(--vs-transition-timing-function)}.vs__fade-enter,.vs__fade-leave-to{opacity:0}:root{--vs-disabled-bg: var(--vs-state-disabled-bg);--vs-disabled-color: var(--vs-state-disabled-color);--vs-disabled-cursor: var(--vs-state-disabled-cursor)}.vs--disabled .vs__dropdown-toggle,.vs--disabled .vs__clear,.vs--disabled .vs__search,.vs--disabled .vs__selected,.vs--disabled .vs__open-indicator{cursor:var(--vs-disabled-cursor);background-color:var(--vs-disabled-bg)}.v-select[dir=rtl] .vs__actions{padding:0 3px 0 6px}.v-select[dir=rtl] .vs__clear{margin-left:6px;margin-right:0}.v-select[dir=rtl] .vs__deselect{margin-left:0;margin-right:2px}.v-select[dir=rtl] .vs__dropdown-menu{text-align:right}.vs__dropdown-toggle{-webkit-appearance:none;-moz-appearance:none;appearance:none;display:flex;padding:0 0 4px;background:none;border:var(--vs-border-width) var(--vs-border-style) var(--vs-border-color);border-radius:var(--vs-border-radius);white-space:normal}.vs__selected-options{display:flex;flex-basis:100%;flex-grow:1;flex-wrap:wrap;padding:0 2px;position:relative}.vs__actions{display:flex;align-items:center;padding:var(--vs-actions-padding)}.vs--searchable .vs__dropdown-toggle{cursor:text}.vs--unsearchable .vs__dropdown-toggle{cursor:pointer}.vs--open .vs__dropdown-toggle{border-bottom-color:transparent;border-bottom-left-radius:0;border-bottom-right-radius:0}.vs__open-indicator{fill:var(--vs-controls-color);transform:scale(var(--vs-controls-size));transition:transform var(--vs-transition-duration) var(--vs-transition-timing-function);transition-timing-function:var(--vs-transition-timing-function)}.vs--open .vs__open-indicator{transform:rotate(180deg) scale(var(--vs-controls-size))}.vs--loading .vs__open-indicator{opacity:0}.vs__clear{fill:var(--vs-controls-color);padding:0;border:0;background-color:transparent;cursor:pointer;margin-right:8px}.vs__dropdown-menu{display:block;box-sizing:border-box;position:absolute;top:calc(100% - var(--vs-border-width));left:0;z-index:var(--vs-dropdown-z-index);padding:5px 0;margin:0;width:100%;max-height:var(--vs-dropdown-max-height);min-width:var(--vs-dropdown-min-width);overflow-y:auto;box-shadow:var(--vs-dropdown-box-shadow);border:var(--vs-border-width) var(--vs-border-style) var(--vs-border-color);border-top-style:none;border-radius:0 0 var(--vs-border-radius) var(--vs-border-radius);text-align:left;list-style:none;background:var(--vs-dropdown-bg);color:var(--vs-dropdown-color)}.vs__no-options{text-align:center}.vs__dropdown-option{line-height:1.42857143;display:block;padding:var(--vs-dropdown-option-padding);clear:both;color:var(--vs-dropdown-option-color);white-space:nowrap;cursor:pointer}.vs__dropdown-option--highlight{background:var(--vs-dropdown-option--active-bg);color:var(--vs-dropdown-option--active-color)}.vs__dropdown-option--deselect{background:var(--vs-dropdown-option--deselect-bg);color:var(--vs-dropdown-option--deselect-color)}.vs__dropdown-option--disabled{background:var(--vs-state-disabled-bg);color:var(--vs-state-disabled-color);cursor:var(--vs-state-disabled-cursor)}.vs__selected{display:flex;align-items:center;background-color:var(--vs-selected-bg);border:var(--vs-selected-border-width) var(--vs-selected-border-style) var(--vs-selected-border-color);border-radius:var(--vs-border-radius);color:var(--vs-selected-color);line-height:var(--vs-line-height);margin:4px 2px 0;padding:0 .25em;z-index:0}.vs__deselect{display:inline-flex;-webkit-appearance:none;-moz-appearance:none;appearance:none;margin-left:4px;padding:0;border:0;cursor:pointer;background:none;fill:var(--vs-controls-color);text-shadow:var(--vs-controls--deselect-text-shadow)}.vs--single .vs__selected{background-color:transparent;border-color:transparent}.vs--single.vs--open .vs__selected,.vs--single.vs--loading .vs__selected{position:absolute;opacity:.4}.vs--single.vs--searching .vs__selected{display:none}.vs__search::-webkit-search-cancel-button{display:none}.vs__search::-webkit-search-decoration,.vs__search::-webkit-search-results-button,.vs__search::-webkit-search-results-decoration,.vs__search::-ms-clear{display:none}.vs__search,.vs__search:focus{color:var(--vs-search-input-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;line-height:var(--vs-line-height);font-size:var(--vs-font-size);border:1px solid transparent;border-left:none;outline:none;margin:4px 0 0;padding:0 7px;background:none;box-shadow:none;width:0;max-width:100%;flex-grow:1;z-index:1}.vs__search::-moz-placeholder{color:var(--vs-search-input-placeholder-color)}.vs__search::placeholder{color:var(--vs-search-input-placeholder-color)}.vs--unsearchable .vs__search{opacity:1}.vs--unsearchable:not(.vs--disabled) .vs__search{cursor:pointer}.vs--single.vs--searching:not(.vs--open):not(.vs--loading) .vs__search{opacity:.2}.vs__spinner{align-self:center;opacity:0;font-size:5px;text-indent:-9999em;overflow:hidden;border-top:.9em solid rgba(100,100,100,.1);border-right:.9em solid rgba(100,100,100,.1);border-bottom:.9em solid rgba(100,100,100,.1);border-left:.9em solid rgba(60,60,60,.45);transform:translateZ(0) scale(var(--vs-controls--spinner-size, var(--vs-controls-size)));-webkit-animation:vSelectSpinner 1.1s infinite linear;animation:vSelectSpinner 1.1s infinite linear;transition:opacity .1s}.vs__spinner,.vs__spinner:after{border-radius:50%;width:5em;height:5em;transform:scale(var(--vs-controls--spinner-size, var(--vs-controls-size)))}.vs--loading .vs__spinner{opacity:1}.material-design-icon[data-v-3d24879b]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.color-picker[data-v-3d24879b]{display:flex;overflow:hidden;align-content:flex-end;flex-direction:column;justify-content:space-between;padding:var(--border-radius-element);min-width:calc(4 * var(--default-clickable-area) + 2 * var(--border-radius-element))}.color-picker--clearable[data-v-3d24879b]{min-width:calc(5 * var(--default-clickable-area) + 2 * var(--border-radius-element))}.color-picker--advanced-fields[data-v-3d24879b]{min-width:264px}.color-picker__clear[data-v-3d24879b]{color:var(--color-main-text)}.color-picker__clear[data-v-3d24879b]:hover:not(:has(:checked)){color:var(--color-text-maxcontrast)}.color-picker__simple[data-v-3d24879b]{display:grid;grid-template-columns:repeat(auto-fit,var(--default-clickable-area));grid-auto-rows:var(--default-clickable-area)}.color-picker__simple-color-circle[data-v-3d24879b]{display:flex;align-items:center;justify-content:center;width:calc(var(--default-clickable-area) - 10px);height:calc(var(--default-clickable-area) - 10px);min-height:calc(var(--default-clickable-area) - 10px);margin:auto;padding:0;color:#fff;border:1px solid rgba(0,0,0,.25);border-radius:50%;font-size:16px}.color-picker__simple-color-circle[data-v-3d24879b]:focus-within{outline:2px solid var(--color-main-text)}.color-picker__simple-color-circle[data-v-3d24879b]:hover{opacity:.6}.color-picker__simple-color-circle--active[data-v-3d24879b]{width:calc(var(--default-clickable-area) - 6px);height:calc(var(--default-clickable-area) - 6px);min-height:calc(var(--default-clickable-area) - 6px);transition:all .1s ease-in-out;opacity:1!important}.color-picker__advanced[data-v-3d24879b]{box-shadow:none!important}.color-picker__navigation[data-v-3d24879b]{display:flex;flex-direction:row;gap:var(--default-grid-baseline);justify-content:space-between;margin-top:calc(2 * var(--default-grid-baseline))}[data-v-3d24879b] .vc-chrome{width:unset;background-color:var(--color-main-background)}[data-v-3d24879b] .vc-chrome-color-wrap{width:30px;height:30px}[data-v-3d24879b] .vc-chrome-active-color{border-radius:17px}[data-v-3d24879b] .vc-chrome-body{padding:14px 0 0;background-color:var(--color-main-background)}[data-v-3d24879b] .vc-chrome-body .vc-input__input{--input-border-radius: var(--border-radius-element);--input-border-width-offset: calc(var(--border-width-input-focused, 2px) - var(--border-width-input, 2px));width:100%;height:var(--default-clickable-area);margin:0;padding-inline:calc(var(--border-radius-element) + var(--input-border-width-offset));padding-block:var(--input-border-width-offset);border:var(--border-width-input, 2px) solid var(--color-border-maxcontrast);border-radius:var(--input-border-radius);font-size:var(--default-font-size);color:var(--color-main-text);box-shadow:none}[data-v-3d24879b] .vc-chrome-body .vc-input__input:active:not([disabled]),[data-v-3d24879b] .vc-chrome-body .vc-input__input:hover:not([disabled]),[data-v-3d24879b] .vc-chrome-body .vc-input__input:focus:not([disabled]){--input-border-width-offset: 0px;border-color:var(--color-main-text);border-width:var(--border-width-input-focused, 2px);box-shadow:0 0 0 2px var(--color-main-background)!important}[data-v-3d24879b] .vc-chrome-body .vc-input__input:active:not([disabled])+.vc-input__label,[data-v-3d24879b] .vc-chrome-body .vc-input__input:hover:not([disabled])+.vc-input__label,[data-v-3d24879b] .vc-chrome-body .vc-input__input:focus:not([disabled])+.vc-input__label{color:var(--color-main-text)}[data-v-3d24879b] .vc-chrome-body .vc-input__label{position:absolute;inset-inline:var(--border-width-input-focused, 2px);inset-block-start:calc(-1.5 * var(--font-size-small, 13px) / 2);max-width:fit-content;margin-inline:calc(var(--border-radius-element) - var(--default-grid-baseline));margin-block:0;padding-inline:var(--default-grid-baseline);font-family:var(--font-face);font-size:var(--font-size-small, 13px);line-height:1.5;font-weight:500;color:var(--color-text-maxcontrast);background-color:var(--color-main-background);pointer-events:none}[data-v-3d24879b] .vc-chrome-toggle-btn{display:flex;justify-content:center;align-items:center;width:var(--default-clickable-area);height:var(--default-clickable-area);margin-inline-start:6px;filter:var(--background-invert-if-dark)}[data-v-3d24879b] .vc-chrome-toggle-icon{width:24px;height:24px;margin:0}[data-v-3d24879b] .vc-chrome-toggle-icon-highlight{width:var(--default-clickable-area);height:var(--default-clickable-area);inset:0}[data-v-3d24879b] .vc-chrome-saturation-wrap{border-radius:3px}[data-v-3d24879b] .vc-chrome-saturation-circle{width:20px;height:20px}.slide-enter-from[data-v-3d24879b]{transform:translate(-50%);opacity:0}.slide-enter-to[data-v-3d24879b],.slide-leave-from[data-v-3d24879b]{transform:translate(0);opacity:1}.slide-leave-to[data-v-3d24879b]{transform:translate(-50%);opacity:0}.slide-enter-active[data-v-3d24879b],.slide-leave-active[data-v-3d24879b]{transition:all 50ms ease-in-out}#skip-actions.vue-skip-actions:focus-within{top:0!important;inset-inline-start:0!important;width:100vw;height:100vh;padding:var(--body-container-margin)!important;-webkit-backdrop-filter:brightness(50%);backdrop-filter:brightness(50%)}.material-design-icon[data-v-d9b0d7e8]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.vue-skip-actions__container[data-v-d9b0d7e8]{background-color:var(--color-main-background);border-radius:var(--border-radius-element);padding:22px}.vue-skip-actions__headline[data-v-d9b0d7e8]{font-weight:700;font-size:20px;line-height:30px;margin-bottom:12px}.vue-skip-actions__buttons[data-v-d9b0d7e8]{display:flex;flex-wrap:wrap;gap:12px}.vue-skip-actions__buttons[data-v-d9b0d7e8]>*{flex:1 0 fit-content}.vue-skip-actions__image[data-v-d9b0d7e8]{margin-top:12px}.vue-skip-actions__image[data-v-d9b0d7e8]:dir(rtl){transform:rotateY(180deg)}.content[data-v-d9b0d7e8]{display:flex;width:calc(100% - var(--body-container-margin) * 2);border-radius:var(--body-container-radius);height:var(--body-height);overflow:hidden;padding:0}.content[data-v-d9b0d7e8]:not(.with-sidebar--full){position:fixed}.content[data-v-d9b0d7e8],.content[data-v-d9b0d7e8] *{box-sizing:border-box}.material-design-icon[data-v-36ffc13f]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.counter-bubble__counter[data-v-36ffc13f]{--counter-bubble-height: 22px;font-size:var(--font-size-small, 13px);overflow:hidden;width:fit-content;min-width:var(--counter-bubble-height);text-align:center;line-height:var(--counter-bubble-height);padding:0 calc(1.5 * var(--default-grid-baseline));border-radius:.5lh;background-color:var(--color-primary-element-light);font-weight:700;color:var(--color-primary-element-light-text)}.counter-bubble__counter .active[data-v-36ffc13f]{color:var(--color-main-background);background-color:var(--color-primary-element-light)}.counter-bubble__counter--highlighted[data-v-36ffc13f]{color:var(--color-primary-element-text);background-color:var(--color-primary-element)}.counter-bubble__counter--highlighted.active[data-v-36ffc13f]{color:var(--color-primary-element);background-color:var(--color-main-background)}.counter-bubble__counter--outlined[data-v-36ffc13f]{color:var(--color-primary-element);background:transparent;box-shadow:inset 0 0 0 2px}.counter-bubble__counter--outlined.active[data-v-36ffc13f]{color:var(--color-main-background);box-shadow:inset 0 0 0 2px}.material-design-icon[data-v-6b5fc397]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.dashboard-widget[data-v-6b5fc397] .empty-content{text-align:center;padding-top:5vh}.dashboard-widget[data-v-6b5fc397] .empty-content.half-screen{padding-top:0;margin-bottom:1vh}.more[data-v-6b5fc397]{display:block;text-align:center;color:var(--color-text-maxcontrast);line-height:60px;cursor:pointer}.more[data-v-6b5fc397]:hover,.more[data-v-6b5fc397]:focus{background-color:var(--color-background-hover);border-radius:var(--border-radius-element);color:var(--color-main-text)}.item-list__entry[data-v-6b5fc397]{display:flex;align-items:flex-start;padding:8px}.item-list__entry .item-avatar[data-v-6b5fc397]{position:relative;margin-block:auto;background-color:var(--color-background-dark)!important}.item-list__entry .item__details[data-v-6b5fc397]{padding-inline-start:8px;max-height:var(--default-clickable-area);flex-grow:1;overflow:hidden;display:flex;flex-direction:column}.item-list__entry .item__details h3[data-v-6b5fc397],.item-list__entry .item__details .message[data-v-6b5fc397]{white-space:nowrap;background-color:var(--color-background-dark)}.item-list__entry .item__details h3[data-v-6b5fc397]{font-size:100%;margin:0}.item-list__entry .item__details .message[data-v-6b5fc397]{width:80%;height:15px;margin-top:5px}.material-design-icon[data-v-c033ba26]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.item-list__entry[data-v-c033ba26]{display:flex;align-items:center;position:relative;padding:8px}.item-list__entry[data-v-c033ba26]:hover,.item-list__entry[data-v-c033ba26]:focus{background-color:var(--color-background-hover);border-radius:var(--border-radius-element)}.item-list__entry .item-avatar[data-v-c033ba26]{position:relative;margin-top:auto;margin-bottom:auto}.item-list__entry .item__details[data-v-c033ba26]{padding-inline-start:8px;max-height:fit-content;flex-grow:1;overflow:hidden;display:flex;flex-direction:column;justify-content:center;min-height:var(--default-clickable-area)}.item-list__entry .item__details h3[data-v-c033ba26],.item-list__entry .item__details .message[data-v-c033ba26]{white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.item-list__entry .item__details .message span[data-v-c033ba26]{width:10px;display:inline-block;margin-bottom:-3px}.item-list__entry .item__details h3[data-v-c033ba26]{font-size:100%;margin:0}.item-list__entry .item__details .message[data-v-c033ba26]{width:100%;color:var(--color-text-maxcontrast)}.item-list__entry .item-icon[data-v-c033ba26]{position:relative;width:14px;height:14px;margin-top:25px;margin-inline:-10px -2px}.item-list__entry button.primary[data-v-c033ba26]{padding:21px;margin:0}.material-design-icon[data-v-02e90461]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.vue-date-time-picker__wrapper[data-v-02e90461]{--dp-common-transition: all var(--animation-quick) ease-in;--dp-menu-padding: 6px 8px;--dp-animation-duration: var(--animation-quick);--dp-menu-appear-transition-timing: cubic-bezier(.4, 0, 1, 1);--dp-transition-timing: ease-out;--dp-action-row-transtion: all .2s ease-in;--dp-font-family: var(--font-face);--dp-border-radius: var(--border-radius-element);--dp-cell-border-radius: var(--border-radius-small);--dp-transition-length: 22px;--dp-transition-timing-general: var(--animation-quick);--dp-button-height: var(--default-clickable-area);--dp-month-year-row-height: var(--default-clickable-area);--dp-month-year-row-button-size: var(--clickable-area-small);--dp-button-icon-height: 20px;--dp-calendar-wrap-padding: 0 5px;--dp-cell-size: var(--default-clickable-area);--dp-cell-padding: 5px;--dp-common-padding: 10px;--dp-input-icon-padding: var(--default-clickable-area);--dp-input-padding: 6px 12px;--dp-menu-min-width: 260px;--dp-action-buttons-padding: 1px 6px;--dp-row-margin: 5px 0;--dp-calendar-header-cell-padding: .5rem;--dp-multi-calendars-spacing: 10px;--dp-overlay-col-padding: 3px;--dp-time-inc-dec-button-size: var(--default-clickable-area);--dp-font-size: 1rem;--dp-preview-font-size: var(--font-size-small);--dp-time-font-size: 2rem;--dp-action-button-height: var(--clickable-area-small);--dp-action-row-padding: 8px;--dp-direction: ltr}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_wrap{position:relative;width:100%;box-sizing:unset}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_wrap:focus{border-color:var(--dp-border-color-hover);outline:none}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_valid{box-shadow:0 0 var(--dp-border-radius) var(--dp-success-color);border-color:var(--dp-success-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_valid:hover{border-color:var(--dp-success-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_invalid{box-shadow:0 0 var(--dp-border-radius) var(--dp-danger-color);border-color:var(--dp-danger-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_invalid:hover{border-color:var(--dp-danger-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input{background-color:var(--dp-background-color);border-radius:var(--dp-border-radius);font-family:var(--dp-font-family);border:1px solid var(--dp-border-color);outline:none;transition:border-color .2s cubic-bezier(.645,.045,.355,1);width:100%;font-size:var(--dp-font-size);line-height:calc(var(--dp-font-size) * 1.5);padding:var(--dp-input-padding);color:var(--dp-text-color);box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input::placeholder{opacity:.7}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input:hover:not(.dp__input_focus){border-color:var(--dp-border-color-hover)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_not_clearable{padding-inline-end:var(--dp-input-not-clearable-padding)!important}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_reg{caret-color:#0000}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_focus{border-color:var(--dp-border-color-focus)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__disabled{background:var(--dp-disabled-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__disabled::placeholder{color:var(--dp-disabled-color-text)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_icons{display:inline-block;width:var(--dp-font-size);height:var(--dp-font-size);stroke-width:0;font-size:var(--dp-font-size);line-height:calc(var(--dp-font-size) * 1.5);padding:6px 12px;color:var(--dp-icon-color);box-sizing:content-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_icon{cursor:pointer;position:absolute;top:50%;inset-inline-start:0;transform:translateY(-50%);color:var(--dp-icon-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--clear-btn{position:absolute;top:50%;inset-inline-end:0;transform:translateY(-50%);cursor:pointer;color:var(--dp-icon-color);background:#0000;border:none;display:inline-flex;align-items:center;padding:0;margin:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__input_icon_pad{padding-inline-start:var(--dp-input-icon-padding)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu{background:var(--dp-background-color);border-radius:var(--dp-border-radius);min-width:var(--dp-menu-min-width);font-family:var(--dp-font-family);font-size:var(--dp-font-size);-webkit-user-select:none;user-select:none;border:1px solid var(--dp-menu-border-color);box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu:after{box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu:before{box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu:focus{border:1px solid var(--dp-menu-border-color);outline:none}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--menu-wrapper{position:absolute;z-index:99999}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu_inner{padding:var(--dp-menu-padding)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--menu--inner-stretched{padding:6px 0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu_index{z-index:99999}.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-loading,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu_readonly,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu_disabled{position:absolute;inset:0;z-index:999999}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu_disabled{background:#ffffff80;cursor:not-allowed}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu_readonly{background:#0000;cursor:default}.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-loading{background:#ffffff80;cursor:default}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--menu-load-container{display:flex;height:100%;width:100%;justify-content:center;align-items:center}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--menu-loader{width:48px;height:48px;border:var(--dp-loader);border-bottom-color:#0000;border-radius:50%;display:inline-block;box-sizing:border-box;animation:dp-load-rotation-02e90461 1s linear infinite;position:absolute}@keyframes dp-load-rotation-02e90461{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__arrow_top{left:var(--dp-arrow-left);top:0;height:12px;width:12px;background-color:var(--dp-background-color);position:absolute;border-inline-end:1px solid var(--dp-menu-border-color);border-top:1px solid var(--dp-menu-border-color);transform:translate(-50%,-50%) rotate(-45deg)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__arrow_bottom{left:var(--dp-arrow-left);bottom:0;height:12px;width:12px;background-color:var(--dp-background-color);position:absolute;border-inline-end:1px solid var(--dp-menu-border-color);border-bottom:1px solid var(--dp-menu-border-color);transform:translate(-50%,50%) rotate(45deg)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_extra{text-align:center;padding:2px 0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-dates{padding:5px;border-inline-end:1px solid var(--dp-border-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-dates[data-dp-mobile],.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-dates-collapsed{display:flex;align-self:center;border:none;overflow-x:auto;max-width:calc(var(--dp-menu-width) - var(--dp-action-row-padding) * 2)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__sidebar_left{padding:5px;border-inline-end:1px solid var(--dp-border-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__sidebar_right{padding:5px;margin-inline-end:1px solid var(--dp-border-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-range{display:block;width:100%;padding:5px;text-align:left;white-space:nowrap;color:var(--dp-text-color);border-radius:var(--dp-border-radius);transition:var(--dp-common-transition)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-range:hover{background-color:var(--dp-hover-color);color:var(--dp-hover-text-color);cursor:pointer}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-range[data-dp-mobile]{border:1px solid var(--dp-border-color);margin:0 3px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-range[data-dp-mobile]:first-child{margin-left:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-range[data-dp-mobile]:last-child{margin-right:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-range-collapsed{border:1px solid var(--dp-border-color);margin:0 3px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-range-collapsed:first-child{margin-left:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--preset-range-collapsed:last-child{margin-right:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu_content_wrapper{display:flex}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__menu_content_wrapper[data-dp-mobile],.vue-date-time-picker__wrapper[data-v-02e90461] .dp--menu-content-wrapper-collapsed{flex-direction:column-reverse}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__calendar_header{position:relative;display:flex;justify-content:center;align-items:center;color:var(--dp-text-color);white-space:nowrap;font-weight:700}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__calendar_header_item{text-align:center;flex-grow:1;height:var(--dp-cell-size);padding:var(--dp-cell-padding);width:var(--dp-cell-size);box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__calendar_row{display:flex;justify-content:center;align-items:center;margin:var(--dp-row-margin)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__calendar_item{text-align:center;flex-grow:1;box-sizing:border-box;color:var(--dp-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__calendar{position:relative}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__calendar_header_cell{border-bottom:thin solid var(--dp-border-color);padding:var(--dp-calendar-header-cell-padding)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_inner{display:flex;align-items:center;text-align:center;justify-content:center;border-radius:var(--dp-cell-border-radius);height:var(--dp-cell-size);padding:var(--dp-cell-padding);width:var(--dp-cell-size);border:1px solid rgba(0,0,0,0);box-sizing:border-box;position:relative}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_inner:hover{transition:all .2s}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_auto_range_start,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__date_hover_start:hover,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__range_start{border-end-end-radius:0;border-start-end-radius:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_auto_range_end,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__date_hover_end:hover,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__range_end{border-end-start-radius:0;border-start-start-radius:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__range_end,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__range_start,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__active_date{background:var(--dp-primary-color);color:var(--dp-primary-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__date_hover_end:hover,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__date_hover_start:hover,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__date_hover:hover{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_offset{color:var(--dp-secondary-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_disabled{color:var(--dp-secondary-color);cursor:not-allowed}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__range_between{background:var(--dp-range-between-dates-background-color);color:var(--dp-range-between-dates-text-color);border-radius:0;border:1px solid var(--dp-range-between-border-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__range_between_week{background:var(--dp-primary-color);color:var(--dp-primary-text-color);border-radius:0;border-top:1px solid var(--dp-primary-color);border-bottom:1px solid var(--dp-primary-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__today{border:1px solid var(--dp-primary-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__week_num{color:var(--dp-secondary-color);text-align:center}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_auto_range{border-radius:0;border-top:1px dashed var(--dp-primary-color);border-bottom:1px dashed var(--dp-primary-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_auto_range_start{border-start-start-radius:var(--dp-cell-border-radius);border-end-start-radius:var(--dp-cell-border-radius);border-inline-start:1px dashed var(--dp-primary-color);border-top:1px dashed var(--dp-primary-color);border-bottom:1px dashed var(--dp-primary-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_auto_range_end{border-start-end-radius:var(--dp-cell-border-radius);border-end-end-radius:var(--dp-cell-border-radius);border-top:1px dashed var(--dp-primary-color);border-bottom:1px dashed var(--dp-primary-color);border-inline-end:1px dashed var(--dp-primary-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__calendar_header_separator{width:100%;height:1px;background:var(--dp-border-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__calendar_next{margin-inline-start:var(--dp-multi-calendars-spacing)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__marker_line,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__marker_dot{height:5px;background-color:var(--dp-marker-color);position:absolute;bottom:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__marker_dot{width:5px;border-radius:50%;left:50%;transform:translate(-50%)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__marker_line{width:100%;left:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__marker_tooltip{position:absolute;border-radius:var(--dp-border-radius);background-color:var(--dp-tooltip-color);padding:5px;border:1px solid var(--dp-border-color);z-index:99999;box-sizing:border-box;cursor:default}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__tooltip_content{white-space:nowrap}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__tooltip_text{display:flex;align-items:center;flex-flow:row nowrap;color:var(--dp-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__tooltip_mark{height:5px;width:5px;border-radius:50%;background-color:var(--dp-text-color);color:var(--dp-text-color);margin-inline-end:5px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__arrow_bottom_tp{bottom:0;height:8px;width:8px;background-color:var(--dp-tooltip-color);position:absolute;border-inline-end:1px solid var(--dp-border-color);border-bottom:1px solid var(--dp-border-color);transform:translate(-50%,50%) rotate(45deg)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__instance_calendar{position:relative;width:100%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__flex_display[data-dp-mobile],.vue-date-time-picker__wrapper[data-v-02e90461] .dp--flex-display-collapsed{flex-direction:column}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_highlight{background-color:var(--dp-highlight-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__month_year_row{display:flex;align-items:center;height:var(--dp-month-year-row-height);color:var(--dp-text-color);box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inner_nav{display:flex;align-items:center;justify-content:center;cursor:pointer;height:var(--dp-month-year-row-button-size);width:var(--dp-month-year-row-button-size);color:var(--dp-icon-color);text-align:center;border-radius:50%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inner_nav svg{height:var(--dp-button-icon-height);width:var(--dp-button-icon-height)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inner_nav:hover{background:var(--dp-hover-color);color:var(--dp-hover-icon-color)}.vue-date-time-picker__wrapper[data-v-02e90461] [dir=rtl] .dp__inner_nav{transform:rotate(180deg)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inner_nav_disabled:hover,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inner_nav_disabled{background:var(--dp-disabled-color);color:var(--dp-disabled-color-text);cursor:not-allowed}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--year-select,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__month_year_select{text-align:center;cursor:pointer;height:var(--dp-month-year-row-height);display:flex;align-items:center;justify-content:center;border-radius:var(--dp-border-radius);box-sizing:border-box;color:var(--dp-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--year-select:hover,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__month_year_select:hover{background:var(--dp-hover-color);color:var(--dp-hover-text-color);transition:var(--dp-common-transition)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__month_year_select{width:50%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--year-select{width:100%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__month_year_wrap{display:flex;flex-direction:row;width:100%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__year_disable_select{justify-content:space-around}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--header-wrap{display:flex;width:100%;flex-direction:column}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay{width:100%;background:var(--dp-background-color);transition:opacity 1s ease-out;z-index:99999;font-family:var(--dp-font-family);color:var(--dp-text-color);box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--overlay-absolute{position:absolute;height:100%;top:0;left:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--overlay-relative{position:relative}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_container::-webkit-scrollbar-track{box-shadow:var(--dp-scroll-bar-background);background-color:var(--dp-scroll-bar-background)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_container::-webkit-scrollbar{width:5px;background-color:var(--dp-scroll-bar-background)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_container::-webkit-scrollbar-thumb{background-color:var(--dp-scroll-bar-color);border-radius:10px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay:focus{border:none;outline:none}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__container_flex{display:flex}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__container_block{display:block}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_container{flex-direction:column;overflow-y:auto;height:var(--dp-overlay-height)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_picker_overlay_container{height:100%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_row{padding:0;box-sizing:border-box;display:flex;margin-inline:auto;flex-wrap:wrap;max-width:100%;width:100%;align-items:center}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__flex_row{flex:1}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_col{box-sizing:border-box;width:33%;padding:var(--dp-overlay-col-padding);white-space:nowrap}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_cell_pad{padding:var(--dp-common-padding) 0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_cell_active{cursor:pointer;border-radius:var(--dp-border-radius);text-align:center;background:var(--dp-primary-color);color:var(--dp-primary-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_cell{cursor:pointer;border-radius:var(--dp-border-radius);text-align:center}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_cell:hover{background:var(--dp-hover-color);color:var(--dp-hover-text-color);transition:var(--dp-common-transition)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__cell_in_between{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__over_action_scroll{right:5px;box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_cell_disabled{cursor:not-allowed;background:var(--dp-disabled-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_cell_disabled:hover{background:var(--dp-disabled-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_cell_active_disabled{cursor:not-allowed;background:var(--dp-primary-disabled-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay_cell_active_disabled:hover{background:var(--dp-primary-disabled-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__btn,.vue-date-time-picker__wrapper[data-v-02e90461] .dp--qr-btn,.vue-date-time-picker__wrapper[data-v-02e90461] .dp--time-overlay-btn,.vue-date-time-picker__wrapper[data-v-02e90461] .dp--time-invalid{border:none;font:inherit;transition:var(--dp-common-transition);line-height:normal}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--year-mode-picker{display:flex;width:100%;align-items:center;justify-content:space-between;height:var(--dp-cell-size)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--tp-wrap{max-width:var(--dp-menu-min-width)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--tp-wrap[data-dp-mobile]{max-width:100%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_input{width:100%;display:flex;align-items:center;justify-content:center;-webkit-user-select:none;user-select:none;font-family:var(--dp-font-family);color:var(--dp-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col_reg_block{padding:0 20px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col_reg_inline{padding:0 10px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col_reg_with_button{padding:0 15px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col_reg_with_button[data-compact~=true]{padding:0 5px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col_sec{padding:0 10px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col_sec_with_button{padding:0 5px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col_sec_with_button[data-collapsed~=true]{padding:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col{text-align:center;display:flex;align-items:center;justify-content:center;flex-direction:column}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col_block{font-size:var(--dp-time-font-size)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_display_block{padding:0 3px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_display_inline{padding:5px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_picker_inline_container{display:flex;width:100%;justify-content:center}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inc_dec_button{padding:5px;margin:0;height:var(--dp-time-inc-dec-button-size);width:var(--dp-time-inc-dec-button-size);display:flex;align-items:center;justify-content:center;cursor:pointer;border-radius:50%;color:var(--dp-icon-color);box-sizing:border-box}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inc_dec_button svg{height:var(--dp-time-inc-dec-button-size);width:var(--dp-time-inc-dec-button-size)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inc_dec_button:hover{background:var(--dp-hover-color);color:var(--dp-hover-icon-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_display{cursor:pointer;color:var(--dp-text-color);border-radius:var(--dp-border-radius);display:flex;align-items:center;justify-content:center}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_display:hover:enabled{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inc_dec_button_inline{width:100%;padding:0;height:8px;cursor:pointer;display:flex;align-items:center}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inc_dec_button_disabled,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inc_dec_button_disabled:hover{background:var(--dp-disabled-color);color:var(--dp-disabled-color-text);cursor:not-allowed}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__pm_am_button{background:var(--dp-primary-color);color:var(--dp-primary-text-color);border:none;padding:var(--dp-common-padding);border-radius:var(--dp-border-radius);cursor:pointer}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__pm_am_button[data-compact~=true]{padding:7px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__tp_inline_btn_bar{width:100%;height:4px;background-color:var(--dp-secondary-color);transition:var(--dp-common-transition);border-collapse:collapse}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__tp_inline_btn_top:hover .dp__tp_btn_in_r{background-color:var(--dp-primary-color);transform:rotate(12deg) scale(1.15) translateY(-2px)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__tp_inline_btn_top:hover .dp__tp_btn_in_l,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__tp_inline_btn_bottom:hover .dp__tp_btn_in_r{background-color:var(--dp-primary-color);transform:rotate(-12deg) scale(1.15) translateY(-2px)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__tp_inline_btn_bottom:hover .dp__tp_btn_in_l{background-color:var(--dp-primary-color);transform:rotate(12deg) scale(1.15) translateY(-2px)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--time-overlay-btn{background:none}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--time-invalid{background-color:var(--dp-disabled-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_row{display:flex;align-items:center;width:100%;padding:var(--dp-action-row-padding);box-sizing:border-box;color:var(--dp-text-color);flex-flow:row nowrap}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_row svg{height:var(--dp-button-icon-height);width:auto}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__selection_preview{display:block;color:var(--dp-text-color);font-size:var(--dp-preview-font-size);overflow:hidden;white-space:nowrap;text-overflow:ellipsis}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_buttons{display:flex;flex:0;white-space:nowrap;align-items:center;justify-content:flex-end;margin-inline-start:auto}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_button{display:inline-flex;align-items:center;background:#0000;border:1px solid rgba(0,0,0,0);padding:var(--dp-action-buttons-padding);line-height:var(--dp-action-button-height);margin-inline-start:3px;height:var(--dp-action-button-height);cursor:pointer;border-radius:var(--dp-border-radius);font-size:var(--dp-preview-font-size);font-family:var(--dp-font-family)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_cancel{color:var(--dp-text-color);border:1px solid var(--dp-border-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_cancel:hover{border-color:var(--dp-primary-color);transition:var(--dp-action-row-transition)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_buttons .dp__action_select{background:var(--dp-primary-color);color:var(--dp-primary-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_buttons .dp__action_select:hover{background:var(--dp-primary-color);transition:var(--dp-action-row-transition)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_buttons .dp__action_select:disabled{background:var(--dp-primary-disabled-color);cursor:not-allowed}.vue-date-time-picker__wrapper[data-v-02e90461] .dp-quarter-picker-wrap{display:flex;flex-direction:column;height:100%;min-width:var(--dp-menu-min-width)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--qr-btn-disabled{cursor:not-allowed;background:var(--dp-disabled-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--qr-btn-disabled:hover{background:var(--dp-disabled-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--qr-btn{width:100%;padding:var(--dp-common-padding)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--qr-btn:not(.dp--highlighted,.dp--qr-btn-active,.dp--qr-btn-disabled,.dp--qr-btn-between){background:none}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--qr-btn:hover:not(.dp--qr-btn-active,.dp--qr-btn-disabled){background:var(--dp-hover-color);color:var(--dp-hover-text-color);transition:var(--dp-common-transition)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--quarter-items{display:flex;flex-direction:column;flex:1;width:100%;height:100%;justify-content:space-evenly}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--qr-btn-active{background:var(--dp-primary-color);color:var(--dp-primary-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--qr-btn-between{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}.vue-date-time-picker__wrapper[data-v-02e90461] :root{--dp-common-transition: all .1s ease-in;--dp-menu-padding: 6px 8px;--dp-animation-duration: .1s;--dp-menu-appear-transition-timing: cubic-bezier(.4, 0, 1, 1);--dp-transition-timing: ease-out;--dp-action-row-transition: all .2s ease-in;--dp-font-family: -apple-system, blinkmacsystemfont, "Segoe UI", roboto, oxygen, ubuntu, cantarell, "Open Sans", "Helvetica Neue", sans-serif;--dp-border-radius: 4px;--dp-cell-border-radius: 4px;--dp-transition-length: 22px;--dp-transition-timing-general: .1s;--dp-button-height: 35px;--dp-month-year-row-height: 35px;--dp-month-year-row-button-size: 25px;--dp-button-icon-height: 20px;--dp-calendar-wrap-padding: 0 5px;--dp-cell-size: 35px;--dp-cell-padding: 5px;--dp-common-padding: 10px;--dp-input-icon-padding: 35px;--dp-input-padding: 6px 30px 6px 12px;--dp-input-not-clearable-padding: 12px;--dp-menu-min-width: 260px;--dp-action-buttons-padding: 1px 6px;--dp-row-margin: 5px 0;--dp-calendar-header-cell-padding: .5rem;--dp-multi-calendars-spacing: 10px;--dp-overlay-col-padding: 3px;--dp-time-inc-dec-button-size: 32px;--dp-font-size: 1rem;--dp-preview-font-size: .8rem;--dp-time-font-size: 2rem;--dp-action-button-height: 22px;--dp-action-row-padding: 8px;--dp-direction: ltr}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__theme_dark{--dp-background-color: #212121;--dp-text-color: #fff;--dp-hover-color: #484848;--dp-hover-text-color: #fff;--dp-hover-icon-color: #959595;--dp-primary-color: #005cb2;--dp-primary-disabled-color: #61a8ea;--dp-primary-text-color: #fff;--dp-secondary-color: #a9a9a9;--dp-border-color: #2d2d2d;--dp-menu-border-color: #2d2d2d;--dp-border-color-hover: #aaaeb7;--dp-border-color-focus: #aaaeb7;--dp-disabled-color: #737373;--dp-disabled-color-text: #d0d0d0;--dp-scroll-bar-background: #212121;--dp-scroll-bar-color: #484848;--dp-success-color: #00701a;--dp-success-color-disabled: #428f59;--dp-icon-color: #959595;--dp-danger-color: #e53935;--dp-marker-color: #e53935;--dp-tooltip-color: #3e3e3e;--dp-highlight-color: rgb(0 92 178 / 20%);--dp-range-between-dates-background-color: var(--dp-hover-color, #484848);--dp-range-between-dates-text-color: var(--dp-hover-text-color, #fff);--dp-range-between-border-color: var(--dp-hover-color, #fff);--dp-loader: 5px solid #005cb2}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__theme_light{--dp-background-color: #fff;--dp-text-color: #212121;--dp-hover-color: #f3f3f3;--dp-hover-text-color: #212121;--dp-hover-icon-color: #959595;--dp-primary-color: #1976d2;--dp-primary-disabled-color: #6bacea;--dp-primary-text-color: #fff;--dp-secondary-color: #c0c4cc;--dp-border-color: #ddd;--dp-menu-border-color: #ddd;--dp-border-color-hover: #aaaeb7;--dp-border-color-focus: #aaaeb7;--dp-disabled-color: #f6f6f6;--dp-scroll-bar-background: #f3f3f3;--dp-scroll-bar-color: #959595;--dp-success-color: #76d275;--dp-success-color-disabled: #a3d9b1;--dp-icon-color: #959595;--dp-danger-color: #ff6f60;--dp-marker-color: #ff6f60;--dp-tooltip-color: #fafafa;--dp-disabled-color-text: #8e8e8e;--dp-highlight-color: rgb(25 118 210 / 10%);--dp-range-between-dates-background-color: var(--dp-hover-color, #f3f3f3);--dp-range-between-dates-text-color: var(--dp-hover-text-color, #212121);--dp-range-between-border-color: var(--dp-hover-color, #f3f3f3);--dp-loader: 5px solid #1976d2}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__flex{display:flex;align-items:center}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__btn{background:none}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__main{font-family:var(--dp-font-family);-webkit-user-select:none;user-select:none;box-sizing:border-box;position:relative;width:100%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__main *{direction:var(--dp-direction, ltr)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__pointer{cursor:pointer}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__icon{stroke:currentcolor;fill:currentcolor}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__button{width:100%;text-align:center;color:var(--dp-icon-color);cursor:pointer;display:flex;align-items:center;place-content:center center;padding:var(--dp-common-padding);box-sizing:border-box;height:var(--dp-button-height)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__button.dp__overlay_action{position:absolute;bottom:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__button:hover{background:var(--dp-hover-color);color:var(--dp-hover-icon-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__button svg{height:var(--dp-button-icon-height);width:auto}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__button_bottom{border-bottom-left-radius:var(--dp-border-radius);border-bottom-right-radius:var(--dp-border-radius)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__flex_display{display:flex}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__flex_display_with_input{flex-direction:column;align-items:flex-start}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__relative{position:relative}.vue-date-time-picker__wrapper[data-v-02e90461] .calendar-next-enter-active,.vue-date-time-picker__wrapper[data-v-02e90461] .calendar-next-leave-active,.vue-date-time-picker__wrapper[data-v-02e90461] .calendar-prev-enter-active,.vue-date-time-picker__wrapper[data-v-02e90461] .calendar-prev-leave-active{transition:all var(--dp-transition-timing-general) ease-out}.vue-date-time-picker__wrapper[data-v-02e90461] .calendar-next-enter-from{opacity:0;transform:translate(var(--dp-transition-length))}.vue-date-time-picker__wrapper[data-v-02e90461] .calendar-next-leave-to,.vue-date-time-picker__wrapper[data-v-02e90461] .calendar-prev-enter-from{opacity:0;transform:translate(calc(var(--dp-transition-length) * -1))}.vue-date-time-picker__wrapper[data-v-02e90461] .calendar-prev-leave-to{opacity:0;transform:translate(var(--dp-transition-length))}.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-appear-bottom-enter-active,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-appear-bottom-leave-active,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-appear-top-enter-active,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-appear-top-leave-active,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-slide-up-enter-active,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-slide-up-leave-active,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-slide-down-enter-active,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-slide-down-leave-active{transition:all var(--dp-animation-duration) var(--dp-transition-timing)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-appear-top-enter-from,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-appear-top-leave-to,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-slide-down-leave-to,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-slide-up-enter-from{opacity:0;transform:translateY(var(--dp-transition-length))}.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-appear-bottom-enter-from,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-menu-appear-bottom-leave-to,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-slide-down-enter-from,.vue-date-time-picker__wrapper[data-v-02e90461] .dp-slide-up-leave-to{opacity:0;transform:translateY(calc(var(--dp-transition-length) * -1))}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--arrow-btn-nav{transition:var(--dp-common-transition)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--highlighted{background-color:var(--dp-highlight-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--hidden-el{visibility:hidden}.vue-date-time-picker__wrapper .vue-date-time-picker--clearable[data-v-02e90461] .dp__input{padding-inline-end:var(--default-clickable-area)}.vue-date-time-picker__wrapper .vue-date-time-picker__timezone[data-v-02e90461]{min-width:unset;width:100%}.vue-date-time-picker__wrapper[data-v-02e90461] .icon-vue{opacity:1!important}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--tp-wrap,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__action_extra{padding:var(--dp-menu-padding);padding-top:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay.dp--overlay-absolute{padding:var(--dp-menu-padding)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__overlay.dp--overlay-absolute .dp__btn.dp__button.dp__button_bottom{inset-block-end:6px}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__btn.dp__button.dp__button_bottom,.vue-date-time-picker__wrapper[data-v-02e90461] .dp--tp-wrap .dp__button{width:100%}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__btn.dp__button.dp__overlay_action{width:calc(100% - 16px)}.vue-date-time-picker__wrapper[data-v-02e90461] input{padding-inline-start:var(--dp-input-icon-padding)!important}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__btn{margin:0}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__inner_nav{height:fit-content;width:fit-content}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__btn.dp__button.dp__button_bottom{color:var(--color-primary-element-light);background-color:var(--color-primary-element-light)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--header-wrap .dp__btn:not(.dp__button_bottom),.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col .dp__btn{background-color:var(--color-main-background)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--header-wrap .dp__btn:not(.dp__button_bottom):hover,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_col .dp__btn:hover{background:var(--dp-hover-color);color:var(--dp-hover-icon-color)}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__month_year_select{flex:1}.vue-date-time-picker__wrapper[data-v-02e90461] .dp--time-overlay-btn{font-size:calc(2 * var(--default-font-size))!important}.vue-date-time-picker__wrapper[data-v-02e90461] .dp__time_input .dp__time_col_reg_block{padding:0 calc(4 * var(--default-grid-baseline))}.vue-date-time-picker__wrapper .vue-date-time-picker.dp__theme_dark[data-v-02e90461],.vue-date-time-picker__wrapper .vue-date-time-picker.dp__theme_light[data-v-02e90461],.vue-date-time-picker__wrapper[data-v-02e90461] .dp__theme_dark,.vue-date-time-picker__wrapper[data-v-02e90461] .dp__theme_light{--dp-background-color: var(--color-main-background);--dp-text-color: var(--color-main-text);--dp-hover-color: var(--color-primary-element-light-hover);--dp-hover-text-color: var(--color-primary-element-light-text);--dp-hover-icon-color: var(--color-primary-element-light-text);--dp-primary-color: var(--color-primary-element);--dp-primary-disabled-color: var(--color-primary-element-hover);--dp-primary-text-color: var(--color-primary-element-text);--dp-secondary-color: var(--color-text-maxcontrast);--dp-border-color: var(--color-border);--dp-menu-border-color: var(--color-border-dark);--dp-border-color-hover: var(--color-border-maxcontrast);--dp-border-color-focus: var(--color-border-maxcontrast);--dp-disabled-color: var(--color-background-dark);--dp-disabled-color-text: var(--color-text-maxcontrast);--dp-scroll-bar-background: var(--color-scrollbar);--dp-scroll-bar-color: var(--color-scrollbar);--dp-success-color: var(--color-success);--dp-success-color-disabled: var(--color-success-hover);--dp-icon-color: var(--color-main-text);--dp-danger-color: var(--color-error);--dp-marker-color: var(--color-text-error, var(--color-error));--dp-tooltip-color: var(--color-main-text);--dp-highlight-color: var(--color-main-text)}.material-design-icon[data-v-f2f99131]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart *{box-sizing:border-box;line-height:1.15}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart{font-family:-apple-system,BlinkMacSystemFont,Helvetica Neue,sans-serif;font-size:16px;display:flex;flex-direction:column;height:420px;color:#222427;border:1px solid #d9d9d9;border-radius:5px;background:#fff}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-emoji{padding:6px;position:relative;display:inline-block;font-size:0;border:none;background:none;box-shadow:none}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-emoji span{display:inline-block}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-emoji .emoji-mart-emoji span{width:38px;height:38px;font-size:32px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-type-native{font-family:"Segoe UI Emoji",Segoe UI Symbol,Segoe UI,"Apple Color Emoji",Twemoji Mozilla,"Noto Color Emoji",EmojiOne Color,"Android Emoji";word-break:keep-all}.nc-emoji-picker-container[data-v-f2f99131] .emoji-type-image{background-size:6100%}.nc-emoji-picker-container[data-v-f2f99131] .emoji-type-image.emoji-set-apple{background-image:url(https://unpkg.com/emoji-datasource-apple@15.0.1/img/apple/sheets-256/64.png)}.nc-emoji-picker-container[data-v-f2f99131] .emoji-type-image.emoji-set-facebook{background-image:url(https://unpkg.com/emoji-datasource-facebook@15.0.1/img/facebook/sheets-256/64.png)}.nc-emoji-picker-container[data-v-f2f99131] .emoji-type-image.emoji-set-google{background-image:url(https://unpkg.com/emoji-datasource-google@15.0.1/img/google/sheets-256/64.png)}.nc-emoji-picker-container[data-v-f2f99131] .emoji-type-image.emoji-set-twitter{background-image:url(https://unpkg.com/emoji-datasource-twitter@15.0.1/img/twitter/sheets-256/64.png)}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-bar{border:0 solid #d9d9d9}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-bar:first-child{border-bottom-width:1px;border-top-left-radius:5px;border-top-right-radius:5px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-bar:last-child{border-top-width:1px;border-bottom-left-radius:5px;border-bottom-right-radius:5px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-scroll{position:relative;overflow-y:scroll;flex:1;padding:0 6px 6px;z-index:0;will-change:transform;-webkit-overflow-scrolling:touch}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-anchors{display:flex;flex-direction:row;justify-content:space-between;padding:0 6px;color:#858585;line-height:0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-anchor{position:relative;display:block;flex:1 1 auto;text-align:center;padding:12px 4px;overflow:hidden;transition:color .1s ease-out;border:none;background:none;box-shadow:none}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-anchor:hover,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-anchor-selected{color:#464646}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-anchor-selected .emoji-mart-anchor-bar{bottom:0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-anchor-bar{position:absolute;bottom:-3px;left:0;width:100%;height:3px;background-color:#464646}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-anchors i{display:inline-block;width:100%;max-width:22px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-anchors svg{fill:currentColor;max-height:18px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .scroller{height:250px;position:relative;flex:1;padding:0 6px 6px;z-index:0;will-change:transform;-webkit-overflow-scrolling:touch}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-search{margin-top:6px;padding:0 6px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-search input{font-size:16px;display:block;width:100%;padding:.2em .6em;border-radius:25px;border:1px solid #d9d9d9;outline:0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-search-results{height:250px;overflow-y:scroll}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-category{position:relative}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-category .emoji-mart-emoji span{z-index:1;position:relative;text-align:center;cursor:default}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-category .emoji-mart-emoji:hover:before,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-emoji-selected:before{z-index:0;content:"";position:absolute;top:0;left:0;width:100%;height:100%;background-color:#f4f4f4;border-radius:100%;opacity:0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-category .emoji-mart-emoji:hover:before,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-emoji-selected:before{opacity:1}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-category-label{position:sticky;top:0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-static .emoji-mart-category-label{z-index:2;position:relative}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-category-label h3{display:block;font-size:16px;width:100%;font-weight:500;padding:5px 6px;background-color:#fff;background-color:#fffffff2}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-emoji{position:relative;display:inline-block;font-size:0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-no-results{font-size:14px;text-align:center;padding-top:70px;color:#858585}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-no-results .emoji-mart-category-label{display:none}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-no-results .emoji-mart-no-results-label{margin-top:.2em}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-no-results .emoji-mart-emoji:hover:before{content:none}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview{position:relative;height:70px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-emoji,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-data,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-skins{position:absolute;top:50%;transform:translateY(-50%)}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-emoji{left:12px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-data{left:68px;right:12px;word-break:break-all}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-skins{right:30px;text-align:right}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-name{font-size:14px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-shortname{font-size:12px;color:#888}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-shortname+.emoji-mart-preview-shortname,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-shortname+.emoji-mart-preview-emoticon,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-emoticon+.emoji-mart-preview-emoticon{margin-left:.5em}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-preview-emoticon{font-size:11px;color:#bbb}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-title span{display:inline-block;vertical-align:middle}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-title .emoji-mart-emoji{padding:0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-title-label{color:#999a9c;font-size:21px;font-weight:300}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatches{font-size:0;padding:2px 0;border:1px solid #d9d9d9;border-radius:12px;background-color:#fff}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatches-opened .emoji-mart-skin-swatch{width:16px;padding:0 2px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatches-opened .emoji-mart-skin-swatch-selected:after{opacity:.75}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch{display:inline-block;width:0;vertical-align:middle;transition-property:width,padding;transition-duration:.125s;transition-timing-function:ease-out}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch:nth-child(1){transition-delay:0s}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch:nth-child(2){transition-delay:.03s}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch:nth-child(3){transition-delay:.06s}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch:nth-child(4){transition-delay:.09s}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch:nth-child(5){transition-delay:.12s}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch:nth-child(6){transition-delay:.15s}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch-selected{position:relative;width:16px;padding:0 2px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-swatch-selected:after{content:"";position:absolute;top:50%;left:50%;width:4px;height:4px;margin:-2px 0 0 -2px;background-color:#fff;border-radius:100%;pointer-events:none;opacity:0;transition:opacity .2s ease-out}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin{display:inline-block;width:100%;padding-top:100%;max-width:12px;border-radius:100%}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-tone-1{background-color:#ffc93a}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-tone-2{background-color:#fadcbc}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-tone-3{background-color:#e0bb95}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-tone-4{background-color:#bf8f68}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-tone-5{background-color:#9b643d}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-skin-tone-6{background-color:#594539}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller{position:relative}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller.direction-vertical:not(.page-mode){overflow-y:auto}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller.direction-horizontal:not(.page-mode){overflow-x:auto}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller.direction-horizontal{display:flex}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller__slot{flex:auto 0 0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller__item-wrapper{flex:1;box-sizing:border-box;overflow:hidden;position:relative}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller.ready .vue-recycle-scroller__item-view{position:absolute;top:0;left:0;will-change:transform}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller.direction-vertical .vue-recycle-scroller__item-wrapper{width:100%}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller.direction-horizontal .vue-recycle-scroller__item-wrapper{height:100%}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller.ready.direction-vertical .vue-recycle-scroller__item-view{width:100%}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .vue-recycle-scroller.ready.direction-horizontal .vue-recycle-scroller__item-view{height:100%}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .resize-observer[data-v-b329ee4c]{position:absolute;top:0;left:0;z-index:-1;width:100%;height:100%;border:none;background-color:transparent;pointer-events:none;display:block;overflow:hidden;opacity:0}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .resize-observer[data-v-b329ee4c] object{display:block;position:absolute;top:0;left:0;height:100%;width:100%;overflow:hidden;pointer-events:none;z-index:-1}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart-search .hidden{display:none;visibility:hidden}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart{background-color:var(--color-main-background)!important;border:0;color:var(--color-main-text)!important;display:flex!important}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart button{border:none;background:transparent;font-size:inherit}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-bar,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-anchors,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-search,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-search input,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-category,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-category-label,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-category-label span,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-skin-swatches{background-color:transparent!important;border-color:var(--color-border)!important;color:inherit!important}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-anchors{padding-block:0;padding-inline:calc(2 * var(--default-grid-baseline))}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-anchor{border-radius:0;margin:0!important;padding:0!important;height:var(--clickable-area-small);min-width:var(--clickable-area-small)}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-anchor:hover{background-color:var(--color-background-hover)}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-anchor:focus-visible{outline:2px solid var(--color-primary-element)!important;outline-offset:-2px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-anchor div{display:grid;place-content:center}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-scroll{padding-inline:calc(2 * var(--default-grid-baseline));padding-block:0 calc(2 * var(--default-grid-baseline))}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-category{display:grid;grid-template-columns:repeat(8,1fr);justify-items:stretch}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-category.emoji-mart-no-results{grid-template-columns:1fr;font-size:inherit;color:var(--color-text-maxcontrast)!important}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart div.emoji-mart-category-label{grid-column:span 8;justify-self:stretch}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart h3.emoji-mart-category-label{display:flex;align-items:center;height:var(--default-clickable-area);margin:0;padding-inline:calc(2 * var(--default-grid-baseline));padding-block:0;-webkit-user-select:none;user-select:none}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-emoji{aspect-ratio:1/1;text-align:center;margin:0!important;padding:0!important}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-emoji:hover,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-emoji:focus-visible,.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-emoji.emoji-mart-emoji-selected{background-color:var(--color-background-hover)!important;border:none;border-radius:var(--border-radius-element);box-shadow:none!important;outline:2px solid var(--color-primary-element)!important;outline-offset:-2px}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-emoji:before{display:none}.nc-emoji-picker-container[data-v-f2f99131] .emoji-mart .emoji-mart-emoji span{cursor:pointer}.search__wrapper[data-v-f2f99131]{display:flex;flex-direction:row;gap:var(--default-grid-baseline);align-items:end;padding-block:var(--default-grid-baseline);padding-inline:calc(2 * var(--default-grid-baseline))}.row-selected button[data-v-f2f99131],.row-selected span[data-v-f2f99131]{vertical-align:middle}.emoji-delete[data-v-f2f99131]{vertical-align:top;margin-inline-start:-21px;margin-top:-3px}._material-design-icon_1u9di_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._ncFormBox_1u9di_20{display:flex;flex-direction:column;gap:calc(1 * var(--default-grid-baseline))}._ncFormBox_1u9di_20._ncFormBox_row_1u9di_25{flex-direction:row}._ncFormBox__item_1u9di_29{border-radius:var(--border-radius-small)!important}._ncFormBox_col_1u9di_33{flex-direction:column}._ncFormBox_col_1u9di_33 ._ncFormBox__item_1u9di_29:first-child{border-start-start-radius:var(--border-radius-element)!important;border-start-end-radius:var(--border-radius-element)!important}._ncFormBox_col_1u9di_33 ._ncFormBox__item_1u9di_29:last-child{border-end-start-radius:var(--border-radius-element)!important;border-end-end-radius:var(--border-radius-element)!important}._ncFormBox_row_1u9di_25{flex-direction:row}._ncFormBox_row_1u9di_25 ._ncFormBox__item_1u9di_29{flex:1 1}._ncFormBox_row_1u9di_25 ._ncFormBox__item_1u9di_29:first-child{border-start-start-radius:var(--border-radius-element)!important;border-end-start-radius:var(--border-radius-element)!important}._ncFormBox_row_1u9di_25 ._ncFormBox__item_1u9di_29:last-child{border-end-end-radius:var(--border-radius-element)!important;border-start-end-radius:var(--border-radius-element)!important}._material-design-icon_15jyc_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._formBoxButton_15jyc_20{background:unset;border:none;color:inherit;font-size:inherit;font-weight:inherit;text-decoration:none;text-align:inherit;line-height:inherit;padding:0;margin:0;outline:none}._material-design-icon_v5un7_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._formBoxItem_v5un7_20{--nc-form-box-item-border-width: 1px;--nc-form-box-item-min-height: 40px;--form-element-label-offset: calc(var(--border-radius-element) + var(--default-grid-baseline));--form-element-label-padding: calc(var(--form-element-label-offset) - var(--nc-form-box-item-border-width));--color-primary-element-extra-light: hsl(from var(--color-primary-element-light) h s calc(l*1.045) );--color-primary-element-extra-light-hover: hsl(from var(--color-primary-element-light-hover) h s calc(l*1.045) );position:relative;display:flex;align-items:center;gap:calc(2 * var(--default-grid-baseline));min-height:var(--nc-form-box-item-min-height);padding-inline:var(--form-element-label-padding);border:1px solid var(--color-primary-element-extra-light-hover);border-bottom-width:2px;border-radius:var(--border-radius-element);background-color:var(--color-primary-element-extra-light);color:var(--color-main-text);transition-property:color,border-color,background-color;transition-duration:var(--animation-quick);transition-timing-function:linear;-webkit-user-select:none;user-select:none;cursor:pointer}._formBoxItem_v5un7_20 *{cursor:inherit}._formBoxItem_v5un7_20:has(:disabled){cursor:default;opacity:.5}._formBoxItem_v5un7_20:hover:not(:has(:disabled)){color:var(--color-primary-element-light-text);background-color:var(--color-primary-element-extra-light-hover)}._formBoxItem_v5un7_20:has(:focus-visible){outline:2px solid var(--color-main-text);box-shadow:0 0 0 4px var(--color-main-background)}._formBoxItem_v5un7_20._formBoxItem_legacy_v5un7_60{--nc-form-box-item-border-width: 0px;border:none}._formBoxItem_v5un7_20._formBoxItem_inverted_v5un7_64 ._formBoxItem__element_v5un7_64{color:var(--color-text-maxcontrast)}._formBoxItem_v5un7_20._formBoxItem_inverted_v5un7_64 ._formBoxItem__description_v5un7_67{color:inherit}._formBoxItem__content_v5un7_71{flex:1;display:flex;flex-direction:column;padding-block:calc(2 * var(--default-grid-baseline));overflow-wrap:anywhere}._formBoxItem__element_v5un7_64:after{content:"";position:absolute;inset:0}._formBoxItem__description_v5un7_67{color:var(--color-text-maxcontrast)}._formBoxItem__icon_v5un7_89{display:flex;align-items:center;justify-content:flex-end}._material-design-icon_hjv1a_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}input._formBoxSwitch__input_hjv1a_20{margin:0;width:var(--default-clickable-area);position:absolute;inset-block:0;inset-inline-end:var(--form-element-label-offset);z-index:-1;opacity:0!important;height:auto;cursor:inherit}._formBoxSwitch__icon_hjv1a_34{color:var(--color-text-maxcontrast)}input:checked+._formBoxSwitch__icon_hjv1a_34{color:var(--color-primary-element)}._material-design-icon_9p8a1_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._formGroup_9p8a1_20{--form-element-label-offset: calc(var(--border-radius-element) + var(--default-grid-baseline));--form-group-content-gap: calc(2 * var(--default-grid-baseline))}._formGroup_9p8a1_20._formGroup_noGap_9p8a1_24{--form-group-content-gap: 0}._formGroup__label_9p8a1_28{padding-inline:var(--form-element-label-offset);font-size:var(--font-size);font-weight:700}._formGroup__description_9p8a1_34{padding-inline:var(--form-element-label-offset);color:var(--color-text-maxcontrast)}._formGroup__content_9p8a1_39{display:flex;flex-direction:column;gap:var(--form-group-content-gap);margin-block-start:calc(2.5 * var(--default-grid-baseline))}._formGroup__content_9p8a1_39._formGroup__content_only_9p8a1_45{margin-block-start:0}.material-design-icon[data-v-26ad2498]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}#guest-content-vue[data-v-26ad2498]{color:var(--color-main-text);background-color:var(--color-main-background);min-width:0;border-radius:var(--border-radius-element);box-shadow:0 0 10px var(--color-box-shadow);height:fit-content;padding:15px;margin:20px auto}.material-design-icon{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}#content.nc-guest-content{overflow:auto;margin-bottom:0;height:calc(var(--body-height) + var(--body-container-margin))}.material-design-icon[data-v-92fb182d]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.header-menu[data-v-92fb182d]{position:relative;width:var(--header-height);height:var(--header-height)}.header-menu .header-menu__trigger[data-v-92fb182d]{--button-size: var(--header-height) !important;height:var(--header-height);opacity:.85;filter:none!important;color:var(--color-background-plain-text, var(--color-primary-text))!important}.header-menu .header-menu__trigger[data-v-92fb182d]:focus-visible{outline:none!important;box-shadow:none!important}.header-menu .header-menu__trigger[data-v-92fb182d] .button-vue__icon svg,.header-menu .header-menu__trigger[data-v-92fb182d] .button-vue__icon:not(:has(svg)){mask:var(--header-menu-icon-mask, none)}.header-menu--opened .header-menu__trigger[data-v-92fb182d],.header-menu__trigger[data-v-92fb182d]:hover,.header-menu__trigger[data-v-92fb182d]:focus,.header-menu__trigger[data-v-92fb182d]:active{opacity:1}@media only screen and (max-width: 512px){.header-menu[data-v-92fb182d]{width:var(--default-clickable-area)}.header-menu .header-menu__trigger[data-v-92fb182d]{--button-size: var(--default-clickable-area) !important}}.material-design-icon[data-v-d45c5788]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}/*! + * SPDX-FileCopyrightText: 2024 Nextcloud GmbH and Nextcloud contributors + * SPDX-License-Identifier: AGPL-3.0-or-later + */.header-menu[data-v-d45c5788]{position:relative;width:var(--header-height);height:var(--header-height)}.header-menu .header-menu__trigger[data-v-d45c5788]{--button-size: var(--header-height) !important;height:var(--header-height);opacity:.85;filter:none!important;color:var(--color-background-plain-text, var(--color-primary-text))!important}.header-menu .header-menu__trigger[data-v-d45c5788]:focus-visible{outline:none!important;box-shadow:none!important}.header-menu .header-menu__trigger[data-v-d45c5788] .button-vue__icon svg,.header-menu .header-menu__trigger[data-v-d45c5788] .button-vue__icon:not(:has(svg)){mask:var(--header-menu-icon-mask, none)}.header-menu--opened .header-menu__trigger[data-v-d45c5788],.header-menu__trigger[data-v-d45c5788]:hover,.header-menu__trigger[data-v-d45c5788]:focus,.header-menu__trigger[data-v-d45c5788]:active{opacity:1}@media only screen and (max-width: 512px){.header-menu[data-v-d45c5788]{width:var(--default-clickable-area)}.header-menu .header-menu__trigger[data-v-d45c5788]{--button-size: var(--default-clickable-area) !important}}.header-menu__wrapper[data-v-d45c5788]{position:fixed;z-index:2000;top:var(--header-height);inset-inline-end:0;box-sizing:border-box;margin:0 8px;border-radius:var(--border-radius-element);background-color:var(--color-main-background);filter:drop-shadow(0 1px 5px var(--color-box-shadow))}.header-menu__caret[data-v-d45c5788]{position:absolute;z-index:2001;bottom:0;inset-inline-start:calc(50% - 10px);width:0;height:0;content:" ";pointer-events:none;border:10px solid transparent;border-bottom-color:var(--color-main-background)}.header-menu__content[data-v-d45c5788]{overflow:auto;width:350px;max-width:calc(100vw - 16px);min-height:calc(var(--default-clickable-area) * 1.5);max-height:calc(100vh - var(--header-height) * 2)}.header-menu__content[data-v-d45c5788] .empty-content{margin:12vh 10px}._material-design-icon_1s86g_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._hotkey_1s86g_20{--form-element-label-offset: calc(var(--border-radius-element) + var(--default-grid-baseline));display:flex;flex-direction:row-reverse;align-items:stretch;padding-inline:var(--form-element-label-offset)}._hotkey_1s86g_20:first-child ._hotkey__label_1s86g_27,._hotkey_1s86g_20:first-child ._hotkey__keys_1s86g_28{border-block-start:none}._hotkey__label_1s86g_27,._hotkey__keys_1s86g_28{display:flex;align-items:center;padding-block:calc(2 * var(--default-grid-baseline));border-block-start:1px solid var(--color-border)}._hotkey__label_1s86g_27{flex:1 1 200px}._hotkey__keys_1s86g_28{flex:1 1 auto;flex-wrap:wrap;justify-content:end;row-gap:calc(1 * var(--default-grid-baseline))}._material-design-icon_lf0a1_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._kbd_lf0a1_20{display:inline-flex;align-items:center;justify-content:center;min-width:var(--default-clickable-area);height:var(--default-clickable-area);padding-inline:calc(2 * var(--default-grid-baseline)) calc(2 * var(--default-grid-baseline));border:2px solid var(--color-primary-element-light);border-block-end-width:4px;border-radius:var(--border-radius-element);box-shadow:none;font-family:var(--font-family);line-height:1;white-space:nowrap}._kbd_lf0a1_20+._kbd_lf0a1_20{margin-inline-start:calc(1 * var(--default-grid-baseline))}._hotkeyList_pf97p_2{--form-element-label-offset: calc(var(--border-radius-element) + var(--default-grid-baseline))}._hotkeyList__heading_pf97p_6{font-weight:700;margin-inline:var(--form-element-label-offset)}.material-design-icon[data-v-532f3807]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.list-item__wrapper[data-v-532f3807]{display:flex;position:relative;width:100%;padding:2px 4px}.list-item__wrapper[data-v-532f3807]:first-of-type{padding-block-start:4px}.list-item__wrapper[data-v-532f3807]:last-of-type{padding-block-end:4px}.list-item__wrapper--active .list-item[data-v-532f3807],.list-item__wrapper.active .list-item[data-v-532f3807]{background-color:var(--color-primary-element);color:var(--color-primary-element-text)!important}.list-item__wrapper--active .list-item[data-v-532f3807]:hover,.list-item__wrapper--active .list-item[data-v-532f3807]:focus-within,.list-item__wrapper--active .list-item[data-v-532f3807]:has(:focus-visible),.list-item__wrapper--active .list-item[data-v-532f3807]:has(:active),.list-item__wrapper.active .list-item[data-v-532f3807]:hover,.list-item__wrapper.active .list-item[data-v-532f3807]:focus-within,.list-item__wrapper.active .list-item[data-v-532f3807]:has(:focus-visible),.list-item__wrapper.active .list-item[data-v-532f3807]:has(:active){background-color:var(--color-primary-element-hover)}.list-item__wrapper--active .list-item-content__name[data-v-532f3807],.list-item__wrapper--active .list-item-content__subname[data-v-532f3807],.list-item__wrapper--active .list-item-content__details[data-v-532f3807],.list-item__wrapper--active .list-item-details__details[data-v-532f3807],.list-item__wrapper.active .list-item-content__name[data-v-532f3807],.list-item__wrapper.active .list-item-content__subname[data-v-532f3807],.list-item__wrapper.active .list-item-content__details[data-v-532f3807],.list-item__wrapper.active .list-item-details__details[data-v-532f3807]{color:var(--color-primary-element-text)!important}.list-item__wrapper .list-item-content__name[data-v-532f3807],.list-item__wrapper .list-item-content__subname[data-v-532f3807],.list-item__wrapper .list-item-content__details[data-v-532f3807],.list-item__wrapper .list-item-details__details[data-v-532f3807]{white-space:nowrap;margin-block:0;margin-inline:0 auto;overflow:hidden;text-overflow:ellipsis}.list-item-content__name[data-v-532f3807]{min-width:100px;flex:1 1 10%;font-weight:500}.list-item-content__subname[data-v-532f3807]{flex:1 0;min-width:0;color:var(--color-text-maxcontrast)}.list-item-content__subname--bold[data-v-532f3807]{font-weight:500}.list-item[data-v-532f3807]{--list-item-padding: var(--default-grid-baseline);--list-item-height: 2lh;--list-item-border-radius: var(--border-radius-element, 32px);box-sizing:border-box;display:flex;position:relative;flex:0 0 auto;justify-content:flex-start;padding:var(--list-item-padding);width:100%;border-radius:var(--border-radius-element, 32px);cursor:pointer;transition:background-color var(--animation-quick) ease-in-out;list-style:none}.list-item[data-v-532f3807]:hover,.list-item[data-v-532f3807]:focus-within,.list-item[data-v-532f3807]:has(:active),.list-item[data-v-532f3807]:has(:focus-visible){background-color:var(--color-background-hover)}.list-item[data-v-532f3807]:has(.list-item__anchor:focus-visible){outline:2px solid var(--color-main-text);box-shadow:0 0 0 4px var(--color-main-background)}.list-item--compact[data-v-532f3807]{--list-item-padding: calc(.5 * var(--default-grid-baseline)) var(--default-grid-baseline)}.list-item--compact[data-v-532f3807]:not(:has(.list-item-content__subname)){--list-item-height: var(--default-clickable-area)}.list-item--one-line[data-v-532f3807]{--list-item-height: var(--default-clickable-area);--list-item-border-radius: var(--border-radius-element, calc(var(--default-clickable-area) / 2));--list-item-padding: var(--default-grid-baseline)}.list-item--one-line .list-item-content__main[data-v-532f3807]{display:flex;justify-content:start;gap:12px;min-width:0}.list-item--one-line .list-item-content__details[data-v-532f3807]{flex-direction:row;align-items:center;justify-content:end}.list-item--one-line .list-item-content__name[data-v-532f3807]{align-self:center;max-width:300px}.list-item__anchor[data-v-532f3807]{color:inherit;display:flex;flex:1 0 auto;align-items:center;height:var(--list-item-height);min-width:0}.list-item__anchor[data-v-532f3807]:focus-visible{outline:none}.list-item-content[data-v-532f3807]{display:flex;flex:1 0;justify-content:space-between;padding-inline-start:calc(2 * var(--default-grid-baseline));min-width:0}.list-item-content__main[data-v-532f3807]{flex:1 0;width:0;margin:auto 0}.list-item-content__main--oneline[data-v-532f3807]{display:flex}.list-item-content__details[data-v-532f3807]{display:flex;flex-direction:column;justify-content:end;align-items:end}.list-item-content__actions[data-v-532f3807],.list-item-content__extra-actions[data-v-532f3807]{flex:0 0 auto;align-self:center;justify-content:center;margin-inline-start:var(--default-grid-baseline)}.list-item-content__extra-actions[data-v-532f3807]{display:flex;align-items:center;gap:var(--default-grid-baseline)}.list-item-details__details[data-v-532f3807]{color:var(--color-text-maxcontrast);margin:0 9px!important;font-weight:400}.list-item-details__extra[data-v-532f3807]{margin:2px 4px 0;display:flex;align-items:center}.list-item-details__indicator[data-v-532f3807]{margin:0 5px}.list-item__extra[data-v-532f3807]{margin-top:var(--default-grid-baseline)}.material-design-icon[data-v-60a83836]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.option[data-v-60a83836]{display:flex;align-items:center;width:100%;height:var(--height);cursor:inherit}.option__avatar[data-v-60a83836]{margin-inline-end:var(--margin)}.option__details[data-v-60a83836]{display:flex;flex:1 1;flex-direction:column;justify-content:center;min-width:0}.option__lineone[data-v-60a83836]{color:var(--color-main-text)}.option__linetwo[data-v-60a83836]{color:var(--color-text-maxcontrast)}.option__lineone[data-v-60a83836],.option__linetwo[data-v-60a83836]{overflow:hidden;white-space:nowrap;text-overflow:ellipsis;line-height:1.2}.option__lineone strong[data-v-60a83836],.option__linetwo strong[data-v-60a83836]{font-weight:700}.option--compact .option__lineone[data-v-60a83836]{font-size:14px}.option--compact .option__linetwo[data-v-60a83836]{font-size:11px;line-height:1.5;margin-top:-4px}.option__icon[data-v-60a83836]{width:var(--default-clickable-area);height:var(--default-clickable-area);color:var(--color-text-maxcontrast)}.option__icon.icon[data-v-60a83836]{flex:0 0 var(--default-clickable-area);opacity:.7;background-position:center;background-size:16px}.option__details[data-v-60a83836],.option__lineone[data-v-60a83836],.option__linetwo[data-v-60a83836],.option__icon[data-v-60a83836]{cursor:inherit}.material-design-icon[data-v-38ba4aa1]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.progress-bar[data-v-38ba4aa1]{display:block;height:var(--progress-bar-height);--progress-bar-color: var(--0a7905e8);--progress-bar-height: var(--d7eb5974)}.progress-bar--linear[data-v-38ba4aa1]{width:100%;overflow:hidden;border:0;padding:0;background:var(--color-background-dark);border-radius:calc(var(--progress-bar-height) / 2)}.progress-bar--linear[data-v-38ba4aa1]::-webkit-progress-bar{height:var(--progress-bar-height);background-color:transparent}.progress-bar--linear[data-v-38ba4aa1]::-webkit-progress-value{background:var(--progress-bar-color, var(--gradient-primary-background));border-radius:calc(var(--progress-bar-height) / 2)}.progress-bar--linear[data-v-38ba4aa1]::-moz-progress-bar{background:var(--progress-bar-color, var(--gradient-primary-background));border-radius:calc(var(--progress-bar-height) / 2)}.progress-bar--circular[data-v-38ba4aa1]{width:var(--progress-bar-height);color:var(--progress-bar-color)}.progress-bar--error[data-v-38ba4aa1]{color:var(--color-text-error, var(--color-error))!important}.progress-bar--error[data-v-38ba4aa1]::-moz-progress-bar{background:var(--color-text-error, var(--color-error))!important}.progress-bar--error[data-v-38ba4aa1]::-webkit-progress-value{background:var(--color-text-error, var(--color-error))!important}._material-design-icon_14z4o_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._radioGroup_checkboxRadioContainer_14z4o_20 .checkbox-content{max-width:unset!important}._material-design-icon_1euqq_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._radioGroupButton_1euqq_20{--radio-group-button--border-radius: var(--border-radius-small);--radio-group-button--border-width: 1px;--radio-group-button--color: var(--color-primary-element-light-text);--radio-group-button--background-color: var(--color-primary-element-light);--radio-group-button--background-color-hover: var(--color-primary-element-light-hover);--radio-group-button--padding: 1px;cursor:pointer;color:var(--radio-group-button--color);background-color:var(--radio-group-button--background-color);transition:var(--animation-quick) background-color;border:var(--radio-group-button--border-width) solid var(--radio-group-button--background-color-hover);border-bottom-width:2px;border-radius:var(--radio-group-button--border-radius);display:flex;flex-direction:row;align-items:center;justify-content:center;text-align:center;min-height:var(--default-clickable-area);padding-block:var(--radio-group-button--padding) 0;padding-inline:var(--radio-group-button--padding)}._radioGroupButton_1euqq_20 *{cursor:pointer}._radioGroupButton_1euqq_20:has(._radioGroupButton__label_1euqq_46){padding-inline:calc(var(--radio-group-button--padding) + var(--border-radius-element))}._radioGroupButton_1euqq_20:has(._radioGroupButton__icon_1euqq_49){padding-inline-start:var(--radio-group-button--padding)}._radioGroupButton_1euqq_20:hover{background-color:var(--radio-group-button--background-color-hover)}._radioGroupButton_1euqq_20:focus-within{--radio-group-button--border-width: 2px;--radio-group-button--padding: 0px;border:var(--radio-group-button--border-width) solid var(--color-main-text)!important;outline:calc(var(--default-grid-baseline) / 2) var(--color-main-background)}._radioGroupButton_active_1euqq_62{--radio-group-button--color: var(--color-primary-element-text);--radio-group-button--background-color: var(--color-primary-element);--radio-group-button--background-color-hover: var(--color-primary-element-hover)}._radioGroupButton__label_1euqq_46{font-weight:700}._radioGroupButton__icon_1euqq_49{--radio-group-button--icon-size: calc(var(--default-clickable-area) - 4px);display:flex;align-items:center;justify-content:center;height:100%;width:var(--radio-group-button--icon-size)}._radioGroupButton__icon_1euqq_49 *{--default-clickable-area: var(--radio-group-button--icon-size)}.material-design-icon[data-v-8db55138]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.resource[data-v-8db55138]{display:flex;align-items:center;height:var(--default-clickable-area)}.resource__button[data-v-8db55138]{width:100%!important;justify-content:flex-start!important;padding:0!important}.resource__button[data-v-8db55138] .button-vue__wrapper{justify-content:flex-start!important}.resource__button[data-v-8db55138] .button-vue__wrapper .button-vue__text{font-weight:400!important;margin-inline-start:2px!important}.resource__icon[data-v-8db55138]{width:32px;height:32px;background-color:var(--color-text-maxcontrast);border-radius:50%;display:flex;align-items:center;justify-content:center}.resource__icon img[data-v-8db55138]{width:16px;height:16px;filter:var(--background-invert-if-dark)}.material-design-icon[data-v-a0203ee5]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.team-resources__header[data-v-a0203ee5]{font-weight:700;margin-bottom:6px}.related-team[data-v-a0203ee5]{border-radius:var(--border-radius-container);border:2px solid var(--color-border-dark);margin-bottom:6px}.related-team__open[data-v-a0203ee5]{border-color:var(--color-primary-element)}.related-team__header[data-v-a0203ee5]{padding:6px;padding-inline-end:24px;display:flex;gap:12px}.related-team__name[data-v-a0203ee5]{display:flex;flex-grow:1;align-items:center;gap:12px;padding:6px 12px;font-weight:700;margin:0}.related-team .related-team-provider[data-v-a0203ee5]{padding:6px 12px}.related-team .related-team-provider__name[data-v-a0203ee5]{font-weight:700;margin-bottom:3px}.related-team .related-team-provider__link[data-v-a0203ee5]{display:flex;gap:12px;padding:6px 12px;font-weight:700}.related-team .related-team-resource__link[data-v-a0203ee5]{display:flex;gap:12px;height:var(--default-clickable-area);align-items:center;border-radius:var(--border-radius-element)}.related-team .related-team-resource__link[data-v-a0203ee5]:hover{background-color:var(--color-background-hover)}.related-team .related-team-resource__link[data-v-a0203ee5]:focus{background-color:var(--color-background-hover);outline:2px solid var(--color-primary-element)}.related-team .related-team-resource .resource__icon[data-v-a0203ee5]{width:var(--default-clickable-area);height:var(--default-clickable-area);display:flex;align-items:center;justify-content:center;text-align:center}.related-team .related-team-resource .resource__icon>img[data-v-a0203ee5]{border-radius:var(--border-radius-pill);overflow:hidden;width:32px;height:32px}.material-design-icon[data-v-7a009a6b]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.related-resources__header h5[data-v-7a009a6b]{font-weight:700;margin-bottom:6px}.related-resources__header p[data-v-7a009a6b]{color:var(--color-text-maxcontrast)}.material-design-icon[data-v-ca83b679]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.autocomplete-result[data-v-ca83b679]{display:flex;align-items:center;gap:var(--default-grid-baseline);line-height:1.2;--auto-complete-result-avatar-size: var(--default-clickable-area)}.autocomplete-result__icon[data-v-ca83b679]{position:relative;flex:0 0 var(--default-clickable-area);width:var(--default-clickable-area);min-width:var(--default-clickable-area);height:var(--default-clickable-area);border-radius:var(--default-clickable-area);background-color:var(--color-background-darker);background-repeat:no-repeat;background-position:center;background-size:contain}.autocomplete-result__icon--with-avatar[data-v-ca83b679]{color:inherit;background-size:cover}.autocomplete-result__status[data-v-ca83b679]{--auto-complete-result-status-icon-size: clamp(14px, var(--auto-complete-result-avatar-size) * .4, 18px);--auto-complete-result-status-icon-position: calc(var(--auto-complete-result-avatar-size) / 2 * (1 - 1 / sqrt(2)) - var(--auto-complete-result-status-icon-size) / 2);box-sizing:border-box;position:absolute;inset-inline-end:var(--auto-complete-result-status-icon-position);bottom:var(--auto-complete-result-status-icon-position);height:var(--auto-complete-result-status-icon-size);width:var(--auto-complete-result-status-icon-size);border:2px solid var(--color-main-background);border-radius:50%;background-color:var(--color-main-background);font-size:calc(var(--auto-complete-result-status-icon-size) / 1.2);line-height:1.2;background-repeat:no-repeat;background-size:var(--auto-complete-result-status-icon-size);background-position:center}.autocomplete-result__status--icon[data-v-ca83b679]{border:none;background-color:transparent}.autocomplete-result__content[data-v-ca83b679]{display:flex;flex:1 1 100%;flex-direction:column;justify-content:center;min-width:0}.autocomplete-result__title[data-v-ca83b679],.autocomplete-result__subline[data-v-ca83b679]{white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.autocomplete-result__subline[data-v-ca83b679]{color:var(--color-text-maxcontrast)}.material-design-icon[data-v-faef642b]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.rich-contenteditable[data-v-faef642b]{--contenteditable-block-offset: calc(2 * var(--default-grid-baseline));--contenteditable-inline-start-offset: calc(2 * var(--default-grid-baseline));--contenteditable-inline-end-offset: calc(2 * var(--default-grid-baseline));position:relative;width:auto}.rich-contenteditable__label[data-v-faef642b]{position:absolute;margin-inline:14px;max-width:fit-content;inset-block-start:11px;inset-inline:0;color:var(--color-text-maxcontrast);white-space:nowrap;overflow:hidden;text-overflow:ellipsis;pointer-events:none;transition:height var(--animation-quick),inset-block-start var(--animation-quick),font-size var(--animation-quick),color var(--animation-quick),background-color var(--animation-quick) var(--animation-slow)}.rich-contenteditable__input:focus+.rich-contenteditable__label[data-v-faef642b],.rich-contenteditable__input:not(.rich-contenteditable__input--empty)+.rich-contenteditable__label[data-v-faef642b]{inset-block-start:-10px;line-height:1.5;font-size:13px;font-weight:500;border-radius:var(--default-grid-baseline) var(--default-grid-baseline) 0 0;background-color:var(--color-main-background);padding-inline:5px;margin-inline:9px;transition:height var(--animation-quick),inset-block-start var(--animation-quick),font-size var(--animation-quick),color var(--animation-quick)}.rich-contenteditable__input[data-v-faef642b]{overflow-y:auto;width:auto;margin:0;padding-block:var(--contenteditable-block-offset);padding-inline:var(--contenteditable-inline-start-offset) var(--contenteditable-inline-end-offset);cursor:text;white-space:pre-wrap;overflow-wrap:break-word;color:var(--color-main-text);border:2px solid var(--color-border-maxcontrast);border-radius:var(--border-radius-element);outline:none;background-color:var(--color-main-background);font-family:var(--font-face);font-size:inherit;tab-size:4;min-height:var(--default-clickable-area);max-height:calc(var(--default-clickable-area) * 5.5)}.rich-contenteditable__input--has-label[data-v-faef642b]{margin-top:10px}.rich-contenteditable__input--empty[data-v-faef642b]:focus:before,.rich-contenteditable__input--empty[data-v-faef642b]:not(.rich-contenteditable__input--has-label):before{content:attr(aria-placeholder);color:var(--color-text-maxcontrast);position:absolute;width:calc(100% - var(--contenteditable-inline-start-offset) - var(--contenteditable-inline-end-offset));height:calc(100% - 2 * var(--contenteditable-block-offset));overflow:hidden;white-space:nowrap;text-overflow:ellipsis}.rich-contenteditable__input[contenteditable=false][data-v-faef642b]:not(.rich-contenteditable__input--disabled){cursor:default;background-color:transparent;color:var(--color-main-text);border-color:transparent;opacity:1;border-radius:0}.rich-contenteditable__input--multiline[data-v-faef642b]{min-height:calc(var(--default-clickable-area) * 3);max-height:none}.rich-contenteditable__input--disabled[data-v-faef642b]{opacity:.5;color:var(--color-text-maxcontrast);border:2px solid var(--color-background-darker);border-radius:var(--border-radius-small);background-color:var(--color-background-dark)}.rich-contenteditable__input--overflow[data-v-faef642b],.rich-contenteditable__input--overflow[data-v-faef642b]:hover{border-color:var(--color-border-error, var(--color-error))!important}._material-design-icon_1xkrb_12{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}._tribute-container_1xkrb_20{z-index:9000;overflow:auto;position:absolute;left:-100vw;margin:var(--default-grid-baseline) 0;padding:var(--default-grid-baseline);color:var(--color-text-maxcontrast);border-radius:var(--border-radius-element);background:var(--color-main-background);box-shadow:0 1px 5px var(--color-box-shadow)}._tribute-container_1xkrb_20,._tribute-container_1xkrb_20 *{box-sizing:border-box}._tribute-container_1xkrb_20 ul{display:flex;flex-direction:column;gap:var(--default-grid-baseline)}._tribute-container_1xkrb_20 ._tribute-container__item_1xkrb_41{color:var(--color-text-maxcontrast);border-radius:var(--border-radius-small);padding:var(--default-grid-baseline);cursor:pointer;min-height:var(--clickable-area-small, auto)}._tribute-container_1xkrb_20 ._tribute-container__item_1xkrb_41.highlight{color:var(--color-main-text);background:var(--color-background-hover)}._tribute-container_1xkrb_20 ._tribute-container__item_1xkrb_41.highlight,._tribute-container_1xkrb_20 ._tribute-container__item_1xkrb_41.highlight *{cursor:pointer}._tribute-container_1xkrb_20._tribute-container--focus-visible_1xkrb_55 .highlight._tribute-container__item_1xkrb_41{outline:2px solid var(--color-main-text)!important}._tribute-container-autocomplete_1xkrb_59{min-width:250px;max-width:300px;max-height:calc((var(--default-clickable-area) + 3 * var(--default-grid-baseline)) * 4.5 - 1.5 * var(--default-grid-baseline))}._tribute-container-emoji_1xkrb_65,._tribute-container-link_1xkrb_66{min-width:200px;max-width:200px;max-height:calc((24px + 3 * var(--default-grid-baseline)) * 5.5 - 1.5 * var(--default-grid-baseline))}._tribute-container-emoji_1xkrb_65 ._tribute-item_1xkrb_71,._tribute-container-link_1xkrb_66 ._tribute-item_1xkrb_71{white-space:nowrap;overflow:hidden;text-overflow:ellipsis}._tribute-container-link_1xkrb_66{min-width:200px;max-width:300px}._tribute-container-link_1xkrb_66 ._tribute-item_1xkrb_71{display:flex;align-items:center}._tribute-container-link_1xkrb_66 ._tribute-item__title_1xkrb_86{white-space:nowrap;overflow:hidden;text-overflow:ellipsis}._tribute-container-link_1xkrb_66 ._tribute-item__icon_1xkrb_91{margin:auto 0;width:20px;height:20px;object-fit:contain;padding-inline-end:var(--default-grid-baseline);filter:var(--background-invert-if-dark)}.material-design-icon[data-v-e408867a],.material-design-icon[data-v-90c6aa3b]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.provider-list[data-v-90c6aa3b]{width:100%;min-height:400px;padding:0 16px 16px;display:flex;flex-direction:column}.provider-list--select[data-v-90c6aa3b]{width:100%}.provider-list--select .provider[data-v-90c6aa3b]{display:flex;align-items:center;height:28px;overflow:hidden}.provider-list--select .provider .link-icon[data-v-90c6aa3b]{margin-inline-end:8px}.provider-list--select .provider .provider-icon[data-v-90c6aa3b]{width:20px;height:20px;object-fit:contain;margin-inline-end:8px;filter:var(--background-invert-if-dark)}.provider-list--select .provider .option-text[data-v-90c6aa3b]{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.material-design-icon[data-v-8ce33442]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.widget-custom[data-v-8ce33442]{width:100%;margin:auto;margin-bottom:calc(var(--default-grid-baseline, 4px) * 3);margin-top:calc(var(--default-grid-baseline, 4px) * 3);overflow:hidden;border:2px solid var(--color-border);border-radius:var(--border-radius-container);background-color:transparent;display:flex}.widget-custom.full-width[data-v-8ce33442]{width:var(--widget-full-width, 100%)!important;inset-inline-start:calc((var(--widget-full-width, 100%) - 100%) / 2 * -1);position:relative}.widget-access[data-v-8ce33442]{width:100%;margin:auto;margin-bottom:calc(var(--default-grid-baseline, 4px) * 3);margin-top:calc(var(--default-grid-baseline, 4px) * 3);overflow:hidden;border:2px solid var(--color-border);border-radius:var(--border-radius-container);background-color:transparent;display:flex;padding:calc(var(--default-grid-baseline, 4px) * 3)}.widget-default[data-v-8ce33442]{width:100%;margin:auto;margin-bottom:calc(var(--default-grid-baseline, 4px) * 3);margin-top:calc(var(--default-grid-baseline, 4px) * 3);overflow:hidden;border:2px solid var(--color-border);border-radius:var(--border-radius-container);background-color:transparent;display:flex}.widget-default--compact[data-v-8ce33442]{flex-direction:column}.widget-default--compact .widget-default--image[data-v-8ce33442]{width:100%;height:150px}.widget-default--compact .widget-default--details[data-v-8ce33442]{width:100%;padding-top:calc(var(--default-grid-baseline, 4px) * 2);padding-bottom:calc(var(--default-grid-baseline, 4px) * 2)}.widget-default--compact .widget-default--description[data-v-8ce33442]{display:none}.widget-default--image[data-v-8ce33442]{width:40%;background-position:center;background-size:cover;background-repeat:no-repeat}.widget-default--name[data-v-8ce33442]{overflow:hidden;text-overflow:ellipsis;white-space:nowrap;font-weight:700}.widget-default--details[data-v-8ce33442]{padding:calc(var(--default-grid-baseline, 4px) * 3);width:60%}.widget-default--details p[data-v-8ce33442]{margin:0;padding:0}.widget-default--description[data-v-8ce33442]{overflow:hidden;text-overflow:ellipsis;display:-webkit-box;-webkit-line-clamp:3;line-clamp:3;-webkit-box-orient:vertical}.widget-default--link[data-v-8ce33442]{color:var(--color-text-maxcontrast);overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.toggle-interactive[data-v-8ce33442]{position:relative}.toggle-interactive .toggle-interactive--button[data-v-8ce33442]{position:absolute;bottom:var(--default-grid-baseline);inset-inline-end:var(--default-grid-baseline);z-index:10000}.material-design-icon[data-v-a0658f2a]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.raw-link[data-v-a0658f2a]{width:100%;min-height:350px;display:flex;flex-direction:column;overflow-y:auto;padding:0 16px 16px}.raw-link .input-wrapper[data-v-a0658f2a]{width:100%}.raw-link .reference-widget[data-v-a0658f2a]{display:flex}.raw-link--empty-content .provider-icon[data-v-a0658f2a]{width:150px;height:150px;object-fit:contain;filter:var(--background-invert-if-dark)}.raw-link--input[data-v-a0658f2a]{width:99%}.material-design-icon[data-v-059edcfb]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.result[data-v-059edcfb]{display:flex;align-items:center;height:var(--default-clickable-area);overflow:hidden}.result--icon-class[data-v-059edcfb],.result--image[data-v-059edcfb]{width:40px;min-width:40px;height:40px;object-fit:contain}.result--icon-class.rounded[data-v-059edcfb],.result--image.rounded[data-v-059edcfb]{border-radius:50%}.result--content[data-v-059edcfb]{display:flex;flex-direction:column;padding-inline-start:10px;overflow:hidden}.result--content--name[data-v-059edcfb],.result--content--subline[data-v-059edcfb]{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.material-design-icon[data-v-e8abf1d4]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.smart-picker-search[data-v-e8abf1d4]{width:100%;display:flex;flex-direction:column;padding:0 16px 16px}.smart-picker-search.with-empty-content[data-v-e8abf1d4]{min-height:400px}.smart-picker-search .provider-icon[data-v-e8abf1d4]{width:150px;height:150px;object-fit:contain;filter:var(--background-invert-if-dark)}.smart-picker-search--select[data-v-e8abf1d4],.smart-picker-search--select .search-result[data-v-e8abf1d4]{width:100%}.smart-picker-search--select .group-name-icon[data-v-e8abf1d4],.smart-picker-search--select .option-simple-icon[data-v-e8abf1d4]{width:20px;height:20px;margin:0 20px 0 10px}.smart-picker-search--select .custom-option[data-v-e8abf1d4]{height:var(--default-clickable-area);display:flex;align-items:center;overflow:hidden}.smart-picker-search--select .option-text[data-v-e8abf1d4]{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.material-design-icon[data-v-b193005a]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.reference-picker[data-v-b193005a],.reference-picker .custom-element-wrapper[data-v-b193005a],.reference-picker .custom-element-wrapper .custom-element[data-v-b193005a]{display:flex;overflow-y:auto;width:100%}.material-design-icon[data-v-15018516]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.reference-picker-modal[data-v-15018516] .modal-container{display:flex!important}.reference-picker-modal--content[data-v-15018516]{width:100%;display:flex;flex-direction:column;align-items:center;justify-content:center;overflow-y:auto}.reference-picker-modal--content .close-button[data-v-15018516],.reference-picker-modal--content .back-button[data-v-15018516]{position:absolute;top:4px}.reference-picker-modal--content .back-button[data-v-15018516]{inset-inline-start:4px}.reference-picker-modal--content .close-button[data-v-15018516]{inset-inline-end:4px}.reference-picker-modal--content>h2[data-v-15018516]{display:flex;margin:12px 0 20px}.reference-picker-modal--content>h2 .icon[data-v-15018516]{margin-inline-end:8px}.material-design-icon[data-v-ddd65c9e]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.widgets--list[data-v-ddd65c9e]{width:100%;min-height:var(--default-clickable-area)}.material-design-icon[data-v-a47e4ba7]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.rich-text--wrapper[data-v-a47e4ba7]{overflow-wrap:break-word;line-height:1.5}.rich-text--wrapper .rich-text--fallback[data-v-a47e4ba7],.rich-text--wrapper .rich-text-component[data-v-a47e4ba7]{display:inline}.rich-text--wrapper .rich-text--external-link[data-v-a47e4ba7]{text-decoration:underline}.rich-text--wrapper .rich-text--external-link[data-v-a47e4ba7]:after{content:" ↗"}.rich-text--wrapper-markdown[data-v-a47e4ba7]{tab-size:4}.rich-text--wrapper-markdown[data-v-a47e4ba7]>:first-child,.rich-text--wrapper-markdown div[data-v-a47e4ba7]>:first-child,.rich-text--wrapper-markdown blockquote[data-v-a47e4ba7]>:first-child{margin-top:0!important}.rich-text--wrapper-markdown[data-v-a47e4ba7]>:last-child,.rich-text--wrapper-markdown[data-v-a47e4ba7]>*:has(+.rich-text--reference-widget),.rich-text--wrapper-markdown div[data-v-a47e4ba7]>:last-child,.rich-text--wrapper-markdown blockquote[data-v-a47e4ba7]>:last-child{margin-block-end:0!important}.rich-text--wrapper-markdown blockquote[data-v-a47e4ba7]{padding-inline-start:13px;border-inline-start:2px solid var(--color-border-dark);color:var(--color-text-maxcontrast)}.rich-text--wrapper-markdown h1[data-v-a47e4ba7],.rich-text--wrapper-markdown h2[data-v-a47e4ba7],.rich-text--wrapper-markdown h3[data-v-a47e4ba7],.rich-text--wrapper-markdown h4[data-v-a47e4ba7],.rich-text--wrapper-markdown h5[data-v-a47e4ba7],.rich-text--wrapper-markdown h6[data-v-a47e4ba7],.rich-text--wrapper-markdown p[data-v-a47e4ba7],.rich-text--wrapper-markdown ul[data-v-a47e4ba7],.rich-text--wrapper-markdown ol[data-v-a47e4ba7],.rich-text--wrapper-markdown blockquote[data-v-a47e4ba7],.rich-text--wrapper-markdown pre[data-v-a47e4ba7]{margin-top:0;margin-block-end:1em}.rich-text--wrapper-markdown h1[data-v-a47e4ba7],.rich-text--wrapper-markdown h2[data-v-a47e4ba7],.rich-text--wrapper-markdown h3[data-v-a47e4ba7],.rich-text--wrapper-markdown h4[data-v-a47e4ba7],.rich-text--wrapper-markdown h5[data-v-a47e4ba7],.rich-text--wrapper-markdown h6[data-v-a47e4ba7]{font-weight:700}.rich-text--wrapper-markdown h4[data-v-a47e4ba7]{font-size:20px}.rich-text--wrapper-markdown h5[data-v-a47e4ba7]{font-size:18px}.rich-text--wrapper-markdown h6[data-v-a47e4ba7]{font-size:15px}.rich-text--wrapper-markdown ul[data-v-a47e4ba7],.rich-text--wrapper-markdown ol[data-v-a47e4ba7]{padding-inline-start:4ch}.rich-text--wrapper-markdown ul[data-v-a47e4ba7]{list-style-type:disc}.rich-text--wrapper-markdown ul.contains-task-list[data-v-a47e4ba7]{list-style-type:none;padding:0}.rich-text--wrapper-markdown li.task-list-item>ul[data-v-a47e4ba7],.rich-text--wrapper-markdown li.task-list-item>ol[data-v-a47e4ba7],.rich-text--wrapper-markdown li.task-list-item>li[data-v-a47e4ba7],.rich-text--wrapper-markdown li.task-list-item>blockquote[data-v-a47e4ba7],.rich-text--wrapper-markdown li.task-list-item>pre[data-v-a47e4ba7]{margin-inline-start:15px;margin-block-end:0}.rich-text--wrapper-markdown pre[data-v-a47e4ba7]{direction:ltr}.rich-text--wrapper-markdown table[data-v-a47e4ba7]{border-collapse:collapse;border:2px solid var(--color-border-maxcontrast)}.rich-text--wrapper-markdown table th[data-v-a47e4ba7],.rich-text--wrapper-markdown table td[data-v-a47e4ba7]{padding:var(--default-grid-baseline);border:1px solid var(--color-border-maxcontrast)}.rich-text--wrapper-markdown table th[data-v-a47e4ba7]:first-child,.rich-text--wrapper-markdown table td[data-v-a47e4ba7]:first-child{border-inline-start:0}.rich-text--wrapper-markdown table th[data-v-a47e4ba7]:last-child,.rich-text--wrapper-markdown table td[data-v-a47e4ba7]:last-child{border-inline-end:0}.rich-text--wrapper-markdown table tr:first-child th[data-v-a47e4ba7]{border-top:0}.rich-text--wrapper-markdown table tr:last-child td[data-v-a47e4ba7]{border-block-end:0}.rich-text--wrapper-markdown .rich-text__code-block[data-v-a47e4ba7]:has(.hljs){color:var(--hljs-color);background:var(--hljs-background-color)}.rich-text--wrapper-markdown .hljs-doctag[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-keyword[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-meta .hljs-keyword[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-template-tag[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-template-variable[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-type[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-variable.language_[data-v-a47e4ba7]{color:var(--hljs-syntax-keyword-color)}.rich-text--wrapper-markdown .hljs-title[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-title.class_[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-title.class_.inherited__[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-title.function_[data-v-a47e4ba7]{color:var(--hljs-syntax-entity-color)}.rich-text--wrapper-markdown .hljs-attr[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-attribute[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-literal[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-meta[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-number[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-operator[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-variable[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-selector-attr[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-selector-class[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-selector-id[data-v-a47e4ba7]{color:var(--hljs-syntax-constant-color)}.rich-text--wrapper-markdown .hljs-regexp[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-string[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-meta .hljs-string[data-v-a47e4ba7]{color:var(--hljs-syntax-string-color)}.rich-text--wrapper-markdown .hljs-built_in[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-symbol[data-v-a47e4ba7]{color:var(--hljs-syntax-variable-color)}.rich-text--wrapper-markdown .hljs-comment[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-code[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-formula[data-v-a47e4ba7]{color:var(--hljs-syntax-comment-color)}.rich-text--wrapper-markdown .hljs-name[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-quote[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-selector-tag[data-v-a47e4ba7],.rich-text--wrapper-markdown .hljs-selector-pseudo[data-v-a47e4ba7]{color:var(--hljs-syntax-entity-tag-color)}.rich-text--wrapper-markdown .hljs-subst[data-v-a47e4ba7]{color:var(--hljs-syntax-storage-modifier-import-color)}.rich-text--wrapper-markdown .hljs-section[data-v-a47e4ba7]{color:var(--hljs-syntax-markup-heading-color);font-weight:700}.rich-text--wrapper-markdown .hljs-bullet[data-v-a47e4ba7]{color:var(--hljs-syntax-markup-list-color)}.rich-text--wrapper-markdown .hljs-emphasis[data-v-a47e4ba7]{color:var(--hljs-syntax-markup-italic-color);font-style:italic}.rich-text--wrapper-markdown .hljs-strong[data-v-a47e4ba7]{color:var(--hljs-syntax-markup-bold-color);font-weight:700}.rich-text--wrapper-markdown .hljs-addition[data-v-a47e4ba7]{color:var(--hljs-syntax-markup-inserted-color);background-color:var(--hljs-syntax-markup-inserted-background-color)}.rich-text--wrapper-markdown .hljs-deletion[data-v-a47e4ba7]{color:var(--hljs-syntax-markup-deleted-color);background-color:var(--hljs-syntax-markup-deleted-background-color)}a[data-v-a47e4ba7]:not(.rich-text--component){text-decoration:underline}@media (prefers-color-scheme: light){.rich-text--wrapper-markdown[data-v-a47e4ba7]{--hljs-color: var(--color-main-text, #24292e);--hljs-background-color: var(--color-background-dark, #ffffff);--hljs-syntax-keyword-color: #d73a49;--hljs-syntax-entity-color: #6f42c1;--hljs-syntax-constant-color: #005cc5;--hljs-syntax-string-color: #032f62;--hljs-syntax-variable-color: #e36209;--hljs-syntax-comment-color: #6a737d;--hljs-syntax-entity-tag-color: #22863a;--hljs-syntax-storage-modifier-import-color: #24292e;--hljs-syntax-markup-heading-color: #005cc5;--hljs-syntax-markup-list-color: #735c0f;--hljs-syntax-markup-italic-color: #24292e;--hljs-syntax-markup-bold-color: #24292e;--hljs-syntax-markup-inserted-color: #22863a;--hljs-syntax-markup-inserted-background-color: #f0fff4;--hljs-syntax-markup-deleted-color: #b31d28;--hljs-syntax-markup-deleted-background-color: #ffeef0}[data-theme-dark] .rich-text--wrapper-markdown[data-v-a47e4ba7]{--hljs-color: var(--color-main-text, #c9d1d9);--hljs-background-color: var(--color-background-dark, #0d1117);--hljs-syntax-keyword-color: #ff7b72;--hljs-syntax-entity-color: #d2a8ff;--hljs-syntax-constant-color: #79c0ff;--hljs-syntax-string-color: #a5d6ff;--hljs-syntax-variable-color: #ffa657;--hljs-syntax-comment-color: #8b949e;--hljs-syntax-entity-tag-color: #7ee787;--hljs-syntax-storage-modifier-import-color: #c9d1d9;--hljs-syntax-markup-heading-color: #1f6feb;--hljs-syntax-markup-list-color: #f2cc60;--hljs-syntax-markup-italic-color: #c9d1d9;--hljs-syntax-markup-bold-color: #c9d1d9;--hljs-syntax-markup-inserted-color: #aff5b4;--hljs-syntax-markup-inserted-background-color: #033a16;--hljs-syntax-markup-deleted-color: #ffdcd7;--hljs-syntax-markup-deleted-background-color: #67060c}}@media (prefers-color-scheme: dark){.rich-text--wrapper-markdown[data-v-a47e4ba7]{--hljs-color: var(--color-main-text, #c9d1d9);--hljs-background-color: var(--color-background-dark, #0d1117);--hljs-syntax-keyword-color: #ff7b72;--hljs-syntax-entity-color: #d2a8ff;--hljs-syntax-constant-color: #79c0ff;--hljs-syntax-string-color: #a5d6ff;--hljs-syntax-variable-color: #ffa657;--hljs-syntax-comment-color: #8b949e;--hljs-syntax-entity-tag-color: #7ee787;--hljs-syntax-storage-modifier-import-color: #c9d1d9;--hljs-syntax-markup-heading-color: #1f6feb;--hljs-syntax-markup-list-color: #f2cc60;--hljs-syntax-markup-italic-color: #c9d1d9;--hljs-syntax-markup-bold-color: #c9d1d9;--hljs-syntax-markup-inserted-color: #aff5b4;--hljs-syntax-markup-inserted-background-color: #033a16;--hljs-syntax-markup-deleted-color: #ffdcd7;--hljs-syntax-markup-deleted-background-color: #67060c}[data-theme-light] .rich-text--wrapper-markdown[data-v-a47e4ba7]{--hljs-color: var(--color-main-text, #24292e);--hljs-background-color: var(--color-background-dark, #ffffff);--hljs-syntax-keyword-color: #d73a49;--hljs-syntax-entity-color: #6f42c1;--hljs-syntax-constant-color: #005cc5;--hljs-syntax-string-color: #032f62;--hljs-syntax-variable-color: #e36209;--hljs-syntax-comment-color: #6a737d;--hljs-syntax-entity-tag-color: #22863a;--hljs-syntax-storage-modifier-import-color: #24292e;--hljs-syntax-markup-heading-color: #005cc5;--hljs-syntax-markup-list-color: #735c0f;--hljs-syntax-markup-italic-color: #24292e;--hljs-syntax-markup-bold-color: #24292e;--hljs-syntax-markup-inserted-color: #22863a;--hljs-syntax-markup-inserted-background-color: #f0fff4;--hljs-syntax-markup-deleted-color: #b31d28;--hljs-syntax-markup-deleted-background-color: #ffeef0}}.rich-text__code-block[data-v-a47e4ba7]{position:relative;padding-inline-end:calc(var(--clickable-area-small) + var(--default-grid-baseline))}.rich-text__code-block pre[data-v-a47e4ba7]{width:100%;overflow-x:auto}.rich-text__code-block .rich-text__code-block-button[data-v-a47e4ba7]{position:absolute;top:var(--default-grid-baseline);inset-inline-end:var(--default-grid-baseline);opacity:0}.rich-text__code-block:hover .rich-text__code-block-button[data-v-a47e4ba7],.rich-text__code-block:focus-within .rich-text__code-block-button[data-v-a47e4ba7],.rich-text__code-block .rich-text__code-block-button[data-v-a47e4ba7]:focus{opacity:1}.nc-select-users[data-v-4fbb6472] .vs__selected{padding-inline:0 5px!important}.material-design-icon[data-v-9cedb949]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.settings-section[data-v-9cedb949]{display:block;padding:0 0 calc(var(--default-grid-baseline) * 5) 0;margin:calc(var(--default-grid-baseline) * 7);width:min(900px,100% - var(--default-grid-baseline) * 7 * 2)}.settings-section[data-v-9cedb949]:not(:last-child){border-bottom:1px solid var(--color-border)}.settings-section__name[data-v-9cedb949]{display:inline-flex;align-items:center;justify-content:center;max-width:900px;margin-top:0}.settings-section__info[data-v-9cedb949]{display:flex;align-items:center;justify-content:center;width:var(--default-clickable-area);height:var(--default-clickable-area);margin:calc((var(--default-clickable-area) - 16px) / 2 * -1);margin-inline-start:0;color:var(--color-text-maxcontrast)}.settings-section__info[data-v-9cedb949]:hover,.settings-section__info[data-v-9cedb949]:focus,.settings-section__info[data-v-9cedb949]:active{color:var(--color-main-text)}.settings-section__desc[data-v-9cedb949]{margin-top:-.2em;margin-bottom:1em;color:var(--color-text-maxcontrast);max-width:900px}.material-design-icon[data-v-21e2bf0c]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.select-group-error[data-v-21e2bf0c]{color:var(--color-text-error, var(--color-error));font-size:13px;padding-inline-start:var(--border-radius-element)}.material-design-icon[data-v-87d290b5]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.textarea[data-v-87d290b5]{--input-border-color: var(--color-border-maxcontrast);--input-border-width-offset: calc(var(--border-width-input-focused, 2px) - var(--border-width-input, 2px));position:relative;width:100%;border-radius:var(--border-radius-element);margin-block-start:6px;resize:vertical}.textarea--disabled[data-v-87d290b5]{opacity:.7;filter:saturate(.7)}.textarea__main-wrapper[data-v-87d290b5]{height:calc(var(--default-clickable-area) * 2);padding:var(--border-width-input, 2px);position:relative}.textarea__main-wrapper[data-v-87d290b5]:not(:has([disabled])):has(textarea:focus),.textarea__main-wrapper[data-v-87d290b5]:not(:has([disabled])):has(textarea:active){padding:0}.textarea__input[data-v-87d290b5]{margin:0;padding-block:calc(10px + var(--input-border-width-offset));padding-inline:calc(12px - var(--border-width-input, 2px) + var(--input-border-width-offset));width:100%;font-size:var(--default-font-size);text-overflow:ellipsis;cursor:pointer;background-color:var(--color-main-background);color:var(--color-main-text);border:none;border-radius:var(--border-radius-element);box-shadow:0 -1px var(--input-border-color),0 0 0 1px color-mix(in srgb,var(--input-border-color),65% transparent)}.textarea__input[data-v-87d290b5]:hover:not([disabled]){box-shadow:0 0 0 1px var(--input-border-color)}.textarea__input[data-v-87d290b5]:active:not([disabled]),.textarea__input[data-v-87d290b5]:focus:not([disabled]){--input-border-width-offset: 0px;--input-border-color: var(--color-main-text);border:var(--border-width-input-focused, 2px) solid var(--input-border-color);box-shadow:0 0 0 2px var(--color-main-background)!important}.textarea__input[data-v-87d290b5]:not(:focus,.textarea__input--label-outside)::placeholder{opacity:0}.textarea__input[data-v-87d290b5]:focus{cursor:text}.textarea__input[data-v-87d290b5]:disabled{cursor:default}.textarea__input[data-v-87d290b5]:focus-visible{box-shadow:unset!important}.textarea__input--success[data-v-87d290b5]{--input-border-color: var(--color-border-success, var(--color-success)) !important}.textarea__input--success[data-v-87d290b5]:focus-visible{box-shadow:#f8fafc 0 0 0 2px,var(--color-primary-element) 0 0 0 4px,#0000000d 0 1px 2px}.textarea__input--error[data-v-87d290b5]{--input-border-color: var(--color-border-error, var(--color-error)) !important}.textarea__input--error[data-v-87d290b5]:focus-visible{box-shadow:#f8fafc 0 0 0 2px,var(--color-primary-element) 0 0 0 4px,#0000000d 0 1px 2px}.textarea__label[data-v-87d290b5]{position:absolute;margin-inline:12px 0;max-width:fit-content;inset-block-start:11px;inset-inline:0;color:var(--color-text-maxcontrast);white-space:nowrap;overflow:hidden;text-overflow:ellipsis;pointer-events:none;transition:height var(--animation-quick),inset-block-start var(--animation-quick),font-size var(--animation-quick),color var(--animation-quick),background-color var(--animation-quick) var(--animation-slow)}.textarea__input:focus+.textarea__label[data-v-87d290b5],.textarea__input:not(:placeholder-shown)+.textarea__label[data-v-87d290b5]{inset-block-start:-10px;line-height:1.5;font-size:13px;font-weight:500;color:var(--color-main-text);background-color:var(--color-main-background);padding-inline:4px;margin-inline-start:8px;transition:height var(--animation-quick),inset-block-start var(--animation-quick),font-size var(--animation-quick),color var(--animation-quick)}.textarea__helper-text-message[data-v-87d290b5]{padding-block:4px;display:flex;align-items:center}.textarea__helper-text-message__icon[data-v-87d290b5]{margin-inline-end:8px}.textarea__helper-text-message--error[data-v-87d290b5]{color:var(--color-error-text)}.textarea__helper-text-message--success[data-v-87d290b5]{color:var(--color-success-text)}.textarea--legacy .textarea__input[data-v-87d290b5]{box-shadow:0 0 0 1px var(--input-border-color)}.textarea--legacy .textarea__main-wrapper[data-v-87d290b5]:hover:not(:has([disabled])){padding:0}.textarea--legacy .textarea__main-wrapper:hover:not(:has([disabled])) .textarea__input[data-v-87d290b5]{--input-border-color: var(--color-main-text);--input-border-width-offset: 0px;border:var(--border-width-input-focused, 2px) solid var(--input-border-color);box-shadow:0 0 0 2px var(--color-main-background)!important}.material-design-icon[data-v-37bde6b7]{display:flex;align-self:center;justify-self:center;align-items:center;justify-content:center}.user-bubble__wrapper[data-v-37bde6b7]{display:inline-block;vertical-align:middle;min-width:0;max-width:100%}.user-bubble__content[data-v-37bde6b7]{display:inline-flex;max-width:100%;background-color:var(--color-background-dark)}.user-bubble__content--primary[data-v-37bde6b7]{color:var(--color-primary-element-text);background-color:var(--color-primary-element)}.user-bubble__content[data-v-37bde6b7]>:last-child{padding-inline-end:8px}.user-bubble__avatar[data-v-37bde6b7]{align-self:center}.user-bubble__name[data-v-37bde6b7]{overflow:hidden;white-space:nowrap;text-overflow:ellipsis}.user-bubble__name[data-v-37bde6b7],.user-bubble__secondary[data-v-37bde6b7]{padding-block:0;padding-inline:4px 0}div[data-v-d275e202]{display:flex;flex-wrap:wrap;gap:12px;padding-inline-end:12px}.info-note[data-v-d275e202]{justify-self:stretch}fieldset[data-v-c4dfb39e],fieldset[data-v-a03d12ca],fieldset[data-v-ffa2e576]{padding:6px}.trace__position[data-v-fc2bb3ab]{display:flex}.trace__file[data-v-fc2bb3ab]{font-style:italic}.trace__line[data-v-fc2bb3ab]:before{content:"-";padding-inline:6px}.trace__line[data-v-fc2bb3ab]:after{content:":"}.stack-trace li[data-v-2dba9c9f]:not(:last-child){margin-block-end:.5rem}.exception[data-v-a89fd782]{display:flex;align-items:start}.exception__title[data-v-a89fd782]{font-weight:700;white-space:normal}.exception__message[data-v-a89fd782]{margin-inline-start:6px;overflow:hidden;text-overflow:ellipsis}.exception__trace[data-v-a89fd782]{margin-inline-start:2em}/*! + Theme: Material Darker + Author: Nate Peterson + License: ~ MIT (or more permissive) [via base16-schemes-source] + Maintainer: @highlightjs/core-team + Version: 2021.09.0 +*/pre code.hljs{display:block;overflow-x:auto;padding:1em}code.hljs{padding:3px 5px}.hljs{color:#eff;background:#212121}.hljs::selection,.hljs ::selection{background-color:#353535;color:#eff}.hljs-comment{color:#4a4a4a}.hljs-tag{color:#b2ccd6}.hljs-subst,.hljs-punctuation,.hljs-operator{color:#eff}.hljs-operator{opacity:.7}.hljs-bullet,.hljs-variable,.hljs-template-variable,.hljs-selector-tag,.hljs-name,.hljs-deletion{color:#f07178}.hljs-symbol,.hljs-number,.hljs-link,.hljs-attr,.hljs-variable.constant_,.hljs-literal{color:#f78c6c}.hljs-title,.hljs-class .hljs-title,.hljs-title.class_{color:#ffcb6b}.hljs-strong{font-weight:700;color:#ffcb6b}.hljs-code,.hljs-addition,.hljs-title.class_.inherited__,.hljs-string{color:#c3e88d}.hljs-built_in,.hljs-doctag,.hljs-quote,.hljs-keyword.hljs-atrule,.hljs-regexp{color:#89ddff}.hljs-function .hljs-title,.hljs-attribute,.ruby .hljs-property,.hljs-title.function_,.hljs-section{color:#82aaff}.hljs-type,.hljs-template-tag,.diff .hljs-meta,.hljs-keyword{color:#c792ea}.hljs-emphasis{color:#c792ea;font-style:italic}.hljs-meta,.hljs-meta .hljs-keyword,.hljs-meta .hljs-string{color:#ff5370}.hljs-meta .hljs-keyword,.hljs-meta-keyword{font-weight:700}.log-details[data-v-49d1689c]{padding:12px}.log-details__raw[data-v-49d1689c],.log-details__exception[data-v-49d1689c]{padding-block-start:12px}.log-details__info[data-v-49d1689c]{display:flex;justify-content:space-between;border-block-end:4px solid;padding-inline-end:50px;padding-block:13px 4px;margin-block-end:13px}.log-details__info dt[data-v-49d1689c],.log-details__info dd[data-v-49d1689c]{padding:0}.log-details__info dt[data-v-49d1689c]{font-weight:700}.log-details__info dt[data-v-49d1689c]:after{content:":"}.log-details__info--debug[data-v-49d1689c]{border-block-end-color:var(--color-border-maxcontrast)}.log-details__info--info[data-v-49d1689c]{border-block-end-color:var(--color-element-info, var(--color-info))}.log-details__info--warning[data-v-49d1689c]{border-block-end-color:var(--color-element-warning, var(--color-warning))}.log-details__info--error[data-v-49d1689c],.log-details__info--fatal[data-v-49d1689c]{border-block-end-color:var(--color-element-error, var(--color-error))}.log-details__actions[data-v-49d1689c]{display:flex;flex-wrap:wrap;align-items:center;justify-content:end;gap:9px;margin-block:9px}.log-details hr[data-v-49d1689c]{color:var(--color-border-dark)}.hljs[data-v-49d1689c]{border-radius:var(--border-radius-large)}@media only screen and (max-width: 399px){.log-details__info[data-v-49d1689c]{display:block}.log-details dd[data-v-49d1689c]{margin-inline-start:12px}}.log-table-header__wrapper[data-v-56a91c00]{display:flex;align-items:center;justify-content:space-between}.log-table-header__text[data-v-56a91c00]{padding-inline-start:12px}th[data-v-56a91c00] .button-vue__wrapper{justify-content:left}th[data-v-56a91c00]>*{padding-inline:6px 2px}td[data-v-49208122]{display:block;overflow:hidden;text-overflow:ellipsis;min-height:42px;padding-block-start:4px;padding-inline:18px 0}.row-message__container[data-v-49208122]{display:flex;justify-content:space-between;justify-items:start}.row-message__container--expanded[data-v-49208122]{margin-block-end:.5rem}.row-message__text[data-v-49208122]{display:flex;flex-direction:column;width:calc(100% - 48px)}.row-message__text_message[data-v-49208122]{overflow:hidden;text-overflow:ellipsis;width:100%}.row-message__action[data-v-49208122]{padding:2px}tr[data-v-49208122]{display:flex}tr.expanded[data-v-49208122],tr.expanded .row-message--text[data-v-49208122]{white-space:normal}.logging-level[data-v-49208122]{border-inline-start:4px solid}.logging-level--debug[data-v-49208122]{border-inline-start-color:var(--color-border-maxcontrast)}.logging-level--info[data-v-49208122]{border-inline-start-color:var(--color-element-info, var(--color-info))}.logging-level--warning[data-v-49208122]{border-inline-start-color:var(--color-element-warning, var(--color-warning))}.logging-level--error[data-v-49208122],.logging-level--fatal[data-v-49208122]{border-inline-start-color:var(--color-element-error, var(--color-error))}.log-table[data-v-87d89a52]{width:100%;height:100%;overflow:hidden}.log-table__table[data-v-87d89a52]{width:calc(100% - 12px);margin-inline:6px;table-layout:fixed;display:block;overflow:auto;height:100%;will-change:scroll-position}.log-table__load-more[data-v-87d89a52]{display:flex}.log-table__load-more[data-v-87d89a52] td{flex-basis:100%;text-align:center;padding-block:4px}.log-table__header[data-v-87d89a52],.log-table__body[data-v-87d89a52],.log-table__footer[data-v-87d89a52]{display:flex;flex-direction:column;width:100%}.log-table__header[data-v-87d89a52] tr,.log-table__body[data-v-87d89a52] tr,.log-table__footer[data-v-87d89a52] tr{display:flex}.log-table__header[data-v-87d89a52] th,.log-table__header[data-v-87d89a52] td,.log-table__body[data-v-87d89a52] th,.log-table__body[data-v-87d89a52] td,.log-table__footer[data-v-87d89a52] th,.log-table__footer[data-v-87d89a52] td{flex-shrink:0}.log-table__header[data-v-87d89a52] th:nth-child(1),.log-table__header[data-v-87d89a52] td:nth-child(1),.log-table__body[data-v-87d89a52] th:nth-child(1),.log-table__body[data-v-87d89a52] td:nth-child(1),.log-table__footer[data-v-87d89a52] th:nth-child(1),.log-table__footer[data-v-87d89a52] td:nth-child(1){width:108px}.log-table__header[data-v-87d89a52] th:nth-child(2),.log-table__header[data-v-87d89a52] td:nth-child(2),.log-table__body[data-v-87d89a52] th:nth-child(2),.log-table__body[data-v-87d89a52] td:nth-child(2),.log-table__footer[data-v-87d89a52] th:nth-child(2),.log-table__footer[data-v-87d89a52] td:nth-child(2){width:168px}.log-table__header[data-v-87d89a52] th:nth-child(3),.log-table__header[data-v-87d89a52] td:nth-child(3),.log-table__body[data-v-87d89a52] th:nth-child(3),.log-table__body[data-v-87d89a52] td:nth-child(3),.log-table__footer[data-v-87d89a52] th:nth-child(3),.log-table__footer[data-v-87d89a52] td:nth-child(3){width:418px;flex-grow:1}.log-table__header[data-v-87d89a52] th:nth-child(4),.log-table__header[data-v-87d89a52] td:nth-child(4),.log-table__body[data-v-87d89a52] th:nth-child(4),.log-table__body[data-v-87d89a52] td:nth-child(4),.log-table__footer[data-v-87d89a52] th:nth-child(4),.log-table__footer[data-v-87d89a52] td:nth-child(4){width:25ch}.log-table__header[data-v-87d89a52] th:last-child,.log-table__header[data-v-87d89a52] td:last-child,.log-table__body[data-v-87d89a52] th:last-child,.log-table__body[data-v-87d89a52] td:last-child,.log-table__footer[data-v-87d89a52] th:last-child,.log-table__footer[data-v-87d89a52] td:last-child{width:62px}.log-table__header[data-v-87d89a52]{position:sticky;top:0;z-index:1;min-height:44px}.log-table__header[data-v-87d89a52] th{position:sticky;top:0;z-index:99;background-color:var(--color-main-background);border-bottom:2px solid var(--color-border-dark)}.log-table__body[data-v-87d89a52]:before{content:"‌";display:block;line-height:6px;text-indent:-99999px}.log-table__row[data-v-87d89a52]{min-height:42px}/*! +* SPDX-FileCopyrightText: 2019 Nextcloud GmbH and Nextcloud contributors +* SPDX-License-Identifier: AGPL-3.0-or-later +*/.toastify.dialogs{min-width:200px;background:none;background-color:var(--color-main-background);color:var(--color-main-text);box-shadow:0 0 6px 0 var(--color-box-shadow);padding:0 12px;margin-top:45px;position:fixed;z-index:10100;border-radius:var(--border-radius);display:flex;align-items:center;min-height:50px}.toastify.dialogs .toast-loader-container,.toastify.dialogs .toast-undo-container{display:flex;align-items:center;width:100%}.toastify.dialogs .toast-undo-button,.toastify.dialogs .toast-close{position:static;overflow:hidden;box-sizing:border-box;min-width:44px;height:100%;padding:12px;white-space:nowrap;background-repeat:no-repeat;background-position:center;background-color:transparent;min-height:0}.toastify.dialogs .toast-undo-button.toast-close,.toastify.dialogs .toast-close.toast-close{text-indent:0;opacity:.4;border:none;min-height:44px;margin-left:10px;font-size:0}.toastify.dialogs .toast-undo-button.toast-close:before,.toastify.dialogs .toast-close.toast-close:before{background-image:url("data:image/svg+xml,%3csvg%20viewBox='0%200%2016%2016'%20height='16'%20width='16'%20xmlns='http://www.w3.org/2000/svg'%20xml:space='preserve'%20style='fill-rule:evenodd;clip-rule:evenodd;stroke-linejoin:round;stroke-miterlimit:2'%3e%3cpath%20d='M6.4%2019%205%2017.6l5.6-5.6L5%206.4%206.4%205l5.6%205.6L17.6%205%2019%206.4%2013.4%2012l5.6%205.6-1.4%201.4-5.6-5.6L6.4%2019Z'%20style='fill-rule:nonzero'%20transform='matrix(.85714%200%200%20.85714%20-2.286%20-2.286)'/%3e%3c/svg%3e");content:" ";filter:var(--background-invert-if-dark);display:inline-block;width:16px;height:16px}.toastify.dialogs .toast-undo-button.toast-undo-button,.toastify.dialogs .toast-close.toast-undo-button{height:calc(100% - 6px);margin:3px 3px 3px 12px}.toastify.dialogs .toast-undo-button:hover,.toastify.dialogs .toast-undo-button:focus,.toastify.dialogs .toast-undo-button:active,.toastify.dialogs .toast-close:hover,.toastify.dialogs .toast-close:focus,.toastify.dialogs .toast-close:active{cursor:pointer;opacity:1}.toastify.dialogs.toastify-top{right:10px}.toastify.dialogs.toast-with-click{cursor:pointer}.toastify.dialogs.toast-error{border-left:3px solid var(--color-element-error, var(--color-error))}.toastify.dialogs.toast-info{border-left:3px solid var(--color-element-info, var(--color-primary))}.toastify.dialogs.toast-warning{border-left:3px solid var(--color-element-warning, var(--color-warning))}.toastify.dialogs.toast-success,.toastify.dialogs.toast-undo{border-left:3px solid var(--color-element-success, var(--color-success))}.toastify.dialogs.toast-loading{border-left:3px solid var(--color-element-info, var(--color-primary))}.toastify.dialogs.toast-loading .toast-loader{display:inline-block;width:20px;height:20px;animation:rotate var(--animation-duration, .8s) linear infinite;margin-left:auto}.theme--dark .toastify.dialogs .toast-close.toast-close:before{background-image:url("data:image/svg+xml,%3csvg%20viewBox='0%200%2016%2016'%20height='16'%20width='16'%20xmlns='http://www.w3.org/2000/svg'%20xml:space='preserve'%20style='fill-rule:evenodd;clip-rule:evenodd;stroke-linejoin:round;stroke-miterlimit:2'%3e%3cpath%20d='M6.4%2019%205%2017.6l5.6-5.6L5%206.4%206.4%205l5.6%205.6L17.6%205%2019%206.4%2013.4%2012l5.6%205.6-1.4%201.4-5.6-5.6L6.4%2019Z'%20style='fill:%23fff;fill-rule:nonzero'%20transform='matrix(.85714%200%200%20.85714%20-2.286%20-2.286)'/%3e%3c/svg%3e")}.nc-generic-dialog .dialog__actions{justify-content:space-between;min-width:calc(100% - 12px)}._pickerEntry_xk2pl_1:not(:last-of-type){border-bottom:1px solid var(--color-border)}._pickerEntryItem_xk2pl_5{display:flex;align-items:center;height:64px}._pickerEntryIcon_xk2pl_11,._pickerEntryPreview_xk2pl_12{height:64px;width:64px;margin:0 var(--secondary-margin);display:block;flex:0 0 64px}._pickerEntryIcon_xk2pl_11{color:var(--color-text-maxcontrast)}._pickerEntryIcon_folder_xk2pl_24{color:var(--color-primary-element)}._pickerEntryPreview_xk2pl_12{overflow:hidden;border-radius:calc(var(--border-radius) * 2);object-fit:cover}._pickerEntryDescription_xk2pl_34{display:flex;flex-direction:column}._pickerEntryDescription_xk2pl_34 span{white-space:nowrap}._picker_6q4ek_1{--margin: 36px;--secondary-margin: 18px}._pickerHeader_6q4ek_6{position:sticky;z-index:10;top:0;padding:0 var(--margin);padding-bottom:var(--secondary-margin);background-color:var(--color-main-background)}._pickerForm_6q4ek_15{position:relative;overflow:auto;padding:0 var(--margin);margin-top:calc(-1 * var(--secondary-margin))}._pickerActionSubmit_disabled_6q4ek_22{opacity:.7;filter:saturate(50%)}._pickerSelectAll_6q4ek_27{display:grid;width:100%;margin-top:calc(var(--secondary-margin) * 1.5);padding-bottom:var(--secondary-margin);grid-template-columns:1fr 1fr}._pickerSelectAll_6q4ek_27 legend{display:flex;align-items:center;width:100%;margin-bottom:calc(var(--secondary-margin) / 2)}._pickerSelectAll_6q4ek_27._conflict-picker__all_6q4ek_40{position:sticky;top:0;margin:0;padding:var(--secondary-margin) 0;background-image:linear-gradient(to top,transparent,var(--color-main-background-blur) 10%,var(--color-main-background) 15%)}._pickerSelectAll_6q4ek_27._conflict-picker__all_6q4ek_40+fieldset{margin-top:0}._pickerSelectAll_6q4ek_27._conflict-picker__all_6q4ek_40 :deep(label){font-weight:700}._file-picker__file-icon_3v9zx_9{position:relative;width:32px;height:32px;min-width:32px;min-height:32px;background-repeat:no-repeat;background-size:contain;display:flex;justify-content:center}._file-picker__file-icon--primary_3v9zx_21{color:var(--color-primary-element)}._file-picker__file-icon-overlay_3v9zx_25{color:var(--color-primary-element-text);position:absolute;inset-block-start:10px}tr.file-picker__row[data-v-a5daea8d]{height:var(--row-height, 50px)}tr.file-picker__row td[data-v-a5daea8d]{cursor:pointer;overflow:hidden;text-overflow:ellipsis;border-bottom:none}tr.file-picker__row td.row-checkbox[data-v-a5daea8d]{padding:0 2px}tr.file-picker__row td[data-v-a5daea8d]:not(.row-checkbox){padding-inline:14px 0}tr.file-picker__row td.row-size[data-v-a5daea8d]{text-align:end;padding-inline:0 14px}tr.file-picker__row td.row-name[data-v-a5daea8d]{padding-inline:2px 0}.file-picker__row[data-v-a5daea8d] *{cursor:pointer}.file-picker__row--selected[data-v-a5daea8d]{background-color:var(--color-background-dark)}.file-picker__row--not-navigatable[data-v-a5daea8d]{filter:saturate(.7);opacity:.7}.file-picker__row--not-navigatable[data-v-a5daea8d] *,.file-picker__row--not-pickable[data-v-a5daea8d] *{cursor:default!important}.file-picker__row[data-v-a5daea8d]:hover{background-color:var(--color-background-hover)}.file-picker__name-container[data-v-a5daea8d]{display:flex;justify-content:start;align-items:center;height:100%}.file-picker__file-name[data-v-a5daea8d]{padding-inline-start:6px;min-width:0;overflow:hidden;text-overflow:ellipsis}.file-picker__file-extension[data-v-a5daea8d]{color:var(--color-text-maxcontrast);min-width:fit-content}/*! +* SPDX-FileCopyrightText: 2023-2024 Nextcloud GmbH and Nextcloud contributors +* SPDX-License-Identifier: AGPL-3.0-or-later +*/tr.file-picker__row[data-v-1f96131b]{height:var(--row-height, 50px)}tr.file-picker__row td[data-v-1f96131b]{cursor:pointer;overflow:hidden;text-overflow:ellipsis;border-bottom:none}tr.file-picker__row td.row-checkbox[data-v-1f96131b]{padding:0 2px}tr.file-picker__row td[data-v-1f96131b]:not(.row-checkbox){padding-inline:14px 0}tr.file-picker__row td.row-size[data-v-1f96131b]{text-align:end;padding-inline:0 14px}tr.file-picker__row td.row-name[data-v-1f96131b]{padding-inline:2px 0}@keyframes gradient-1f96131b{0%{background-position:0% 50%}50%{background-position:100% 50%}to{background-position:0% 50%}}.loading-row .row-checkbox[data-v-1f96131b]{text-align:center!important}.loading-row span[data-v-1f96131b]{display:inline-block;height:24px;background:linear-gradient(to right,var(--color-background-darker),var(--color-text-maxcontrast),var(--color-background-darker));background-size:600px 100%;border-radius:var(--border-radius);animation:gradient-1f96131b 12s ease infinite}.loading-row .row-wrapper[data-v-1f96131b]{display:inline-flex;align-items:center}.loading-row .row-checkbox span[data-v-1f96131b]{width:24px}.loading-row .row-name span[data-v-1f96131b]:last-of-type{margin-inline-start:6px;width:130px}.loading-row .row-size span[data-v-1f96131b]{width:80px}.loading-row .row-modified span[data-v-1f96131b]{width:90px}.file-picker__header-preview[data-v-38620705]{width:22px;height:32px;flex:0 0 auto}.file-picker__files[data-v-38620705]{margin:2px;margin-inline-start:12px;overflow:scroll auto}.file-picker__files table[data-v-38620705]{width:100%;max-height:100%;table-layout:fixed}.file-picker__files th[data-v-38620705]{position:sticky;z-index:1;top:0;background-color:var(--color-main-background);padding:2px}.file-picker__files th .header-wrapper[data-v-38620705]{display:flex}.file-picker__files th.row-checkbox[data-v-38620705]{width:44px}.file-picker__files th.row-name[data-v-38620705]{width:230px}.file-picker__files th.row-size[data-v-38620705]{width:100px}.file-picker__files th.row-modified[data-v-38620705]{width:120px}.file-picker__files th[data-v-38620705]:not(.row-size) .button-vue__wrapper{justify-content:start;flex-direction:row-reverse}.file-picker__files th[data-v-38620705]:not(.row-size) .button-vue{padding-inline:16px 4px}.file-picker__files th.row-size[data-v-38620705] .button-vue__wrapper{justify-content:end}.file-picker__files th[data-v-38620705] .button-vue__wrapper{color:var(--color-text-maxcontrast)}.file-picker__files th[data-v-38620705] .button-vue__wrapper .button-vue__text{font-weight:400}.file-picker__breadcrumbs[data-v-4e6fd4e4]{flex-grow:0!important}.file-picker__side[data-v-86223490]{display:flex;flex-direction:column;align-items:stretch;gap:.5rem;min-width:200px;padding:2px;margin-block-start:7px;overflow:auto}.file-picker__side[data-v-86223490] .button-vue__wrapper{justify-content:start}.file-picker__filter-input[data-v-86223490]{margin-block:7px;max-width:260px}@media (max-width: 736px){.file-picker__side[data-v-86223490]{flex-direction:row;min-width:unset}}@media (max-width: 512px){.file-picker__side[data-v-86223490]{flex-direction:row;min-width:unset}.file-picker__filter-input[data-v-86223490]{max-width:unset}}.file-picker__navigation{padding-inline:8px 2px}.file-picker__navigation,.file-picker__navigation *{box-sizing:border-box}.file-picker__navigation .v-select.select{min-width:220px}@media (min-width: 513px) and (max-width: 736px){.file-picker__navigation{gap:11px}}@media (max-width: 512px){.file-picker__navigation{flex-direction:column-reverse!important}}.file-picker__view[data-v-5287035b]{height:50px;display:flex;justify-content:start;align-items:center}.file-picker__view h3[data-v-5287035b]{font-weight:700;height:fit-content;margin:0}.file-picker__main[data-v-5287035b]{box-sizing:border-box;width:100%;display:flex;flex-direction:column;min-height:0;flex:1;padding-inline:2px}.file-picker__main[data-v-5287035b] *{box-sizing:border-box}[data-v-5287035b] .file-picker{height:min(80vh,800px)!important}@media (max-width: 512px){[data-v-5287035b] .file-picker{height:calc(100% - 16px - var(--default-clickable-area))!important}}[data-v-5287035b] .file-picker__content{display:flex;flex-direction:column;overflow:hidden}.public-auth-prompt__text[data-v-b33d88e5]{font-size:1.25em;margin-block:0 calc(3 * var(--default-grid-baseline))}.public-auth-prompt__header[data-v-b33d88e5]{margin-block:0 calc(3 * var(--default-grid-baseline))}.public-auth-prompt__header[data-v-b33d88e5]:first-child{margin-top:0}.public-auth-prompt__input[data-v-b33d88e5]{margin-block:calc(4 * var(--default-grid-baseline)) calc(2 * var(--default-grid-baseline))}legend[data-v-866c4870]{font-weight:700}.logreader-container[data-v-866c4870]{display:flex;flex-direction:column;height:100%}.logreader-container .info-note[data-v-866c4870]{margin-block:4px;margin-inline:1rem}.logreader-container .info-note__content[data-v-866c4870]{display:flex;gap:12px;align-items:center;justify-content:space-between}.logreader-container__header[data-v-866c4870]{padding-inline-start:1rem;display:flex;flex-direction:row;align-items:center;justify-content:space-between}.logreader-container__header h2[data-v-866c4870]{margin:0;padding:0}.logreader-container__header .settings-toggle[data-v-866c4870]{margin:2px}[data-v-866c4870] .empty-content{text-align:center}@media only screen and (max-width: 1023px){.logreader-container__header[data-v-866c4870]{padding-inline-start:48px}} diff --git a/eslint.config.mjs b/eslint.config.mjs index f25729cde..3963cf75c 100644 --- a/eslint.config.mjs +++ b/eslint.config.mjs @@ -3,10 +3,10 @@ * SPDX-License-Identifier: AGPL-3.0-or-later */ -import { recommendedVue2 } from '@nextcloud/eslint-config' +import { recommended } from '@nextcloud/eslint-config' export default [ - ...recommendedVue2, + ...recommended, { name: 'logreader/disabled-during-migration', rules: { diff --git a/js/NcColorPicker-CD-30f1k.chunk.mjs b/js/NcColorPicker-CD-30f1k.chunk.mjs deleted file mode 100644 index 6276b0387..000000000 --- a/js/NcColorPicker-CD-30f1k.chunk.mjs +++ /dev/null @@ -1,864 +0,0 @@ -/*! third party licenses: js/vendor.LICENSE.txt */ -import{c as gt,n as Ct,d as kt,u as St,b as Ft,e as At,f as Ot,h as Et,l as Mt,t as xt,N as jt,i as Lt,j as Pt,m as Bt,k as Dt,o as Nt,p as Rt,r as Tt}from"./logreader-main.mjs";import{d as mt,C as _t,a as wt}from"./colors-BwQwSDJi-BUp7eygq.chunk.mjs";var bt={exports:{}},Ht=bt.exports,yt;function zt(){return yt||(yt=1,function(z,X){(function(a,o){z.exports=o()})(typeof self<"u"?self:Ht,function(){return function(a){function o(r){if(e[r])return e[r].exports;var i=e[r]={i:r,l:!1,exports:{}};return a[r].call(i.exports,i,i.exports,o),i.l=!0,i.exports}var e={};return o.m=a,o.c=e,o.d=function(r,i,s){o.o(r,i)||Object.defineProperty(r,i,{configurable:!1,enumerable:!0,get:s})},o.n=function(r){var i=r&&r.__esModule?function(){return r.default}:function(){return r};return o.d(i,"a",i),i},o.o=function(r,i){return Object.prototype.hasOwnProperty.call(r,i)},o.p="",o(o.s=60)}([function(a,o){function e(i,s){var t=i[1]||"",f=i[3];if(!f)return t;if(s&&typeof btoa=="function"){var n=r(f);return[t].concat(f.sources.map(function(l){return"/*# sourceURL="+f.sourceRoot+l+" */"})).concat([n]).join(` -`)}return[t].join(` -`)}function r(i){return"/*# sourceMappingURL=data:application/json;charset=utf-8;base64,"+btoa(unescape(encodeURIComponent(JSON.stringify(i))))+" */"}a.exports=function(i){var s=[];return s.toString=function(){return this.map(function(t){var f=e(t,i);return t[2]?"@media "+t[2]+"{"+f+"}":f}).join("")},s.i=function(t,f){typeof t=="string"&&(t=[[null,t,""]]);for(var n={},l=0;lL.parts.length&&(O.parts.length=L.parts.length)}else{for(var M=[],g=0;g"u"||(y=__VUE_SSR_CONTEXT__),s&&s.call(this,y),y&&y._registeredComponents&&y._registeredComponents.add(f)},d._ssrRegister=b):s&&(b=s),b){var _=d.functional,v=_?d.render:d.beforeCreate;_?(d._injectStyles=b,d.render=function(y,w){return b.call(w),v(y,w)}):d.beforeCreate=v?[].concat(v,b):[b]}return{esModule:n,exports:l,options:d}}},function(a,o,e){function r(t,f){var n,l=t&&t.a;!(n=t&&t.hsl?(0,s.default)(t.hsl):t&&t.hex&&t.hex.length>0?(0,s.default)(t.hex):t&&t.hsv?(0,s.default)(t.hsv):t&&t.rgba?(0,s.default)(t.rgba):t&&t.rgb?(0,s.default)(t.rgb):(0,s.default)(t))||n._a!==void 0&&n._a!==null||n.setAlpha(l||1);var p=n.toHsl(),d=n.toHsv();return p.s===0&&(d.h=p.h=t.h||t.hsl&&t.hsl.h||f||0),{hsl:p,hex:n.toHexString().toUpperCase(),hex8:n.toHex8String().toUpperCase(),rgba:n.toRgb(),hsv:d,oldHue:t.h||f||p.h,source:t.source,a:t.a||n.getAlpha()}}Object.defineProperty(o,"__esModule",{value:!0});var i=e(65),s=function(t){return t&&t.__esModule?t:{default:t}}(i);o.default={props:["value"],data:function(){return{val:r(this.value)}},computed:{colors:{get:function(){return this.val},set:function(t){this.val=t,this.$emit("input",t)}}},watch:{value:function(t){this.val=r(t)}},methods:{colorChange:function(t,f){this.oldHue=this.colors.hsl.h,this.colors=r(t,f||this.oldHue)},isValidHex:function(t){return(0,s.default)(t).isValid()},simpleCheckForValidColor:function(t){for(var f=["r","g","b","a","h","s","l","v"],n=0,l=0,p=0;p0?r:e)(i)}},function(a,o){a.exports=function(e){if(e==null)throw TypeError("Can't call method on "+e);return e}},function(a,o,e){var r=e(12);a.exports=function(i,s){if(!r(i))return i;var t,f;if(s&&typeof(t=i.toString)=="function"&&!r(f=t.call(i))||typeof(t=i.valueOf)=="function"&&!r(f=t.call(i))||!s&&typeof(t=i.toString)=="function"&&!r(f=t.call(i)))return f;throw TypeError("Can't convert object to primitive value")}},function(a,o){a.exports={}},function(a,o,e){var r=e(46),i=e(30);a.exports=Object.keys||function(s){return r(s,i)}},function(a,o,e){var r=e(29)("keys"),i=e(19);a.exports=function(s){return r[s]||(r[s]=i(s))}},function(a,o,e){var r=e(15),i=e(4),s=i["__core-js_shared__"]||(i["__core-js_shared__"]={});(a.exports=function(t,f){return s[t]||(s[t]=f!==void 0?f:{})})("versions",[]).push({version:r.version,mode:e(14)?"pure":"global",copyright:"© 2019 Denis Pushkarev (zloirock.ru)"})},function(a,o){a.exports="constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf".split(",")},function(a,o,e){var r=e(8).f,i=e(6),s=e(11)("toStringTag");a.exports=function(t,f,n){t&&!i(t=n?t:t.prototype,s)&&r(t,s,{configurable:!0,value:f})}},function(a,o,e){o.f=e(11)},function(a,o,e){var r=e(4),i=e(15),s=e(14),t=e(32),f=e(8).f;a.exports=function(n){var l=i.Symbol||(i.Symbol=s?{}:r.Symbol||{});n.charAt(0)=="_"||n in l||f(l,n,{value:t.f(n)})}},function(a,o){o.f={}.propertyIsEnumerable},function(a,o,e){function r(l){return l&&l.__esModule?l:{default:l}}Object.defineProperty(o,"__esModule",{value:!0});var i=e(3),s=r(i),t=e(5),f=r(t),n=["#4D4D4D","#999999","#FFFFFF","#F44E3B","#FE9200","#FCDC00","#DBDF00","#A4DD00","#68CCCA","#73D8FF","#AEA1FF","#FDA1FF","#333333","#808080","#CCCCCC","#D33115","#E27300","#FCC400","#B0BC00","#68BC00","#16A5A5","#009CE0","#7B64FF","#FA28FF","#000000","#666666","#B3B3B3","#9F0500","#C45100","#FB9E00","#808900","#194D33","#0C797D","#0062B1","#653294","#AB149E"];o.default={name:"Compact",mixins:[s.default],props:{palette:{type:Array,default:function(){return n}}},components:{"ed-in":f.default},computed:{pick:function(){return this.colors.hex.toUpperCase()}},methods:{handlerClick:function(l){this.colorChange({hex:l,source:"hex"})}}}},function(a,o,e){Object.defineProperty(o,"__esModule",{value:!0}),o.default={name:"editableInput",props:{label:String,labelText:String,desc:String,value:[String,Number],max:Number,min:Number,arrowOffset:{type:Number,default:1}},computed:{val:{get:function(){return this.value},set:function(r){if(!(this.max!==void 0&&+r>this.max))return r;this.$refs.input.value=this.max}},labelId:function(){return"input__label__"+this.label+"__"+Math.random().toString().slice(2,5)},labelSpanText:function(){return this.labelText||this.label}},methods:{update:function(r){this.handleChange(r.target.value)},handleChange:function(r){var i={};i[this.label]=r,i.hex===void 0&&i["#"]===void 0?this.$emit("change",i):r.length>5&&this.$emit("change",i)},handleKeyDown:function(r){var i=this.val,s=Number(i);if(s){var t=this.arrowOffset||1;r.keyCode===38&&(i=s+t,this.handleChange(i),r.preventDefault()),r.keyCode===40&&(i=s-t,this.handleChange(i),r.preventDefault())}}}}},function(a,o,e){Object.defineProperty(o,"__esModule",{value:!0});var r=e(3),i=function(t){return t&&t.__esModule?t:{default:t}}(r),s=["#FFFFFF","#F2F2F2","#E6E6E6","#D9D9D9","#CCCCCC","#BFBFBF","#B3B3B3","#A6A6A6","#999999","#8C8C8C","#808080","#737373","#666666","#595959","#4D4D4D","#404040","#333333","#262626","#0D0D0D","#000000"];o.default={name:"Grayscale",mixins:[i.default],props:{palette:{type:Array,default:function(){return s}}},components:{},computed:{pick:function(){return this.colors.hex.toUpperCase()}},methods:{handlerClick:function(t){this.colorChange({hex:t,source:"hex"})}}}},function(a,o,e){function r(n){return n&&n.__esModule?n:{default:n}}Object.defineProperty(o,"__esModule",{value:!0});var i=e(5),s=r(i),t=e(3),f=r(t);o.default={name:"Material",mixins:[f.default],components:{"ed-in":s.default},methods:{onChange:function(n){n&&(n.hex?this.isValidHex(n.hex)&&this.colorChange({hex:n.hex,source:"hex"}):(n.r||n.g||n.b)&&this.colorChange({r:n.r||this.colors.rgba.r,g:n.g||this.colors.rgba.g,b:n.b||this.colors.rgba.b,a:n.a||this.colors.rgba.a,source:"rgba"}))}}}},function(a,o,e){function r(p){return p&&p.__esModule?p:{default:p}}Object.defineProperty(o,"__esModule",{value:!0});var i=e(81),s=r(i),t=e(3),f=r(t),n=e(13),l=r(n);o.default={name:"Slider",mixins:[f.default],props:{swatches:{type:Array,default:function(){return[{s:.5,l:.8},{s:.5,l:.65},{s:.5,l:.5},{s:.5,l:.35},{s:.5,l:.2}]}}},components:{hue:l.default},computed:{normalizedSwatches:function(){return this.swatches.map(function(p){return(p===void 0?"undefined":(0,s.default)(p))!=="object"?{s:.5,l:p}:p})}},methods:{isActive:function(p,d){var b=this.colors.hsl;return b.l===1&&p.l===1||b.l===0&&p.l===0||Math.abs(b.l-p.l)<.01&&Math.abs(b.s-p.s)<.01},hueChange:function(p){this.colorChange(p)},handleSwClick:function(p,d){this.colorChange({h:this.colors.hsl.h,s:d.s,l:d.l,source:"hsl"})}}}},function(a,o,e){var r=e(14),i=e(41),s=e(44),t=e(7),f=e(26),n=e(88),l=e(31),p=e(95),d=e(11)("iterator"),b=!([].keys&&"next"in[].keys()),_=function(){return this};a.exports=function(v,y,w,F,T,J,A){n(w,y,F);var j,L,O,g=function(G){if(!b&&G in I)return I[G];switch(G){case"keys":case"values":return function(){return new w(this,G)}}return function(){return new w(this,G)}},M=y+" Iterator",B=T=="values",D=!1,I=v.prototype,P=I[d]||I["@@iterator"]||T&&I[T],Y=P||g(T),H=T?B?g("entries"):Y:void 0,lt=y=="Array"&&I.entries||P;if(lt&&(O=p(lt.call(new v)))!==Object.prototype&&O.next&&(l(O,M,!0),r||typeof O[d]=="function"||t(O,d,_)),B&&P&&P.name!=="values"&&(D=!0,Y=function(){return P.call(this)}),r&&!A||!b&&!D&&I[d]||t(I,d,Y),f[y]=Y,f[M]=_,T)if(j={values:B?Y:g("values"),keys:J?Y:g("keys"),entries:H},A)for(L in j)L in I||s(I,L,j[L]);else i(i.P+i.F*(b||D),y,j);return j}},function(a,o,e){var r=e(4),i=e(15),s=e(86),t=e(7),f=e(6),n=function(l,p,d){var b,_,v,y=l&n.F,w=l&n.G,F=l&n.S,T=l&n.P,J=l&n.B,A=l&n.W,j=w?i:i[p]||(i[p]={}),L=j.prototype,O=w?r:F?r[p]:(r[p]||{}).prototype;w&&(d=p);for(b in d)(_=!y&&O&&O[b]!==void 0)&&f(j,b)||(v=_?O[b]:d[b],j[b]=w&&typeof O[b]!="function"?d[b]:J&&_?s(v,r):A&&O[b]==v?function(g){var M=function(B,D,I){if(this instanceof g){switch(arguments.length){case 0:return new g;case 1:return new g(B);case 2:return new g(B,D)}return new g(B,D,I)}return g.apply(this,arguments)};return M.prototype=g.prototype,M}(v):T&&typeof v=="function"?s(Function.call,v):v,T&&((j.virtual||(j.virtual={}))[b]=v,l&n.R&&L&&!L[b]&&t(L,b,v)))};n.F=1,n.G=2,n.S=4,n.P=8,n.B=16,n.W=32,n.U=64,n.R=128,a.exports=n},function(a,o,e){a.exports=!e(9)&&!e(17)(function(){return Object.defineProperty(e(43)("div"),"a",{get:function(){return 7}}).a!=7})},function(a,o,e){var r=e(12),i=e(4).document,s=r(i)&&r(i.createElement);a.exports=function(t){return s?i.createElement(t):{}}},function(a,o,e){a.exports=e(7)},function(a,o,e){var r=e(16),i=e(89),s=e(30),t=e(28)("IE_PROTO"),f=function(){},n=function(){var l,p=e(43)("iframe"),d=s.length;for(p.style.display="none",e(94).appendChild(p),p.src="javascript:",l=p.contentWindow.document,l.open(),l.write("","\n\n","import Vue from 'vue'\nimport { getCurrentInstance } from 'vue'\n\nvar isVue2 = true\nvar isVue3 = false\nvar Vue2 = Vue\nvar warn = Vue.util.warn\n\nfunction install() {}\n\n// createApp polyfill\nexport function createApp(rootComponent, rootProps) {\n var vm\n var provide = {}\n var app = {\n config: Vue.config,\n use: Vue.use.bind(Vue),\n mixin: Vue.mixin.bind(Vue),\n component: Vue.component.bind(Vue),\n provide: function (key, value) {\n provide[key] = value\n return this\n },\n directive: function (name, dir) {\n if (dir) {\n Vue.directive(name, dir)\n return app\n } else {\n return Vue.directive(name)\n }\n },\n mount: function (el, hydrating) {\n if (!vm) {\n vm = new Vue(Object.assign({ propsData: rootProps }, rootComponent, { provide: Object.assign(provide, rootComponent.provide) }))\n vm.$mount(el, hydrating)\n return vm\n } else {\n return vm\n }\n },\n unmount: function () {\n if (vm) {\n vm.$destroy()\n vm = undefined\n }\n },\n }\n return app\n}\n\nexport {\n Vue,\n Vue2,\n isVue2,\n isVue3,\n install,\n warn\n}\n\n// Vue 3 components mock\nfunction createMockComponent(name) {\n return {\n setup() {\n throw new Error('[vue-demi] ' + name + ' is not supported in Vue 2. It\\'s provided to avoid compiler errors.')\n }\n }\n}\nexport var Fragment = /*#__PURE__*/ createMockComponent('Fragment')\nexport var Transition = /*#__PURE__*/ createMockComponent('Transition')\nexport var TransitionGroup = /*#__PURE__*/ createMockComponent('TransitionGroup')\nexport var Teleport = /*#__PURE__*/ createMockComponent('Teleport')\nexport var Suspense = /*#__PURE__*/ createMockComponent('Suspense')\nexport var KeepAlive = /*#__PURE__*/ createMockComponent('KeepAlive')\n\nexport * from 'vue'\n\n// Not implemented https://github.com/vuejs/core/pull/8111, falls back to getCurrentInstance()\nexport function hasInjectionContext() {\n return !!getCurrentInstance()\n}\n","import { shallowRef, watchEffect, readonly, ref, watch, customRef, getCurrentScope, onScopeDispose, effectScope, getCurrentInstance, provide, inject, isVue3, version, isRef, unref, computed, reactive, toRefs as toRefs$1, toRef as toRef$1, isVue2, set as set$1, onBeforeMount, nextTick, onBeforeUnmount, onMounted, onUnmounted, isReactive } from 'vue-demi';\n\nfunction computedEager(fn, options) {\n var _a;\n const result = shallowRef();\n watchEffect(() => {\n result.value = fn();\n }, {\n ...options,\n flush: (_a = options == null ? void 0 : options.flush) != null ? _a : \"sync\"\n });\n return readonly(result);\n}\n\nfunction computedWithControl(source, fn) {\n let v = void 0;\n let track;\n let trigger;\n const dirty = ref(true);\n const update = () => {\n dirty.value = true;\n trigger();\n };\n watch(source, update, { flush: \"sync\" });\n const get = typeof fn === \"function\" ? fn : fn.get;\n const set = typeof fn === \"function\" ? void 0 : fn.set;\n const result = customRef((_track, _trigger) => {\n track = _track;\n trigger = _trigger;\n return {\n get() {\n if (dirty.value) {\n v = get(v);\n dirty.value = false;\n }\n track();\n return v;\n },\n set(v2) {\n set == null ? void 0 : set(v2);\n }\n };\n });\n if (Object.isExtensible(result))\n result.trigger = update;\n return result;\n}\n\nfunction tryOnScopeDispose(fn) {\n if (getCurrentScope()) {\n onScopeDispose(fn);\n return true;\n }\n return false;\n}\n\nfunction createEventHook() {\n const fns = /* @__PURE__ */ new Set();\n const off = (fn) => {\n fns.delete(fn);\n };\n const on = (fn) => {\n fns.add(fn);\n const offFn = () => off(fn);\n tryOnScopeDispose(offFn);\n return {\n off: offFn\n };\n };\n const trigger = (...args) => {\n return Promise.all(Array.from(fns).map((fn) => fn(...args)));\n };\n return {\n on,\n off,\n trigger\n };\n}\n\nfunction createGlobalState(stateFactory) {\n let initialized = false;\n let state;\n const scope = effectScope(true);\n return (...args) => {\n if (!initialized) {\n state = scope.run(() => stateFactory(...args));\n initialized = true;\n }\n return state;\n };\n}\n\nconst localProvidedStateMap = /* @__PURE__ */ new WeakMap();\n\nconst provideLocal = (key, value) => {\n var _a;\n const instance = (_a = getCurrentInstance()) == null ? void 0 : _a.proxy;\n if (instance == null)\n throw new Error(\"provideLocal must be called in setup\");\n if (!localProvidedStateMap.has(instance))\n localProvidedStateMap.set(instance, /* @__PURE__ */ Object.create(null));\n const localProvidedState = localProvidedStateMap.get(instance);\n localProvidedState[key] = value;\n provide(key, value);\n};\n\nconst injectLocal = (...args) => {\n var _a;\n const key = args[0];\n const instance = (_a = getCurrentInstance()) == null ? void 0 : _a.proxy;\n if (instance == null)\n throw new Error(\"injectLocal must be called in setup\");\n if (localProvidedStateMap.has(instance) && key in localProvidedStateMap.get(instance))\n return localProvidedStateMap.get(instance)[key];\n return inject(...args);\n};\n\nfunction createInjectionState(composable, options) {\n const key = (options == null ? void 0 : options.injectionKey) || Symbol(composable.name || \"InjectionState\");\n const defaultValue = options == null ? void 0 : options.defaultValue;\n const useProvidingState = (...args) => {\n const state = composable(...args);\n provideLocal(key, state);\n return state;\n };\n const useInjectedState = () => injectLocal(key, defaultValue);\n return [useProvidingState, useInjectedState];\n}\n\nfunction createSharedComposable(composable) {\n let subscribers = 0;\n let state;\n let scope;\n const dispose = () => {\n subscribers -= 1;\n if (scope && subscribers <= 0) {\n scope.stop();\n state = void 0;\n scope = void 0;\n }\n };\n return (...args) => {\n subscribers += 1;\n if (!scope) {\n scope = effectScope(true);\n state = scope.run(() => composable(...args));\n }\n tryOnScopeDispose(dispose);\n return state;\n };\n}\n\nfunction extendRef(ref, extend, { enumerable = false, unwrap = true } = {}) {\n if (!isVue3 && !version.startsWith(\"2.7.\")) {\n if (process.env.NODE_ENV !== \"production\")\n throw new Error(\"[VueUse] extendRef only works in Vue 2.7 or above.\");\n return;\n }\n for (const [key, value] of Object.entries(extend)) {\n if (key === \"value\")\n continue;\n if (isRef(value) && unwrap) {\n Object.defineProperty(ref, key, {\n get() {\n return value.value;\n },\n set(v) {\n value.value = v;\n },\n enumerable\n });\n } else {\n Object.defineProperty(ref, key, { value, enumerable });\n }\n }\n return ref;\n}\n\nfunction get(obj, key) {\n if (key == null)\n return unref(obj);\n return unref(obj)[key];\n}\n\nfunction isDefined(v) {\n return unref(v) != null;\n}\n\nfunction makeDestructurable(obj, arr) {\n if (typeof Symbol !== \"undefined\") {\n const clone = { ...obj };\n Object.defineProperty(clone, Symbol.iterator, {\n enumerable: false,\n value() {\n let index = 0;\n return {\n next: () => ({\n value: arr[index++],\n done: index > arr.length\n })\n };\n }\n });\n return clone;\n } else {\n return Object.assign([...arr], obj);\n }\n}\n\nfunction toValue(r) {\n return typeof r === \"function\" ? r() : unref(r);\n}\nconst resolveUnref = toValue;\n\nfunction reactify(fn, options) {\n const unrefFn = (options == null ? void 0 : options.computedGetter) === false ? unref : toValue;\n return function(...args) {\n return computed(() => fn.apply(this, args.map((i) => unrefFn(i))));\n };\n}\n\nfunction reactifyObject(obj, optionsOrKeys = {}) {\n let keys = [];\n let options;\n if (Array.isArray(optionsOrKeys)) {\n keys = optionsOrKeys;\n } else {\n options = optionsOrKeys;\n const { includeOwnProperties = true } = optionsOrKeys;\n keys.push(...Object.keys(obj));\n if (includeOwnProperties)\n keys.push(...Object.getOwnPropertyNames(obj));\n }\n return Object.fromEntries(\n keys.map((key) => {\n const value = obj[key];\n return [\n key,\n typeof value === \"function\" ? reactify(value.bind(obj), options) : value\n ];\n })\n );\n}\n\nfunction toReactive(objectRef) {\n if (!isRef(objectRef))\n return reactive(objectRef);\n const proxy = new Proxy({}, {\n get(_, p, receiver) {\n return unref(Reflect.get(objectRef.value, p, receiver));\n },\n set(_, p, value) {\n if (isRef(objectRef.value[p]) && !isRef(value))\n objectRef.value[p].value = value;\n else\n objectRef.value[p] = value;\n return true;\n },\n deleteProperty(_, p) {\n return Reflect.deleteProperty(objectRef.value, p);\n },\n has(_, p) {\n return Reflect.has(objectRef.value, p);\n },\n ownKeys() {\n return Object.keys(objectRef.value);\n },\n getOwnPropertyDescriptor() {\n return {\n enumerable: true,\n configurable: true\n };\n }\n });\n return reactive(proxy);\n}\n\nfunction reactiveComputed(fn) {\n return toReactive(computed(fn));\n}\n\nfunction reactiveOmit(obj, ...keys) {\n const flatKeys = keys.flat();\n const predicate = flatKeys[0];\n return reactiveComputed(() => typeof predicate === \"function\" ? Object.fromEntries(Object.entries(toRefs$1(obj)).filter(([k, v]) => !predicate(toValue(v), k))) : Object.fromEntries(Object.entries(toRefs$1(obj)).filter((e) => !flatKeys.includes(e[0]))));\n}\n\nconst isClient = typeof window !== \"undefined\" && typeof document !== \"undefined\";\nconst isWorker = typeof WorkerGlobalScope !== \"undefined\" && globalThis instanceof WorkerGlobalScope;\nconst isDef = (val) => typeof val !== \"undefined\";\nconst notNullish = (val) => val != null;\nconst assert = (condition, ...infos) => {\n if (!condition)\n console.warn(...infos);\n};\nconst toString = Object.prototype.toString;\nconst isObject = (val) => toString.call(val) === \"[object Object]\";\nconst now = () => Date.now();\nconst timestamp = () => +Date.now();\nconst clamp = (n, min, max) => Math.min(max, Math.max(min, n));\nconst noop = () => {\n};\nconst rand = (min, max) => {\n min = Math.ceil(min);\n max = Math.floor(max);\n return Math.floor(Math.random() * (max - min + 1)) + min;\n};\nconst hasOwn = (val, key) => Object.prototype.hasOwnProperty.call(val, key);\nconst isIOS = /* @__PURE__ */ getIsIOS();\nfunction getIsIOS() {\n var _a, _b;\n return isClient && ((_a = window == null ? void 0 : window.navigator) == null ? void 0 : _a.userAgent) && (/iP(?:ad|hone|od)/.test(window.navigator.userAgent) || ((_b = window == null ? void 0 : window.navigator) == null ? void 0 : _b.maxTouchPoints) > 2 && /iPad|Macintosh/.test(window == null ? void 0 : window.navigator.userAgent));\n}\n\nfunction createFilterWrapper(filter, fn) {\n function wrapper(...args) {\n return new Promise((resolve, reject) => {\n Promise.resolve(filter(() => fn.apply(this, args), { fn, thisArg: this, args })).then(resolve).catch(reject);\n });\n }\n return wrapper;\n}\nconst bypassFilter = (invoke) => {\n return invoke();\n};\nfunction debounceFilter(ms, options = {}) {\n let timer;\n let maxTimer;\n let lastRejector = noop;\n const _clearTimeout = (timer2) => {\n clearTimeout(timer2);\n lastRejector();\n lastRejector = noop;\n };\n const filter = (invoke) => {\n const duration = toValue(ms);\n const maxDuration = toValue(options.maxWait);\n if (timer)\n _clearTimeout(timer);\n if (duration <= 0 || maxDuration !== void 0 && maxDuration <= 0) {\n if (maxTimer) {\n _clearTimeout(maxTimer);\n maxTimer = null;\n }\n return Promise.resolve(invoke());\n }\n return new Promise((resolve, reject) => {\n lastRejector = options.rejectOnCancel ? reject : resolve;\n if (maxDuration && !maxTimer) {\n maxTimer = setTimeout(() => {\n if (timer)\n _clearTimeout(timer);\n maxTimer = null;\n resolve(invoke());\n }, maxDuration);\n }\n timer = setTimeout(() => {\n if (maxTimer)\n _clearTimeout(maxTimer);\n maxTimer = null;\n resolve(invoke());\n }, duration);\n });\n };\n return filter;\n}\nfunction throttleFilter(...args) {\n let lastExec = 0;\n let timer;\n let isLeading = true;\n let lastRejector = noop;\n let lastValue;\n let ms;\n let trailing;\n let leading;\n let rejectOnCancel;\n if (!isRef(args[0]) && typeof args[0] === \"object\")\n ({ delay: ms, trailing = true, leading = true, rejectOnCancel = false } = args[0]);\n else\n [ms, trailing = true, leading = true, rejectOnCancel = false] = args;\n const clear = () => {\n if (timer) {\n clearTimeout(timer);\n timer = void 0;\n lastRejector();\n lastRejector = noop;\n }\n };\n const filter = (_invoke) => {\n const duration = toValue(ms);\n const elapsed = Date.now() - lastExec;\n const invoke = () => {\n return lastValue = _invoke();\n };\n clear();\n if (duration <= 0) {\n lastExec = Date.now();\n return invoke();\n }\n if (elapsed > duration && (leading || !isLeading)) {\n lastExec = Date.now();\n invoke();\n } else if (trailing) {\n lastValue = new Promise((resolve, reject) => {\n lastRejector = rejectOnCancel ? reject : resolve;\n timer = setTimeout(() => {\n lastExec = Date.now();\n isLeading = true;\n resolve(invoke());\n clear();\n }, Math.max(0, duration - elapsed));\n });\n }\n if (!leading && !timer)\n timer = setTimeout(() => isLeading = true, duration);\n isLeading = false;\n return lastValue;\n };\n return filter;\n}\nfunction pausableFilter(extendFilter = bypassFilter) {\n const isActive = ref(true);\n function pause() {\n isActive.value = false;\n }\n function resume() {\n isActive.value = true;\n }\n const eventFilter = (...args) => {\n if (isActive.value)\n extendFilter(...args);\n };\n return { isActive: readonly(isActive), pause, resume, eventFilter };\n}\n\nconst directiveHooks = {\n mounted: isVue3 ? \"mounted\" : \"inserted\",\n updated: isVue3 ? \"updated\" : \"componentUpdated\",\n unmounted: isVue3 ? \"unmounted\" : \"unbind\"\n};\n\nfunction cacheStringFunction(fn) {\n const cache = /* @__PURE__ */ Object.create(null);\n return (str) => {\n const hit = cache[str];\n return hit || (cache[str] = fn(str));\n };\n}\nconst hyphenateRE = /\\B([A-Z])/g;\nconst hyphenate = cacheStringFunction((str) => str.replace(hyphenateRE, \"-$1\").toLowerCase());\nconst camelizeRE = /-(\\w)/g;\nconst camelize = cacheStringFunction((str) => {\n return str.replace(camelizeRE, (_, c) => c ? c.toUpperCase() : \"\");\n});\n\nfunction promiseTimeout(ms, throwOnTimeout = false, reason = \"Timeout\") {\n return new Promise((resolve, reject) => {\n if (throwOnTimeout)\n setTimeout(() => reject(reason), ms);\n else\n setTimeout(resolve, ms);\n });\n}\nfunction identity(arg) {\n return arg;\n}\nfunction createSingletonPromise(fn) {\n let _promise;\n function wrapper() {\n if (!_promise)\n _promise = fn();\n return _promise;\n }\n wrapper.reset = async () => {\n const _prev = _promise;\n _promise = void 0;\n if (_prev)\n await _prev;\n };\n return wrapper;\n}\nfunction invoke(fn) {\n return fn();\n}\nfunction containsProp(obj, ...props) {\n return props.some((k) => k in obj);\n}\nfunction increaseWithUnit(target, delta) {\n var _a;\n if (typeof target === \"number\")\n return target + delta;\n const value = ((_a = target.match(/^-?\\d+\\.?\\d*/)) == null ? void 0 : _a[0]) || \"\";\n const unit = target.slice(value.length);\n const result = Number.parseFloat(value) + delta;\n if (Number.isNaN(result))\n return target;\n return result + unit;\n}\nfunction objectPick(obj, keys, omitUndefined = false) {\n return keys.reduce((n, k) => {\n if (k in obj) {\n if (!omitUndefined || obj[k] !== void 0)\n n[k] = obj[k];\n }\n return n;\n }, {});\n}\nfunction objectOmit(obj, keys, omitUndefined = false) {\n return Object.fromEntries(Object.entries(obj).filter(([key, value]) => {\n return (!omitUndefined || value !== void 0) && !keys.includes(key);\n }));\n}\nfunction objectEntries(obj) {\n return Object.entries(obj);\n}\nfunction getLifeCycleTarget(target) {\n return target || getCurrentInstance();\n}\n\nfunction toRef(...args) {\n if (args.length !== 1)\n return toRef$1(...args);\n const r = args[0];\n return typeof r === \"function\" ? readonly(customRef(() => ({ get: r, set: noop }))) : ref(r);\n}\nconst resolveRef = toRef;\n\nfunction reactivePick(obj, ...keys) {\n const flatKeys = keys.flat();\n const predicate = flatKeys[0];\n return reactiveComputed(() => typeof predicate === \"function\" ? Object.fromEntries(Object.entries(toRefs$1(obj)).filter(([k, v]) => predicate(toValue(v), k))) : Object.fromEntries(flatKeys.map((k) => [k, toRef(obj, k)])));\n}\n\nfunction refAutoReset(defaultValue, afterMs = 1e4) {\n return customRef((track, trigger) => {\n let value = toValue(defaultValue);\n let timer;\n const resetAfter = () => setTimeout(() => {\n value = toValue(defaultValue);\n trigger();\n }, toValue(afterMs));\n tryOnScopeDispose(() => {\n clearTimeout(timer);\n });\n return {\n get() {\n track();\n return value;\n },\n set(newValue) {\n value = newValue;\n trigger();\n clearTimeout(timer);\n timer = resetAfter();\n }\n };\n });\n}\n\nfunction useDebounceFn(fn, ms = 200, options = {}) {\n return createFilterWrapper(\n debounceFilter(ms, options),\n fn\n );\n}\n\nfunction refDebounced(value, ms = 200, options = {}) {\n const debounced = ref(value.value);\n const updater = useDebounceFn(() => {\n debounced.value = value.value;\n }, ms, options);\n watch(value, () => updater());\n return debounced;\n}\n\nfunction refDefault(source, defaultValue) {\n return computed({\n get() {\n var _a;\n return (_a = source.value) != null ? _a : defaultValue;\n },\n set(value) {\n source.value = value;\n }\n });\n}\n\nfunction useThrottleFn(fn, ms = 200, trailing = false, leading = true, rejectOnCancel = false) {\n return createFilterWrapper(\n throttleFilter(ms, trailing, leading, rejectOnCancel),\n fn\n );\n}\n\nfunction refThrottled(value, delay = 200, trailing = true, leading = true) {\n if (delay <= 0)\n return value;\n const throttled = ref(value.value);\n const updater = useThrottleFn(() => {\n throttled.value = value.value;\n }, delay, trailing, leading);\n watch(value, () => updater());\n return throttled;\n}\n\nfunction refWithControl(initial, options = {}) {\n let source = initial;\n let track;\n let trigger;\n const ref = customRef((_track, _trigger) => {\n track = _track;\n trigger = _trigger;\n return {\n get() {\n return get();\n },\n set(v) {\n set(v);\n }\n };\n });\n function get(tracking = true) {\n if (tracking)\n track();\n return source;\n }\n function set(value, triggering = true) {\n var _a, _b;\n if (value === source)\n return;\n const old = source;\n if (((_a = options.onBeforeChange) == null ? void 0 : _a.call(options, value, old)) === false)\n return;\n source = value;\n (_b = options.onChanged) == null ? void 0 : _b.call(options, value, old);\n if (triggering)\n trigger();\n }\n const untrackedGet = () => get(false);\n const silentSet = (v) => set(v, false);\n const peek = () => get(false);\n const lay = (v) => set(v, false);\n return extendRef(\n ref,\n {\n get,\n set,\n untrackedGet,\n silentSet,\n peek,\n lay\n },\n { enumerable: true }\n );\n}\nconst controlledRef = refWithControl;\n\nfunction set(...args) {\n if (args.length === 2) {\n const [ref, value] = args;\n ref.value = value;\n }\n if (args.length === 3) {\n if (isVue2) {\n set$1(...args);\n } else {\n const [target, key, value] = args;\n target[key] = value;\n }\n }\n}\n\nfunction watchWithFilter(source, cb, options = {}) {\n const {\n eventFilter = bypassFilter,\n ...watchOptions\n } = options;\n return watch(\n source,\n createFilterWrapper(\n eventFilter,\n cb\n ),\n watchOptions\n );\n}\n\nfunction watchPausable(source, cb, options = {}) {\n const {\n eventFilter: filter,\n ...watchOptions\n } = options;\n const { eventFilter, pause, resume, isActive } = pausableFilter(filter);\n const stop = watchWithFilter(\n source,\n cb,\n {\n ...watchOptions,\n eventFilter\n }\n );\n return { stop, pause, resume, isActive };\n}\n\nfunction syncRef(left, right, ...[options]) {\n const {\n flush = \"sync\",\n deep = false,\n immediate = true,\n direction = \"both\",\n transform = {}\n } = options || {};\n const watchers = [];\n const transformLTR = \"ltr\" in transform && transform.ltr || ((v) => v);\n const transformRTL = \"rtl\" in transform && transform.rtl || ((v) => v);\n if (direction === \"both\" || direction === \"ltr\") {\n watchers.push(watchPausable(\n left,\n (newValue) => {\n watchers.forEach((w) => w.pause());\n right.value = transformLTR(newValue);\n watchers.forEach((w) => w.resume());\n },\n { flush, deep, immediate }\n ));\n }\n if (direction === \"both\" || direction === \"rtl\") {\n watchers.push(watchPausable(\n right,\n (newValue) => {\n watchers.forEach((w) => w.pause());\n left.value = transformRTL(newValue);\n watchers.forEach((w) => w.resume());\n },\n { flush, deep, immediate }\n ));\n }\n const stop = () => {\n watchers.forEach((w) => w.stop());\n };\n return stop;\n}\n\nfunction syncRefs(source, targets, options = {}) {\n const {\n flush = \"sync\",\n deep = false,\n immediate = true\n } = options;\n if (!Array.isArray(targets))\n targets = [targets];\n return watch(\n source,\n (newValue) => targets.forEach((target) => target.value = newValue),\n { flush, deep, immediate }\n );\n}\n\nfunction toRefs(objectRef, options = {}) {\n if (!isRef(objectRef))\n return toRefs$1(objectRef);\n const result = Array.isArray(objectRef.value) ? Array.from({ length: objectRef.value.length }) : {};\n for (const key in objectRef.value) {\n result[key] = customRef(() => ({\n get() {\n return objectRef.value[key];\n },\n set(v) {\n var _a;\n const replaceRef = (_a = toValue(options.replaceRef)) != null ? _a : true;\n if (replaceRef) {\n if (Array.isArray(objectRef.value)) {\n const copy = [...objectRef.value];\n copy[key] = v;\n objectRef.value = copy;\n } else {\n const newObject = { ...objectRef.value, [key]: v };\n Object.setPrototypeOf(newObject, Object.getPrototypeOf(objectRef.value));\n objectRef.value = newObject;\n }\n } else {\n objectRef.value[key] = v;\n }\n }\n }));\n }\n return result;\n}\n\nfunction tryOnBeforeMount(fn, sync = true, target) {\n const instance = getLifeCycleTarget(target);\n if (instance)\n onBeforeMount(fn, target);\n else if (sync)\n fn();\n else\n nextTick(fn);\n}\n\nfunction tryOnBeforeUnmount(fn, target) {\n const instance = getLifeCycleTarget(target);\n if (instance)\n onBeforeUnmount(fn, target);\n}\n\nfunction tryOnMounted(fn, sync = true, target) {\n const instance = getLifeCycleTarget();\n if (instance)\n onMounted(fn, target);\n else if (sync)\n fn();\n else\n nextTick(fn);\n}\n\nfunction tryOnUnmounted(fn, target) {\n const instance = getLifeCycleTarget(target);\n if (instance)\n onUnmounted(fn, target);\n}\n\nfunction createUntil(r, isNot = false) {\n function toMatch(condition, { flush = \"sync\", deep = false, timeout, throwOnTimeout } = {}) {\n let stop = null;\n const watcher = new Promise((resolve) => {\n stop = watch(\n r,\n (v) => {\n if (condition(v) !== isNot) {\n if (stop)\n stop();\n else\n nextTick(() => stop == null ? void 0 : stop());\n resolve(v);\n }\n },\n {\n flush,\n deep,\n immediate: true\n }\n );\n });\n const promises = [watcher];\n if (timeout != null) {\n promises.push(\n promiseTimeout(timeout, throwOnTimeout).then(() => toValue(r)).finally(() => stop == null ? void 0 : stop())\n );\n }\n return Promise.race(promises);\n }\n function toBe(value, options) {\n if (!isRef(value))\n return toMatch((v) => v === value, options);\n const { flush = \"sync\", deep = false, timeout, throwOnTimeout } = options != null ? options : {};\n let stop = null;\n const watcher = new Promise((resolve) => {\n stop = watch(\n [r, value],\n ([v1, v2]) => {\n if (isNot !== (v1 === v2)) {\n if (stop)\n stop();\n else\n nextTick(() => stop == null ? void 0 : stop());\n resolve(v1);\n }\n },\n {\n flush,\n deep,\n immediate: true\n }\n );\n });\n const promises = [watcher];\n if (timeout != null) {\n promises.push(\n promiseTimeout(timeout, throwOnTimeout).then(() => toValue(r)).finally(() => {\n stop == null ? void 0 : stop();\n return toValue(r);\n })\n );\n }\n return Promise.race(promises);\n }\n function toBeTruthy(options) {\n return toMatch((v) => Boolean(v), options);\n }\n function toBeNull(options) {\n return toBe(null, options);\n }\n function toBeUndefined(options) {\n return toBe(void 0, options);\n }\n function toBeNaN(options) {\n return toMatch(Number.isNaN, options);\n }\n function toContains(value, options) {\n return toMatch((v) => {\n const array = Array.from(v);\n return array.includes(value) || array.includes(toValue(value));\n }, options);\n }\n function changed(options) {\n return changedTimes(1, options);\n }\n function changedTimes(n = 1, options) {\n let count = -1;\n return toMatch(() => {\n count += 1;\n return count >= n;\n }, options);\n }\n if (Array.isArray(toValue(r))) {\n const instance = {\n toMatch,\n toContains,\n changed,\n changedTimes,\n get not() {\n return createUntil(r, !isNot);\n }\n };\n return instance;\n } else {\n const instance = {\n toMatch,\n toBe,\n toBeTruthy,\n toBeNull,\n toBeNaN,\n toBeUndefined,\n changed,\n changedTimes,\n get not() {\n return createUntil(r, !isNot);\n }\n };\n return instance;\n }\n}\nfunction until(r) {\n return createUntil(r);\n}\n\nfunction defaultComparator(value, othVal) {\n return value === othVal;\n}\nfunction useArrayDifference(...args) {\n var _a;\n const list = args[0];\n const values = args[1];\n let compareFn = (_a = args[2]) != null ? _a : defaultComparator;\n if (typeof compareFn === \"string\") {\n const key = compareFn;\n compareFn = (value, othVal) => value[key] === othVal[key];\n }\n return computed(() => toValue(list).filter((x) => toValue(values).findIndex((y) => compareFn(x, y)) === -1));\n}\n\nfunction useArrayEvery(list, fn) {\n return computed(() => toValue(list).every((element, index, array) => fn(toValue(element), index, array)));\n}\n\nfunction useArrayFilter(list, fn) {\n return computed(() => toValue(list).map((i) => toValue(i)).filter(fn));\n}\n\nfunction useArrayFind(list, fn) {\n return computed(() => toValue(\n toValue(list).find((element, index, array) => fn(toValue(element), index, array))\n ));\n}\n\nfunction useArrayFindIndex(list, fn) {\n return computed(() => toValue(list).findIndex((element, index, array) => fn(toValue(element), index, array)));\n}\n\nfunction findLast(arr, cb) {\n let index = arr.length;\n while (index-- > 0) {\n if (cb(arr[index], index, arr))\n return arr[index];\n }\n return void 0;\n}\nfunction useArrayFindLast(list, fn) {\n return computed(() => toValue(\n !Array.prototype.findLast ? findLast(toValue(list), (element, index, array) => fn(toValue(element), index, array)) : toValue(list).findLast((element, index, array) => fn(toValue(element), index, array))\n ));\n}\n\nfunction isArrayIncludesOptions(obj) {\n return isObject(obj) && containsProp(obj, \"formIndex\", \"comparator\");\n}\nfunction useArrayIncludes(...args) {\n var _a;\n const list = args[0];\n const value = args[1];\n let comparator = args[2];\n let formIndex = 0;\n if (isArrayIncludesOptions(comparator)) {\n formIndex = (_a = comparator.fromIndex) != null ? _a : 0;\n comparator = comparator.comparator;\n }\n if (typeof comparator === \"string\") {\n const key = comparator;\n comparator = (element, value2) => element[key] === toValue(value2);\n }\n comparator = comparator != null ? comparator : (element, value2) => element === toValue(value2);\n return computed(() => toValue(list).slice(formIndex).some((element, index, array) => comparator(\n toValue(element),\n toValue(value),\n index,\n toValue(array)\n )));\n}\n\nfunction useArrayJoin(list, separator) {\n return computed(() => toValue(list).map((i) => toValue(i)).join(toValue(separator)));\n}\n\nfunction useArrayMap(list, fn) {\n return computed(() => toValue(list).map((i) => toValue(i)).map(fn));\n}\n\nfunction useArrayReduce(list, reducer, ...args) {\n const reduceCallback = (sum, value, index) => reducer(toValue(sum), toValue(value), index);\n return computed(() => {\n const resolved = toValue(list);\n return args.length ? resolved.reduce(reduceCallback, toValue(args[0])) : resolved.reduce(reduceCallback);\n });\n}\n\nfunction useArraySome(list, fn) {\n return computed(() => toValue(list).some((element, index, array) => fn(toValue(element), index, array)));\n}\n\nfunction uniq(array) {\n return Array.from(new Set(array));\n}\nfunction uniqueElementsBy(array, fn) {\n return array.reduce((acc, v) => {\n if (!acc.some((x) => fn(v, x, array)))\n acc.push(v);\n return acc;\n }, []);\n}\nfunction useArrayUnique(list, compareFn) {\n return computed(() => {\n const resolvedList = toValue(list).map((element) => toValue(element));\n return compareFn ? uniqueElementsBy(resolvedList, compareFn) : uniq(resolvedList);\n });\n}\n\nfunction useCounter(initialValue = 0, options = {}) {\n let _initialValue = unref(initialValue);\n const count = ref(initialValue);\n const {\n max = Number.POSITIVE_INFINITY,\n min = Number.NEGATIVE_INFINITY\n } = options;\n const inc = (delta = 1) => count.value = Math.max(Math.min(max, count.value + delta), min);\n const dec = (delta = 1) => count.value = Math.min(Math.max(min, count.value - delta), max);\n const get = () => count.value;\n const set = (val) => count.value = Math.max(min, Math.min(max, val));\n const reset = (val = _initialValue) => {\n _initialValue = val;\n return set(val);\n };\n return { count, inc, dec, get, set, reset };\n}\n\nconst REGEX_PARSE = /^(\\d{4})[-/]?(\\d{1,2})?[-/]?(\\d{0,2})[T\\s]*(\\d{1,2})?:?(\\d{1,2})?:?(\\d{1,2})?[.:]?(\\d+)?$/i;\nconst REGEX_FORMAT = /[YMDHhms]o|\\[([^\\]]+)\\]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a{1,2}|A{1,2}|m{1,2}|s{1,2}|Z{1,2}|SSS/g;\nfunction defaultMeridiem(hours, minutes, isLowercase, hasPeriod) {\n let m = hours < 12 ? \"AM\" : \"PM\";\n if (hasPeriod)\n m = m.split(\"\").reduce((acc, curr) => acc += `${curr}.`, \"\");\n return isLowercase ? m.toLowerCase() : m;\n}\nfunction formatOrdinal(num) {\n const suffixes = [\"th\", \"st\", \"nd\", \"rd\"];\n const v = num % 100;\n return num + (suffixes[(v - 20) % 10] || suffixes[v] || suffixes[0]);\n}\nfunction formatDate(date, formatStr, options = {}) {\n var _a;\n const years = date.getFullYear();\n const month = date.getMonth();\n const days = date.getDate();\n const hours = date.getHours();\n const minutes = date.getMinutes();\n const seconds = date.getSeconds();\n const milliseconds = date.getMilliseconds();\n const day = date.getDay();\n const meridiem = (_a = options.customMeridiem) != null ? _a : defaultMeridiem;\n const matches = {\n Yo: () => formatOrdinal(years),\n YY: () => String(years).slice(-2),\n YYYY: () => years,\n M: () => month + 1,\n Mo: () => formatOrdinal(month + 1),\n MM: () => `${month + 1}`.padStart(2, \"0\"),\n MMM: () => date.toLocaleDateString(toValue(options.locales), { month: \"short\" }),\n MMMM: () => date.toLocaleDateString(toValue(options.locales), { month: \"long\" }),\n D: () => String(days),\n Do: () => formatOrdinal(days),\n DD: () => `${days}`.padStart(2, \"0\"),\n H: () => String(hours),\n Ho: () => formatOrdinal(hours),\n HH: () => `${hours}`.padStart(2, \"0\"),\n h: () => `${hours % 12 || 12}`.padStart(1, \"0\"),\n ho: () => formatOrdinal(hours % 12 || 12),\n hh: () => `${hours % 12 || 12}`.padStart(2, \"0\"),\n m: () => String(minutes),\n mo: () => formatOrdinal(minutes),\n mm: () => `${minutes}`.padStart(2, \"0\"),\n s: () => String(seconds),\n so: () => formatOrdinal(seconds),\n ss: () => `${seconds}`.padStart(2, \"0\"),\n SSS: () => `${milliseconds}`.padStart(3, \"0\"),\n d: () => day,\n dd: () => date.toLocaleDateString(toValue(options.locales), { weekday: \"narrow\" }),\n ddd: () => date.toLocaleDateString(toValue(options.locales), { weekday: \"short\" }),\n dddd: () => date.toLocaleDateString(toValue(options.locales), { weekday: \"long\" }),\n A: () => meridiem(hours, minutes),\n AA: () => meridiem(hours, minutes, false, true),\n a: () => meridiem(hours, minutes, true),\n aa: () => meridiem(hours, minutes, true, true)\n };\n return formatStr.replace(REGEX_FORMAT, (match, $1) => {\n var _a2, _b;\n return (_b = $1 != null ? $1 : (_a2 = matches[match]) == null ? void 0 : _a2.call(matches)) != null ? _b : match;\n });\n}\nfunction normalizeDate(date) {\n if (date === null)\n return new Date(Number.NaN);\n if (date === void 0)\n return /* @__PURE__ */ new Date();\n if (date instanceof Date)\n return new Date(date);\n if (typeof date === \"string\" && !/Z$/i.test(date)) {\n const d = date.match(REGEX_PARSE);\n if (d) {\n const m = d[2] - 1 || 0;\n const ms = (d[7] || \"0\").substring(0, 3);\n return new Date(d[1], m, d[3] || 1, d[4] || 0, d[5] || 0, d[6] || 0, ms);\n }\n }\n return new Date(date);\n}\nfunction useDateFormat(date, formatStr = \"HH:mm:ss\", options = {}) {\n return computed(() => formatDate(normalizeDate(toValue(date)), toValue(formatStr), options));\n}\n\nfunction useIntervalFn(cb, interval = 1e3, options = {}) {\n const {\n immediate = true,\n immediateCallback = false\n } = options;\n let timer = null;\n const isActive = ref(false);\n function clean() {\n if (timer) {\n clearInterval(timer);\n timer = null;\n }\n }\n function pause() {\n isActive.value = false;\n clean();\n }\n function resume() {\n const intervalValue = toValue(interval);\n if (intervalValue <= 0)\n return;\n isActive.value = true;\n if (immediateCallback)\n cb();\n clean();\n timer = setInterval(cb, intervalValue);\n }\n if (immediate && isClient)\n resume();\n if (isRef(interval) || typeof interval === \"function\") {\n const stopWatch = watch(interval, () => {\n if (isActive.value && isClient)\n resume();\n });\n tryOnScopeDispose(stopWatch);\n }\n tryOnScopeDispose(pause);\n return {\n isActive,\n pause,\n resume\n };\n}\n\nfunction useInterval(interval = 1e3, options = {}) {\n const {\n controls: exposeControls = false,\n immediate = true,\n callback\n } = options;\n const counter = ref(0);\n const update = () => counter.value += 1;\n const reset = () => {\n counter.value = 0;\n };\n const controls = useIntervalFn(\n callback ? () => {\n update();\n callback(counter.value);\n } : update,\n interval,\n { immediate }\n );\n if (exposeControls) {\n return {\n counter,\n reset,\n ...controls\n };\n } else {\n return counter;\n }\n}\n\nfunction useLastChanged(source, options = {}) {\n var _a;\n const ms = ref((_a = options.initialValue) != null ? _a : null);\n watch(\n source,\n () => ms.value = timestamp(),\n options\n );\n return ms;\n}\n\nfunction useTimeoutFn(cb, interval, options = {}) {\n const {\n immediate = true\n } = options;\n const isPending = ref(false);\n let timer = null;\n function clear() {\n if (timer) {\n clearTimeout(timer);\n timer = null;\n }\n }\n function stop() {\n isPending.value = false;\n clear();\n }\n function start(...args) {\n clear();\n isPending.value = true;\n timer = setTimeout(() => {\n isPending.value = false;\n timer = null;\n cb(...args);\n }, toValue(interval));\n }\n if (immediate) {\n isPending.value = true;\n if (isClient)\n start();\n }\n tryOnScopeDispose(stop);\n return {\n isPending: readonly(isPending),\n start,\n stop\n };\n}\n\nfunction useTimeout(interval = 1e3, options = {}) {\n const {\n controls: exposeControls = false,\n callback\n } = options;\n const controls = useTimeoutFn(\n callback != null ? callback : noop,\n interval,\n options\n );\n const ready = computed(() => !controls.isPending.value);\n if (exposeControls) {\n return {\n ready,\n ...controls\n };\n } else {\n return ready;\n }\n}\n\nfunction useToNumber(value, options = {}) {\n const {\n method = \"parseFloat\",\n radix,\n nanToZero\n } = options;\n return computed(() => {\n let resolved = toValue(value);\n if (typeof resolved === \"string\")\n resolved = Number[method](resolved, radix);\n if (nanToZero && Number.isNaN(resolved))\n resolved = 0;\n return resolved;\n });\n}\n\nfunction useToString(value) {\n return computed(() => `${toValue(value)}`);\n}\n\nfunction useToggle(initialValue = false, options = {}) {\n const {\n truthyValue = true,\n falsyValue = false\n } = options;\n const valueIsRef = isRef(initialValue);\n const _value = ref(initialValue);\n function toggle(value) {\n if (arguments.length) {\n _value.value = value;\n return _value.value;\n } else {\n const truthy = toValue(truthyValue);\n _value.value = _value.value === truthy ? toValue(falsyValue) : truthy;\n return _value.value;\n }\n }\n if (valueIsRef)\n return toggle;\n else\n return [_value, toggle];\n}\n\nfunction watchArray(source, cb, options) {\n let oldList = (options == null ? void 0 : options.immediate) ? [] : [...source instanceof Function ? source() : Array.isArray(source) ? source : toValue(source)];\n return watch(source, (newList, _, onCleanup) => {\n const oldListRemains = Array.from({ length: oldList.length });\n const added = [];\n for (const obj of newList) {\n let found = false;\n for (let i = 0; i < oldList.length; i++) {\n if (!oldListRemains[i] && obj === oldList[i]) {\n oldListRemains[i] = true;\n found = true;\n break;\n }\n }\n if (!found)\n added.push(obj);\n }\n const removed = oldList.filter((_2, i) => !oldListRemains[i]);\n cb(newList, oldList, added, removed, onCleanup);\n oldList = [...newList];\n }, options);\n}\n\nfunction watchAtMost(source, cb, options) {\n const {\n count,\n ...watchOptions\n } = options;\n const current = ref(0);\n const stop = watchWithFilter(\n source,\n (...args) => {\n current.value += 1;\n if (current.value >= toValue(count))\n nextTick(() => stop());\n cb(...args);\n },\n watchOptions\n );\n return { count: current, stop };\n}\n\nfunction watchDebounced(source, cb, options = {}) {\n const {\n debounce = 0,\n maxWait = void 0,\n ...watchOptions\n } = options;\n return watchWithFilter(\n source,\n cb,\n {\n ...watchOptions,\n eventFilter: debounceFilter(debounce, { maxWait })\n }\n );\n}\n\nfunction watchDeep(source, cb, options) {\n return watch(\n source,\n cb,\n {\n ...options,\n deep: true\n }\n );\n}\n\nfunction watchIgnorable(source, cb, options = {}) {\n const {\n eventFilter = bypassFilter,\n ...watchOptions\n } = options;\n const filteredCb = createFilterWrapper(\n eventFilter,\n cb\n );\n let ignoreUpdates;\n let ignorePrevAsyncUpdates;\n let stop;\n if (watchOptions.flush === \"sync\") {\n const ignore = ref(false);\n ignorePrevAsyncUpdates = () => {\n };\n ignoreUpdates = (updater) => {\n ignore.value = true;\n updater();\n ignore.value = false;\n };\n stop = watch(\n source,\n (...args) => {\n if (!ignore.value)\n filteredCb(...args);\n },\n watchOptions\n );\n } else {\n const disposables = [];\n const ignoreCounter = ref(0);\n const syncCounter = ref(0);\n ignorePrevAsyncUpdates = () => {\n ignoreCounter.value = syncCounter.value;\n };\n disposables.push(\n watch(\n source,\n () => {\n syncCounter.value++;\n },\n { ...watchOptions, flush: \"sync\" }\n )\n );\n ignoreUpdates = (updater) => {\n const syncCounterPrev = syncCounter.value;\n updater();\n ignoreCounter.value += syncCounter.value - syncCounterPrev;\n };\n disposables.push(\n watch(\n source,\n (...args) => {\n const ignore = ignoreCounter.value > 0 && ignoreCounter.value === syncCounter.value;\n ignoreCounter.value = 0;\n syncCounter.value = 0;\n if (ignore)\n return;\n filteredCb(...args);\n },\n watchOptions\n )\n );\n stop = () => {\n disposables.forEach((fn) => fn());\n };\n }\n return { stop, ignoreUpdates, ignorePrevAsyncUpdates };\n}\n\nfunction watchImmediate(source, cb, options) {\n return watch(\n source,\n cb,\n {\n ...options,\n immediate: true\n }\n );\n}\n\nfunction watchOnce(source, cb, options) {\n const stop = watch(source, (...args) => {\n nextTick(() => stop());\n return cb(...args);\n }, options);\n return stop;\n}\n\nfunction watchThrottled(source, cb, options = {}) {\n const {\n throttle = 0,\n trailing = true,\n leading = true,\n ...watchOptions\n } = options;\n return watchWithFilter(\n source,\n cb,\n {\n ...watchOptions,\n eventFilter: throttleFilter(throttle, trailing, leading)\n }\n );\n}\n\nfunction watchTriggerable(source, cb, options = {}) {\n let cleanupFn;\n function onEffect() {\n if (!cleanupFn)\n return;\n const fn = cleanupFn;\n cleanupFn = void 0;\n fn();\n }\n function onCleanup(callback) {\n cleanupFn = callback;\n }\n const _cb = (value, oldValue) => {\n onEffect();\n return cb(value, oldValue, onCleanup);\n };\n const res = watchIgnorable(source, _cb, options);\n const { ignoreUpdates } = res;\n const trigger = () => {\n let res2;\n ignoreUpdates(() => {\n res2 = _cb(getWatchSources(source), getOldValue(source));\n });\n return res2;\n };\n return {\n ...res,\n trigger\n };\n}\nfunction getWatchSources(sources) {\n if (isReactive(sources))\n return sources;\n if (Array.isArray(sources))\n return sources.map((item) => toValue(item));\n return toValue(sources);\n}\nfunction getOldValue(source) {\n return Array.isArray(source) ? source.map(() => void 0) : void 0;\n}\n\nfunction whenever(source, cb, options) {\n const stop = watch(\n source,\n (v, ov, onInvalidate) => {\n if (v) {\n if (options == null ? void 0 : options.once)\n nextTick(() => stop());\n cb(v, ov, onInvalidate);\n }\n },\n {\n ...options,\n once: false\n }\n );\n return stop;\n}\n\nexport { assert, refAutoReset as autoResetRef, bypassFilter, camelize, clamp, computedEager, computedWithControl, containsProp, computedWithControl as controlledComputed, controlledRef, createEventHook, createFilterWrapper, createGlobalState, createInjectionState, reactify as createReactiveFn, createSharedComposable, createSingletonPromise, debounceFilter, refDebounced as debouncedRef, watchDebounced as debouncedWatch, directiveHooks, computedEager as eagerComputed, extendRef, formatDate, get, getLifeCycleTarget, hasOwn, hyphenate, identity, watchIgnorable as ignorableWatch, increaseWithUnit, injectLocal, invoke, isClient, isDef, isDefined, isIOS, isObject, isWorker, makeDestructurable, noop, normalizeDate, notNullish, now, objectEntries, objectOmit, objectPick, pausableFilter, watchPausable as pausableWatch, promiseTimeout, provideLocal, rand, reactify, reactifyObject, reactiveComputed, reactiveOmit, reactivePick, refAutoReset, refDebounced, refDefault, refThrottled, refWithControl, resolveRef, resolveUnref, set, syncRef, syncRefs, throttleFilter, refThrottled as throttledRef, watchThrottled as throttledWatch, timestamp, toReactive, toRef, toRefs, toValue, tryOnBeforeMount, tryOnBeforeUnmount, tryOnMounted, tryOnScopeDispose, tryOnUnmounted, until, useArrayDifference, useArrayEvery, useArrayFilter, useArrayFind, useArrayFindIndex, useArrayFindLast, useArrayIncludes, useArrayJoin, useArrayMap, useArrayReduce, useArraySome, useArrayUnique, useCounter, useDateFormat, refDebounced as useDebounce, useDebounceFn, useInterval, useIntervalFn, useLastChanged, refThrottled as useThrottle, useThrottleFn, useTimeout, useTimeoutFn, useToNumber, useToString, useToggle, watchArray, watchAtMost, watchDebounced, watchDeep, watchIgnorable, watchImmediate, watchOnce, watchPausable, watchThrottled, watchTriggerable, watchWithFilter, whenever };\n","import Vue from 'vue'\nimport { getCurrentInstance } from 'vue'\n\nvar isVue2 = true\nvar isVue3 = false\nvar Vue2 = Vue\nvar warn = Vue.util.warn\n\nfunction install() {}\n\n// createApp polyfill\nexport function createApp(rootComponent, rootProps) {\n var vm\n var provide = {}\n var app = {\n config: Vue.config,\n use: Vue.use.bind(Vue),\n mixin: Vue.mixin.bind(Vue),\n component: Vue.component.bind(Vue),\n provide: function (key, value) {\n provide[key] = value\n return this\n },\n directive: function (name, dir) {\n if (dir) {\n Vue.directive(name, dir)\n return app\n } else {\n return Vue.directive(name)\n }\n },\n mount: function (el, hydrating) {\n if (!vm) {\n vm = new Vue(Object.assign({ propsData: rootProps }, rootComponent, { provide: Object.assign(provide, rootComponent.provide) }))\n vm.$mount(el, hydrating)\n return vm\n } else {\n return vm\n }\n },\n unmount: function () {\n if (vm) {\n vm.$destroy()\n vm = undefined\n }\n },\n }\n return app\n}\n\nexport {\n Vue,\n Vue2,\n isVue2,\n isVue3,\n install,\n warn\n}\n\n// Vue 3 components mock\nfunction createMockComponent(name) {\n return {\n setup() {\n throw new Error('[vue-demi] ' + name + ' is not supported in Vue 2. It\\'s provided to avoid compiler errors.')\n }\n }\n}\nexport var Fragment = /*#__PURE__*/ createMockComponent('Fragment')\nexport var Transition = /*#__PURE__*/ createMockComponent('Transition')\nexport var TransitionGroup = /*#__PURE__*/ createMockComponent('TransitionGroup')\nexport var Teleport = /*#__PURE__*/ createMockComponent('Teleport')\nexport var Suspense = /*#__PURE__*/ createMockComponent('Suspense')\nexport var KeepAlive = /*#__PURE__*/ createMockComponent('KeepAlive')\n\nexport * from 'vue'\n\n// Not implemented https://github.com/vuejs/core/pull/8111, falls back to getCurrentInstance()\nexport function hasInjectionContext() {\n return !!getCurrentInstance()\n}\n","import { noop, makeDestructurable, camelize, toValue, isClient, isObject, tryOnScopeDispose, isIOS, tryOnMounted, notNullish, objectOmit, promiseTimeout, until, increaseWithUnit, objectEntries, createSingletonPromise, useTimeoutFn, pausableWatch, toRef, createEventHook, computedWithControl, timestamp, pausableFilter, watchIgnorable, debounceFilter, createFilterWrapper, bypassFilter, toRefs, useIntervalFn, containsProp, hasOwn, throttleFilter, useDebounceFn, useThrottleFn, clamp, syncRef, objectPick, tryOnUnmounted, watchWithFilter, tryOnBeforeUnmount, identity, isDef, whenever, isWorker } from '@vueuse/shared';\nexport * from '@vueuse/shared';\nimport { isRef, ref, shallowRef, watchEffect, computed, inject, isVue3, version, defineComponent, h, TransitionGroup, shallowReactive, Fragment, watch, getCurrentInstance, customRef, onUpdated, onMounted, isVue2, readonly, reactive, toRaw, nextTick, markRaw, unref, getCurrentScope, set, del, isReadonly, onBeforeUpdate } from 'vue-demi';\n\nfunction computedAsync(evaluationCallback, initialState, optionsOrRef) {\n let options;\n if (isRef(optionsOrRef)) {\n options = {\n evaluating: optionsOrRef\n };\n } else {\n options = optionsOrRef || {};\n }\n const {\n lazy = false,\n evaluating = void 0,\n shallow = true,\n onError = noop\n } = options;\n const started = ref(!lazy);\n const current = shallow ? shallowRef(initialState) : ref(initialState);\n let counter = 0;\n watchEffect(async (onInvalidate) => {\n if (!started.value)\n return;\n counter++;\n const counterAtBeginning = counter;\n let hasFinished = false;\n if (evaluating) {\n Promise.resolve().then(() => {\n evaluating.value = true;\n });\n }\n try {\n const result = await evaluationCallback((cancelCallback) => {\n onInvalidate(() => {\n if (evaluating)\n evaluating.value = false;\n if (!hasFinished)\n cancelCallback();\n });\n });\n if (counterAtBeginning === counter)\n current.value = result;\n } catch (e) {\n onError(e);\n } finally {\n if (evaluating && counterAtBeginning === counter)\n evaluating.value = false;\n hasFinished = true;\n }\n });\n if (lazy) {\n return computed(() => {\n started.value = true;\n return current.value;\n });\n } else {\n return current;\n }\n}\n\nfunction computedInject(key, options, defaultSource, treatDefaultAsFactory) {\n let source = inject(key);\n if (defaultSource)\n source = inject(key, defaultSource);\n if (treatDefaultAsFactory)\n source = inject(key, defaultSource, treatDefaultAsFactory);\n if (typeof options === \"function\") {\n return computed((ctx) => options(source, ctx));\n } else {\n return computed({\n get: (ctx) => options.get(source, ctx),\n set: options.set\n });\n }\n}\n\nfunction createReusableTemplate(options = {}) {\n if (!isVue3 && !version.startsWith(\"2.7.\")) {\n if (process.env.NODE_ENV !== \"production\")\n throw new Error(\"[VueUse] createReusableTemplate only works in Vue 2.7 or above.\");\n return;\n }\n const {\n inheritAttrs = true\n } = options;\n const render = shallowRef();\n const define = /* #__PURE__ */ defineComponent({\n setup(_, { slots }) {\n return () => {\n render.value = slots.default;\n };\n }\n });\n const reuse = /* #__PURE__ */ defineComponent({\n inheritAttrs,\n setup(_, { attrs, slots }) {\n return () => {\n var _a;\n if (!render.value && process.env.NODE_ENV !== \"production\")\n throw new Error(\"[VueUse] Failed to find the definition of reusable template\");\n const vnode = (_a = render.value) == null ? void 0 : _a.call(render, { ...keysToCamelKebabCase(attrs), $slots: slots });\n return inheritAttrs && (vnode == null ? void 0 : vnode.length) === 1 ? vnode[0] : vnode;\n };\n }\n });\n return makeDestructurable(\n { define, reuse },\n [define, reuse]\n );\n}\nfunction keysToCamelKebabCase(obj) {\n const newObj = {};\n for (const key in obj)\n newObj[camelize(key)] = obj[key];\n return newObj;\n}\n\nfunction createTemplatePromise(options = {}) {\n if (!isVue3) {\n if (process.env.NODE_ENV !== \"production\")\n throw new Error(\"[VueUse] createTemplatePromise only works in Vue 3 or above.\");\n return;\n }\n let index = 0;\n const instances = ref([]);\n function create(...args) {\n const props = shallowReactive({\n key: index++,\n args,\n promise: void 0,\n resolve: () => {\n },\n reject: () => {\n },\n isResolving: false,\n options\n });\n instances.value.push(props);\n props.promise = new Promise((_resolve, _reject) => {\n props.resolve = (v) => {\n props.isResolving = true;\n return _resolve(v);\n };\n props.reject = _reject;\n }).finally(() => {\n props.promise = void 0;\n const index2 = instances.value.indexOf(props);\n if (index2 !== -1)\n instances.value.splice(index2, 1);\n });\n return props.promise;\n }\n function start(...args) {\n if (options.singleton && instances.value.length > 0)\n return instances.value[0].promise;\n return create(...args);\n }\n const component = /* #__PURE__ */ defineComponent((_, { slots }) => {\n const renderList = () => instances.value.map((props) => {\n var _a;\n return h(Fragment, { key: props.key }, (_a = slots.default) == null ? void 0 : _a.call(slots, props));\n });\n if (options.transition)\n return () => h(TransitionGroup, options.transition, renderList);\n return renderList;\n });\n component.start = start;\n return component;\n}\n\nfunction createUnrefFn(fn) {\n return function(...args) {\n return fn.apply(this, args.map((i) => toValue(i)));\n };\n}\n\nfunction unrefElement(elRef) {\n var _a;\n const plain = toValue(elRef);\n return (_a = plain == null ? void 0 : plain.$el) != null ? _a : plain;\n}\n\nconst defaultWindow = isClient ? window : void 0;\nconst defaultDocument = isClient ? window.document : void 0;\nconst defaultNavigator = isClient ? window.navigator : void 0;\nconst defaultLocation = isClient ? window.location : void 0;\n\nfunction useEventListener(...args) {\n let target;\n let events;\n let listeners;\n let options;\n if (typeof args[0] === \"string\" || Array.isArray(args[0])) {\n [events, listeners, options] = args;\n target = defaultWindow;\n } else {\n [target, events, listeners, options] = args;\n }\n if (!target)\n return noop;\n if (!Array.isArray(events))\n events = [events];\n if (!Array.isArray(listeners))\n listeners = [listeners];\n const cleanups = [];\n const cleanup = () => {\n cleanups.forEach((fn) => fn());\n cleanups.length = 0;\n };\n const register = (el, event, listener, options2) => {\n el.addEventListener(event, listener, options2);\n return () => el.removeEventListener(event, listener, options2);\n };\n const stopWatch = watch(\n () => [unrefElement(target), toValue(options)],\n ([el, options2]) => {\n cleanup();\n if (!el)\n return;\n const optionsClone = isObject(options2) ? { ...options2 } : options2;\n cleanups.push(\n ...events.flatMap((event) => {\n return listeners.map((listener) => register(el, event, listener, optionsClone));\n })\n );\n },\n { immediate: true, flush: \"post\" }\n );\n const stop = () => {\n stopWatch();\n cleanup();\n };\n tryOnScopeDispose(stop);\n return stop;\n}\n\nlet _iOSWorkaround = false;\nfunction onClickOutside(target, handler, options = {}) {\n const { window = defaultWindow, ignore = [], capture = true, detectIframe = false } = options;\n if (!window)\n return noop;\n if (isIOS && !_iOSWorkaround) {\n _iOSWorkaround = true;\n Array.from(window.document.body.children).forEach((el) => el.addEventListener(\"click\", noop));\n window.document.documentElement.addEventListener(\"click\", noop);\n }\n let shouldListen = true;\n const shouldIgnore = (event) => {\n return ignore.some((target2) => {\n if (typeof target2 === \"string\") {\n return Array.from(window.document.querySelectorAll(target2)).some((el) => el === event.target || event.composedPath().includes(el));\n } else {\n const el = unrefElement(target2);\n return el && (event.target === el || event.composedPath().includes(el));\n }\n });\n };\n const listener = (event) => {\n const el = unrefElement(target);\n if (!el || el === event.target || event.composedPath().includes(el))\n return;\n if (event.detail === 0)\n shouldListen = !shouldIgnore(event);\n if (!shouldListen) {\n shouldListen = true;\n return;\n }\n handler(event);\n };\n const cleanup = [\n useEventListener(window, \"click\", listener, { passive: true, capture }),\n useEventListener(window, \"pointerdown\", (e) => {\n const el = unrefElement(target);\n shouldListen = !shouldIgnore(e) && !!(el && !e.composedPath().includes(el));\n }, { passive: true }),\n detectIframe && useEventListener(window, \"blur\", (event) => {\n setTimeout(() => {\n var _a;\n const el = unrefElement(target);\n if (((_a = window.document.activeElement) == null ? void 0 : _a.tagName) === \"IFRAME\" && !(el == null ? void 0 : el.contains(window.document.activeElement))) {\n handler(event);\n }\n }, 0);\n })\n ].filter(Boolean);\n const stop = () => cleanup.forEach((fn) => fn());\n return stop;\n}\n\nfunction createKeyPredicate(keyFilter) {\n if (typeof keyFilter === \"function\")\n return keyFilter;\n else if (typeof keyFilter === \"string\")\n return (event) => event.key === keyFilter;\n else if (Array.isArray(keyFilter))\n return (event) => keyFilter.includes(event.key);\n return () => true;\n}\nfunction onKeyStroke(...args) {\n let key;\n let handler;\n let options = {};\n if (args.length === 3) {\n key = args[0];\n handler = args[1];\n options = args[2];\n } else if (args.length === 2) {\n if (typeof args[1] === \"object\") {\n key = true;\n handler = args[0];\n options = args[1];\n } else {\n key = args[0];\n handler = args[1];\n }\n } else {\n key = true;\n handler = args[0];\n }\n const {\n target = defaultWindow,\n eventName = \"keydown\",\n passive = false,\n dedupe = false\n } = options;\n const predicate = createKeyPredicate(key);\n const listener = (e) => {\n if (e.repeat && toValue(dedupe))\n return;\n if (predicate(e))\n handler(e);\n };\n return useEventListener(target, eventName, listener, passive);\n}\nfunction onKeyDown(key, handler, options = {}) {\n return onKeyStroke(key, handler, { ...options, eventName: \"keydown\" });\n}\nfunction onKeyPressed(key, handler, options = {}) {\n return onKeyStroke(key, handler, { ...options, eventName: \"keypress\" });\n}\nfunction onKeyUp(key, handler, options = {}) {\n return onKeyStroke(key, handler, { ...options, eventName: \"keyup\" });\n}\n\nconst DEFAULT_DELAY = 500;\nconst DEFAULT_THRESHOLD = 10;\nfunction onLongPress(target, handler, options) {\n var _a, _b;\n const elementRef = computed(() => unrefElement(target));\n let timeout;\n let posStart;\n let startTimestamp;\n let hasLongPressed = false;\n function clear() {\n if (timeout) {\n clearTimeout(timeout);\n timeout = void 0;\n }\n posStart = void 0;\n startTimestamp = void 0;\n hasLongPressed = false;\n }\n function onRelease(ev) {\n var _a2, _b2, _c;\n const [_startTimestamp, _posStart, _hasLongPressed] = [startTimestamp, posStart, hasLongPressed];\n clear();\n if (!(options == null ? void 0 : options.onMouseUp) || !_posStart || !_startTimestamp)\n return;\n if (((_a2 = options == null ? void 0 : options.modifiers) == null ? void 0 : _a2.self) && ev.target !== elementRef.value)\n return;\n if ((_b2 = options == null ? void 0 : options.modifiers) == null ? void 0 : _b2.prevent)\n ev.preventDefault();\n if ((_c = options == null ? void 0 : options.modifiers) == null ? void 0 : _c.stop)\n ev.stopPropagation();\n const dx = ev.x - _posStart.x;\n const dy = ev.y - _posStart.y;\n const distance = Math.sqrt(dx * dx + dy * dy);\n options.onMouseUp(ev.timeStamp - _startTimestamp, distance, _hasLongPressed);\n }\n function onDown(ev) {\n var _a2, _b2, _c, _d;\n if (((_a2 = options == null ? void 0 : options.modifiers) == null ? void 0 : _a2.self) && ev.target !== elementRef.value)\n return;\n clear();\n if ((_b2 = options == null ? void 0 : options.modifiers) == null ? void 0 : _b2.prevent)\n ev.preventDefault();\n if ((_c = options == null ? void 0 : options.modifiers) == null ? void 0 : _c.stop)\n ev.stopPropagation();\n posStart = {\n x: ev.x,\n y: ev.y\n };\n startTimestamp = ev.timeStamp;\n timeout = setTimeout(\n () => {\n hasLongPressed = true;\n handler(ev);\n },\n (_d = options == null ? void 0 : options.delay) != null ? _d : DEFAULT_DELAY\n );\n }\n function onMove(ev) {\n var _a2, _b2, _c, _d;\n if (((_a2 = options == null ? void 0 : options.modifiers) == null ? void 0 : _a2.self) && ev.target !== elementRef.value)\n return;\n if (!posStart || (options == null ? void 0 : options.distanceThreshold) === false)\n return;\n if ((_b2 = options == null ? void 0 : options.modifiers) == null ? void 0 : _b2.prevent)\n ev.preventDefault();\n if ((_c = options == null ? void 0 : options.modifiers) == null ? void 0 : _c.stop)\n ev.stopPropagation();\n const dx = ev.x - posStart.x;\n const dy = ev.y - posStart.y;\n const distance = Math.sqrt(dx * dx + dy * dy);\n if (distance >= ((_d = options == null ? void 0 : options.distanceThreshold) != null ? _d : DEFAULT_THRESHOLD))\n clear();\n }\n const listenerOptions = {\n capture: (_a = options == null ? void 0 : options.modifiers) == null ? void 0 : _a.capture,\n once: (_b = options == null ? void 0 : options.modifiers) == null ? void 0 : _b.once\n };\n const cleanup = [\n useEventListener(elementRef, \"pointerdown\", onDown, listenerOptions),\n useEventListener(elementRef, \"pointermove\", onMove, listenerOptions),\n useEventListener(elementRef, [\"pointerup\", \"pointerleave\"], onRelease, listenerOptions)\n ];\n const stop = () => cleanup.forEach((fn) => fn());\n return stop;\n}\n\nfunction isFocusedElementEditable() {\n const { activeElement, body } = document;\n if (!activeElement)\n return false;\n if (activeElement === body)\n return false;\n switch (activeElement.tagName) {\n case \"INPUT\":\n case \"TEXTAREA\":\n return true;\n }\n return activeElement.hasAttribute(\"contenteditable\");\n}\nfunction isTypedCharValid({\n keyCode,\n metaKey,\n ctrlKey,\n altKey\n}) {\n if (metaKey || ctrlKey || altKey)\n return false;\n if (keyCode >= 48 && keyCode <= 57)\n return true;\n if (keyCode >= 65 && keyCode <= 90)\n return true;\n if (keyCode >= 97 && keyCode <= 122)\n return true;\n return false;\n}\nfunction onStartTyping(callback, options = {}) {\n const { document: document2 = defaultDocument } = options;\n const keydown = (event) => {\n if (!isFocusedElementEditable() && isTypedCharValid(event)) {\n callback(event);\n }\n };\n if (document2)\n useEventListener(document2, \"keydown\", keydown, { passive: true });\n}\n\nfunction templateRef(key, initialValue = null) {\n const instance = getCurrentInstance();\n let _trigger = () => {\n };\n const element = customRef((track, trigger) => {\n _trigger = trigger;\n return {\n get() {\n var _a, _b;\n track();\n return (_b = (_a = instance == null ? void 0 : instance.proxy) == null ? void 0 : _a.$refs[key]) != null ? _b : initialValue;\n },\n set() {\n }\n };\n });\n tryOnMounted(_trigger);\n onUpdated(_trigger);\n return element;\n}\n\nfunction useMounted() {\n const isMounted = ref(false);\n const instance = getCurrentInstance();\n if (instance) {\n onMounted(() => {\n isMounted.value = true;\n }, isVue2 ? void 0 : instance);\n }\n return isMounted;\n}\n\nfunction useSupported(callback) {\n const isMounted = useMounted();\n return computed(() => {\n isMounted.value;\n return Boolean(callback());\n });\n}\n\nfunction useMutationObserver(target, callback, options = {}) {\n const { window = defaultWindow, ...mutationOptions } = options;\n let observer;\n const isSupported = useSupported(() => window && \"MutationObserver\" in window);\n const cleanup = () => {\n if (observer) {\n observer.disconnect();\n observer = void 0;\n }\n };\n const targets = computed(() => {\n const value = toValue(target);\n const items = (Array.isArray(value) ? value : [value]).map(unrefElement).filter(notNullish);\n return new Set(items);\n });\n const stopWatch = watch(\n () => targets.value,\n (targets2) => {\n cleanup();\n if (isSupported.value && targets2.size) {\n observer = new MutationObserver(callback);\n targets2.forEach((el) => observer.observe(el, mutationOptions));\n }\n },\n { immediate: true, flush: \"post\" }\n );\n const takeRecords = () => {\n return observer == null ? void 0 : observer.takeRecords();\n };\n const stop = () => {\n stopWatch();\n cleanup();\n };\n tryOnScopeDispose(stop);\n return {\n isSupported,\n stop,\n takeRecords\n };\n}\n\nfunction useActiveElement(options = {}) {\n var _a;\n const {\n window = defaultWindow,\n deep = true,\n triggerOnRemoval = false\n } = options;\n const document = (_a = options.document) != null ? _a : window == null ? void 0 : window.document;\n const getDeepActiveElement = () => {\n var _a2;\n let element = document == null ? void 0 : document.activeElement;\n if (deep) {\n while (element == null ? void 0 : element.shadowRoot)\n element = (_a2 = element == null ? void 0 : element.shadowRoot) == null ? void 0 : _a2.activeElement;\n }\n return element;\n };\n const activeElement = ref();\n const trigger = () => {\n activeElement.value = getDeepActiveElement();\n };\n if (window) {\n useEventListener(window, \"blur\", (event) => {\n if (event.relatedTarget !== null)\n return;\n trigger();\n }, true);\n useEventListener(window, \"focus\", trigger, true);\n }\n if (triggerOnRemoval) {\n useMutationObserver(document, (mutations) => {\n mutations.filter((m) => m.removedNodes.length).map((n) => Array.from(n.removedNodes)).flat().forEach((node) => {\n if (node === activeElement.value)\n trigger();\n });\n }, {\n childList: true,\n subtree: true\n });\n }\n trigger();\n return activeElement;\n}\n\nfunction useRafFn(fn, options = {}) {\n const {\n immediate = true,\n fpsLimit = void 0,\n window = defaultWindow\n } = options;\n const isActive = ref(false);\n const intervalLimit = fpsLimit ? 1e3 / fpsLimit : null;\n let previousFrameTimestamp = 0;\n let rafId = null;\n function loop(timestamp) {\n if (!isActive.value || !window)\n return;\n if (!previousFrameTimestamp)\n previousFrameTimestamp = timestamp;\n const delta = timestamp - previousFrameTimestamp;\n if (intervalLimit && delta < intervalLimit) {\n rafId = window.requestAnimationFrame(loop);\n return;\n }\n previousFrameTimestamp = timestamp;\n fn({ delta, timestamp });\n rafId = window.requestAnimationFrame(loop);\n }\n function resume() {\n if (!isActive.value && window) {\n isActive.value = true;\n previousFrameTimestamp = 0;\n rafId = window.requestAnimationFrame(loop);\n }\n }\n function pause() {\n isActive.value = false;\n if (rafId != null && window) {\n window.cancelAnimationFrame(rafId);\n rafId = null;\n }\n }\n if (immediate)\n resume();\n tryOnScopeDispose(pause);\n return {\n isActive: readonly(isActive),\n pause,\n resume\n };\n}\n\nfunction useAnimate(target, keyframes, options) {\n let config;\n let animateOptions;\n if (isObject(options)) {\n config = options;\n animateOptions = objectOmit(options, [\"window\", \"immediate\", \"commitStyles\", \"persist\", \"onReady\", \"onError\"]);\n } else {\n config = { duration: options };\n animateOptions = options;\n }\n const {\n window = defaultWindow,\n immediate = true,\n commitStyles,\n persist,\n playbackRate: _playbackRate = 1,\n onReady,\n onError = (e) => {\n console.error(e);\n }\n } = config;\n const isSupported = useSupported(() => window && HTMLElement && \"animate\" in HTMLElement.prototype);\n const animate = shallowRef(void 0);\n const store = shallowReactive({\n startTime: null,\n currentTime: null,\n timeline: null,\n playbackRate: _playbackRate,\n pending: false,\n playState: immediate ? \"idle\" : \"paused\",\n replaceState: \"active\"\n });\n const pending = computed(() => store.pending);\n const playState = computed(() => store.playState);\n const replaceState = computed(() => store.replaceState);\n const startTime = computed({\n get() {\n return store.startTime;\n },\n set(value) {\n store.startTime = value;\n if (animate.value)\n animate.value.startTime = value;\n }\n });\n const currentTime = computed({\n get() {\n return store.currentTime;\n },\n set(value) {\n store.currentTime = value;\n if (animate.value) {\n animate.value.currentTime = value;\n syncResume();\n }\n }\n });\n const timeline = computed({\n get() {\n return store.timeline;\n },\n set(value) {\n store.timeline = value;\n if (animate.value)\n animate.value.timeline = value;\n }\n });\n const playbackRate = computed({\n get() {\n return store.playbackRate;\n },\n set(value) {\n store.playbackRate = value;\n if (animate.value)\n animate.value.playbackRate = value;\n }\n });\n const play = () => {\n if (animate.value) {\n try {\n animate.value.play();\n syncResume();\n } catch (e) {\n syncPause();\n onError(e);\n }\n } else {\n update();\n }\n };\n const pause = () => {\n var _a;\n try {\n (_a = animate.value) == null ? void 0 : _a.pause();\n syncPause();\n } catch (e) {\n onError(e);\n }\n };\n const reverse = () => {\n var _a;\n if (!animate.value)\n update();\n try {\n (_a = animate.value) == null ? void 0 : _a.reverse();\n syncResume();\n } catch (e) {\n syncPause();\n onError(e);\n }\n };\n const finish = () => {\n var _a;\n try {\n (_a = animate.value) == null ? void 0 : _a.finish();\n syncPause();\n } catch (e) {\n onError(e);\n }\n };\n const cancel = () => {\n var _a;\n try {\n (_a = animate.value) == null ? void 0 : _a.cancel();\n syncPause();\n } catch (e) {\n onError(e);\n }\n };\n watch(() => unrefElement(target), (el) => {\n if (el)\n update();\n });\n watch(() => keyframes, (value) => {\n if (animate.value)\n update();\n if (!unrefElement(target) && animate.value) {\n animate.value.effect = new KeyframeEffect(\n unrefElement(target),\n toValue(value),\n animateOptions\n );\n }\n }, { deep: true });\n tryOnMounted(() => update(true), false);\n tryOnScopeDispose(cancel);\n function update(init) {\n const el = unrefElement(target);\n if (!isSupported.value || !el)\n return;\n if (!animate.value)\n animate.value = el.animate(toValue(keyframes), animateOptions);\n if (persist)\n animate.value.persist();\n if (_playbackRate !== 1)\n animate.value.playbackRate = _playbackRate;\n if (init && !immediate)\n animate.value.pause();\n else\n syncResume();\n onReady == null ? void 0 : onReady(animate.value);\n }\n useEventListener(animate, [\"cancel\", \"finish\", \"remove\"], syncPause);\n useEventListener(animate, \"finish\", () => {\n var _a;\n if (commitStyles)\n (_a = animate.value) == null ? void 0 : _a.commitStyles();\n });\n const { resume: resumeRef, pause: pauseRef } = useRafFn(() => {\n if (!animate.value)\n return;\n store.pending = animate.value.pending;\n store.playState = animate.value.playState;\n store.replaceState = animate.value.replaceState;\n store.startTime = animate.value.startTime;\n store.currentTime = animate.value.currentTime;\n store.timeline = animate.value.timeline;\n store.playbackRate = animate.value.playbackRate;\n }, { immediate: false });\n function syncResume() {\n if (isSupported.value)\n resumeRef();\n }\n function syncPause() {\n if (isSupported.value && window)\n window.requestAnimationFrame(pauseRef);\n }\n return {\n isSupported,\n animate,\n // actions\n play,\n pause,\n reverse,\n finish,\n cancel,\n // state\n pending,\n playState,\n replaceState,\n startTime,\n currentTime,\n timeline,\n playbackRate\n };\n}\n\nfunction useAsyncQueue(tasks, options) {\n const {\n interrupt = true,\n onError = noop,\n onFinished = noop,\n signal\n } = options || {};\n const promiseState = {\n aborted: \"aborted\",\n fulfilled: \"fulfilled\",\n pending: \"pending\",\n rejected: \"rejected\"\n };\n const initialResult = Array.from(Array.from({ length: tasks.length }), () => ({ state: promiseState.pending, data: null }));\n const result = reactive(initialResult);\n const activeIndex = ref(-1);\n if (!tasks || tasks.length === 0) {\n onFinished();\n return {\n activeIndex,\n result\n };\n }\n function updateResult(state, res) {\n activeIndex.value++;\n result[activeIndex.value].data = res;\n result[activeIndex.value].state = state;\n }\n tasks.reduce((prev, curr) => {\n return prev.then((prevRes) => {\n var _a;\n if (signal == null ? void 0 : signal.aborted) {\n updateResult(promiseState.aborted, new Error(\"aborted\"));\n return;\n }\n if (((_a = result[activeIndex.value]) == null ? void 0 : _a.state) === promiseState.rejected && interrupt) {\n onFinished();\n return;\n }\n const done = curr(prevRes).then((currentRes) => {\n updateResult(promiseState.fulfilled, currentRes);\n if (activeIndex.value === tasks.length - 1)\n onFinished();\n return currentRes;\n });\n if (!signal)\n return done;\n return Promise.race([done, whenAborted(signal)]);\n }).catch((e) => {\n if (signal == null ? void 0 : signal.aborted) {\n updateResult(promiseState.aborted, e);\n return e;\n }\n updateResult(promiseState.rejected, e);\n onError();\n return e;\n });\n }, Promise.resolve());\n return {\n activeIndex,\n result\n };\n}\nfunction whenAborted(signal) {\n return new Promise((resolve, reject) => {\n const error = new Error(\"aborted\");\n if (signal.aborted)\n reject(error);\n else\n signal.addEventListener(\"abort\", () => reject(error), { once: true });\n });\n}\n\nfunction useAsyncState(promise, initialState, options) {\n const {\n immediate = true,\n delay = 0,\n onError = noop,\n onSuccess = noop,\n resetOnExecute = true,\n shallow = true,\n throwError\n } = options != null ? options : {};\n const state = shallow ? shallowRef(initialState) : ref(initialState);\n const isReady = ref(false);\n const isLoading = ref(false);\n const error = shallowRef(void 0);\n async function execute(delay2 = 0, ...args) {\n if (resetOnExecute)\n state.value = initialState;\n error.value = void 0;\n isReady.value = false;\n isLoading.value = true;\n if (delay2 > 0)\n await promiseTimeout(delay2);\n const _promise = typeof promise === \"function\" ? promise(...args) : promise;\n try {\n const data = await _promise;\n state.value = data;\n isReady.value = true;\n onSuccess(data);\n } catch (e) {\n error.value = e;\n onError(e);\n if (throwError)\n throw e;\n } finally {\n isLoading.value = false;\n }\n return state.value;\n }\n if (immediate)\n execute(delay);\n const shell = {\n state,\n isReady,\n isLoading,\n error,\n execute\n };\n function waitUntilIsLoaded() {\n return new Promise((resolve, reject) => {\n until(isLoading).toBe(false).then(() => resolve(shell)).catch(reject);\n });\n }\n return {\n ...shell,\n then(onFulfilled, onRejected) {\n return waitUntilIsLoaded().then(onFulfilled, onRejected);\n }\n };\n}\n\nconst defaults = {\n array: (v) => JSON.stringify(v),\n object: (v) => JSON.stringify(v),\n set: (v) => JSON.stringify(Array.from(v)),\n map: (v) => JSON.stringify(Object.fromEntries(v)),\n null: () => \"\"\n};\nfunction getDefaultSerialization(target) {\n if (!target)\n return defaults.null;\n if (target instanceof Map)\n return defaults.map;\n else if (target instanceof Set)\n return defaults.set;\n else if (Array.isArray(target))\n return defaults.array;\n else\n return defaults.object;\n}\n\nfunction useBase64(target, options) {\n const base64 = ref(\"\");\n const promise = ref();\n function execute() {\n if (!isClient)\n return;\n promise.value = new Promise((resolve, reject) => {\n try {\n const _target = toValue(target);\n if (_target == null) {\n resolve(\"\");\n } else if (typeof _target === \"string\") {\n resolve(blobToBase64(new Blob([_target], { type: \"text/plain\" })));\n } else if (_target instanceof Blob) {\n resolve(blobToBase64(_target));\n } else if (_target instanceof ArrayBuffer) {\n resolve(window.btoa(String.fromCharCode(...new Uint8Array(_target))));\n } else if (_target instanceof HTMLCanvasElement) {\n resolve(_target.toDataURL(options == null ? void 0 : options.type, options == null ? void 0 : options.quality));\n } else if (_target instanceof HTMLImageElement) {\n const img = _target.cloneNode(false);\n img.crossOrigin = \"Anonymous\";\n imgLoaded(img).then(() => {\n const canvas = document.createElement(\"canvas\");\n const ctx = canvas.getContext(\"2d\");\n canvas.width = img.width;\n canvas.height = img.height;\n ctx.drawImage(img, 0, 0, canvas.width, canvas.height);\n resolve(canvas.toDataURL(options == null ? void 0 : options.type, options == null ? void 0 : options.quality));\n }).catch(reject);\n } else if (typeof _target === \"object\") {\n const _serializeFn = (options == null ? void 0 : options.serializer) || getDefaultSerialization(_target);\n const serialized = _serializeFn(_target);\n return resolve(blobToBase64(new Blob([serialized], { type: \"application/json\" })));\n } else {\n reject(new Error(\"target is unsupported types\"));\n }\n } catch (error) {\n reject(error);\n }\n });\n promise.value.then((res) => base64.value = res);\n return promise.value;\n }\n if (isRef(target) || typeof target === \"function\")\n watch(target, execute, { immediate: true });\n else\n execute();\n return {\n base64,\n promise,\n execute\n };\n}\nfunction imgLoaded(img) {\n return new Promise((resolve, reject) => {\n if (!img.complete) {\n img.onload = () => {\n resolve();\n };\n img.onerror = reject;\n } else {\n resolve();\n }\n });\n}\nfunction blobToBase64(blob) {\n return new Promise((resolve, reject) => {\n const fr = new FileReader();\n fr.onload = (e) => {\n resolve(e.target.result);\n };\n fr.onerror = reject;\n fr.readAsDataURL(blob);\n });\n}\n\nfunction useBattery(options = {}) {\n const { navigator = defaultNavigator } = options;\n const events = [\"chargingchange\", \"chargingtimechange\", \"dischargingtimechange\", \"levelchange\"];\n const isSupported = useSupported(() => navigator && \"getBattery\" in navigator && typeof navigator.getBattery === \"function\");\n const charging = ref(false);\n const chargingTime = ref(0);\n const dischargingTime = ref(0);\n const level = ref(1);\n let battery;\n function updateBatteryInfo() {\n charging.value = this.charging;\n chargingTime.value = this.chargingTime || 0;\n dischargingTime.value = this.dischargingTime || 0;\n level.value = this.level;\n }\n if (isSupported.value) {\n navigator.getBattery().then((_battery) => {\n battery = _battery;\n updateBatteryInfo.call(battery);\n useEventListener(battery, events, updateBatteryInfo, { passive: true });\n });\n }\n return {\n isSupported,\n charging,\n chargingTime,\n dischargingTime,\n level\n };\n}\n\nfunction useBluetooth(options) {\n let {\n acceptAllDevices = false\n } = options || {};\n const {\n filters = void 0,\n optionalServices = void 0,\n navigator = defaultNavigator\n } = options || {};\n const isSupported = useSupported(() => navigator && \"bluetooth\" in navigator);\n const device = shallowRef(void 0);\n const error = shallowRef(null);\n watch(device, () => {\n connectToBluetoothGATTServer();\n });\n async function requestDevice() {\n if (!isSupported.value)\n return;\n error.value = null;\n if (filters && filters.length > 0)\n acceptAllDevices = false;\n try {\n device.value = await (navigator == null ? void 0 : navigator.bluetooth.requestDevice({\n acceptAllDevices,\n filters,\n optionalServices\n }));\n } catch (err) {\n error.value = err;\n }\n }\n const server = ref();\n const isConnected = computed(() => {\n var _a;\n return ((_a = server.value) == null ? void 0 : _a.connected) || false;\n });\n async function connectToBluetoothGATTServer() {\n error.value = null;\n if (device.value && device.value.gatt) {\n device.value.addEventListener(\"gattserverdisconnected\", () => {\n });\n try {\n server.value = await device.value.gatt.connect();\n } catch (err) {\n error.value = err;\n }\n }\n }\n tryOnMounted(() => {\n var _a;\n if (device.value)\n (_a = device.value.gatt) == null ? void 0 : _a.connect();\n });\n tryOnScopeDispose(() => {\n var _a;\n if (device.value)\n (_a = device.value.gatt) == null ? void 0 : _a.disconnect();\n });\n return {\n isSupported,\n isConnected,\n // Device:\n device,\n requestDevice,\n // Server:\n server,\n // Errors:\n error\n };\n}\n\nfunction useMediaQuery(query, options = {}) {\n const { window = defaultWindow } = options;\n const isSupported = useSupported(() => window && \"matchMedia\" in window && typeof window.matchMedia === \"function\");\n let mediaQuery;\n const matches = ref(false);\n const handler = (event) => {\n matches.value = event.matches;\n };\n const cleanup = () => {\n if (!mediaQuery)\n return;\n if (\"removeEventListener\" in mediaQuery)\n mediaQuery.removeEventListener(\"change\", handler);\n else\n mediaQuery.removeListener(handler);\n };\n const stopWatch = watchEffect(() => {\n if (!isSupported.value)\n return;\n cleanup();\n mediaQuery = window.matchMedia(toValue(query));\n if (\"addEventListener\" in mediaQuery)\n mediaQuery.addEventListener(\"change\", handler);\n else\n mediaQuery.addListener(handler);\n matches.value = mediaQuery.matches;\n });\n tryOnScopeDispose(() => {\n stopWatch();\n cleanup();\n mediaQuery = void 0;\n });\n return matches;\n}\n\nconst breakpointsTailwind = {\n \"sm\": 640,\n \"md\": 768,\n \"lg\": 1024,\n \"xl\": 1280,\n \"2xl\": 1536\n};\nconst breakpointsBootstrapV5 = {\n xs: 0,\n sm: 576,\n md: 768,\n lg: 992,\n xl: 1200,\n xxl: 1400\n};\nconst breakpointsVuetifyV2 = {\n xs: 0,\n sm: 600,\n md: 960,\n lg: 1264,\n xl: 1904\n};\nconst breakpointsVuetifyV3 = {\n xs: 0,\n sm: 600,\n md: 960,\n lg: 1280,\n xl: 1920,\n xxl: 2560\n};\nconst breakpointsVuetify = breakpointsVuetifyV2;\nconst breakpointsAntDesign = {\n xs: 480,\n sm: 576,\n md: 768,\n lg: 992,\n xl: 1200,\n xxl: 1600\n};\nconst breakpointsQuasar = {\n xs: 0,\n sm: 600,\n md: 1024,\n lg: 1440,\n xl: 1920\n};\nconst breakpointsSematic = {\n mobileS: 320,\n mobileM: 375,\n mobileL: 425,\n tablet: 768,\n laptop: 1024,\n laptopL: 1440,\n desktop4K: 2560\n};\nconst breakpointsMasterCss = {\n \"3xs\": 360,\n \"2xs\": 480,\n \"xs\": 600,\n \"sm\": 768,\n \"md\": 1024,\n \"lg\": 1280,\n \"xl\": 1440,\n \"2xl\": 1600,\n \"3xl\": 1920,\n \"4xl\": 2560\n};\nconst breakpointsPrimeFlex = {\n sm: 576,\n md: 768,\n lg: 992,\n xl: 1200\n};\n\nfunction useBreakpoints(breakpoints, options = {}) {\n function getValue(k, delta) {\n let v = toValue(breakpoints[toValue(k)]);\n if (delta != null)\n v = increaseWithUnit(v, delta);\n if (typeof v === \"number\")\n v = `${v}px`;\n return v;\n }\n const { window = defaultWindow, strategy = \"min-width\" } = options;\n function match(query) {\n if (!window)\n return false;\n return window.matchMedia(query).matches;\n }\n const greaterOrEqual = (k) => {\n return useMediaQuery(() => `(min-width: ${getValue(k)})`, options);\n };\n const smallerOrEqual = (k) => {\n return useMediaQuery(() => `(max-width: ${getValue(k)})`, options);\n };\n const shortcutMethods = Object.keys(breakpoints).reduce((shortcuts, k) => {\n Object.defineProperty(shortcuts, k, {\n get: () => strategy === \"min-width\" ? greaterOrEqual(k) : smallerOrEqual(k),\n enumerable: true,\n configurable: true\n });\n return shortcuts;\n }, {});\n function current() {\n const points = Object.keys(breakpoints).map((i) => [i, greaterOrEqual(i)]);\n return computed(() => points.filter(([, v]) => v.value).map(([k]) => k));\n }\n return Object.assign(shortcutMethods, {\n greaterOrEqual,\n smallerOrEqual,\n greater(k) {\n return useMediaQuery(() => `(min-width: ${getValue(k, 0.1)})`, options);\n },\n smaller(k) {\n return useMediaQuery(() => `(max-width: ${getValue(k, -0.1)})`, options);\n },\n between(a, b) {\n return useMediaQuery(() => `(min-width: ${getValue(a)}) and (max-width: ${getValue(b, -0.1)})`, options);\n },\n isGreater(k) {\n return match(`(min-width: ${getValue(k, 0.1)})`);\n },\n isGreaterOrEqual(k) {\n return match(`(min-width: ${getValue(k)})`);\n },\n isSmaller(k) {\n return match(`(max-width: ${getValue(k, -0.1)})`);\n },\n isSmallerOrEqual(k) {\n return match(`(max-width: ${getValue(k)})`);\n },\n isInBetween(a, b) {\n return match(`(min-width: ${getValue(a)}) and (max-width: ${getValue(b, -0.1)})`);\n },\n current,\n active() {\n const bps = current();\n return computed(() => bps.value.length === 0 ? \"\" : bps.value.at(-1));\n }\n });\n}\n\nfunction useBroadcastChannel(options) {\n const {\n name,\n window = defaultWindow\n } = options;\n const isSupported = useSupported(() => window && \"BroadcastChannel\" in window);\n const isClosed = ref(false);\n const channel = ref();\n const data = ref();\n const error = shallowRef(null);\n const post = (data2) => {\n if (channel.value)\n channel.value.postMessage(data2);\n };\n const close = () => {\n if (channel.value)\n channel.value.close();\n isClosed.value = true;\n };\n if (isSupported.value) {\n tryOnMounted(() => {\n error.value = null;\n channel.value = new BroadcastChannel(name);\n channel.value.addEventListener(\"message\", (e) => {\n data.value = e.data;\n }, { passive: true });\n channel.value.addEventListener(\"messageerror\", (e) => {\n error.value = e;\n }, { passive: true });\n channel.value.addEventListener(\"close\", () => {\n isClosed.value = true;\n });\n });\n }\n tryOnScopeDispose(() => {\n close();\n });\n return {\n isSupported,\n channel,\n data,\n post,\n close,\n error,\n isClosed\n };\n}\n\nconst WRITABLE_PROPERTIES = [\n \"hash\",\n \"host\",\n \"hostname\",\n \"href\",\n \"pathname\",\n \"port\",\n \"protocol\",\n \"search\"\n];\nfunction useBrowserLocation(options = {}) {\n const { window = defaultWindow } = options;\n const refs = Object.fromEntries(\n WRITABLE_PROPERTIES.map((key) => [key, ref()])\n );\n for (const [key, ref2] of objectEntries(refs)) {\n watch(ref2, (value) => {\n if (!(window == null ? void 0 : window.location) || window.location[key] === value)\n return;\n window.location[key] = value;\n });\n }\n const buildState = (trigger) => {\n var _a;\n const { state: state2, length } = (window == null ? void 0 : window.history) || {};\n const { origin } = (window == null ? void 0 : window.location) || {};\n for (const key of WRITABLE_PROPERTIES)\n refs[key].value = (_a = window == null ? void 0 : window.location) == null ? void 0 : _a[key];\n return reactive({\n trigger,\n state: state2,\n length,\n origin,\n ...refs\n });\n };\n const state = ref(buildState(\"load\"));\n if (window) {\n useEventListener(window, \"popstate\", () => state.value = buildState(\"popstate\"), { passive: true });\n useEventListener(window, \"hashchange\", () => state.value = buildState(\"hashchange\"), { passive: true });\n }\n return state;\n}\n\nfunction useCached(refValue, comparator = (a, b) => a === b, watchOptions) {\n const cachedValue = ref(refValue.value);\n watch(() => refValue.value, (value) => {\n if (!comparator(value, cachedValue.value))\n cachedValue.value = value;\n }, watchOptions);\n return cachedValue;\n}\n\nfunction usePermission(permissionDesc, options = {}) {\n const {\n controls = false,\n navigator = defaultNavigator\n } = options;\n const isSupported = useSupported(() => navigator && \"permissions\" in navigator);\n const permissionStatus = shallowRef();\n const desc = typeof permissionDesc === \"string\" ? { name: permissionDesc } : permissionDesc;\n const state = shallowRef();\n const update = () => {\n var _a, _b;\n state.value = (_b = (_a = permissionStatus.value) == null ? void 0 : _a.state) != null ? _b : \"prompt\";\n };\n useEventListener(permissionStatus, \"change\", update);\n const query = createSingletonPromise(async () => {\n if (!isSupported.value)\n return;\n if (!permissionStatus.value) {\n try {\n permissionStatus.value = await navigator.permissions.query(desc);\n } catch (e) {\n permissionStatus.value = void 0;\n } finally {\n update();\n }\n }\n if (controls)\n return toRaw(permissionStatus.value);\n });\n query();\n if (controls) {\n return {\n state,\n isSupported,\n query\n };\n } else {\n return state;\n }\n}\n\nfunction useClipboard(options = {}) {\n const {\n navigator = defaultNavigator,\n read = false,\n source,\n copiedDuring = 1500,\n legacy = false\n } = options;\n const isClipboardApiSupported = useSupported(() => navigator && \"clipboard\" in navigator);\n const permissionRead = usePermission(\"clipboard-read\");\n const permissionWrite = usePermission(\"clipboard-write\");\n const isSupported = computed(() => isClipboardApiSupported.value || legacy);\n const text = ref(\"\");\n const copied = ref(false);\n const timeout = useTimeoutFn(() => copied.value = false, copiedDuring);\n function updateText() {\n if (isClipboardApiSupported.value && isAllowed(permissionRead.value)) {\n navigator.clipboard.readText().then((value) => {\n text.value = value;\n });\n } else {\n text.value = legacyRead();\n }\n }\n if (isSupported.value && read)\n useEventListener([\"copy\", \"cut\"], updateText);\n async function copy(value = toValue(source)) {\n if (isSupported.value && value != null) {\n if (isClipboardApiSupported.value && isAllowed(permissionWrite.value))\n await navigator.clipboard.writeText(value);\n else\n legacyCopy(value);\n text.value = value;\n copied.value = true;\n timeout.start();\n }\n }\n function legacyCopy(value) {\n const ta = document.createElement(\"textarea\");\n ta.value = value != null ? value : \"\";\n ta.style.position = \"absolute\";\n ta.style.opacity = \"0\";\n document.body.appendChild(ta);\n ta.select();\n document.execCommand(\"copy\");\n ta.remove();\n }\n function legacyRead() {\n var _a, _b, _c;\n return (_c = (_b = (_a = document == null ? void 0 : document.getSelection) == null ? void 0 : _a.call(document)) == null ? void 0 : _b.toString()) != null ? _c : \"\";\n }\n function isAllowed(status) {\n return status === \"granted\" || status === \"prompt\";\n }\n return {\n isSupported,\n text,\n copied,\n copy\n };\n}\n\nfunction useClipboardItems(options = {}) {\n const {\n navigator = defaultNavigator,\n read = false,\n source,\n copiedDuring = 1500\n } = options;\n const isSupported = useSupported(() => navigator && \"clipboard\" in navigator);\n const content = ref([]);\n const copied = ref(false);\n const timeout = useTimeoutFn(() => copied.value = false, copiedDuring);\n function updateContent() {\n if (isSupported.value) {\n navigator.clipboard.read().then((items) => {\n content.value = items;\n });\n }\n }\n if (isSupported.value && read)\n useEventListener([\"copy\", \"cut\"], updateContent);\n async function copy(value = toValue(source)) {\n if (isSupported.value && value != null) {\n await navigator.clipboard.write(value);\n content.value = value;\n copied.value = true;\n timeout.start();\n }\n }\n return {\n isSupported,\n content,\n copied,\n copy\n };\n}\n\nfunction cloneFnJSON(source) {\n return JSON.parse(JSON.stringify(source));\n}\nfunction useCloned(source, options = {}) {\n const cloned = ref({});\n const {\n manual,\n clone = cloneFnJSON,\n // watch options\n deep = true,\n immediate = true\n } = options;\n function sync() {\n cloned.value = clone(toValue(source));\n }\n if (!manual && (isRef(source) || typeof source === \"function\")) {\n watch(source, sync, {\n ...options,\n deep,\n immediate\n });\n } else {\n sync();\n }\n return { cloned, sync };\n}\n\nconst _global = typeof globalThis !== \"undefined\" ? globalThis : typeof window !== \"undefined\" ? window : typeof global !== \"undefined\" ? global : typeof self !== \"undefined\" ? self : {};\nconst globalKey = \"__vueuse_ssr_handlers__\";\nconst handlers = /* @__PURE__ */ getHandlers();\nfunction getHandlers() {\n if (!(globalKey in _global))\n _global[globalKey] = _global[globalKey] || {};\n return _global[globalKey];\n}\nfunction getSSRHandler(key, fallback) {\n return handlers[key] || fallback;\n}\nfunction setSSRHandler(key, fn) {\n handlers[key] = fn;\n}\n\nfunction guessSerializerType(rawInit) {\n return rawInit == null ? \"any\" : rawInit instanceof Set ? \"set\" : rawInit instanceof Map ? \"map\" : rawInit instanceof Date ? \"date\" : typeof rawInit === \"boolean\" ? \"boolean\" : typeof rawInit === \"string\" ? \"string\" : typeof rawInit === \"object\" ? \"object\" : !Number.isNaN(rawInit) ? \"number\" : \"any\";\n}\n\nconst StorageSerializers = {\n boolean: {\n read: (v) => v === \"true\",\n write: (v) => String(v)\n },\n object: {\n read: (v) => JSON.parse(v),\n write: (v) => JSON.stringify(v)\n },\n number: {\n read: (v) => Number.parseFloat(v),\n write: (v) => String(v)\n },\n any: {\n read: (v) => v,\n write: (v) => String(v)\n },\n string: {\n read: (v) => v,\n write: (v) => String(v)\n },\n map: {\n read: (v) => new Map(JSON.parse(v)),\n write: (v) => JSON.stringify(Array.from(v.entries()))\n },\n set: {\n read: (v) => new Set(JSON.parse(v)),\n write: (v) => JSON.stringify(Array.from(v))\n },\n date: {\n read: (v) => new Date(v),\n write: (v) => v.toISOString()\n }\n};\nconst customStorageEventName = \"vueuse-storage\";\nfunction useStorage(key, defaults, storage, options = {}) {\n var _a;\n const {\n flush = \"pre\",\n deep = true,\n listenToStorageChanges = true,\n writeDefaults = true,\n mergeDefaults = false,\n shallow,\n window = defaultWindow,\n eventFilter,\n onError = (e) => {\n console.error(e);\n },\n initOnMounted\n } = options;\n const data = (shallow ? shallowRef : ref)(typeof defaults === \"function\" ? defaults() : defaults);\n if (!storage) {\n try {\n storage = getSSRHandler(\"getDefaultStorage\", () => {\n var _a2;\n return (_a2 = defaultWindow) == null ? void 0 : _a2.localStorage;\n })();\n } catch (e) {\n onError(e);\n }\n }\n if (!storage)\n return data;\n const rawInit = toValue(defaults);\n const type = guessSerializerType(rawInit);\n const serializer = (_a = options.serializer) != null ? _a : StorageSerializers[type];\n const { pause: pauseWatch, resume: resumeWatch } = pausableWatch(\n data,\n () => write(data.value),\n { flush, deep, eventFilter }\n );\n if (window && listenToStorageChanges) {\n tryOnMounted(() => {\n if (storage instanceof Storage)\n useEventListener(window, \"storage\", update);\n else\n useEventListener(window, customStorageEventName, updateFromCustomEvent);\n if (initOnMounted)\n update();\n });\n }\n if (!initOnMounted)\n update();\n function dispatchWriteEvent(oldValue, newValue) {\n if (window) {\n const payload = {\n key,\n oldValue,\n newValue,\n storageArea: storage\n };\n window.dispatchEvent(storage instanceof Storage ? new StorageEvent(\"storage\", payload) : new CustomEvent(customStorageEventName, {\n detail: payload\n }));\n }\n }\n function write(v) {\n try {\n const oldValue = storage.getItem(key);\n if (v == null) {\n dispatchWriteEvent(oldValue, null);\n storage.removeItem(key);\n } else {\n const serialized = serializer.write(v);\n if (oldValue !== serialized) {\n storage.setItem(key, serialized);\n dispatchWriteEvent(oldValue, serialized);\n }\n }\n } catch (e) {\n onError(e);\n }\n }\n function read(event) {\n const rawValue = event ? event.newValue : storage.getItem(key);\n if (rawValue == null) {\n if (writeDefaults && rawInit != null)\n storage.setItem(key, serializer.write(rawInit));\n return rawInit;\n } else if (!event && mergeDefaults) {\n const value = serializer.read(rawValue);\n if (typeof mergeDefaults === \"function\")\n return mergeDefaults(value, rawInit);\n else if (type === \"object\" && !Array.isArray(value))\n return { ...rawInit, ...value };\n return value;\n } else if (typeof rawValue !== \"string\") {\n return rawValue;\n } else {\n return serializer.read(rawValue);\n }\n }\n function update(event) {\n if (event && event.storageArea !== storage)\n return;\n if (event && event.key == null) {\n data.value = rawInit;\n return;\n }\n if (event && event.key !== key)\n return;\n pauseWatch();\n try {\n if ((event == null ? void 0 : event.newValue) !== serializer.write(data.value))\n data.value = read(event);\n } catch (e) {\n onError(e);\n } finally {\n if (event)\n nextTick(resumeWatch);\n else\n resumeWatch();\n }\n }\n function updateFromCustomEvent(event) {\n update(event.detail);\n }\n return data;\n}\n\nfunction usePreferredDark(options) {\n return useMediaQuery(\"(prefers-color-scheme: dark)\", options);\n}\n\nconst CSS_DISABLE_TRANS = \"*,*::before,*::after{-webkit-transition:none!important;-moz-transition:none!important;-o-transition:none!important;-ms-transition:none!important;transition:none!important}\";\nfunction useColorMode(options = {}) {\n const {\n selector = \"html\",\n attribute = \"class\",\n initialValue = \"auto\",\n window = defaultWindow,\n storage,\n storageKey = \"vueuse-color-scheme\",\n listenToStorageChanges = true,\n storageRef,\n emitAuto,\n disableTransition = true\n } = options;\n const modes = {\n auto: \"\",\n light: \"light\",\n dark: \"dark\",\n ...options.modes || {}\n };\n const preferredDark = usePreferredDark({ window });\n const system = computed(() => preferredDark.value ? \"dark\" : \"light\");\n const store = storageRef || (storageKey == null ? toRef(initialValue) : useStorage(storageKey, initialValue, storage, { window, listenToStorageChanges }));\n const state = computed(() => store.value === \"auto\" ? system.value : store.value);\n const updateHTMLAttrs = getSSRHandler(\n \"updateHTMLAttrs\",\n (selector2, attribute2, value) => {\n const el = typeof selector2 === \"string\" ? window == null ? void 0 : window.document.querySelector(selector2) : unrefElement(selector2);\n if (!el)\n return;\n const classesToAdd = /* @__PURE__ */ new Set();\n const classesToRemove = /* @__PURE__ */ new Set();\n let attributeToChange = null;\n if (attribute2 === \"class\") {\n const current = value.split(/\\s/g);\n Object.values(modes).flatMap((i) => (i || \"\").split(/\\s/g)).filter(Boolean).forEach((v) => {\n if (current.includes(v))\n classesToAdd.add(v);\n else\n classesToRemove.add(v);\n });\n } else {\n attributeToChange = { key: attribute2, value };\n }\n if (classesToAdd.size === 0 && classesToRemove.size === 0 && attributeToChange === null)\n return;\n let style;\n if (disableTransition) {\n style = window.document.createElement(\"style\");\n style.appendChild(document.createTextNode(CSS_DISABLE_TRANS));\n window.document.head.appendChild(style);\n }\n for (const c of classesToAdd) {\n el.classList.add(c);\n }\n for (const c of classesToRemove) {\n el.classList.remove(c);\n }\n if (attributeToChange) {\n el.setAttribute(attributeToChange.key, attributeToChange.value);\n }\n if (disableTransition) {\n window.getComputedStyle(style).opacity;\n document.head.removeChild(style);\n }\n }\n );\n function defaultOnChanged(mode) {\n var _a;\n updateHTMLAttrs(selector, attribute, (_a = modes[mode]) != null ? _a : mode);\n }\n function onChanged(mode) {\n if (options.onChanged)\n options.onChanged(mode, defaultOnChanged);\n else\n defaultOnChanged(mode);\n }\n watch(state, onChanged, { flush: \"post\", immediate: true });\n tryOnMounted(() => onChanged(state.value));\n const auto = computed({\n get() {\n return emitAuto ? store.value : state.value;\n },\n set(v) {\n store.value = v;\n }\n });\n try {\n return Object.assign(auto, { store, system, state });\n } catch (e) {\n return auto;\n }\n}\n\nfunction useConfirmDialog(revealed = ref(false)) {\n const confirmHook = createEventHook();\n const cancelHook = createEventHook();\n const revealHook = createEventHook();\n let _resolve = noop;\n const reveal = (data) => {\n revealHook.trigger(data);\n revealed.value = true;\n return new Promise((resolve) => {\n _resolve = resolve;\n });\n };\n const confirm = (data) => {\n revealed.value = false;\n confirmHook.trigger(data);\n _resolve({ data, isCanceled: false });\n };\n const cancel = (data) => {\n revealed.value = false;\n cancelHook.trigger(data);\n _resolve({ data, isCanceled: true });\n };\n return {\n isRevealed: computed(() => revealed.value),\n reveal,\n confirm,\n cancel,\n onReveal: revealHook.on,\n onConfirm: confirmHook.on,\n onCancel: cancelHook.on\n };\n}\n\nfunction useCssVar(prop, target, options = {}) {\n const { window = defaultWindow, initialValue, observe = false } = options;\n const variable = ref(initialValue);\n const elRef = computed(() => {\n var _a;\n return unrefElement(target) || ((_a = window == null ? void 0 : window.document) == null ? void 0 : _a.documentElement);\n });\n function updateCssVar() {\n var _a;\n const key = toValue(prop);\n const el = toValue(elRef);\n if (el && window && key) {\n const value = (_a = window.getComputedStyle(el).getPropertyValue(key)) == null ? void 0 : _a.trim();\n variable.value = value || initialValue;\n }\n }\n if (observe) {\n useMutationObserver(elRef, updateCssVar, {\n attributeFilter: [\"style\", \"class\"],\n window\n });\n }\n watch(\n [elRef, () => toValue(prop)],\n (_, old) => {\n if (old[0] && old[1])\n old[0].style.removeProperty(old[1]);\n updateCssVar();\n },\n { immediate: true }\n );\n watch(\n variable,\n (val) => {\n var _a;\n const raw_prop = toValue(prop);\n if (((_a = elRef.value) == null ? void 0 : _a.style) && raw_prop) {\n if (val == null)\n elRef.value.style.removeProperty(raw_prop);\n else\n elRef.value.style.setProperty(raw_prop, val);\n }\n }\n );\n return variable;\n}\n\nfunction useCurrentElement(rootComponent) {\n const vm = getCurrentInstance();\n const currentElement = computedWithControl(\n () => null,\n () => rootComponent ? unrefElement(rootComponent) : vm.proxy.$el\n );\n onUpdated(currentElement.trigger);\n onMounted(currentElement.trigger);\n return currentElement;\n}\n\nfunction useCycleList(list, options) {\n const state = shallowRef(getInitialValue());\n const listRef = toRef(list);\n const index = computed({\n get() {\n var _a;\n const targetList = listRef.value;\n let index2 = (options == null ? void 0 : options.getIndexOf) ? options.getIndexOf(state.value, targetList) : targetList.indexOf(state.value);\n if (index2 < 0)\n index2 = (_a = options == null ? void 0 : options.fallbackIndex) != null ? _a : 0;\n return index2;\n },\n set(v) {\n set(v);\n }\n });\n function set(i) {\n const targetList = listRef.value;\n const length = targetList.length;\n const index2 = (i % length + length) % length;\n const value = targetList[index2];\n state.value = value;\n return value;\n }\n function shift(delta = 1) {\n return set(index.value + delta);\n }\n function next(n = 1) {\n return shift(n);\n }\n function prev(n = 1) {\n return shift(-n);\n }\n function getInitialValue() {\n var _a, _b;\n return (_b = toValue((_a = options == null ? void 0 : options.initialValue) != null ? _a : toValue(list)[0])) != null ? _b : void 0;\n }\n watch(listRef, () => set(index.value));\n return {\n state,\n index,\n next,\n prev,\n go: set\n };\n}\n\nfunction useDark(options = {}) {\n const {\n valueDark = \"dark\",\n valueLight = \"\",\n window = defaultWindow\n } = options;\n const mode = useColorMode({\n ...options,\n onChanged: (mode2, defaultHandler) => {\n var _a;\n if (options.onChanged)\n (_a = options.onChanged) == null ? void 0 : _a.call(options, mode2 === \"dark\", defaultHandler, mode2);\n else\n defaultHandler(mode2);\n },\n modes: {\n dark: valueDark,\n light: valueLight\n }\n });\n const system = computed(() => {\n if (mode.system) {\n return mode.system.value;\n } else {\n const preferredDark = usePreferredDark({ window });\n return preferredDark.value ? \"dark\" : \"light\";\n }\n });\n const isDark = computed({\n get() {\n return mode.value === \"dark\";\n },\n set(v) {\n const modeVal = v ? \"dark\" : \"light\";\n if (system.value === modeVal)\n mode.value = \"auto\";\n else\n mode.value = modeVal;\n }\n });\n return isDark;\n}\n\nfunction fnBypass(v) {\n return v;\n}\nfunction fnSetSource(source, value) {\n return source.value = value;\n}\nfunction defaultDump(clone) {\n return clone ? typeof clone === \"function\" ? clone : cloneFnJSON : fnBypass;\n}\nfunction defaultParse(clone) {\n return clone ? typeof clone === \"function\" ? clone : cloneFnJSON : fnBypass;\n}\nfunction useManualRefHistory(source, options = {}) {\n const {\n clone = false,\n dump = defaultDump(clone),\n parse = defaultParse(clone),\n setSource = fnSetSource\n } = options;\n function _createHistoryRecord() {\n return markRaw({\n snapshot: dump(source.value),\n timestamp: timestamp()\n });\n }\n const last = ref(_createHistoryRecord());\n const undoStack = ref([]);\n const redoStack = ref([]);\n const _setSource = (record) => {\n setSource(source, parse(record.snapshot));\n last.value = record;\n };\n const commit = () => {\n undoStack.value.unshift(last.value);\n last.value = _createHistoryRecord();\n if (options.capacity && undoStack.value.length > options.capacity)\n undoStack.value.splice(options.capacity, Number.POSITIVE_INFINITY);\n if (redoStack.value.length)\n redoStack.value.splice(0, redoStack.value.length);\n };\n const clear = () => {\n undoStack.value.splice(0, undoStack.value.length);\n redoStack.value.splice(0, redoStack.value.length);\n };\n const undo = () => {\n const state = undoStack.value.shift();\n if (state) {\n redoStack.value.unshift(last.value);\n _setSource(state);\n }\n };\n const redo = () => {\n const state = redoStack.value.shift();\n if (state) {\n undoStack.value.unshift(last.value);\n _setSource(state);\n }\n };\n const reset = () => {\n _setSource(last.value);\n };\n const history = computed(() => [last.value, ...undoStack.value]);\n const canUndo = computed(() => undoStack.value.length > 0);\n const canRedo = computed(() => redoStack.value.length > 0);\n return {\n source,\n undoStack,\n redoStack,\n last,\n history,\n canUndo,\n canRedo,\n clear,\n commit,\n reset,\n undo,\n redo\n };\n}\n\nfunction useRefHistory(source, options = {}) {\n const {\n deep = false,\n flush = \"pre\",\n eventFilter\n } = options;\n const {\n eventFilter: composedFilter,\n pause,\n resume: resumeTracking,\n isActive: isTracking\n } = pausableFilter(eventFilter);\n const {\n ignoreUpdates,\n ignorePrevAsyncUpdates,\n stop\n } = watchIgnorable(\n source,\n commit,\n { deep, flush, eventFilter: composedFilter }\n );\n function setSource(source2, value) {\n ignorePrevAsyncUpdates();\n ignoreUpdates(() => {\n source2.value = value;\n });\n }\n const manualHistory = useManualRefHistory(source, { ...options, clone: options.clone || deep, setSource });\n const { clear, commit: manualCommit } = manualHistory;\n function commit() {\n ignorePrevAsyncUpdates();\n manualCommit();\n }\n function resume(commitNow) {\n resumeTracking();\n if (commitNow)\n commit();\n }\n function batch(fn) {\n let canceled = false;\n const cancel = () => canceled = true;\n ignoreUpdates(() => {\n fn(cancel);\n });\n if (!canceled)\n commit();\n }\n function dispose() {\n stop();\n clear();\n }\n return {\n ...manualHistory,\n isTracking,\n pause,\n resume,\n commit,\n batch,\n dispose\n };\n}\n\nfunction useDebouncedRefHistory(source, options = {}) {\n const filter = options.debounce ? debounceFilter(options.debounce) : void 0;\n const history = useRefHistory(source, { ...options, eventFilter: filter });\n return {\n ...history\n };\n}\n\nfunction useDeviceMotion(options = {}) {\n const {\n window = defaultWindow,\n eventFilter = bypassFilter\n } = options;\n const acceleration = ref({ x: null, y: null, z: null });\n const rotationRate = ref({ alpha: null, beta: null, gamma: null });\n const interval = ref(0);\n const accelerationIncludingGravity = ref({\n x: null,\n y: null,\n z: null\n });\n if (window) {\n const onDeviceMotion = createFilterWrapper(\n eventFilter,\n (event) => {\n acceleration.value = event.acceleration;\n accelerationIncludingGravity.value = event.accelerationIncludingGravity;\n rotationRate.value = event.rotationRate;\n interval.value = event.interval;\n }\n );\n useEventListener(window, \"devicemotion\", onDeviceMotion);\n }\n return {\n acceleration,\n accelerationIncludingGravity,\n rotationRate,\n interval\n };\n}\n\nfunction useDeviceOrientation(options = {}) {\n const { window = defaultWindow } = options;\n const isSupported = useSupported(() => window && \"DeviceOrientationEvent\" in window);\n const isAbsolute = ref(false);\n const alpha = ref(null);\n const beta = ref(null);\n const gamma = ref(null);\n if (window && isSupported.value) {\n useEventListener(window, \"deviceorientation\", (event) => {\n isAbsolute.value = event.absolute;\n alpha.value = event.alpha;\n beta.value = event.beta;\n gamma.value = event.gamma;\n });\n }\n return {\n isSupported,\n isAbsolute,\n alpha,\n beta,\n gamma\n };\n}\n\nfunction useDevicePixelRatio(options = {}) {\n const {\n window = defaultWindow\n } = options;\n const pixelRatio = ref(1);\n if (window) {\n let observe2 = function() {\n pixelRatio.value = window.devicePixelRatio;\n cleanup2();\n media = window.matchMedia(`(resolution: ${pixelRatio.value}dppx)`);\n media.addEventListener(\"change\", observe2, { once: true });\n }, cleanup2 = function() {\n media == null ? void 0 : media.removeEventListener(\"change\", observe2);\n };\n let media;\n observe2();\n tryOnScopeDispose(cleanup2);\n }\n return { pixelRatio };\n}\n\nfunction useDevicesList(options = {}) {\n const {\n navigator = defaultNavigator,\n requestPermissions = false,\n constraints = { audio: true, video: true },\n onUpdated\n } = options;\n const devices = ref([]);\n const videoInputs = computed(() => devices.value.filter((i) => i.kind === \"videoinput\"));\n const audioInputs = computed(() => devices.value.filter((i) => i.kind === \"audioinput\"));\n const audioOutputs = computed(() => devices.value.filter((i) => i.kind === \"audiooutput\"));\n const isSupported = useSupported(() => navigator && navigator.mediaDevices && navigator.mediaDevices.enumerateDevices);\n const permissionGranted = ref(false);\n let stream;\n async function update() {\n if (!isSupported.value)\n return;\n devices.value = await navigator.mediaDevices.enumerateDevices();\n onUpdated == null ? void 0 : onUpdated(devices.value);\n if (stream) {\n stream.getTracks().forEach((t) => t.stop());\n stream = null;\n }\n }\n async function ensurePermissions() {\n if (!isSupported.value)\n return false;\n if (permissionGranted.value)\n return true;\n const { state, query } = usePermission(\"camera\", { controls: true });\n await query();\n if (state.value !== \"granted\") {\n stream = await navigator.mediaDevices.getUserMedia(constraints);\n update();\n permissionGranted.value = true;\n } else {\n permissionGranted.value = true;\n }\n return permissionGranted.value;\n }\n if (isSupported.value) {\n if (requestPermissions)\n ensurePermissions();\n useEventListener(navigator.mediaDevices, \"devicechange\", update);\n update();\n }\n return {\n devices,\n ensurePermissions,\n permissionGranted,\n videoInputs,\n audioInputs,\n audioOutputs,\n isSupported\n };\n}\n\nfunction useDisplayMedia(options = {}) {\n var _a;\n const enabled = ref((_a = options.enabled) != null ? _a : false);\n const video = options.video;\n const audio = options.audio;\n const { navigator = defaultNavigator } = options;\n const isSupported = useSupported(() => {\n var _a2;\n return (_a2 = navigator == null ? void 0 : navigator.mediaDevices) == null ? void 0 : _a2.getDisplayMedia;\n });\n const constraint = { audio, video };\n const stream = shallowRef();\n async function _start() {\n var _a2;\n if (!isSupported.value || stream.value)\n return;\n stream.value = await navigator.mediaDevices.getDisplayMedia(constraint);\n (_a2 = stream.value) == null ? void 0 : _a2.getTracks().forEach((t) => t.addEventListener(\"ended\", stop));\n return stream.value;\n }\n async function _stop() {\n var _a2;\n (_a2 = stream.value) == null ? void 0 : _a2.getTracks().forEach((t) => t.stop());\n stream.value = void 0;\n }\n function stop() {\n _stop();\n enabled.value = false;\n }\n async function start() {\n await _start();\n if (stream.value)\n enabled.value = true;\n return stream.value;\n }\n watch(\n enabled,\n (v) => {\n if (v)\n _start();\n else\n _stop();\n },\n { immediate: true }\n );\n return {\n isSupported,\n stream,\n start,\n stop,\n enabled\n };\n}\n\nfunction useDocumentVisibility(options = {}) {\n const { document = defaultDocument } = options;\n if (!document)\n return ref(\"visible\");\n const visibility = ref(document.visibilityState);\n useEventListener(document, \"visibilitychange\", () => {\n visibility.value = document.visibilityState;\n });\n return visibility;\n}\n\nfunction useDraggable(target, options = {}) {\n var _a, _b;\n const {\n pointerTypes,\n preventDefault,\n stopPropagation,\n exact,\n onMove,\n onEnd,\n onStart,\n initialValue,\n axis = \"both\",\n draggingElement = defaultWindow,\n containerElement,\n handle: draggingHandle = target,\n buttons = [0]\n } = options;\n const position = ref(\n (_a = toValue(initialValue)) != null ? _a : { x: 0, y: 0 }\n );\n const pressedDelta = ref();\n const filterEvent = (e) => {\n if (pointerTypes)\n return pointerTypes.includes(e.pointerType);\n return true;\n };\n const handleEvent = (e) => {\n if (toValue(preventDefault))\n e.preventDefault();\n if (toValue(stopPropagation))\n e.stopPropagation();\n };\n const start = (e) => {\n var _a2;\n if (!toValue(buttons).includes(e.button))\n return;\n if (toValue(options.disabled) || !filterEvent(e))\n return;\n if (toValue(exact) && e.target !== toValue(target))\n return;\n const container = toValue(containerElement);\n const containerRect = (_a2 = container == null ? void 0 : container.getBoundingClientRect) == null ? void 0 : _a2.call(container);\n const targetRect = toValue(target).getBoundingClientRect();\n const pos = {\n x: e.clientX - (container ? targetRect.left - containerRect.left + container.scrollLeft : targetRect.left),\n y: e.clientY - (container ? targetRect.top - containerRect.top + container.scrollTop : targetRect.top)\n };\n if ((onStart == null ? void 0 : onStart(pos, e)) === false)\n return;\n pressedDelta.value = pos;\n handleEvent(e);\n };\n const move = (e) => {\n if (toValue(options.disabled) || !filterEvent(e))\n return;\n if (!pressedDelta.value)\n return;\n const container = toValue(containerElement);\n const targetRect = toValue(target).getBoundingClientRect();\n let { x, y } = position.value;\n if (axis === \"x\" || axis === \"both\") {\n x = e.clientX - pressedDelta.value.x;\n if (container)\n x = Math.min(Math.max(0, x), container.scrollWidth - targetRect.width);\n }\n if (axis === \"y\" || axis === \"both\") {\n y = e.clientY - pressedDelta.value.y;\n if (container)\n y = Math.min(Math.max(0, y), container.scrollHeight - targetRect.height);\n }\n position.value = {\n x,\n y\n };\n onMove == null ? void 0 : onMove(position.value, e);\n handleEvent(e);\n };\n const end = (e) => {\n if (toValue(options.disabled) || !filterEvent(e))\n return;\n if (!pressedDelta.value)\n return;\n pressedDelta.value = void 0;\n onEnd == null ? void 0 : onEnd(position.value, e);\n handleEvent(e);\n };\n if (isClient) {\n const config = { capture: (_b = options.capture) != null ? _b : true };\n useEventListener(draggingHandle, \"pointerdown\", start, config);\n useEventListener(draggingElement, \"pointermove\", move, config);\n useEventListener(draggingElement, \"pointerup\", end, config);\n }\n return {\n ...toRefs(position),\n position,\n isDragging: computed(() => !!pressedDelta.value),\n style: computed(\n () => `left:${position.value.x}px;top:${position.value.y}px;`\n )\n };\n}\n\nfunction useDropZone(target, options = {}) {\n const isOverDropZone = ref(false);\n const files = shallowRef(null);\n let counter = 0;\n let isDataTypeIncluded = true;\n if (isClient) {\n const _options = typeof options === \"function\" ? { onDrop: options } : options;\n const getFiles = (event) => {\n var _a, _b;\n const list = Array.from((_b = (_a = event.dataTransfer) == null ? void 0 : _a.files) != null ? _b : []);\n return files.value = list.length === 0 ? null : list;\n };\n useEventListener(target, \"dragenter\", (event) => {\n var _a, _b;\n const types = Array.from(((_a = event == null ? void 0 : event.dataTransfer) == null ? void 0 : _a.items) || []).map((i) => i.kind === \"file\" ? i.type : null).filter(notNullish);\n if (_options.dataTypes && event.dataTransfer) {\n const dataTypes = unref(_options.dataTypes);\n isDataTypeIncluded = typeof dataTypes === \"function\" ? dataTypes(types) : dataTypes ? dataTypes.some((item) => types.includes(item)) : true;\n if (!isDataTypeIncluded)\n return;\n }\n event.preventDefault();\n counter += 1;\n isOverDropZone.value = true;\n const files2 = getFiles(event);\n (_b = _options.onEnter) == null ? void 0 : _b.call(_options, files2, event);\n });\n useEventListener(target, \"dragover\", (event) => {\n var _a;\n if (!isDataTypeIncluded)\n return;\n event.preventDefault();\n const files2 = getFiles(event);\n (_a = _options.onOver) == null ? void 0 : _a.call(_options, files2, event);\n });\n useEventListener(target, \"dragleave\", (event) => {\n var _a;\n if (!isDataTypeIncluded)\n return;\n event.preventDefault();\n counter -= 1;\n if (counter === 0)\n isOverDropZone.value = false;\n const files2 = getFiles(event);\n (_a = _options.onLeave) == null ? void 0 : _a.call(_options, files2, event);\n });\n useEventListener(target, \"drop\", (event) => {\n var _a;\n event.preventDefault();\n counter = 0;\n isOverDropZone.value = false;\n const files2 = getFiles(event);\n (_a = _options.onDrop) == null ? void 0 : _a.call(_options, files2, event);\n });\n }\n return {\n files,\n isOverDropZone\n };\n}\n\nfunction useResizeObserver(target, callback, options = {}) {\n const { window = defaultWindow, ...observerOptions } = options;\n let observer;\n const isSupported = useSupported(() => window && \"ResizeObserver\" in window);\n const cleanup = () => {\n if (observer) {\n observer.disconnect();\n observer = void 0;\n }\n };\n const targets = computed(() => {\n const _targets = toValue(target);\n return Array.isArray(_targets) ? _targets.map((el) => unrefElement(el)) : [unrefElement(_targets)];\n });\n const stopWatch = watch(\n targets,\n (els) => {\n cleanup();\n if (isSupported.value && window) {\n observer = new ResizeObserver(callback);\n for (const _el of els) {\n if (_el)\n observer.observe(_el, observerOptions);\n }\n }\n },\n { immediate: true, flush: \"post\" }\n );\n const stop = () => {\n cleanup();\n stopWatch();\n };\n tryOnScopeDispose(stop);\n return {\n isSupported,\n stop\n };\n}\n\nfunction useElementBounding(target, options = {}) {\n const {\n reset = true,\n windowResize = true,\n windowScroll = true,\n immediate = true,\n updateTiming = \"sync\"\n } = options;\n const height = ref(0);\n const bottom = ref(0);\n const left = ref(0);\n const right = ref(0);\n const top = ref(0);\n const width = ref(0);\n const x = ref(0);\n const y = ref(0);\n function recalculate() {\n const el = unrefElement(target);\n if (!el) {\n if (reset) {\n height.value = 0;\n bottom.value = 0;\n left.value = 0;\n right.value = 0;\n top.value = 0;\n width.value = 0;\n x.value = 0;\n y.value = 0;\n }\n return;\n }\n const rect = el.getBoundingClientRect();\n height.value = rect.height;\n bottom.value = rect.bottom;\n left.value = rect.left;\n right.value = rect.right;\n top.value = rect.top;\n width.value = rect.width;\n x.value = rect.x;\n y.value = rect.y;\n }\n function update() {\n if (updateTiming === \"sync\")\n recalculate();\n else if (updateTiming === \"next-frame\")\n requestAnimationFrame(() => recalculate());\n }\n useResizeObserver(target, update);\n watch(() => unrefElement(target), (ele) => !ele && update());\n useMutationObserver(target, update, {\n attributeFilter: [\"style\", \"class\"]\n });\n if (windowScroll)\n useEventListener(\"scroll\", update, { capture: true, passive: true });\n if (windowResize)\n useEventListener(\"resize\", update, { passive: true });\n tryOnMounted(() => {\n if (immediate)\n update();\n });\n return {\n height,\n bottom,\n left,\n right,\n top,\n width,\n x,\n y,\n update\n };\n}\n\nfunction useElementByPoint(options) {\n const {\n x,\n y,\n document = defaultDocument,\n multiple,\n interval = \"requestAnimationFrame\",\n immediate = true\n } = options;\n const isSupported = useSupported(() => {\n if (toValue(multiple))\n return document && \"elementsFromPoint\" in document;\n return document && \"elementFromPoint\" in document;\n });\n const element = ref(null);\n const cb = () => {\n var _a, _b;\n element.value = toValue(multiple) ? (_a = document == null ? void 0 : document.elementsFromPoint(toValue(x), toValue(y))) != null ? _a : [] : (_b = document == null ? void 0 : document.elementFromPoint(toValue(x), toValue(y))) != null ? _b : null;\n };\n const controls = interval === \"requestAnimationFrame\" ? useRafFn(cb, { immediate }) : useIntervalFn(cb, interval, { immediate });\n return {\n isSupported,\n element,\n ...controls\n };\n}\n\nfunction useElementHover(el, options = {}) {\n const {\n delayEnter = 0,\n delayLeave = 0,\n window = defaultWindow\n } = options;\n const isHovered = ref(false);\n let timer;\n const toggle = (entering) => {\n const delay = entering ? delayEnter : delayLeave;\n if (timer) {\n clearTimeout(timer);\n timer = void 0;\n }\n if (delay)\n timer = setTimeout(() => isHovered.value = entering, delay);\n else\n isHovered.value = entering;\n };\n if (!window)\n return isHovered;\n useEventListener(el, \"mouseenter\", () => toggle(true), { passive: true });\n useEventListener(el, \"mouseleave\", () => toggle(false), { passive: true });\n return isHovered;\n}\n\nfunction useElementSize(target, initialSize = { width: 0, height: 0 }, options = {}) {\n const { window = defaultWindow, box = \"content-box\" } = options;\n const isSVG = computed(() => {\n var _a, _b;\n return (_b = (_a = unrefElement(target)) == null ? void 0 : _a.namespaceURI) == null ? void 0 : _b.includes(\"svg\");\n });\n const width = ref(initialSize.width);\n const height = ref(initialSize.height);\n const { stop: stop1 } = useResizeObserver(\n target,\n ([entry]) => {\n const boxSize = box === \"border-box\" ? entry.borderBoxSize : box === \"content-box\" ? entry.contentBoxSize : entry.devicePixelContentBoxSize;\n if (window && isSVG.value) {\n const $elem = unrefElement(target);\n if ($elem) {\n const rect = $elem.getBoundingClientRect();\n width.value = rect.width;\n height.value = rect.height;\n }\n } else {\n if (boxSize) {\n const formatBoxSize = Array.isArray(boxSize) ? boxSize : [boxSize];\n width.value = formatBoxSize.reduce((acc, { inlineSize }) => acc + inlineSize, 0);\n height.value = formatBoxSize.reduce((acc, { blockSize }) => acc + blockSize, 0);\n } else {\n width.value = entry.contentRect.width;\n height.value = entry.contentRect.height;\n }\n }\n },\n options\n );\n tryOnMounted(() => {\n const ele = unrefElement(target);\n if (ele) {\n width.value = \"offsetWidth\" in ele ? ele.offsetWidth : initialSize.width;\n height.value = \"offsetHeight\" in ele ? ele.offsetHeight : initialSize.height;\n }\n });\n const stop2 = watch(\n () => unrefElement(target),\n (ele) => {\n width.value = ele ? initialSize.width : 0;\n height.value = ele ? initialSize.height : 0;\n }\n );\n function stop() {\n stop1();\n stop2();\n }\n return {\n width,\n height,\n stop\n };\n}\n\nfunction useIntersectionObserver(target, callback, options = {}) {\n const {\n root,\n rootMargin = \"0px\",\n threshold = 0,\n window = defaultWindow,\n immediate = true\n } = options;\n const isSupported = useSupported(() => window && \"IntersectionObserver\" in window);\n const targets = computed(() => {\n const _target = toValue(target);\n return (Array.isArray(_target) ? _target : [_target]).map(unrefElement).filter(notNullish);\n });\n let cleanup = noop;\n const isActive = ref(immediate);\n const stopWatch = isSupported.value ? watch(\n () => [targets.value, unrefElement(root), isActive.value],\n ([targets2, root2]) => {\n cleanup();\n if (!isActive.value)\n return;\n if (!targets2.length)\n return;\n const observer = new IntersectionObserver(\n callback,\n {\n root: unrefElement(root2),\n rootMargin,\n threshold\n }\n );\n targets2.forEach((el) => el && observer.observe(el));\n cleanup = () => {\n observer.disconnect();\n cleanup = noop;\n };\n },\n { immediate, flush: \"post\" }\n ) : noop;\n const stop = () => {\n cleanup();\n stopWatch();\n isActive.value = false;\n };\n tryOnScopeDispose(stop);\n return {\n isSupported,\n isActive,\n pause() {\n cleanup();\n isActive.value = false;\n },\n resume() {\n isActive.value = true;\n },\n stop\n };\n}\n\nfunction useElementVisibility(element, options = {}) {\n const { window = defaultWindow, scrollTarget, threshold = 0 } = options;\n const elementIsVisible = ref(false);\n useIntersectionObserver(\n element,\n (intersectionObserverEntries) => {\n let isIntersecting = elementIsVisible.value;\n let latestTime = 0;\n for (const entry of intersectionObserverEntries) {\n if (entry.time >= latestTime) {\n latestTime = entry.time;\n isIntersecting = entry.isIntersecting;\n }\n }\n elementIsVisible.value = isIntersecting;\n },\n {\n root: scrollTarget,\n window,\n threshold\n }\n );\n return elementIsVisible;\n}\n\nconst events = /* @__PURE__ */ new Map();\n\nfunction useEventBus(key) {\n const scope = getCurrentScope();\n function on(listener) {\n var _a;\n const listeners = events.get(key) || /* @__PURE__ */ new Set();\n listeners.add(listener);\n events.set(key, listeners);\n const _off = () => off(listener);\n (_a = scope == null ? void 0 : scope.cleanups) == null ? void 0 : _a.push(_off);\n return _off;\n }\n function once(listener) {\n function _listener(...args) {\n off(_listener);\n listener(...args);\n }\n return on(_listener);\n }\n function off(listener) {\n const listeners = events.get(key);\n if (!listeners)\n return;\n listeners.delete(listener);\n if (!listeners.size)\n reset();\n }\n function reset() {\n events.delete(key);\n }\n function emit(event, payload) {\n var _a;\n (_a = events.get(key)) == null ? void 0 : _a.forEach((v) => v(event, payload));\n }\n return { on, once, off, emit, reset };\n}\n\nfunction resolveNestedOptions$1(options) {\n if (options === true)\n return {};\n return options;\n}\nfunction useEventSource(url, events = [], options = {}) {\n const event = ref(null);\n const data = ref(null);\n const status = ref(\"CONNECTING\");\n const eventSource = ref(null);\n const error = shallowRef(null);\n const urlRef = toRef(url);\n const lastEventId = shallowRef(null);\n let explicitlyClosed = false;\n let retried = 0;\n const {\n withCredentials = false,\n immediate = true\n } = options;\n const close = () => {\n if (isClient && eventSource.value) {\n eventSource.value.close();\n eventSource.value = null;\n status.value = \"CLOSED\";\n explicitlyClosed = true;\n }\n };\n const _init = () => {\n if (explicitlyClosed || typeof urlRef.value === \"undefined\")\n return;\n const es = new EventSource(urlRef.value, { withCredentials });\n status.value = \"CONNECTING\";\n eventSource.value = es;\n es.onopen = () => {\n status.value = \"OPEN\";\n error.value = null;\n };\n es.onerror = (e) => {\n status.value = \"CLOSED\";\n error.value = e;\n if (es.readyState === 2 && !explicitlyClosed && options.autoReconnect) {\n es.close();\n const {\n retries = -1,\n delay = 1e3,\n onFailed\n } = resolveNestedOptions$1(options.autoReconnect);\n retried += 1;\n if (typeof retries === \"number\" && (retries < 0 || retried < retries))\n setTimeout(_init, delay);\n else if (typeof retries === \"function\" && retries())\n setTimeout(_init, delay);\n else\n onFailed == null ? void 0 : onFailed();\n }\n };\n es.onmessage = (e) => {\n event.value = null;\n data.value = e.data;\n lastEventId.value = e.lastEventId;\n };\n for (const event_name of events) {\n useEventListener(es, event_name, (e) => {\n event.value = event_name;\n data.value = e.data || null;\n });\n }\n };\n const open = () => {\n if (!isClient)\n return;\n close();\n explicitlyClosed = false;\n retried = 0;\n _init();\n };\n if (immediate)\n watch(urlRef, open, { immediate: true });\n tryOnScopeDispose(close);\n return {\n eventSource,\n event,\n data,\n status,\n error,\n open,\n close,\n lastEventId\n };\n}\n\nfunction useEyeDropper(options = {}) {\n const { initialValue = \"\" } = options;\n const isSupported = useSupported(() => typeof window !== \"undefined\" && \"EyeDropper\" in window);\n const sRGBHex = ref(initialValue);\n async function open(openOptions) {\n if (!isSupported.value)\n return;\n const eyeDropper = new window.EyeDropper();\n const result = await eyeDropper.open(openOptions);\n sRGBHex.value = result.sRGBHex;\n return result;\n }\n return { isSupported, sRGBHex, open };\n}\n\nfunction useFavicon(newIcon = null, options = {}) {\n const {\n baseUrl = \"\",\n rel = \"icon\",\n document = defaultDocument\n } = options;\n const favicon = toRef(newIcon);\n const applyIcon = (icon) => {\n const elements = document == null ? void 0 : document.head.querySelectorAll(`link[rel*=\"${rel}\"]`);\n if (!elements || elements.length === 0) {\n const link = document == null ? void 0 : document.createElement(\"link\");\n if (link) {\n link.rel = rel;\n link.href = `${baseUrl}${icon}`;\n link.type = `image/${icon.split(\".\").pop()}`;\n document == null ? void 0 : document.head.append(link);\n }\n return;\n }\n elements == null ? void 0 : elements.forEach((el) => el.href = `${baseUrl}${icon}`);\n };\n watch(\n favicon,\n (i, o) => {\n if (typeof i === \"string\" && i !== o)\n applyIcon(i);\n },\n { immediate: true }\n );\n return favicon;\n}\n\nconst payloadMapping = {\n json: \"application/json\",\n text: \"text/plain\"\n};\nfunction isFetchOptions(obj) {\n return obj && containsProp(obj, \"immediate\", \"refetch\", \"initialData\", \"timeout\", \"beforeFetch\", \"afterFetch\", \"onFetchError\", \"fetch\", \"updateDataOnError\");\n}\nconst reAbsolute = /^(?:[a-z][a-z\\d+\\-.]*:)?\\/\\//i;\nfunction isAbsoluteURL(url) {\n return reAbsolute.test(url);\n}\nfunction headersToObject(headers) {\n if (typeof Headers !== \"undefined\" && headers instanceof Headers)\n return Object.fromEntries(headers.entries());\n return headers;\n}\nfunction combineCallbacks(combination, ...callbacks) {\n if (combination === \"overwrite\") {\n return async (ctx) => {\n const callback = callbacks[callbacks.length - 1];\n if (callback)\n return { ...ctx, ...await callback(ctx) };\n return ctx;\n };\n } else {\n return async (ctx) => {\n for (const callback of callbacks) {\n if (callback)\n ctx = { ...ctx, ...await callback(ctx) };\n }\n return ctx;\n };\n }\n}\nfunction createFetch(config = {}) {\n const _combination = config.combination || \"chain\";\n const _options = config.options || {};\n const _fetchOptions = config.fetchOptions || {};\n function useFactoryFetch(url, ...args) {\n const computedUrl = computed(() => {\n const baseUrl = toValue(config.baseUrl);\n const targetUrl = toValue(url);\n return baseUrl && !isAbsoluteURL(targetUrl) ? joinPaths(baseUrl, targetUrl) : targetUrl;\n });\n let options = _options;\n let fetchOptions = _fetchOptions;\n if (args.length > 0) {\n if (isFetchOptions(args[0])) {\n options = {\n ...options,\n ...args[0],\n beforeFetch: combineCallbacks(_combination, _options.beforeFetch, args[0].beforeFetch),\n afterFetch: combineCallbacks(_combination, _options.afterFetch, args[0].afterFetch),\n onFetchError: combineCallbacks(_combination, _options.onFetchError, args[0].onFetchError)\n };\n } else {\n fetchOptions = {\n ...fetchOptions,\n ...args[0],\n headers: {\n ...headersToObject(fetchOptions.headers) || {},\n ...headersToObject(args[0].headers) || {}\n }\n };\n }\n }\n if (args.length > 1 && isFetchOptions(args[1])) {\n options = {\n ...options,\n ...args[1],\n beforeFetch: combineCallbacks(_combination, _options.beforeFetch, args[1].beforeFetch),\n afterFetch: combineCallbacks(_combination, _options.afterFetch, args[1].afterFetch),\n onFetchError: combineCallbacks(_combination, _options.onFetchError, args[1].onFetchError)\n };\n }\n return useFetch(computedUrl, fetchOptions, options);\n }\n return useFactoryFetch;\n}\nfunction useFetch(url, ...args) {\n var _a;\n const supportsAbort = typeof AbortController === \"function\";\n let fetchOptions = {};\n let options = {\n immediate: true,\n refetch: false,\n timeout: 0,\n updateDataOnError: false\n };\n const config = {\n method: \"GET\",\n type: \"text\",\n payload: void 0\n };\n if (args.length > 0) {\n if (isFetchOptions(args[0]))\n options = { ...options, ...args[0] };\n else\n fetchOptions = args[0];\n }\n if (args.length > 1) {\n if (isFetchOptions(args[1]))\n options = { ...options, ...args[1] };\n }\n const {\n fetch = (_a = defaultWindow) == null ? void 0 : _a.fetch,\n initialData,\n timeout\n } = options;\n const responseEvent = createEventHook();\n const errorEvent = createEventHook();\n const finallyEvent = createEventHook();\n const isFinished = ref(false);\n const isFetching = ref(false);\n const aborted = ref(false);\n const statusCode = ref(null);\n const response = shallowRef(null);\n const error = shallowRef(null);\n const data = shallowRef(initialData || null);\n const canAbort = computed(() => supportsAbort && isFetching.value);\n let controller;\n let timer;\n const abort = () => {\n if (supportsAbort) {\n controller == null ? void 0 : controller.abort();\n controller = new AbortController();\n controller.signal.onabort = () => aborted.value = true;\n fetchOptions = {\n ...fetchOptions,\n signal: controller.signal\n };\n }\n };\n const loading = (isLoading) => {\n isFetching.value = isLoading;\n isFinished.value = !isLoading;\n };\n if (timeout)\n timer = useTimeoutFn(abort, timeout, { immediate: false });\n let executeCounter = 0;\n const execute = async (throwOnFailed = false) => {\n var _a2, _b;\n abort();\n loading(true);\n error.value = null;\n statusCode.value = null;\n aborted.value = false;\n executeCounter += 1;\n const currentExecuteCounter = executeCounter;\n const defaultFetchOptions = {\n method: config.method,\n headers: {}\n };\n if (config.payload) {\n const headers = headersToObject(defaultFetchOptions.headers);\n const payload = toValue(config.payload);\n if (!config.payloadType && payload && Object.getPrototypeOf(payload) === Object.prototype && !(payload instanceof FormData))\n config.payloadType = \"json\";\n if (config.payloadType)\n headers[\"Content-Type\"] = (_a2 = payloadMapping[config.payloadType]) != null ? _a2 : config.payloadType;\n defaultFetchOptions.body = config.payloadType === \"json\" ? JSON.stringify(payload) : payload;\n }\n let isCanceled = false;\n const context = {\n url: toValue(url),\n options: {\n ...defaultFetchOptions,\n ...fetchOptions\n },\n cancel: () => {\n isCanceled = true;\n }\n };\n if (options.beforeFetch)\n Object.assign(context, await options.beforeFetch(context));\n if (isCanceled || !fetch) {\n loading(false);\n return Promise.resolve(null);\n }\n let responseData = null;\n if (timer)\n timer.start();\n return fetch(\n context.url,\n {\n ...defaultFetchOptions,\n ...context.options,\n headers: {\n ...headersToObject(defaultFetchOptions.headers),\n ...headersToObject((_b = context.options) == null ? void 0 : _b.headers)\n }\n }\n ).then(async (fetchResponse) => {\n response.value = fetchResponse;\n statusCode.value = fetchResponse.status;\n responseData = await fetchResponse.clone()[config.type]();\n if (!fetchResponse.ok) {\n data.value = initialData || null;\n throw new Error(fetchResponse.statusText);\n }\n if (options.afterFetch) {\n ({ data: responseData } = await options.afterFetch({\n data: responseData,\n response: fetchResponse\n }));\n }\n data.value = responseData;\n responseEvent.trigger(fetchResponse);\n return fetchResponse;\n }).catch(async (fetchError) => {\n let errorData = fetchError.message || fetchError.name;\n if (options.onFetchError) {\n ({ error: errorData, data: responseData } = await options.onFetchError({\n data: responseData,\n error: fetchError,\n response: response.value\n }));\n }\n error.value = errorData;\n if (options.updateDataOnError)\n data.value = responseData;\n errorEvent.trigger(fetchError);\n if (throwOnFailed)\n throw fetchError;\n return null;\n }).finally(() => {\n if (currentExecuteCounter === executeCounter)\n loading(false);\n if (timer)\n timer.stop();\n finallyEvent.trigger(null);\n });\n };\n const refetch = toRef(options.refetch);\n watch(\n [\n refetch,\n toRef(url)\n ],\n ([refetch2]) => refetch2 && execute(),\n { deep: true }\n );\n const shell = {\n isFinished: readonly(isFinished),\n isFetching: readonly(isFetching),\n statusCode,\n response,\n error,\n data,\n canAbort,\n aborted,\n abort,\n execute,\n onFetchResponse: responseEvent.on,\n onFetchError: errorEvent.on,\n onFetchFinally: finallyEvent.on,\n // method\n get: setMethod(\"GET\"),\n put: setMethod(\"PUT\"),\n post: setMethod(\"POST\"),\n delete: setMethod(\"DELETE\"),\n patch: setMethod(\"PATCH\"),\n head: setMethod(\"HEAD\"),\n options: setMethod(\"OPTIONS\"),\n // type\n json: setType(\"json\"),\n text: setType(\"text\"),\n blob: setType(\"blob\"),\n arrayBuffer: setType(\"arrayBuffer\"),\n formData: setType(\"formData\")\n };\n function setMethod(method) {\n return (payload, payloadType) => {\n if (!isFetching.value) {\n config.method = method;\n config.payload = payload;\n config.payloadType = payloadType;\n if (isRef(config.payload)) {\n watch(\n [\n refetch,\n toRef(config.payload)\n ],\n ([refetch2]) => refetch2 && execute(),\n { deep: true }\n );\n }\n return {\n ...shell,\n then(onFulfilled, onRejected) {\n return waitUntilFinished().then(onFulfilled, onRejected);\n }\n };\n }\n return void 0;\n };\n }\n function waitUntilFinished() {\n return new Promise((resolve, reject) => {\n until(isFinished).toBe(true).then(() => resolve(shell)).catch((error2) => reject(error2));\n });\n }\n function setType(type) {\n return () => {\n if (!isFetching.value) {\n config.type = type;\n return {\n ...shell,\n then(onFulfilled, onRejected) {\n return waitUntilFinished().then(onFulfilled, onRejected);\n }\n };\n }\n return void 0;\n };\n }\n if (options.immediate)\n Promise.resolve().then(() => execute());\n return {\n ...shell,\n then(onFulfilled, onRejected) {\n return waitUntilFinished().then(onFulfilled, onRejected);\n }\n };\n}\nfunction joinPaths(start, end) {\n if (!start.endsWith(\"/\") && !end.startsWith(\"/\"))\n return `${start}/${end}`;\n return `${start}${end}`;\n}\n\nconst DEFAULT_OPTIONS = {\n multiple: true,\n accept: \"*\",\n reset: false,\n directory: false\n};\nfunction useFileDialog(options = {}) {\n const {\n document = defaultDocument\n } = options;\n const files = ref(null);\n const { on: onChange, trigger } = createEventHook();\n let input;\n if (document) {\n input = document.createElement(\"input\");\n input.type = \"file\";\n input.onchange = (event) => {\n const result = event.target;\n files.value = result.files;\n trigger(files.value);\n };\n }\n const reset = () => {\n files.value = null;\n if (input && input.value) {\n input.value = \"\";\n trigger(null);\n }\n };\n const open = (localOptions) => {\n if (!input)\n return;\n const _options = {\n ...DEFAULT_OPTIONS,\n ...options,\n ...localOptions\n };\n input.multiple = _options.multiple;\n input.accept = _options.accept;\n input.webkitdirectory = _options.directory;\n if (hasOwn(_options, \"capture\"))\n input.capture = _options.capture;\n if (_options.reset)\n reset();\n input.click();\n };\n return {\n files: readonly(files),\n open,\n reset,\n onChange\n };\n}\n\nfunction useFileSystemAccess(options = {}) {\n const {\n window: _window = defaultWindow,\n dataType = \"Text\"\n } = options;\n const window = _window;\n const isSupported = useSupported(() => window && \"showSaveFilePicker\" in window && \"showOpenFilePicker\" in window);\n const fileHandle = ref();\n const data = ref();\n const file = ref();\n const fileName = computed(() => {\n var _a, _b;\n return (_b = (_a = file.value) == null ? void 0 : _a.name) != null ? _b : \"\";\n });\n const fileMIME = computed(() => {\n var _a, _b;\n return (_b = (_a = file.value) == null ? void 0 : _a.type) != null ? _b : \"\";\n });\n const fileSize = computed(() => {\n var _a, _b;\n return (_b = (_a = file.value) == null ? void 0 : _a.size) != null ? _b : 0;\n });\n const fileLastModified = computed(() => {\n var _a, _b;\n return (_b = (_a = file.value) == null ? void 0 : _a.lastModified) != null ? _b : 0;\n });\n async function open(_options = {}) {\n if (!isSupported.value)\n return;\n const [handle] = await window.showOpenFilePicker({ ...toValue(options), ..._options });\n fileHandle.value = handle;\n await updateData();\n }\n async function create(_options = {}) {\n if (!isSupported.value)\n return;\n fileHandle.value = await window.showSaveFilePicker({ ...options, ..._options });\n data.value = void 0;\n await updateData();\n }\n async function save(_options = {}) {\n if (!isSupported.value)\n return;\n if (!fileHandle.value)\n return saveAs(_options);\n if (data.value) {\n const writableStream = await fileHandle.value.createWritable();\n await writableStream.write(data.value);\n await writableStream.close();\n }\n await updateFile();\n }\n async function saveAs(_options = {}) {\n if (!isSupported.value)\n return;\n fileHandle.value = await window.showSaveFilePicker({ ...options, ..._options });\n if (data.value) {\n const writableStream = await fileHandle.value.createWritable();\n await writableStream.write(data.value);\n await writableStream.close();\n }\n await updateFile();\n }\n async function updateFile() {\n var _a;\n file.value = await ((_a = fileHandle.value) == null ? void 0 : _a.getFile());\n }\n async function updateData() {\n var _a, _b;\n await updateFile();\n const type = toValue(dataType);\n if (type === \"Text\")\n data.value = await ((_a = file.value) == null ? void 0 : _a.text());\n else if (type === \"ArrayBuffer\")\n data.value = await ((_b = file.value) == null ? void 0 : _b.arrayBuffer());\n else if (type === \"Blob\")\n data.value = file.value;\n }\n watch(() => toValue(dataType), updateData);\n return {\n isSupported,\n data,\n file,\n fileName,\n fileMIME,\n fileSize,\n fileLastModified,\n open,\n create,\n save,\n saveAs,\n updateData\n };\n}\n\nfunction useFocus(target, options = {}) {\n const { initialValue = false, focusVisible = false, preventScroll = false } = options;\n const innerFocused = ref(false);\n const targetElement = computed(() => unrefElement(target));\n useEventListener(targetElement, \"focus\", (event) => {\n var _a, _b;\n if (!focusVisible || ((_b = (_a = event.target).matches) == null ? void 0 : _b.call(_a, \":focus-visible\")))\n innerFocused.value = true;\n });\n useEventListener(targetElement, \"blur\", () => innerFocused.value = false);\n const focused = computed({\n get: () => innerFocused.value,\n set(value) {\n var _a, _b;\n if (!value && innerFocused.value)\n (_a = targetElement.value) == null ? void 0 : _a.blur();\n else if (value && !innerFocused.value)\n (_b = targetElement.value) == null ? void 0 : _b.focus({ preventScroll });\n }\n });\n watch(\n targetElement,\n () => {\n focused.value = initialValue;\n },\n { immediate: true, flush: \"post\" }\n );\n return { focused };\n}\n\nfunction useFocusWithin(target, options = {}) {\n const activeElement = useActiveElement(options);\n const targetElement = computed(() => unrefElement(target));\n const focused = computed(() => targetElement.value && activeElement.value ? targetElement.value.contains(activeElement.value) : false);\n return { focused };\n}\n\nfunction useFps(options) {\n var _a;\n const fps = ref(0);\n if (typeof performance === \"undefined\")\n return fps;\n const every = (_a = options == null ? void 0 : options.every) != null ? _a : 10;\n let last = performance.now();\n let ticks = 0;\n useRafFn(() => {\n ticks += 1;\n if (ticks >= every) {\n const now = performance.now();\n const diff = now - last;\n fps.value = Math.round(1e3 / (diff / ticks));\n last = now;\n ticks = 0;\n }\n });\n return fps;\n}\n\nconst eventHandlers = [\n \"fullscreenchange\",\n \"webkitfullscreenchange\",\n \"webkitendfullscreen\",\n \"mozfullscreenchange\",\n \"MSFullscreenChange\"\n];\nfunction useFullscreen(target, options = {}) {\n const {\n document = defaultDocument,\n autoExit = false\n } = options;\n const targetRef = computed(() => {\n var _a;\n return (_a = unrefElement(target)) != null ? _a : document == null ? void 0 : document.querySelector(\"html\");\n });\n const isFullscreen = ref(false);\n const requestMethod = computed(() => {\n return [\n \"requestFullscreen\",\n \"webkitRequestFullscreen\",\n \"webkitEnterFullscreen\",\n \"webkitEnterFullScreen\",\n \"webkitRequestFullScreen\",\n \"mozRequestFullScreen\",\n \"msRequestFullscreen\"\n ].find((m) => document && m in document || targetRef.value && m in targetRef.value);\n });\n const exitMethod = computed(() => {\n return [\n \"exitFullscreen\",\n \"webkitExitFullscreen\",\n \"webkitExitFullScreen\",\n \"webkitCancelFullScreen\",\n \"mozCancelFullScreen\",\n \"msExitFullscreen\"\n ].find((m) => document && m in document || targetRef.value && m in targetRef.value);\n });\n const fullscreenEnabled = computed(() => {\n return [\n \"fullScreen\",\n \"webkitIsFullScreen\",\n \"webkitDisplayingFullscreen\",\n \"mozFullScreen\",\n \"msFullscreenElement\"\n ].find((m) => document && m in document || targetRef.value && m in targetRef.value);\n });\n const fullscreenElementMethod = [\n \"fullscreenElement\",\n \"webkitFullscreenElement\",\n \"mozFullScreenElement\",\n \"msFullscreenElement\"\n ].find((m) => document && m in document);\n const isSupported = useSupported(() => targetRef.value && document && requestMethod.value !== void 0 && exitMethod.value !== void 0 && fullscreenEnabled.value !== void 0);\n const isCurrentElementFullScreen = () => {\n if (fullscreenElementMethod)\n return (document == null ? void 0 : document[fullscreenElementMethod]) === targetRef.value;\n return false;\n };\n const isElementFullScreen = () => {\n if (fullscreenEnabled.value) {\n if (document && document[fullscreenEnabled.value] != null) {\n return document[fullscreenEnabled.value];\n } else {\n const target2 = targetRef.value;\n if ((target2 == null ? void 0 : target2[fullscreenEnabled.value]) != null) {\n return Boolean(target2[fullscreenEnabled.value]);\n }\n }\n }\n return false;\n };\n async function exit() {\n if (!isSupported.value || !isFullscreen.value)\n return;\n if (exitMethod.value) {\n if ((document == null ? void 0 : document[exitMethod.value]) != null) {\n await document[exitMethod.value]();\n } else {\n const target2 = targetRef.value;\n if ((target2 == null ? void 0 : target2[exitMethod.value]) != null)\n await target2[exitMethod.value]();\n }\n }\n isFullscreen.value = false;\n }\n async function enter() {\n if (!isSupported.value || isFullscreen.value)\n return;\n if (isElementFullScreen())\n await exit();\n const target2 = targetRef.value;\n if (requestMethod.value && (target2 == null ? void 0 : target2[requestMethod.value]) != null) {\n await target2[requestMethod.value]();\n isFullscreen.value = true;\n }\n }\n async function toggle() {\n await (isFullscreen.value ? exit() : enter());\n }\n const handlerCallback = () => {\n const isElementFullScreenValue = isElementFullScreen();\n if (!isElementFullScreenValue || isElementFullScreenValue && isCurrentElementFullScreen())\n isFullscreen.value = isElementFullScreenValue;\n };\n useEventListener(document, eventHandlers, handlerCallback, false);\n useEventListener(() => unrefElement(targetRef), eventHandlers, handlerCallback, false);\n if (autoExit)\n tryOnScopeDispose(exit);\n return {\n isSupported,\n isFullscreen,\n enter,\n exit,\n toggle\n };\n}\n\nfunction mapGamepadToXbox360Controller(gamepad) {\n return computed(() => {\n if (gamepad.value) {\n return {\n buttons: {\n a: gamepad.value.buttons[0],\n b: gamepad.value.buttons[1],\n x: gamepad.value.buttons[2],\n y: gamepad.value.buttons[3]\n },\n bumper: {\n left: gamepad.value.buttons[4],\n right: gamepad.value.buttons[5]\n },\n triggers: {\n left: gamepad.value.buttons[6],\n right: gamepad.value.buttons[7]\n },\n stick: {\n left: {\n horizontal: gamepad.value.axes[0],\n vertical: gamepad.value.axes[1],\n button: gamepad.value.buttons[10]\n },\n right: {\n horizontal: gamepad.value.axes[2],\n vertical: gamepad.value.axes[3],\n button: gamepad.value.buttons[11]\n }\n },\n dpad: {\n up: gamepad.value.buttons[12],\n down: gamepad.value.buttons[13],\n left: gamepad.value.buttons[14],\n right: gamepad.value.buttons[15]\n },\n back: gamepad.value.buttons[8],\n start: gamepad.value.buttons[9]\n };\n }\n return null;\n });\n}\nfunction useGamepad(options = {}) {\n const {\n navigator = defaultNavigator\n } = options;\n const isSupported = useSupported(() => navigator && \"getGamepads\" in navigator);\n const gamepads = ref([]);\n const onConnectedHook = createEventHook();\n const onDisconnectedHook = createEventHook();\n const stateFromGamepad = (gamepad) => {\n const hapticActuators = [];\n const vibrationActuator = \"vibrationActuator\" in gamepad ? gamepad.vibrationActuator : null;\n if (vibrationActuator)\n hapticActuators.push(vibrationActuator);\n if (gamepad.hapticActuators)\n hapticActuators.push(...gamepad.hapticActuators);\n return {\n id: gamepad.id,\n index: gamepad.index,\n connected: gamepad.connected,\n mapping: gamepad.mapping,\n timestamp: gamepad.timestamp,\n vibrationActuator: gamepad.vibrationActuator,\n hapticActuators,\n axes: gamepad.axes.map((axes) => axes),\n buttons: gamepad.buttons.map((button) => ({ pressed: button.pressed, touched: button.touched, value: button.value }))\n };\n };\n const updateGamepadState = () => {\n const _gamepads = (navigator == null ? void 0 : navigator.getGamepads()) || [];\n for (const gamepad of _gamepads) {\n if (gamepad && gamepads.value[gamepad.index])\n gamepads.value[gamepad.index] = stateFromGamepad(gamepad);\n }\n };\n const { isActive, pause, resume } = useRafFn(updateGamepadState);\n const onGamepadConnected = (gamepad) => {\n if (!gamepads.value.some(({ index }) => index === gamepad.index)) {\n gamepads.value.push(stateFromGamepad(gamepad));\n onConnectedHook.trigger(gamepad.index);\n }\n resume();\n };\n const onGamepadDisconnected = (gamepad) => {\n gamepads.value = gamepads.value.filter((x) => x.index !== gamepad.index);\n onDisconnectedHook.trigger(gamepad.index);\n };\n useEventListener(\"gamepadconnected\", (e) => onGamepadConnected(e.gamepad));\n useEventListener(\"gamepaddisconnected\", (e) => onGamepadDisconnected(e.gamepad));\n tryOnMounted(() => {\n const _gamepads = (navigator == null ? void 0 : navigator.getGamepads()) || [];\n for (const gamepad of _gamepads) {\n if (gamepad && gamepads.value[gamepad.index])\n onGamepadConnected(gamepad);\n }\n });\n pause();\n return {\n isSupported,\n onConnected: onConnectedHook.on,\n onDisconnected: onDisconnectedHook.on,\n gamepads,\n pause,\n resume,\n isActive\n };\n}\n\nfunction useGeolocation(options = {}) {\n const {\n enableHighAccuracy = true,\n maximumAge = 3e4,\n timeout = 27e3,\n navigator = defaultNavigator,\n immediate = true\n } = options;\n const isSupported = useSupported(() => navigator && \"geolocation\" in navigator);\n const locatedAt = ref(null);\n const error = shallowRef(null);\n const coords = ref({\n accuracy: 0,\n latitude: Number.POSITIVE_INFINITY,\n longitude: Number.POSITIVE_INFINITY,\n altitude: null,\n altitudeAccuracy: null,\n heading: null,\n speed: null\n });\n function updatePosition(position) {\n locatedAt.value = position.timestamp;\n coords.value = position.coords;\n error.value = null;\n }\n let watcher;\n function resume() {\n if (isSupported.value) {\n watcher = navigator.geolocation.watchPosition(\n updatePosition,\n (err) => error.value = err,\n {\n enableHighAccuracy,\n maximumAge,\n timeout\n }\n );\n }\n }\n if (immediate)\n resume();\n function pause() {\n if (watcher && navigator)\n navigator.geolocation.clearWatch(watcher);\n }\n tryOnScopeDispose(() => {\n pause();\n });\n return {\n isSupported,\n coords,\n locatedAt,\n error,\n resume,\n pause\n };\n}\n\nconst defaultEvents$1 = [\"mousemove\", \"mousedown\", \"resize\", \"keydown\", \"touchstart\", \"wheel\"];\nconst oneMinute = 6e4;\nfunction useIdle(timeout = oneMinute, options = {}) {\n const {\n initialState = false,\n listenForVisibilityChange = true,\n events = defaultEvents$1,\n window = defaultWindow,\n eventFilter = throttleFilter(50)\n } = options;\n const idle = ref(initialState);\n const lastActive = ref(timestamp());\n let timer;\n const reset = () => {\n idle.value = false;\n clearTimeout(timer);\n timer = setTimeout(() => idle.value = true, timeout);\n };\n const onEvent = createFilterWrapper(\n eventFilter,\n () => {\n lastActive.value = timestamp();\n reset();\n }\n );\n if (window) {\n const document = window.document;\n for (const event of events)\n useEventListener(window, event, onEvent, { passive: true });\n if (listenForVisibilityChange) {\n useEventListener(document, \"visibilitychange\", () => {\n if (!document.hidden)\n onEvent();\n });\n }\n reset();\n }\n return {\n idle,\n lastActive,\n reset\n };\n}\n\nasync function loadImage(options) {\n return new Promise((resolve, reject) => {\n const img = new Image();\n const { src, srcset, sizes, class: clazz, loading, crossorigin, referrerPolicy } = options;\n img.src = src;\n if (srcset)\n img.srcset = srcset;\n if (sizes)\n img.sizes = sizes;\n if (clazz)\n img.className = clazz;\n if (loading)\n img.loading = loading;\n if (crossorigin)\n img.crossOrigin = crossorigin;\n if (referrerPolicy)\n img.referrerPolicy = referrerPolicy;\n img.onload = () => resolve(img);\n img.onerror = reject;\n });\n}\nfunction useImage(options, asyncStateOptions = {}) {\n const state = useAsyncState(\n () => loadImage(toValue(options)),\n void 0,\n {\n resetOnExecute: true,\n ...asyncStateOptions\n }\n );\n watch(\n () => toValue(options),\n () => state.execute(asyncStateOptions.delay),\n { deep: true }\n );\n return state;\n}\n\nconst ARRIVED_STATE_THRESHOLD_PIXELS = 1;\nfunction useScroll(element, options = {}) {\n const {\n throttle = 0,\n idle = 200,\n onStop = noop,\n onScroll = noop,\n offset = {\n left: 0,\n right: 0,\n top: 0,\n bottom: 0\n },\n eventListenerOptions = {\n capture: false,\n passive: true\n },\n behavior = \"auto\",\n window = defaultWindow,\n onError = (e) => {\n console.error(e);\n }\n } = options;\n const internalX = ref(0);\n const internalY = ref(0);\n const x = computed({\n get() {\n return internalX.value;\n },\n set(x2) {\n scrollTo(x2, void 0);\n }\n });\n const y = computed({\n get() {\n return internalY.value;\n },\n set(y2) {\n scrollTo(void 0, y2);\n }\n });\n function scrollTo(_x, _y) {\n var _a, _b, _c, _d;\n if (!window)\n return;\n const _element = toValue(element);\n if (!_element)\n return;\n (_c = _element instanceof Document ? window.document.body : _element) == null ? void 0 : _c.scrollTo({\n top: (_a = toValue(_y)) != null ? _a : y.value,\n left: (_b = toValue(_x)) != null ? _b : x.value,\n behavior: toValue(behavior)\n });\n const scrollContainer = ((_d = _element == null ? void 0 : _element.document) == null ? void 0 : _d.documentElement) || (_element == null ? void 0 : _element.documentElement) || _element;\n if (x != null)\n internalX.value = scrollContainer.scrollLeft;\n if (y != null)\n internalY.value = scrollContainer.scrollTop;\n }\n const isScrolling = ref(false);\n const arrivedState = reactive({\n left: true,\n right: false,\n top: true,\n bottom: false\n });\n const directions = reactive({\n left: false,\n right: false,\n top: false,\n bottom: false\n });\n const onScrollEnd = (e) => {\n if (!isScrolling.value)\n return;\n isScrolling.value = false;\n directions.left = false;\n directions.right = false;\n directions.top = false;\n directions.bottom = false;\n onStop(e);\n };\n const onScrollEndDebounced = useDebounceFn(onScrollEnd, throttle + idle);\n const setArrivedState = (target) => {\n var _a;\n if (!window)\n return;\n const el = ((_a = target == null ? void 0 : target.document) == null ? void 0 : _a.documentElement) || (target == null ? void 0 : target.documentElement) || unrefElement(target);\n const { display, flexDirection } = getComputedStyle(el);\n const scrollLeft = el.scrollLeft;\n directions.left = scrollLeft < internalX.value;\n directions.right = scrollLeft > internalX.value;\n const left = Math.abs(scrollLeft) <= (offset.left || 0);\n const right = Math.abs(scrollLeft) + el.clientWidth >= el.scrollWidth - (offset.right || 0) - ARRIVED_STATE_THRESHOLD_PIXELS;\n if (display === \"flex\" && flexDirection === \"row-reverse\") {\n arrivedState.left = right;\n arrivedState.right = left;\n } else {\n arrivedState.left = left;\n arrivedState.right = right;\n }\n internalX.value = scrollLeft;\n let scrollTop = el.scrollTop;\n if (target === window.document && !scrollTop)\n scrollTop = window.document.body.scrollTop;\n directions.top = scrollTop < internalY.value;\n directions.bottom = scrollTop > internalY.value;\n const top = Math.abs(scrollTop) <= (offset.top || 0);\n const bottom = Math.abs(scrollTop) + el.clientHeight >= el.scrollHeight - (offset.bottom || 0) - ARRIVED_STATE_THRESHOLD_PIXELS;\n if (display === \"flex\" && flexDirection === \"column-reverse\") {\n arrivedState.top = bottom;\n arrivedState.bottom = top;\n } else {\n arrivedState.top = top;\n arrivedState.bottom = bottom;\n }\n internalY.value = scrollTop;\n };\n const onScrollHandler = (e) => {\n var _a;\n if (!window)\n return;\n const eventTarget = (_a = e.target.documentElement) != null ? _a : e.target;\n setArrivedState(eventTarget);\n isScrolling.value = true;\n onScrollEndDebounced(e);\n onScroll(e);\n };\n useEventListener(\n element,\n \"scroll\",\n throttle ? useThrottleFn(onScrollHandler, throttle, true, false) : onScrollHandler,\n eventListenerOptions\n );\n tryOnMounted(() => {\n try {\n const _element = toValue(element);\n if (!_element)\n return;\n setArrivedState(_element);\n } catch (e) {\n onError(e);\n }\n });\n useEventListener(\n element,\n \"scrollend\",\n onScrollEnd,\n eventListenerOptions\n );\n return {\n x,\n y,\n isScrolling,\n arrivedState,\n directions,\n measure() {\n const _element = toValue(element);\n if (window && _element)\n setArrivedState(_element);\n }\n };\n}\n\nfunction resolveElement(el) {\n if (typeof Window !== \"undefined\" && el instanceof Window)\n return el.document.documentElement;\n if (typeof Document !== \"undefined\" && el instanceof Document)\n return el.documentElement;\n return el;\n}\n\nfunction useInfiniteScroll(element, onLoadMore, options = {}) {\n var _a;\n const {\n direction = \"bottom\",\n interval = 100,\n canLoadMore = () => true\n } = options;\n const state = reactive(useScroll(\n element,\n {\n ...options,\n offset: {\n [direction]: (_a = options.distance) != null ? _a : 0,\n ...options.offset\n }\n }\n ));\n const promise = ref();\n const isLoading = computed(() => !!promise.value);\n const observedElement = computed(() => {\n return resolveElement(toValue(element));\n });\n const isElementVisible = useElementVisibility(observedElement);\n function checkAndLoad() {\n state.measure();\n if (!observedElement.value || !isElementVisible.value || !canLoadMore(observedElement.value))\n return;\n const { scrollHeight, clientHeight, scrollWidth, clientWidth } = observedElement.value;\n const isNarrower = direction === \"bottom\" || direction === \"top\" ? scrollHeight <= clientHeight : scrollWidth <= clientWidth;\n if (state.arrivedState[direction] || isNarrower) {\n if (!promise.value) {\n promise.value = Promise.all([\n onLoadMore(state),\n new Promise((resolve) => setTimeout(resolve, interval))\n ]).finally(() => {\n promise.value = null;\n nextTick(() => checkAndLoad());\n });\n }\n }\n }\n watch(\n () => [state.arrivedState[direction], isElementVisible.value],\n checkAndLoad,\n { immediate: true }\n );\n return {\n isLoading,\n reset() {\n nextTick(() => checkAndLoad());\n }\n };\n}\n\nconst defaultEvents = [\"mousedown\", \"mouseup\", \"keydown\", \"keyup\"];\nfunction useKeyModifier(modifier, options = {}) {\n const {\n events = defaultEvents,\n document = defaultDocument,\n initial = null\n } = options;\n const state = ref(initial);\n if (document) {\n events.forEach((listenerEvent) => {\n useEventListener(document, listenerEvent, (evt) => {\n if (typeof evt.getModifierState === \"function\")\n state.value = evt.getModifierState(modifier);\n });\n });\n }\n return state;\n}\n\nfunction useLocalStorage(key, initialValue, options = {}) {\n const { window = defaultWindow } = options;\n return useStorage(key, initialValue, window == null ? void 0 : window.localStorage, options);\n}\n\nconst DefaultMagicKeysAliasMap = {\n ctrl: \"control\",\n command: \"meta\",\n cmd: \"meta\",\n option: \"alt\",\n up: \"arrowup\",\n down: \"arrowdown\",\n left: \"arrowleft\",\n right: \"arrowright\"\n};\n\nfunction useMagicKeys(options = {}) {\n const {\n reactive: useReactive = false,\n target = defaultWindow,\n aliasMap = DefaultMagicKeysAliasMap,\n passive = true,\n onEventFired = noop\n } = options;\n const current = reactive(/* @__PURE__ */ new Set());\n const obj = {\n toJSON() {\n return {};\n },\n current\n };\n const refs = useReactive ? reactive(obj) : obj;\n const metaDeps = /* @__PURE__ */ new Set();\n const usedKeys = /* @__PURE__ */ new Set();\n function setRefs(key, value) {\n if (key in refs) {\n if (useReactive)\n refs[key] = value;\n else\n refs[key].value = value;\n }\n }\n function reset() {\n current.clear();\n for (const key of usedKeys)\n setRefs(key, false);\n }\n function updateRefs(e, value) {\n var _a, _b;\n const key = (_a = e.key) == null ? void 0 : _a.toLowerCase();\n const code = (_b = e.code) == null ? void 0 : _b.toLowerCase();\n const values = [code, key].filter(Boolean);\n if (key) {\n if (value)\n current.add(key);\n else\n current.delete(key);\n }\n for (const key2 of values) {\n usedKeys.add(key2);\n setRefs(key2, value);\n }\n if (key === \"meta\" && !value) {\n metaDeps.forEach((key2) => {\n current.delete(key2);\n setRefs(key2, false);\n });\n metaDeps.clear();\n } else if (typeof e.getModifierState === \"function\" && e.getModifierState(\"Meta\") && value) {\n [...current, ...values].forEach((key2) => metaDeps.add(key2));\n }\n }\n useEventListener(target, \"keydown\", (e) => {\n updateRefs(e, true);\n return onEventFired(e);\n }, { passive });\n useEventListener(target, \"keyup\", (e) => {\n updateRefs(e, false);\n return onEventFired(e);\n }, { passive });\n useEventListener(\"blur\", reset, { passive: true });\n useEventListener(\"focus\", reset, { passive: true });\n const proxy = new Proxy(\n refs,\n {\n get(target2, prop, rec) {\n if (typeof prop !== \"string\")\n return Reflect.get(target2, prop, rec);\n prop = prop.toLowerCase();\n if (prop in aliasMap)\n prop = aliasMap[prop];\n if (!(prop in refs)) {\n if (/[+_-]/.test(prop)) {\n const keys = prop.split(/[+_-]/g).map((i) => i.trim());\n refs[prop] = computed(() => keys.every((key) => toValue(proxy[key])));\n } else {\n refs[prop] = ref(false);\n }\n }\n const r = Reflect.get(target2, prop, rec);\n return useReactive ? toValue(r) : r;\n }\n }\n );\n return proxy;\n}\n\nfunction usingElRef(source, cb) {\n if (toValue(source))\n cb(toValue(source));\n}\nfunction timeRangeToArray(timeRanges) {\n let ranges = [];\n for (let i = 0; i < timeRanges.length; ++i)\n ranges = [...ranges, [timeRanges.start(i), timeRanges.end(i)]];\n return ranges;\n}\nfunction tracksToArray(tracks) {\n return Array.from(tracks).map(({ label, kind, language, mode, activeCues, cues, inBandMetadataTrackDispatchType }, id) => ({ id, label, kind, language, mode, activeCues, cues, inBandMetadataTrackDispatchType }));\n}\nconst defaultOptions = {\n src: \"\",\n tracks: []\n};\nfunction useMediaControls(target, options = {}) {\n target = toRef(target);\n options = {\n ...defaultOptions,\n ...options\n };\n const {\n document = defaultDocument\n } = options;\n const currentTime = ref(0);\n const duration = ref(0);\n const seeking = ref(false);\n const volume = ref(1);\n const waiting = ref(false);\n const ended = ref(false);\n const playing = ref(false);\n const rate = ref(1);\n const stalled = ref(false);\n const buffered = ref([]);\n const tracks = ref([]);\n const selectedTrack = ref(-1);\n const isPictureInPicture = ref(false);\n const muted = ref(false);\n const supportsPictureInPicture = document && \"pictureInPictureEnabled\" in document;\n const sourceErrorEvent = createEventHook();\n const disableTrack = (track) => {\n usingElRef(target, (el) => {\n if (track) {\n const id = typeof track === \"number\" ? track : track.id;\n el.textTracks[id].mode = \"disabled\";\n } else {\n for (let i = 0; i < el.textTracks.length; ++i)\n el.textTracks[i].mode = \"disabled\";\n }\n selectedTrack.value = -1;\n });\n };\n const enableTrack = (track, disableTracks = true) => {\n usingElRef(target, (el) => {\n const id = typeof track === \"number\" ? track : track.id;\n if (disableTracks)\n disableTrack();\n el.textTracks[id].mode = \"showing\";\n selectedTrack.value = id;\n });\n };\n const togglePictureInPicture = () => {\n return new Promise((resolve, reject) => {\n usingElRef(target, async (el) => {\n if (supportsPictureInPicture) {\n if (!isPictureInPicture.value) {\n el.requestPictureInPicture().then(resolve).catch(reject);\n } else {\n document.exitPictureInPicture().then(resolve).catch(reject);\n }\n }\n });\n });\n };\n watchEffect(() => {\n if (!document)\n return;\n const el = toValue(target);\n if (!el)\n return;\n const src = toValue(options.src);\n let sources = [];\n if (!src)\n return;\n if (typeof src === \"string\")\n sources = [{ src }];\n else if (Array.isArray(src))\n sources = src;\n else if (isObject(src))\n sources = [src];\n el.querySelectorAll(\"source\").forEach((e) => {\n e.removeEventListener(\"error\", sourceErrorEvent.trigger);\n e.remove();\n });\n sources.forEach(({ src: src2, type }) => {\n const source = document.createElement(\"source\");\n source.setAttribute(\"src\", src2);\n source.setAttribute(\"type\", type || \"\");\n source.addEventListener(\"error\", sourceErrorEvent.trigger);\n el.appendChild(source);\n });\n el.load();\n });\n tryOnScopeDispose(() => {\n const el = toValue(target);\n if (!el)\n return;\n el.querySelectorAll(\"source\").forEach((e) => e.removeEventListener(\"error\", sourceErrorEvent.trigger));\n });\n watch([target, volume], () => {\n const el = toValue(target);\n if (!el)\n return;\n el.volume = volume.value;\n });\n watch([target, muted], () => {\n const el = toValue(target);\n if (!el)\n return;\n el.muted = muted.value;\n });\n watch([target, rate], () => {\n const el = toValue(target);\n if (!el)\n return;\n el.playbackRate = rate.value;\n });\n watchEffect(() => {\n if (!document)\n return;\n const textTracks = toValue(options.tracks);\n const el = toValue(target);\n if (!textTracks || !textTracks.length || !el)\n return;\n el.querySelectorAll(\"track\").forEach((e) => e.remove());\n textTracks.forEach(({ default: isDefault, kind, label, src, srcLang }, i) => {\n const track = document.createElement(\"track\");\n track.default = isDefault || false;\n track.kind = kind;\n track.label = label;\n track.src = src;\n track.srclang = srcLang;\n if (track.default)\n selectedTrack.value = i;\n el.appendChild(track);\n });\n });\n const { ignoreUpdates: ignoreCurrentTimeUpdates } = watchIgnorable(currentTime, (time) => {\n const el = toValue(target);\n if (!el)\n return;\n el.currentTime = time;\n });\n const { ignoreUpdates: ignorePlayingUpdates } = watchIgnorable(playing, (isPlaying) => {\n const el = toValue(target);\n if (!el)\n return;\n if (isPlaying)\n el.play();\n else\n el.pause();\n });\n useEventListener(target, \"timeupdate\", () => ignoreCurrentTimeUpdates(() => currentTime.value = toValue(target).currentTime));\n useEventListener(target, \"durationchange\", () => duration.value = toValue(target).duration);\n useEventListener(target, \"progress\", () => buffered.value = timeRangeToArray(toValue(target).buffered));\n useEventListener(target, \"seeking\", () => seeking.value = true);\n useEventListener(target, \"seeked\", () => seeking.value = false);\n useEventListener(target, [\"waiting\", \"loadstart\"], () => {\n waiting.value = true;\n ignorePlayingUpdates(() => playing.value = false);\n });\n useEventListener(target, \"loadeddata\", () => waiting.value = false);\n useEventListener(target, \"playing\", () => {\n waiting.value = false;\n ended.value = false;\n ignorePlayingUpdates(() => playing.value = true);\n });\n useEventListener(target, \"ratechange\", () => rate.value = toValue(target).playbackRate);\n useEventListener(target, \"stalled\", () => stalled.value = true);\n useEventListener(target, \"ended\", () => ended.value = true);\n useEventListener(target, \"pause\", () => ignorePlayingUpdates(() => playing.value = false));\n useEventListener(target, \"play\", () => ignorePlayingUpdates(() => playing.value = true));\n useEventListener(target, \"enterpictureinpicture\", () => isPictureInPicture.value = true);\n useEventListener(target, \"leavepictureinpicture\", () => isPictureInPicture.value = false);\n useEventListener(target, \"volumechange\", () => {\n const el = toValue(target);\n if (!el)\n return;\n volume.value = el.volume;\n muted.value = el.muted;\n });\n const listeners = [];\n const stop = watch([target], () => {\n const el = toValue(target);\n if (!el)\n return;\n stop();\n listeners[0] = useEventListener(el.textTracks, \"addtrack\", () => tracks.value = tracksToArray(el.textTracks));\n listeners[1] = useEventListener(el.textTracks, \"removetrack\", () => tracks.value = tracksToArray(el.textTracks));\n listeners[2] = useEventListener(el.textTracks, \"change\", () => tracks.value = tracksToArray(el.textTracks));\n });\n tryOnScopeDispose(() => listeners.forEach((listener) => listener()));\n return {\n currentTime,\n duration,\n waiting,\n seeking,\n ended,\n stalled,\n buffered,\n playing,\n rate,\n // Volume\n volume,\n muted,\n // Tracks\n tracks,\n selectedTrack,\n enableTrack,\n disableTrack,\n // Picture in Picture\n supportsPictureInPicture,\n togglePictureInPicture,\n isPictureInPicture,\n // Events\n onSourceError: sourceErrorEvent.on\n };\n}\n\nfunction getMapVue2Compat() {\n const data = shallowReactive({});\n return {\n get: (key) => data[key],\n set: (key, value) => set(data, key, value),\n has: (key) => hasOwn(data, key),\n delete: (key) => del(data, key),\n clear: () => {\n Object.keys(data).forEach((key) => {\n del(data, key);\n });\n }\n };\n}\nfunction useMemoize(resolver, options) {\n const initCache = () => {\n if (options == null ? void 0 : options.cache)\n return shallowReactive(options.cache);\n if (isVue2)\n return getMapVue2Compat();\n return shallowReactive(/* @__PURE__ */ new Map());\n };\n const cache = initCache();\n const generateKey = (...args) => (options == null ? void 0 : options.getKey) ? options.getKey(...args) : JSON.stringify(args);\n const _loadData = (key, ...args) => {\n cache.set(key, resolver(...args));\n return cache.get(key);\n };\n const loadData = (...args) => _loadData(generateKey(...args), ...args);\n const deleteData = (...args) => {\n cache.delete(generateKey(...args));\n };\n const clearData = () => {\n cache.clear();\n };\n const memoized = (...args) => {\n const key = generateKey(...args);\n if (cache.has(key))\n return cache.get(key);\n return _loadData(key, ...args);\n };\n memoized.load = loadData;\n memoized.delete = deleteData;\n memoized.clear = clearData;\n memoized.generateKey = generateKey;\n memoized.cache = cache;\n return memoized;\n}\n\nfunction useMemory(options = {}) {\n const memory = ref();\n const isSupported = useSupported(() => typeof performance !== \"undefined\" && \"memory\" in performance);\n if (isSupported.value) {\n const { interval = 1e3 } = options;\n useIntervalFn(() => {\n memory.value = performance.memory;\n }, interval, { immediate: options.immediate, immediateCallback: options.immediateCallback });\n }\n return { isSupported, memory };\n}\n\nconst UseMouseBuiltinExtractors = {\n page: (event) => [event.pageX, event.pageY],\n client: (event) => [event.clientX, event.clientY],\n screen: (event) => [event.screenX, event.screenY],\n movement: (event) => event instanceof Touch ? null : [event.movementX, event.movementY]\n};\nfunction useMouse(options = {}) {\n const {\n type = \"page\",\n touch = true,\n resetOnTouchEnds = false,\n initialValue = { x: 0, y: 0 },\n window = defaultWindow,\n target = window,\n scroll = true,\n eventFilter\n } = options;\n let _prevMouseEvent = null;\n const x = ref(initialValue.x);\n const y = ref(initialValue.y);\n const sourceType = ref(null);\n const extractor = typeof type === \"function\" ? type : UseMouseBuiltinExtractors[type];\n const mouseHandler = (event) => {\n const result = extractor(event);\n _prevMouseEvent = event;\n if (result) {\n [x.value, y.value] = result;\n sourceType.value = \"mouse\";\n }\n };\n const touchHandler = (event) => {\n if (event.touches.length > 0) {\n const result = extractor(event.touches[0]);\n if (result) {\n [x.value, y.value] = result;\n sourceType.value = \"touch\";\n }\n }\n };\n const scrollHandler = () => {\n if (!_prevMouseEvent || !window)\n return;\n const pos = extractor(_prevMouseEvent);\n if (_prevMouseEvent instanceof MouseEvent && pos) {\n x.value = pos[0] + window.scrollX;\n y.value = pos[1] + window.scrollY;\n }\n };\n const reset = () => {\n x.value = initialValue.x;\n y.value = initialValue.y;\n };\n const mouseHandlerWrapper = eventFilter ? (event) => eventFilter(() => mouseHandler(event), {}) : (event) => mouseHandler(event);\n const touchHandlerWrapper = eventFilter ? (event) => eventFilter(() => touchHandler(event), {}) : (event) => touchHandler(event);\n const scrollHandlerWrapper = eventFilter ? () => eventFilter(() => scrollHandler(), {}) : () => scrollHandler();\n if (target) {\n const listenerOptions = { passive: true };\n useEventListener(target, [\"mousemove\", \"dragover\"], mouseHandlerWrapper, listenerOptions);\n if (touch && type !== \"movement\") {\n useEventListener(target, [\"touchstart\", \"touchmove\"], touchHandlerWrapper, listenerOptions);\n if (resetOnTouchEnds)\n useEventListener(target, \"touchend\", reset, listenerOptions);\n }\n if (scroll && type === \"page\")\n useEventListener(window, \"scroll\", scrollHandlerWrapper, { passive: true });\n }\n return {\n x,\n y,\n sourceType\n };\n}\n\nfunction useMouseInElement(target, options = {}) {\n const {\n handleOutside = true,\n window = defaultWindow\n } = options;\n const type = options.type || \"page\";\n const { x, y, sourceType } = useMouse(options);\n const targetRef = ref(target != null ? target : window == null ? void 0 : window.document.body);\n const elementX = ref(0);\n const elementY = ref(0);\n const elementPositionX = ref(0);\n const elementPositionY = ref(0);\n const elementHeight = ref(0);\n const elementWidth = ref(0);\n const isOutside = ref(true);\n let stop = () => {\n };\n if (window) {\n stop = watch(\n [targetRef, x, y],\n () => {\n const el = unrefElement(targetRef);\n if (!el || !(el instanceof HTMLElement))\n return;\n const {\n left,\n top,\n width,\n height\n } = el.getBoundingClientRect();\n elementPositionX.value = left + (type === \"page\" ? window.pageXOffset : 0);\n elementPositionY.value = top + (type === \"page\" ? window.pageYOffset : 0);\n elementHeight.value = height;\n elementWidth.value = width;\n const elX = x.value - elementPositionX.value;\n const elY = y.value - elementPositionY.value;\n isOutside.value = width === 0 || height === 0 || elX < 0 || elY < 0 || elX > width || elY > height;\n if (handleOutside || !isOutside.value) {\n elementX.value = elX;\n elementY.value = elY;\n }\n },\n { immediate: true }\n );\n useEventListener(document, \"mouseleave\", () => {\n isOutside.value = true;\n });\n }\n return {\n x,\n y,\n sourceType,\n elementX,\n elementY,\n elementPositionX,\n elementPositionY,\n elementHeight,\n elementWidth,\n isOutside,\n stop\n };\n}\n\nfunction useMousePressed(options = {}) {\n const {\n touch = true,\n drag = true,\n capture = false,\n initialValue = false,\n window = defaultWindow\n } = options;\n const pressed = ref(initialValue);\n const sourceType = ref(null);\n if (!window) {\n return {\n pressed,\n sourceType\n };\n }\n const onPressed = (srcType) => () => {\n pressed.value = true;\n sourceType.value = srcType;\n };\n const onReleased = () => {\n pressed.value = false;\n sourceType.value = null;\n };\n const target = computed(() => unrefElement(options.target) || window);\n useEventListener(target, \"mousedown\", onPressed(\"mouse\"), { passive: true, capture });\n useEventListener(window, \"mouseleave\", onReleased, { passive: true, capture });\n useEventListener(window, \"mouseup\", onReleased, { passive: true, capture });\n if (drag) {\n useEventListener(target, \"dragstart\", onPressed(\"mouse\"), { passive: true, capture });\n useEventListener(window, \"drop\", onReleased, { passive: true, capture });\n useEventListener(window, \"dragend\", onReleased, { passive: true, capture });\n }\n if (touch) {\n useEventListener(target, \"touchstart\", onPressed(\"touch\"), { passive: true, capture });\n useEventListener(window, \"touchend\", onReleased, { passive: true, capture });\n useEventListener(window, \"touchcancel\", onReleased, { passive: true, capture });\n }\n return {\n pressed,\n sourceType\n };\n}\n\nfunction useNavigatorLanguage(options = {}) {\n const { window = defaultWindow } = options;\n const navigator = window == null ? void 0 : window.navigator;\n const isSupported = useSupported(() => navigator && \"language\" in navigator);\n const language = ref(navigator == null ? void 0 : navigator.language);\n useEventListener(window, \"languagechange\", () => {\n if (navigator)\n language.value = navigator.language;\n });\n return {\n isSupported,\n language\n };\n}\n\nfunction useNetwork(options = {}) {\n const { window = defaultWindow } = options;\n const navigator = window == null ? void 0 : window.navigator;\n const isSupported = useSupported(() => navigator && \"connection\" in navigator);\n const isOnline = ref(true);\n const saveData = ref(false);\n const offlineAt = ref(void 0);\n const onlineAt = ref(void 0);\n const downlink = ref(void 0);\n const downlinkMax = ref(void 0);\n const rtt = ref(void 0);\n const effectiveType = ref(void 0);\n const type = ref(\"unknown\");\n const connection = isSupported.value && navigator.connection;\n function updateNetworkInformation() {\n if (!navigator)\n return;\n isOnline.value = navigator.onLine;\n offlineAt.value = isOnline.value ? void 0 : Date.now();\n onlineAt.value = isOnline.value ? Date.now() : void 0;\n if (connection) {\n downlink.value = connection.downlink;\n downlinkMax.value = connection.downlinkMax;\n effectiveType.value = connection.effectiveType;\n rtt.value = connection.rtt;\n saveData.value = connection.saveData;\n type.value = connection.type;\n }\n }\n if (window) {\n useEventListener(window, \"offline\", () => {\n isOnline.value = false;\n offlineAt.value = Date.now();\n });\n useEventListener(window, \"online\", () => {\n isOnline.value = true;\n onlineAt.value = Date.now();\n });\n }\n if (connection)\n useEventListener(connection, \"change\", updateNetworkInformation, false);\n updateNetworkInformation();\n return {\n isSupported,\n isOnline,\n saveData,\n offlineAt,\n onlineAt,\n downlink,\n downlinkMax,\n effectiveType,\n rtt,\n type\n };\n}\n\nfunction useNow(options = {}) {\n const {\n controls: exposeControls = false,\n interval = \"requestAnimationFrame\"\n } = options;\n const now = ref(/* @__PURE__ */ new Date());\n const update = () => now.value = /* @__PURE__ */ new Date();\n const controls = interval === \"requestAnimationFrame\" ? useRafFn(update, { immediate: true }) : useIntervalFn(update, interval, { immediate: true });\n if (exposeControls) {\n return {\n now,\n ...controls\n };\n } else {\n return now;\n }\n}\n\nfunction useObjectUrl(object) {\n const url = ref();\n const release = () => {\n if (url.value)\n URL.revokeObjectURL(url.value);\n url.value = void 0;\n };\n watch(\n () => toValue(object),\n (newObject) => {\n release();\n if (newObject)\n url.value = URL.createObjectURL(newObject);\n },\n { immediate: true }\n );\n tryOnScopeDispose(release);\n return readonly(url);\n}\n\nfunction useClamp(value, min, max) {\n if (typeof value === \"function\" || isReadonly(value))\n return computed(() => clamp(toValue(value), toValue(min), toValue(max)));\n const _value = ref(value);\n return computed({\n get() {\n return _value.value = clamp(_value.value, toValue(min), toValue(max));\n },\n set(value2) {\n _value.value = clamp(value2, toValue(min), toValue(max));\n }\n });\n}\n\nfunction useOffsetPagination(options) {\n const {\n total = Number.POSITIVE_INFINITY,\n pageSize = 10,\n page = 1,\n onPageChange = noop,\n onPageSizeChange = noop,\n onPageCountChange = noop\n } = options;\n const currentPageSize = useClamp(pageSize, 1, Number.POSITIVE_INFINITY);\n const pageCount = computed(() => Math.max(\n 1,\n Math.ceil(toValue(total) / toValue(currentPageSize))\n ));\n const currentPage = useClamp(page, 1, pageCount);\n const isFirstPage = computed(() => currentPage.value === 1);\n const isLastPage = computed(() => currentPage.value === pageCount.value);\n if (isRef(page)) {\n syncRef(page, currentPage, {\n direction: isReadonly(page) ? \"ltr\" : \"both\"\n });\n }\n if (isRef(pageSize)) {\n syncRef(pageSize, currentPageSize, {\n direction: isReadonly(pageSize) ? \"ltr\" : \"both\"\n });\n }\n function prev() {\n currentPage.value--;\n }\n function next() {\n currentPage.value++;\n }\n const returnValue = {\n currentPage,\n currentPageSize,\n pageCount,\n isFirstPage,\n isLastPage,\n prev,\n next\n };\n watch(currentPage, () => {\n onPageChange(reactive(returnValue));\n });\n watch(currentPageSize, () => {\n onPageSizeChange(reactive(returnValue));\n });\n watch(pageCount, () => {\n onPageCountChange(reactive(returnValue));\n });\n return returnValue;\n}\n\nfunction useOnline(options = {}) {\n const { isOnline } = useNetwork(options);\n return isOnline;\n}\n\nfunction usePageLeave(options = {}) {\n const { window = defaultWindow } = options;\n const isLeft = ref(false);\n const handler = (event) => {\n if (!window)\n return;\n event = event || window.event;\n const from = event.relatedTarget || event.toElement;\n isLeft.value = !from;\n };\n if (window) {\n useEventListener(window, \"mouseout\", handler, { passive: true });\n useEventListener(window.document, \"mouseleave\", handler, { passive: true });\n useEventListener(window.document, \"mouseenter\", handler, { passive: true });\n }\n return isLeft;\n}\n\nfunction useScreenOrientation(options = {}) {\n const {\n window = defaultWindow\n } = options;\n const isSupported = useSupported(() => window && \"screen\" in window && \"orientation\" in window.screen);\n const screenOrientation = isSupported.value ? window.screen.orientation : {};\n const orientation = ref(screenOrientation.type);\n const angle = ref(screenOrientation.angle || 0);\n if (isSupported.value) {\n useEventListener(window, \"orientationchange\", () => {\n orientation.value = screenOrientation.type;\n angle.value = screenOrientation.angle;\n });\n }\n const lockOrientation = (type) => {\n if (isSupported.value && typeof screenOrientation.lock === \"function\")\n return screenOrientation.lock(type);\n return Promise.reject(new Error(\"Not supported\"));\n };\n const unlockOrientation = () => {\n if (isSupported.value && typeof screenOrientation.unlock === \"function\")\n screenOrientation.unlock();\n };\n return {\n isSupported,\n orientation,\n angle,\n lockOrientation,\n unlockOrientation\n };\n}\n\nfunction useParallax(target, options = {}) {\n const {\n deviceOrientationTiltAdjust = (i) => i,\n deviceOrientationRollAdjust = (i) => i,\n mouseTiltAdjust = (i) => i,\n mouseRollAdjust = (i) => i,\n window = defaultWindow\n } = options;\n const orientation = reactive(useDeviceOrientation({ window }));\n const screenOrientation = reactive(useScreenOrientation({ window }));\n const {\n elementX: x,\n elementY: y,\n elementWidth: width,\n elementHeight: height\n } = useMouseInElement(target, { handleOutside: false, window });\n const source = computed(() => {\n if (orientation.isSupported && (orientation.alpha != null && orientation.alpha !== 0 || orientation.gamma != null && orientation.gamma !== 0)) {\n return \"deviceOrientation\";\n }\n return \"mouse\";\n });\n const roll = computed(() => {\n if (source.value === \"deviceOrientation\") {\n let value;\n switch (screenOrientation.orientation) {\n case \"landscape-primary\":\n value = orientation.gamma / 90;\n break;\n case \"landscape-secondary\":\n value = -orientation.gamma / 90;\n break;\n case \"portrait-primary\":\n value = -orientation.beta / 90;\n break;\n case \"portrait-secondary\":\n value = orientation.beta / 90;\n break;\n default:\n value = -orientation.beta / 90;\n }\n return deviceOrientationRollAdjust(value);\n } else {\n const value = -(y.value - height.value / 2) / height.value;\n return mouseRollAdjust(value);\n }\n });\n const tilt = computed(() => {\n if (source.value === \"deviceOrientation\") {\n let value;\n switch (screenOrientation.orientation) {\n case \"landscape-primary\":\n value = orientation.beta / 90;\n break;\n case \"landscape-secondary\":\n value = -orientation.beta / 90;\n break;\n case \"portrait-primary\":\n value = orientation.gamma / 90;\n break;\n case \"portrait-secondary\":\n value = -orientation.gamma / 90;\n break;\n default:\n value = orientation.gamma / 90;\n }\n return deviceOrientationTiltAdjust(value);\n } else {\n const value = (x.value - width.value / 2) / width.value;\n return mouseTiltAdjust(value);\n }\n });\n return { roll, tilt, source };\n}\n\nfunction useParentElement(element = useCurrentElement()) {\n const parentElement = shallowRef();\n const update = () => {\n const el = unrefElement(element);\n if (el)\n parentElement.value = el.parentElement;\n };\n tryOnMounted(update);\n watch(() => toValue(element), update);\n return parentElement;\n}\n\nfunction usePerformanceObserver(options, callback) {\n const {\n window = defaultWindow,\n immediate = true,\n ...performanceOptions\n } = options;\n const isSupported = useSupported(() => window && \"PerformanceObserver\" in window);\n let observer;\n const stop = () => {\n observer == null ? void 0 : observer.disconnect();\n };\n const start = () => {\n if (isSupported.value) {\n stop();\n observer = new PerformanceObserver(callback);\n observer.observe(performanceOptions);\n }\n };\n tryOnScopeDispose(stop);\n if (immediate)\n start();\n return {\n isSupported,\n start,\n stop\n };\n}\n\nconst defaultState = {\n x: 0,\n y: 0,\n pointerId: 0,\n pressure: 0,\n tiltX: 0,\n tiltY: 0,\n width: 0,\n height: 0,\n twist: 0,\n pointerType: null\n};\nconst keys = /* @__PURE__ */ Object.keys(defaultState);\nfunction usePointer(options = {}) {\n const {\n target = defaultWindow\n } = options;\n const isInside = ref(false);\n const state = ref(options.initialValue || {});\n Object.assign(state.value, defaultState, state.value);\n const handler = (event) => {\n isInside.value = true;\n if (options.pointerTypes && !options.pointerTypes.includes(event.pointerType))\n return;\n state.value = objectPick(event, keys, false);\n };\n if (target) {\n const listenerOptions = { passive: true };\n useEventListener(target, [\"pointerdown\", \"pointermove\", \"pointerup\"], handler, listenerOptions);\n useEventListener(target, \"pointerleave\", () => isInside.value = false, listenerOptions);\n }\n return {\n ...toRefs(state),\n isInside\n };\n}\n\nfunction usePointerLock(target, options = {}) {\n const { document = defaultDocument } = options;\n const isSupported = useSupported(() => document && \"pointerLockElement\" in document);\n const element = ref();\n const triggerElement = ref();\n let targetElement;\n if (isSupported.value) {\n useEventListener(document, \"pointerlockchange\", () => {\n var _a;\n const currentElement = (_a = document.pointerLockElement) != null ? _a : element.value;\n if (targetElement && currentElement === targetElement) {\n element.value = document.pointerLockElement;\n if (!element.value)\n targetElement = triggerElement.value = null;\n }\n });\n useEventListener(document, \"pointerlockerror\", () => {\n var _a;\n const currentElement = (_a = document.pointerLockElement) != null ? _a : element.value;\n if (targetElement && currentElement === targetElement) {\n const action = document.pointerLockElement ? \"release\" : \"acquire\";\n throw new Error(`Failed to ${action} pointer lock.`);\n }\n });\n }\n async function lock(e) {\n var _a;\n if (!isSupported.value)\n throw new Error(\"Pointer Lock API is not supported by your browser.\");\n triggerElement.value = e instanceof Event ? e.currentTarget : null;\n targetElement = e instanceof Event ? (_a = unrefElement(target)) != null ? _a : triggerElement.value : unrefElement(e);\n if (!targetElement)\n throw new Error(\"Target element undefined.\");\n targetElement.requestPointerLock();\n return await until(element).toBe(targetElement);\n }\n async function unlock() {\n if (!element.value)\n return false;\n document.exitPointerLock();\n await until(element).toBeNull();\n return true;\n }\n return {\n isSupported,\n element,\n triggerElement,\n lock,\n unlock\n };\n}\n\nfunction usePointerSwipe(target, options = {}) {\n const targetRef = toRef(target);\n const {\n threshold = 50,\n onSwipe,\n onSwipeEnd,\n onSwipeStart,\n disableTextSelect = false\n } = options;\n const posStart = reactive({ x: 0, y: 0 });\n const updatePosStart = (x, y) => {\n posStart.x = x;\n posStart.y = y;\n };\n const posEnd = reactive({ x: 0, y: 0 });\n const updatePosEnd = (x, y) => {\n posEnd.x = x;\n posEnd.y = y;\n };\n const distanceX = computed(() => posStart.x - posEnd.x);\n const distanceY = computed(() => posStart.y - posEnd.y);\n const { max, abs } = Math;\n const isThresholdExceeded = computed(() => max(abs(distanceX.value), abs(distanceY.value)) >= threshold);\n const isSwiping = ref(false);\n const isPointerDown = ref(false);\n const direction = computed(() => {\n if (!isThresholdExceeded.value)\n return \"none\";\n if (abs(distanceX.value) > abs(distanceY.value)) {\n return distanceX.value > 0 ? \"left\" : \"right\";\n } else {\n return distanceY.value > 0 ? \"up\" : \"down\";\n }\n });\n const eventIsAllowed = (e) => {\n var _a, _b, _c;\n const isReleasingButton = e.buttons === 0;\n const isPrimaryButton = e.buttons === 1;\n return (_c = (_b = (_a = options.pointerTypes) == null ? void 0 : _a.includes(e.pointerType)) != null ? _b : isReleasingButton || isPrimaryButton) != null ? _c : true;\n };\n const stops = [\n useEventListener(target, \"pointerdown\", (e) => {\n if (!eventIsAllowed(e))\n return;\n isPointerDown.value = true;\n const eventTarget = e.target;\n eventTarget == null ? void 0 : eventTarget.setPointerCapture(e.pointerId);\n const { clientX: x, clientY: y } = e;\n updatePosStart(x, y);\n updatePosEnd(x, y);\n onSwipeStart == null ? void 0 : onSwipeStart(e);\n }),\n useEventListener(target, \"pointermove\", (e) => {\n if (!eventIsAllowed(e))\n return;\n if (!isPointerDown.value)\n return;\n const { clientX: x, clientY: y } = e;\n updatePosEnd(x, y);\n if (!isSwiping.value && isThresholdExceeded.value)\n isSwiping.value = true;\n if (isSwiping.value)\n onSwipe == null ? void 0 : onSwipe(e);\n }),\n useEventListener(target, \"pointerup\", (e) => {\n if (!eventIsAllowed(e))\n return;\n if (isSwiping.value)\n onSwipeEnd == null ? void 0 : onSwipeEnd(e, direction.value);\n isPointerDown.value = false;\n isSwiping.value = false;\n })\n ];\n tryOnMounted(() => {\n var _a, _b, _c, _d, _e, _f, _g, _h;\n (_b = (_a = targetRef.value) == null ? void 0 : _a.style) == null ? void 0 : _b.setProperty(\"touch-action\", \"none\");\n if (disableTextSelect) {\n (_d = (_c = targetRef.value) == null ? void 0 : _c.style) == null ? void 0 : _d.setProperty(\"-webkit-user-select\", \"none\");\n (_f = (_e = targetRef.value) == null ? void 0 : _e.style) == null ? void 0 : _f.setProperty(\"-ms-user-select\", \"none\");\n (_h = (_g = targetRef.value) == null ? void 0 : _g.style) == null ? void 0 : _h.setProperty(\"user-select\", \"none\");\n }\n });\n const stop = () => stops.forEach((s) => s());\n return {\n isSwiping: readonly(isSwiping),\n direction: readonly(direction),\n posStart: readonly(posStart),\n posEnd: readonly(posEnd),\n distanceX,\n distanceY,\n stop\n };\n}\n\nfunction usePreferredColorScheme(options) {\n const isLight = useMediaQuery(\"(prefers-color-scheme: light)\", options);\n const isDark = useMediaQuery(\"(prefers-color-scheme: dark)\", options);\n return computed(() => {\n if (isDark.value)\n return \"dark\";\n if (isLight.value)\n return \"light\";\n return \"no-preference\";\n });\n}\n\nfunction usePreferredContrast(options) {\n const isMore = useMediaQuery(\"(prefers-contrast: more)\", options);\n const isLess = useMediaQuery(\"(prefers-contrast: less)\", options);\n const isCustom = useMediaQuery(\"(prefers-contrast: custom)\", options);\n return computed(() => {\n if (isMore.value)\n return \"more\";\n if (isLess.value)\n return \"less\";\n if (isCustom.value)\n return \"custom\";\n return \"no-preference\";\n });\n}\n\nfunction usePreferredLanguages(options = {}) {\n const { window = defaultWindow } = options;\n if (!window)\n return ref([\"en\"]);\n const navigator = window.navigator;\n const value = ref(navigator.languages);\n useEventListener(window, \"languagechange\", () => {\n value.value = navigator.languages;\n });\n return value;\n}\n\nfunction usePreferredReducedMotion(options) {\n const isReduced = useMediaQuery(\"(prefers-reduced-motion: reduce)\", options);\n return computed(() => {\n if (isReduced.value)\n return \"reduce\";\n return \"no-preference\";\n });\n}\n\nfunction usePrevious(value, initialValue) {\n const previous = shallowRef(initialValue);\n watch(\n toRef(value),\n (_, oldValue) => {\n previous.value = oldValue;\n },\n { flush: \"sync\" }\n );\n return readonly(previous);\n}\n\nconst topVarName = \"--vueuse-safe-area-top\";\nconst rightVarName = \"--vueuse-safe-area-right\";\nconst bottomVarName = \"--vueuse-safe-area-bottom\";\nconst leftVarName = \"--vueuse-safe-area-left\";\nfunction useScreenSafeArea() {\n const top = ref(\"\");\n const right = ref(\"\");\n const bottom = ref(\"\");\n const left = ref(\"\");\n if (isClient) {\n const topCssVar = useCssVar(topVarName);\n const rightCssVar = useCssVar(rightVarName);\n const bottomCssVar = useCssVar(bottomVarName);\n const leftCssVar = useCssVar(leftVarName);\n topCssVar.value = \"env(safe-area-inset-top, 0px)\";\n rightCssVar.value = \"env(safe-area-inset-right, 0px)\";\n bottomCssVar.value = \"env(safe-area-inset-bottom, 0px)\";\n leftCssVar.value = \"env(safe-area-inset-left, 0px)\";\n update();\n useEventListener(\"resize\", useDebounceFn(update));\n }\n function update() {\n top.value = getValue(topVarName);\n right.value = getValue(rightVarName);\n bottom.value = getValue(bottomVarName);\n left.value = getValue(leftVarName);\n }\n return {\n top,\n right,\n bottom,\n left,\n update\n };\n}\nfunction getValue(position) {\n return getComputedStyle(document.documentElement).getPropertyValue(position);\n}\n\nfunction useScriptTag(src, onLoaded = noop, options = {}) {\n const {\n immediate = true,\n manual = false,\n type = \"text/javascript\",\n async = true,\n crossOrigin,\n referrerPolicy,\n noModule,\n defer,\n document = defaultDocument,\n attrs = {}\n } = options;\n const scriptTag = ref(null);\n let _promise = null;\n const loadScript = (waitForScriptLoad) => new Promise((resolve, reject) => {\n const resolveWithElement = (el2) => {\n scriptTag.value = el2;\n resolve(el2);\n return el2;\n };\n if (!document) {\n resolve(false);\n return;\n }\n let shouldAppend = false;\n let el = document.querySelector(`script[src=\"${toValue(src)}\"]`);\n if (!el) {\n el = document.createElement(\"script\");\n el.type = type;\n el.async = async;\n el.src = toValue(src);\n if (defer)\n el.defer = defer;\n if (crossOrigin)\n el.crossOrigin = crossOrigin;\n if (noModule)\n el.noModule = noModule;\n if (referrerPolicy)\n el.referrerPolicy = referrerPolicy;\n Object.entries(attrs).forEach(([name, value]) => el == null ? void 0 : el.setAttribute(name, value));\n shouldAppend = true;\n } else if (el.hasAttribute(\"data-loaded\")) {\n resolveWithElement(el);\n }\n el.addEventListener(\"error\", (event) => reject(event));\n el.addEventListener(\"abort\", (event) => reject(event));\n el.addEventListener(\"load\", () => {\n el.setAttribute(\"data-loaded\", \"true\");\n onLoaded(el);\n resolveWithElement(el);\n });\n if (shouldAppend)\n el = document.head.appendChild(el);\n if (!waitForScriptLoad)\n resolveWithElement(el);\n });\n const load = (waitForScriptLoad = true) => {\n if (!_promise)\n _promise = loadScript(waitForScriptLoad);\n return _promise;\n };\n const unload = () => {\n if (!document)\n return;\n _promise = null;\n if (scriptTag.value)\n scriptTag.value = null;\n const el = document.querySelector(`script[src=\"${toValue(src)}\"]`);\n if (el)\n document.head.removeChild(el);\n };\n if (immediate && !manual)\n tryOnMounted(load);\n if (!manual)\n tryOnUnmounted(unload);\n return { scriptTag, load, unload };\n}\n\nfunction checkOverflowScroll(ele) {\n const style = window.getComputedStyle(ele);\n if (style.overflowX === \"scroll\" || style.overflowY === \"scroll\" || style.overflowX === \"auto\" && ele.clientWidth < ele.scrollWidth || style.overflowY === \"auto\" && ele.clientHeight < ele.scrollHeight) {\n return true;\n } else {\n const parent = ele.parentNode;\n if (!parent || parent.tagName === \"BODY\")\n return false;\n return checkOverflowScroll(parent);\n }\n}\nfunction preventDefault(rawEvent) {\n const e = rawEvent || window.event;\n const _target = e.target;\n if (checkOverflowScroll(_target))\n return false;\n if (e.touches.length > 1)\n return true;\n if (e.preventDefault)\n e.preventDefault();\n return false;\n}\nconst elInitialOverflow = /* @__PURE__ */ new WeakMap();\nfunction useScrollLock(element, initialState = false) {\n const isLocked = ref(initialState);\n let stopTouchMoveListener = null;\n let initialOverflow = \"\";\n watch(toRef(element), (el) => {\n const target = resolveElement(toValue(el));\n if (target) {\n const ele = target;\n if (!elInitialOverflow.get(ele))\n elInitialOverflow.set(ele, ele.style.overflow);\n if (ele.style.overflow !== \"hidden\")\n initialOverflow = ele.style.overflow;\n if (ele.style.overflow === \"hidden\")\n return isLocked.value = true;\n if (isLocked.value)\n return ele.style.overflow = \"hidden\";\n }\n }, {\n immediate: true\n });\n const lock = () => {\n const el = resolveElement(toValue(element));\n if (!el || isLocked.value)\n return;\n if (isIOS) {\n stopTouchMoveListener = useEventListener(\n el,\n \"touchmove\",\n (e) => {\n preventDefault(e);\n },\n { passive: false }\n );\n }\n el.style.overflow = \"hidden\";\n isLocked.value = true;\n };\n const unlock = () => {\n const el = resolveElement(toValue(element));\n if (!el || !isLocked.value)\n return;\n if (isIOS)\n stopTouchMoveListener == null ? void 0 : stopTouchMoveListener();\n el.style.overflow = initialOverflow;\n elInitialOverflow.delete(el);\n isLocked.value = false;\n };\n tryOnScopeDispose(unlock);\n return computed({\n get() {\n return isLocked.value;\n },\n set(v) {\n if (v)\n lock();\n else unlock();\n }\n });\n}\n\nfunction useSessionStorage(key, initialValue, options = {}) {\n const { window = defaultWindow } = options;\n return useStorage(key, initialValue, window == null ? void 0 : window.sessionStorage, options);\n}\n\nfunction useShare(shareOptions = {}, options = {}) {\n const { navigator = defaultNavigator } = options;\n const _navigator = navigator;\n const isSupported = useSupported(() => _navigator && \"canShare\" in _navigator);\n const share = async (overrideOptions = {}) => {\n if (isSupported.value) {\n const data = {\n ...toValue(shareOptions),\n ...toValue(overrideOptions)\n };\n let granted = true;\n if (data.files && _navigator.canShare)\n granted = _navigator.canShare({ files: data.files });\n if (granted)\n return _navigator.share(data);\n }\n };\n return {\n isSupported,\n share\n };\n}\n\nconst defaultSortFn = (source, compareFn) => source.sort(compareFn);\nconst defaultCompare = (a, b) => a - b;\nfunction useSorted(...args) {\n var _a, _b, _c, _d;\n const [source] = args;\n let compareFn = defaultCompare;\n let options = {};\n if (args.length === 2) {\n if (typeof args[1] === \"object\") {\n options = args[1];\n compareFn = (_a = options.compareFn) != null ? _a : defaultCompare;\n } else {\n compareFn = (_b = args[1]) != null ? _b : defaultCompare;\n }\n } else if (args.length > 2) {\n compareFn = (_c = args[1]) != null ? _c : defaultCompare;\n options = (_d = args[2]) != null ? _d : {};\n }\n const {\n dirty = false,\n sortFn = defaultSortFn\n } = options;\n if (!dirty)\n return computed(() => sortFn([...toValue(source)], compareFn));\n watchEffect(() => {\n const result = sortFn(toValue(source), compareFn);\n if (isRef(source))\n source.value = result;\n else\n source.splice(0, source.length, ...result);\n });\n return source;\n}\n\nfunction useSpeechRecognition(options = {}) {\n const {\n interimResults = true,\n continuous = true,\n maxAlternatives = 1,\n window = defaultWindow\n } = options;\n const lang = toRef(options.lang || \"en-US\");\n const isListening = ref(false);\n const isFinal = ref(false);\n const result = ref(\"\");\n const error = shallowRef(void 0);\n const toggle = (value = !isListening.value) => {\n isListening.value = value;\n };\n const start = () => {\n isListening.value = true;\n };\n const stop = () => {\n isListening.value = false;\n };\n const SpeechRecognition = window && (window.SpeechRecognition || window.webkitSpeechRecognition);\n const isSupported = useSupported(() => SpeechRecognition);\n let recognition;\n if (isSupported.value) {\n recognition = new SpeechRecognition();\n recognition.continuous = continuous;\n recognition.interimResults = interimResults;\n recognition.lang = toValue(lang);\n recognition.maxAlternatives = maxAlternatives;\n recognition.onstart = () => {\n isFinal.value = false;\n };\n watch(lang, (lang2) => {\n if (recognition && !isListening.value)\n recognition.lang = lang2;\n });\n recognition.onresult = (event) => {\n const currentResult = event.results[event.resultIndex];\n const { transcript } = currentResult[0];\n isFinal.value = currentResult.isFinal;\n result.value = transcript;\n error.value = void 0;\n };\n recognition.onerror = (event) => {\n error.value = event;\n };\n recognition.onend = () => {\n isListening.value = false;\n recognition.lang = toValue(lang);\n };\n watch(isListening, () => {\n if (isListening.value)\n recognition.start();\n else\n recognition.stop();\n });\n }\n tryOnScopeDispose(() => {\n isListening.value = false;\n });\n return {\n isSupported,\n isListening,\n isFinal,\n recognition,\n result,\n error,\n toggle,\n start,\n stop\n };\n}\n\nfunction useSpeechSynthesis(text, options = {}) {\n const {\n pitch = 1,\n rate = 1,\n volume = 1,\n window = defaultWindow\n } = options;\n const synth = window && window.speechSynthesis;\n const isSupported = useSupported(() => synth);\n const isPlaying = ref(false);\n const status = ref(\"init\");\n const spokenText = toRef(text || \"\");\n const lang = toRef(options.lang || \"en-US\");\n const error = shallowRef(void 0);\n const toggle = (value = !isPlaying.value) => {\n isPlaying.value = value;\n };\n const bindEventsForUtterance = (utterance2) => {\n utterance2.lang = toValue(lang);\n utterance2.voice = toValue(options.voice) || null;\n utterance2.pitch = toValue(pitch);\n utterance2.rate = toValue(rate);\n utterance2.volume = volume;\n utterance2.onstart = () => {\n isPlaying.value = true;\n status.value = \"play\";\n };\n utterance2.onpause = () => {\n isPlaying.value = false;\n status.value = \"pause\";\n };\n utterance2.onresume = () => {\n isPlaying.value = true;\n status.value = \"play\";\n };\n utterance2.onend = () => {\n isPlaying.value = false;\n status.value = \"end\";\n };\n utterance2.onerror = (event) => {\n error.value = event;\n };\n };\n const utterance = computed(() => {\n isPlaying.value = false;\n status.value = \"init\";\n const newUtterance = new SpeechSynthesisUtterance(spokenText.value);\n bindEventsForUtterance(newUtterance);\n return newUtterance;\n });\n const speak = () => {\n synth.cancel();\n if (utterance)\n synth.speak(utterance.value);\n };\n const stop = () => {\n synth.cancel();\n isPlaying.value = false;\n };\n if (isSupported.value) {\n bindEventsForUtterance(utterance.value);\n watch(lang, (lang2) => {\n if (utterance.value && !isPlaying.value)\n utterance.value.lang = lang2;\n });\n if (options.voice) {\n watch(options.voice, () => {\n synth.cancel();\n });\n }\n watch(isPlaying, () => {\n if (isPlaying.value)\n synth.resume();\n else\n synth.pause();\n });\n }\n tryOnScopeDispose(() => {\n isPlaying.value = false;\n });\n return {\n isSupported,\n isPlaying,\n status,\n utterance,\n error,\n stop,\n toggle,\n speak\n };\n}\n\nfunction useStepper(steps, initialStep) {\n const stepsRef = ref(steps);\n const stepNames = computed(() => Array.isArray(stepsRef.value) ? stepsRef.value : Object.keys(stepsRef.value));\n const index = ref(stepNames.value.indexOf(initialStep != null ? initialStep : stepNames.value[0]));\n const current = computed(() => at(index.value));\n const isFirst = computed(() => index.value === 0);\n const isLast = computed(() => index.value === stepNames.value.length - 1);\n const next = computed(() => stepNames.value[index.value + 1]);\n const previous = computed(() => stepNames.value[index.value - 1]);\n function at(index2) {\n if (Array.isArray(stepsRef.value))\n return stepsRef.value[index2];\n return stepsRef.value[stepNames.value[index2]];\n }\n function get(step) {\n if (!stepNames.value.includes(step))\n return;\n return at(stepNames.value.indexOf(step));\n }\n function goTo(step) {\n if (stepNames.value.includes(step))\n index.value = stepNames.value.indexOf(step);\n }\n function goToNext() {\n if (isLast.value)\n return;\n index.value++;\n }\n function goToPrevious() {\n if (isFirst.value)\n return;\n index.value--;\n }\n function goBackTo(step) {\n if (isAfter(step))\n goTo(step);\n }\n function isNext(step) {\n return stepNames.value.indexOf(step) === index.value + 1;\n }\n function isPrevious(step) {\n return stepNames.value.indexOf(step) === index.value - 1;\n }\n function isCurrent(step) {\n return stepNames.value.indexOf(step) === index.value;\n }\n function isBefore(step) {\n return index.value < stepNames.value.indexOf(step);\n }\n function isAfter(step) {\n return index.value > stepNames.value.indexOf(step);\n }\n return {\n steps: stepsRef,\n stepNames,\n index,\n current,\n next,\n previous,\n isFirst,\n isLast,\n at,\n get,\n goTo,\n goToNext,\n goToPrevious,\n goBackTo,\n isNext,\n isPrevious,\n isCurrent,\n isBefore,\n isAfter\n };\n}\n\nfunction useStorageAsync(key, initialValue, storage, options = {}) {\n var _a;\n const {\n flush = \"pre\",\n deep = true,\n listenToStorageChanges = true,\n writeDefaults = true,\n mergeDefaults = false,\n shallow,\n window = defaultWindow,\n eventFilter,\n onError = (e) => {\n console.error(e);\n }\n } = options;\n const rawInit = toValue(initialValue);\n const type = guessSerializerType(rawInit);\n const data = (shallow ? shallowRef : ref)(initialValue);\n const serializer = (_a = options.serializer) != null ? _a : StorageSerializers[type];\n if (!storage) {\n try {\n storage = getSSRHandler(\"getDefaultStorageAsync\", () => {\n var _a2;\n return (_a2 = defaultWindow) == null ? void 0 : _a2.localStorage;\n })();\n } catch (e) {\n onError(e);\n }\n }\n async function read(event) {\n if (!storage || event && event.key !== key)\n return;\n try {\n const rawValue = event ? event.newValue : await storage.getItem(key);\n if (rawValue == null) {\n data.value = rawInit;\n if (writeDefaults && rawInit !== null)\n await storage.setItem(key, await serializer.write(rawInit));\n } else if (mergeDefaults) {\n const value = await serializer.read(rawValue);\n if (typeof mergeDefaults === \"function\")\n data.value = mergeDefaults(value, rawInit);\n else if (type === \"object\" && !Array.isArray(value))\n data.value = { ...rawInit, ...value };\n else data.value = value;\n } else {\n data.value = await serializer.read(rawValue);\n }\n } catch (e) {\n onError(e);\n }\n }\n read();\n if (window && listenToStorageChanges)\n useEventListener(window, \"storage\", (e) => Promise.resolve().then(() => read(e)));\n if (storage) {\n watchWithFilter(\n data,\n async () => {\n try {\n if (data.value == null)\n await storage.removeItem(key);\n else\n await storage.setItem(key, await serializer.write(data.value));\n } catch (e) {\n onError(e);\n }\n },\n {\n flush,\n deep,\n eventFilter\n }\n );\n }\n return data;\n}\n\nlet _id = 0;\nfunction useStyleTag(css, options = {}) {\n const isLoaded = ref(false);\n const {\n document = defaultDocument,\n immediate = true,\n manual = false,\n id = `vueuse_styletag_${++_id}`\n } = options;\n const cssRef = ref(css);\n let stop = () => {\n };\n const load = () => {\n if (!document)\n return;\n const el = document.getElementById(id) || document.createElement(\"style\");\n if (!el.isConnected) {\n el.id = id;\n if (options.media)\n el.media = options.media;\n document.head.appendChild(el);\n }\n if (isLoaded.value)\n return;\n stop = watch(\n cssRef,\n (value) => {\n el.textContent = value;\n },\n { immediate: true }\n );\n isLoaded.value = true;\n };\n const unload = () => {\n if (!document || !isLoaded.value)\n return;\n stop();\n document.head.removeChild(document.getElementById(id));\n isLoaded.value = false;\n };\n if (immediate && !manual)\n tryOnMounted(load);\n if (!manual)\n tryOnScopeDispose(unload);\n return {\n id,\n css: cssRef,\n unload,\n load,\n isLoaded: readonly(isLoaded)\n };\n}\n\nfunction useSwipe(target, options = {}) {\n const {\n threshold = 50,\n onSwipe,\n onSwipeEnd,\n onSwipeStart,\n passive = true,\n window = defaultWindow\n } = options;\n const coordsStart = reactive({ x: 0, y: 0 });\n const coordsEnd = reactive({ x: 0, y: 0 });\n const diffX = computed(() => coordsStart.x - coordsEnd.x);\n const diffY = computed(() => coordsStart.y - coordsEnd.y);\n const { max, abs } = Math;\n const isThresholdExceeded = computed(() => max(abs(diffX.value), abs(diffY.value)) >= threshold);\n const isSwiping = ref(false);\n const direction = computed(() => {\n if (!isThresholdExceeded.value)\n return \"none\";\n if (abs(diffX.value) > abs(diffY.value)) {\n return diffX.value > 0 ? \"left\" : \"right\";\n } else {\n return diffY.value > 0 ? \"up\" : \"down\";\n }\n });\n const getTouchEventCoords = (e) => [e.touches[0].clientX, e.touches[0].clientY];\n const updateCoordsStart = (x, y) => {\n coordsStart.x = x;\n coordsStart.y = y;\n };\n const updateCoordsEnd = (x, y) => {\n coordsEnd.x = x;\n coordsEnd.y = y;\n };\n let listenerOptions;\n const isPassiveEventSupported = checkPassiveEventSupport(window == null ? void 0 : window.document);\n if (!passive)\n listenerOptions = isPassiveEventSupported ? { passive: false, capture: true } : { capture: true };\n else\n listenerOptions = isPassiveEventSupported ? { passive: true } : { capture: false };\n const onTouchEnd = (e) => {\n if (isSwiping.value)\n onSwipeEnd == null ? void 0 : onSwipeEnd(e, direction.value);\n isSwiping.value = false;\n };\n const stops = [\n useEventListener(target, \"touchstart\", (e) => {\n if (e.touches.length !== 1)\n return;\n if (listenerOptions.capture && !listenerOptions.passive)\n e.preventDefault();\n const [x, y] = getTouchEventCoords(e);\n updateCoordsStart(x, y);\n updateCoordsEnd(x, y);\n onSwipeStart == null ? void 0 : onSwipeStart(e);\n }, listenerOptions),\n useEventListener(target, \"touchmove\", (e) => {\n if (e.touches.length !== 1)\n return;\n const [x, y] = getTouchEventCoords(e);\n updateCoordsEnd(x, y);\n if (!isSwiping.value && isThresholdExceeded.value)\n isSwiping.value = true;\n if (isSwiping.value)\n onSwipe == null ? void 0 : onSwipe(e);\n }, listenerOptions),\n useEventListener(target, [\"touchend\", \"touchcancel\"], onTouchEnd, listenerOptions)\n ];\n const stop = () => stops.forEach((s) => s());\n return {\n isPassiveEventSupported,\n isSwiping,\n direction,\n coordsStart,\n coordsEnd,\n lengthX: diffX,\n lengthY: diffY,\n stop\n };\n}\nfunction checkPassiveEventSupport(document) {\n if (!document)\n return false;\n let supportsPassive = false;\n const optionsBlock = {\n get passive() {\n supportsPassive = true;\n return false;\n }\n };\n document.addEventListener(\"x\", noop, optionsBlock);\n document.removeEventListener(\"x\", noop);\n return supportsPassive;\n}\n\nfunction useTemplateRefsList() {\n const refs = ref([]);\n refs.value.set = (el) => {\n if (el)\n refs.value.push(el);\n };\n onBeforeUpdate(() => {\n refs.value.length = 0;\n });\n return refs;\n}\n\nfunction useTextDirection(options = {}) {\n const {\n document = defaultDocument,\n selector = \"html\",\n observe = false,\n initialValue = \"ltr\"\n } = options;\n function getValue() {\n var _a, _b;\n return (_b = (_a = document == null ? void 0 : document.querySelector(selector)) == null ? void 0 : _a.getAttribute(\"dir\")) != null ? _b : initialValue;\n }\n const dir = ref(getValue());\n tryOnMounted(() => dir.value = getValue());\n if (observe && document) {\n useMutationObserver(\n document.querySelector(selector),\n () => dir.value = getValue(),\n { attributes: true }\n );\n }\n return computed({\n get() {\n return dir.value;\n },\n set(v) {\n var _a, _b;\n dir.value = v;\n if (!document)\n return;\n if (dir.value)\n (_a = document.querySelector(selector)) == null ? void 0 : _a.setAttribute(\"dir\", dir.value);\n else\n (_b = document.querySelector(selector)) == null ? void 0 : _b.removeAttribute(\"dir\");\n }\n });\n}\n\nfunction getRangesFromSelection(selection) {\n var _a;\n const rangeCount = (_a = selection.rangeCount) != null ? _a : 0;\n return Array.from({ length: rangeCount }, (_, i) => selection.getRangeAt(i));\n}\nfunction useTextSelection(options = {}) {\n const {\n window = defaultWindow\n } = options;\n const selection = ref(null);\n const text = computed(() => {\n var _a, _b;\n return (_b = (_a = selection.value) == null ? void 0 : _a.toString()) != null ? _b : \"\";\n });\n const ranges = computed(() => selection.value ? getRangesFromSelection(selection.value) : []);\n const rects = computed(() => ranges.value.map((range) => range.getBoundingClientRect()));\n function onSelectionChange() {\n selection.value = null;\n if (window)\n selection.value = window.getSelection();\n }\n if (window)\n useEventListener(window.document, \"selectionchange\", onSelectionChange);\n return {\n text,\n rects,\n ranges,\n selection\n };\n}\n\nfunction useTextareaAutosize(options) {\n var _a;\n const textarea = ref(options == null ? void 0 : options.element);\n const input = ref(options == null ? void 0 : options.input);\n const styleProp = (_a = options == null ? void 0 : options.styleProp) != null ? _a : \"height\";\n const textareaScrollHeight = ref(1);\n const textareaOldWidth = ref(0);\n function triggerResize() {\n var _a2;\n if (!textarea.value)\n return;\n let height = \"\";\n textarea.value.style[styleProp] = \"1px\";\n textareaScrollHeight.value = (_a2 = textarea.value) == null ? void 0 : _a2.scrollHeight;\n const _styleTarget = toValue(options == null ? void 0 : options.styleTarget);\n if (_styleTarget)\n _styleTarget.style[styleProp] = `${textareaScrollHeight.value}px`;\n else\n height = `${textareaScrollHeight.value}px`;\n textarea.value.style[styleProp] = height;\n }\n watch([input, textarea], () => nextTick(triggerResize), { immediate: true });\n watch(textareaScrollHeight, () => {\n var _a2;\n return (_a2 = options == null ? void 0 : options.onResize) == null ? void 0 : _a2.call(options);\n });\n useResizeObserver(textarea, ([{ contentRect }]) => {\n if (textareaOldWidth.value === contentRect.width)\n return;\n textareaOldWidth.value = contentRect.width;\n triggerResize();\n });\n if (options == null ? void 0 : options.watch)\n watch(options.watch, triggerResize, { immediate: true, deep: true });\n return {\n textarea,\n input,\n triggerResize\n };\n}\n\nfunction useThrottledRefHistory(source, options = {}) {\n const { throttle = 200, trailing = true } = options;\n const filter = throttleFilter(throttle, trailing);\n const history = useRefHistory(source, { ...options, eventFilter: filter });\n return {\n ...history\n };\n}\n\nconst DEFAULT_UNITS = [\n { max: 6e4, value: 1e3, name: \"second\" },\n { max: 276e4, value: 6e4, name: \"minute\" },\n { max: 72e6, value: 36e5, name: \"hour\" },\n { max: 5184e5, value: 864e5, name: \"day\" },\n { max: 24192e5, value: 6048e5, name: \"week\" },\n { max: 28512e6, value: 2592e6, name: \"month\" },\n { max: Number.POSITIVE_INFINITY, value: 31536e6, name: \"year\" }\n];\nconst DEFAULT_MESSAGES = {\n justNow: \"just now\",\n past: (n) => n.match(/\\d/) ? `${n} ago` : n,\n future: (n) => n.match(/\\d/) ? `in ${n}` : n,\n month: (n, past) => n === 1 ? past ? \"last month\" : \"next month\" : `${n} month${n > 1 ? \"s\" : \"\"}`,\n year: (n, past) => n === 1 ? past ? \"last year\" : \"next year\" : `${n} year${n > 1 ? \"s\" : \"\"}`,\n day: (n, past) => n === 1 ? past ? \"yesterday\" : \"tomorrow\" : `${n} day${n > 1 ? \"s\" : \"\"}`,\n week: (n, past) => n === 1 ? past ? \"last week\" : \"next week\" : `${n} week${n > 1 ? \"s\" : \"\"}`,\n hour: (n) => `${n} hour${n > 1 ? \"s\" : \"\"}`,\n minute: (n) => `${n} minute${n > 1 ? \"s\" : \"\"}`,\n second: (n) => `${n} second${n > 1 ? \"s\" : \"\"}`,\n invalid: \"\"\n};\nfunction DEFAULT_FORMATTER(date) {\n return date.toISOString().slice(0, 10);\n}\nfunction useTimeAgo(time, options = {}) {\n const {\n controls: exposeControls = false,\n updateInterval = 3e4\n } = options;\n const { now, ...controls } = useNow({ interval: updateInterval, controls: true });\n const timeAgo = computed(() => formatTimeAgo(new Date(toValue(time)), options, toValue(now)));\n if (exposeControls) {\n return {\n timeAgo,\n ...controls\n };\n } else {\n return timeAgo;\n }\n}\nfunction formatTimeAgo(from, options = {}, now = Date.now()) {\n var _a;\n const {\n max,\n messages = DEFAULT_MESSAGES,\n fullDateFormatter = DEFAULT_FORMATTER,\n units = DEFAULT_UNITS,\n showSecond = false,\n rounding = \"round\"\n } = options;\n const roundFn = typeof rounding === \"number\" ? (n) => +n.toFixed(rounding) : Math[rounding];\n const diff = +now - +from;\n const absDiff = Math.abs(diff);\n function getValue(diff2, unit) {\n return roundFn(Math.abs(diff2) / unit.value);\n }\n function format(diff2, unit) {\n const val = getValue(diff2, unit);\n const past = diff2 > 0;\n const str = applyFormat(unit.name, val, past);\n return applyFormat(past ? \"past\" : \"future\", str, past);\n }\n function applyFormat(name, val, isPast) {\n const formatter = messages[name];\n if (typeof formatter === \"function\")\n return formatter(val, isPast);\n return formatter.replace(\"{0}\", val.toString());\n }\n if (absDiff < 6e4 && !showSecond)\n return messages.justNow;\n if (typeof max === \"number\" && absDiff > max)\n return fullDateFormatter(new Date(from));\n if (typeof max === \"string\") {\n const unitMax = (_a = units.find((i) => i.name === max)) == null ? void 0 : _a.max;\n if (unitMax && absDiff > unitMax)\n return fullDateFormatter(new Date(from));\n }\n for (const [idx, unit] of units.entries()) {\n const val = getValue(diff, unit);\n if (val <= 0 && units[idx - 1])\n return format(diff, units[idx - 1]);\n if (absDiff < unit.max)\n return format(diff, unit);\n }\n return messages.invalid;\n}\n\nfunction useTimeoutPoll(fn, interval, timeoutPollOptions) {\n const { start } = useTimeoutFn(loop, interval, { immediate: false });\n const isActive = ref(false);\n async function loop() {\n if (!isActive.value)\n return;\n await fn();\n start();\n }\n function resume() {\n if (!isActive.value) {\n isActive.value = true;\n loop();\n }\n }\n function pause() {\n isActive.value = false;\n }\n if (timeoutPollOptions == null ? void 0 : timeoutPollOptions.immediate)\n resume();\n tryOnScopeDispose(pause);\n return {\n isActive,\n pause,\n resume\n };\n}\n\nfunction useTimestamp(options = {}) {\n const {\n controls: exposeControls = false,\n offset = 0,\n immediate = true,\n interval = \"requestAnimationFrame\",\n callback\n } = options;\n const ts = ref(timestamp() + offset);\n const update = () => ts.value = timestamp() + offset;\n const cb = callback ? () => {\n update();\n callback(ts.value);\n } : update;\n const controls = interval === \"requestAnimationFrame\" ? useRafFn(cb, { immediate }) : useIntervalFn(cb, interval, { immediate });\n if (exposeControls) {\n return {\n timestamp: ts,\n ...controls\n };\n } else {\n return ts;\n }\n}\n\nfunction useTitle(newTitle = null, options = {}) {\n var _a, _b, _c;\n const {\n document = defaultDocument,\n restoreOnUnmount = (t) => t\n } = options;\n const originalTitle = (_a = document == null ? void 0 : document.title) != null ? _a : \"\";\n const title = toRef((_b = newTitle != null ? newTitle : document == null ? void 0 : document.title) != null ? _b : null);\n const isReadonly = newTitle && typeof newTitle === \"function\";\n function format(t) {\n if (!(\"titleTemplate\" in options))\n return t;\n const template = options.titleTemplate || \"%s\";\n return typeof template === \"function\" ? template(t) : toValue(template).replace(/%s/g, t);\n }\n watch(\n title,\n (t, o) => {\n if (t !== o && document)\n document.title = format(typeof t === \"string\" ? t : \"\");\n },\n { immediate: true }\n );\n if (options.observe && !options.titleTemplate && document && !isReadonly) {\n useMutationObserver(\n (_c = document.head) == null ? void 0 : _c.querySelector(\"title\"),\n () => {\n if (document && document.title !== title.value)\n title.value = format(document.title);\n },\n { childList: true }\n );\n }\n tryOnBeforeUnmount(() => {\n if (restoreOnUnmount) {\n const restoredTitle = restoreOnUnmount(originalTitle, title.value || \"\");\n if (restoredTitle != null && document)\n document.title = restoredTitle;\n }\n });\n return title;\n}\n\nconst _TransitionPresets = {\n easeInSine: [0.12, 0, 0.39, 0],\n easeOutSine: [0.61, 1, 0.88, 1],\n easeInOutSine: [0.37, 0, 0.63, 1],\n easeInQuad: [0.11, 0, 0.5, 0],\n easeOutQuad: [0.5, 1, 0.89, 1],\n easeInOutQuad: [0.45, 0, 0.55, 1],\n easeInCubic: [0.32, 0, 0.67, 0],\n easeOutCubic: [0.33, 1, 0.68, 1],\n easeInOutCubic: [0.65, 0, 0.35, 1],\n easeInQuart: [0.5, 0, 0.75, 0],\n easeOutQuart: [0.25, 1, 0.5, 1],\n easeInOutQuart: [0.76, 0, 0.24, 1],\n easeInQuint: [0.64, 0, 0.78, 0],\n easeOutQuint: [0.22, 1, 0.36, 1],\n easeInOutQuint: [0.83, 0, 0.17, 1],\n easeInExpo: [0.7, 0, 0.84, 0],\n easeOutExpo: [0.16, 1, 0.3, 1],\n easeInOutExpo: [0.87, 0, 0.13, 1],\n easeInCirc: [0.55, 0, 1, 0.45],\n easeOutCirc: [0, 0.55, 0.45, 1],\n easeInOutCirc: [0.85, 0, 0.15, 1],\n easeInBack: [0.36, 0, 0.66, -0.56],\n easeOutBack: [0.34, 1.56, 0.64, 1],\n easeInOutBack: [0.68, -0.6, 0.32, 1.6]\n};\nconst TransitionPresets = /* @__PURE__ */ Object.assign({}, { linear: identity }, _TransitionPresets);\nfunction createEasingFunction([p0, p1, p2, p3]) {\n const a = (a1, a2) => 1 - 3 * a2 + 3 * a1;\n const b = (a1, a2) => 3 * a2 - 6 * a1;\n const c = (a1) => 3 * a1;\n const calcBezier = (t, a1, a2) => ((a(a1, a2) * t + b(a1, a2)) * t + c(a1)) * t;\n const getSlope = (t, a1, a2) => 3 * a(a1, a2) * t * t + 2 * b(a1, a2) * t + c(a1);\n const getTforX = (x) => {\n let aGuessT = x;\n for (let i = 0; i < 4; ++i) {\n const currentSlope = getSlope(aGuessT, p0, p2);\n if (currentSlope === 0)\n return aGuessT;\n const currentX = calcBezier(aGuessT, p0, p2) - x;\n aGuessT -= currentX / currentSlope;\n }\n return aGuessT;\n };\n return (x) => p0 === p1 && p2 === p3 ? x : calcBezier(getTforX(x), p1, p3);\n}\nfunction lerp(a, b, alpha) {\n return a + alpha * (b - a);\n}\nfunction toVec(t) {\n return (typeof t === \"number\" ? [t] : t) || [];\n}\nfunction executeTransition(source, from, to, options = {}) {\n var _a, _b;\n const fromVal = toValue(from);\n const toVal = toValue(to);\n const v1 = toVec(fromVal);\n const v2 = toVec(toVal);\n const duration = (_a = toValue(options.duration)) != null ? _a : 1e3;\n const startedAt = Date.now();\n const endAt = Date.now() + duration;\n const trans = typeof options.transition === \"function\" ? options.transition : (_b = toValue(options.transition)) != null ? _b : identity;\n const ease = typeof trans === \"function\" ? trans : createEasingFunction(trans);\n return new Promise((resolve) => {\n source.value = fromVal;\n const tick = () => {\n var _a2;\n if ((_a2 = options.abort) == null ? void 0 : _a2.call(options)) {\n resolve();\n return;\n }\n const now = Date.now();\n const alpha = ease((now - startedAt) / duration);\n const arr = toVec(source.value).map((n, i) => lerp(v1[i], v2[i], alpha));\n if (Array.isArray(source.value))\n source.value = arr.map((n, i) => {\n var _a3, _b2;\n return lerp((_a3 = v1[i]) != null ? _a3 : 0, (_b2 = v2[i]) != null ? _b2 : 0, alpha);\n });\n else if (typeof source.value === \"number\")\n source.value = arr[0];\n if (now < endAt) {\n requestAnimationFrame(tick);\n } else {\n source.value = toVal;\n resolve();\n }\n };\n tick();\n });\n}\nfunction useTransition(source, options = {}) {\n let currentId = 0;\n const sourceVal = () => {\n const v = toValue(source);\n return typeof v === \"number\" ? v : v.map(toValue);\n };\n const outputRef = ref(sourceVal());\n watch(sourceVal, async (to) => {\n var _a, _b;\n if (toValue(options.disabled))\n return;\n const id = ++currentId;\n if (options.delay)\n await promiseTimeout(toValue(options.delay));\n if (id !== currentId)\n return;\n const toVal = Array.isArray(to) ? to.map(toValue) : toValue(to);\n (_a = options.onStarted) == null ? void 0 : _a.call(options);\n await executeTransition(outputRef, outputRef.value, toVal, {\n ...options,\n abort: () => {\n var _a2;\n return id !== currentId || ((_a2 = options.abort) == null ? void 0 : _a2.call(options));\n }\n });\n (_b = options.onFinished) == null ? void 0 : _b.call(options);\n }, { deep: true });\n watch(() => toValue(options.disabled), (disabled) => {\n if (disabled) {\n currentId++;\n outputRef.value = sourceVal();\n }\n });\n tryOnScopeDispose(() => {\n currentId++;\n });\n return computed(() => toValue(options.disabled) ? sourceVal() : outputRef.value);\n}\n\nfunction useUrlSearchParams(mode = \"history\", options = {}) {\n const {\n initialValue = {},\n removeNullishValues = true,\n removeFalsyValues = false,\n write: enableWrite = true,\n window = defaultWindow\n } = options;\n if (!window)\n return reactive(initialValue);\n const state = reactive({});\n function getRawParams() {\n if (mode === \"history\") {\n return window.location.search || \"\";\n } else if (mode === \"hash\") {\n const hash = window.location.hash || \"\";\n const index = hash.indexOf(\"?\");\n return index > 0 ? hash.slice(index) : \"\";\n } else {\n return (window.location.hash || \"\").replace(/^#/, \"\");\n }\n }\n function constructQuery(params) {\n const stringified = params.toString();\n if (mode === \"history\")\n return `${stringified ? `?${stringified}` : \"\"}${window.location.hash || \"\"}`;\n if (mode === \"hash-params\")\n return `${window.location.search || \"\"}${stringified ? `#${stringified}` : \"\"}`;\n const hash = window.location.hash || \"#\";\n const index = hash.indexOf(\"?\");\n if (index > 0)\n return `${hash.slice(0, index)}${stringified ? `?${stringified}` : \"\"}`;\n return `${hash}${stringified ? `?${stringified}` : \"\"}`;\n }\n function read() {\n return new URLSearchParams(getRawParams());\n }\n function updateState(params) {\n const unusedKeys = new Set(Object.keys(state));\n for (const key of params.keys()) {\n const paramsForKey = params.getAll(key);\n state[key] = paramsForKey.length > 1 ? paramsForKey : params.get(key) || \"\";\n unusedKeys.delete(key);\n }\n Array.from(unusedKeys).forEach((key) => delete state[key]);\n }\n const { pause, resume } = pausableWatch(\n state,\n () => {\n const params = new URLSearchParams(\"\");\n Object.keys(state).forEach((key) => {\n const mapEntry = state[key];\n if (Array.isArray(mapEntry))\n mapEntry.forEach((value) => params.append(key, value));\n else if (removeNullishValues && mapEntry == null)\n params.delete(key);\n else if (removeFalsyValues && !mapEntry)\n params.delete(key);\n else\n params.set(key, mapEntry);\n });\n write(params);\n },\n { deep: true }\n );\n function write(params, shouldUpdate) {\n pause();\n if (shouldUpdate)\n updateState(params);\n window.history.replaceState(\n window.history.state,\n window.document.title,\n window.location.pathname + constructQuery(params)\n );\n resume();\n }\n function onChanged() {\n if (!enableWrite)\n return;\n write(read(), true);\n }\n useEventListener(window, \"popstate\", onChanged, false);\n if (mode !== \"history\")\n useEventListener(window, \"hashchange\", onChanged, false);\n const initial = read();\n if (initial.keys().next().value)\n updateState(initial);\n else\n Object.assign(state, initialValue);\n return state;\n}\n\nfunction useUserMedia(options = {}) {\n var _a, _b;\n const enabled = ref((_a = options.enabled) != null ? _a : false);\n const autoSwitch = ref((_b = options.autoSwitch) != null ? _b : true);\n const constraints = ref(options.constraints);\n const { navigator = defaultNavigator } = options;\n const isSupported = useSupported(() => {\n var _a2;\n return (_a2 = navigator == null ? void 0 : navigator.mediaDevices) == null ? void 0 : _a2.getUserMedia;\n });\n const stream = shallowRef();\n function getDeviceOptions(type) {\n switch (type) {\n case \"video\": {\n if (constraints.value)\n return constraints.value.video || false;\n break;\n }\n case \"audio\": {\n if (constraints.value)\n return constraints.value.audio || false;\n break;\n }\n }\n }\n async function _start() {\n if (!isSupported.value || stream.value)\n return;\n stream.value = await navigator.mediaDevices.getUserMedia({\n video: getDeviceOptions(\"video\"),\n audio: getDeviceOptions(\"audio\")\n });\n return stream.value;\n }\n function _stop() {\n var _a2;\n (_a2 = stream.value) == null ? void 0 : _a2.getTracks().forEach((t) => t.stop());\n stream.value = void 0;\n }\n function stop() {\n _stop();\n enabled.value = false;\n }\n async function start() {\n await _start();\n if (stream.value)\n enabled.value = true;\n return stream.value;\n }\n async function restart() {\n _stop();\n return await start();\n }\n watch(\n enabled,\n (v) => {\n if (v)\n _start();\n else _stop();\n },\n { immediate: true }\n );\n watch(\n constraints,\n () => {\n if (autoSwitch.value && stream.value)\n restart();\n },\n { immediate: true }\n );\n tryOnScopeDispose(() => {\n stop();\n });\n return {\n isSupported,\n stream,\n start,\n stop,\n restart,\n constraints,\n enabled,\n autoSwitch\n };\n}\n\nfunction useVModel(props, key, emit, options = {}) {\n var _a, _b, _c, _d, _e;\n const {\n clone = false,\n passive = false,\n eventName,\n deep = false,\n defaultValue,\n shouldEmit\n } = options;\n const vm = getCurrentInstance();\n const _emit = emit || (vm == null ? void 0 : vm.emit) || ((_a = vm == null ? void 0 : vm.$emit) == null ? void 0 : _a.bind(vm)) || ((_c = (_b = vm == null ? void 0 : vm.proxy) == null ? void 0 : _b.$emit) == null ? void 0 : _c.bind(vm == null ? void 0 : vm.proxy));\n let event = eventName;\n if (!key) {\n if (isVue2) {\n const modelOptions = (_e = (_d = vm == null ? void 0 : vm.proxy) == null ? void 0 : _d.$options) == null ? void 0 : _e.model;\n key = (modelOptions == null ? void 0 : modelOptions.value) || \"value\";\n if (!eventName)\n event = (modelOptions == null ? void 0 : modelOptions.event) || \"input\";\n } else {\n key = \"modelValue\";\n }\n }\n event = event || `update:${key.toString()}`;\n const cloneFn = (val) => !clone ? val : typeof clone === \"function\" ? clone(val) : cloneFnJSON(val);\n const getValue = () => isDef(props[key]) ? cloneFn(props[key]) : defaultValue;\n const triggerEmit = (value) => {\n if (shouldEmit) {\n if (shouldEmit(value))\n _emit(event, value);\n } else {\n _emit(event, value);\n }\n };\n if (passive) {\n const initialValue = getValue();\n const proxy = ref(initialValue);\n let isUpdating = false;\n watch(\n () => props[key],\n (v) => {\n if (!isUpdating) {\n isUpdating = true;\n proxy.value = cloneFn(v);\n nextTick(() => isUpdating = false);\n }\n }\n );\n watch(\n proxy,\n (v) => {\n if (!isUpdating && (v !== props[key] || deep))\n triggerEmit(v);\n },\n { deep }\n );\n return proxy;\n } else {\n return computed({\n get() {\n return getValue();\n },\n set(value) {\n triggerEmit(value);\n }\n });\n }\n}\n\nfunction useVModels(props, emit, options = {}) {\n const ret = {};\n for (const key in props) {\n ret[key] = useVModel(\n props,\n key,\n emit,\n options\n );\n }\n return ret;\n}\n\nfunction useVibrate(options) {\n const {\n pattern = [],\n interval = 0,\n navigator = defaultNavigator\n } = options || {};\n const isSupported = useSupported(() => typeof navigator !== \"undefined\" && \"vibrate\" in navigator);\n const patternRef = toRef(pattern);\n let intervalControls;\n const vibrate = (pattern2 = patternRef.value) => {\n if (isSupported.value)\n navigator.vibrate(pattern2);\n };\n const stop = () => {\n if (isSupported.value)\n navigator.vibrate(0);\n intervalControls == null ? void 0 : intervalControls.pause();\n };\n if (interval > 0) {\n intervalControls = useIntervalFn(\n vibrate,\n interval,\n {\n immediate: false,\n immediateCallback: false\n }\n );\n }\n return {\n isSupported,\n pattern,\n intervalControls,\n vibrate,\n stop\n };\n}\n\nfunction useVirtualList(list, options) {\n const { containerStyle, wrapperProps, scrollTo, calculateRange, currentList, containerRef } = \"itemHeight\" in options ? useVerticalVirtualList(options, list) : useHorizontalVirtualList(options, list);\n return {\n list: currentList,\n scrollTo,\n containerProps: {\n ref: containerRef,\n onScroll: () => {\n calculateRange();\n },\n style: containerStyle\n },\n wrapperProps\n };\n}\nfunction useVirtualListResources(list) {\n const containerRef = ref(null);\n const size = useElementSize(containerRef);\n const currentList = ref([]);\n const source = shallowRef(list);\n const state = ref({ start: 0, end: 10 });\n return { state, source, currentList, size, containerRef };\n}\nfunction createGetViewCapacity(state, source, itemSize) {\n return (containerSize) => {\n if (typeof itemSize === \"number\")\n return Math.ceil(containerSize / itemSize);\n const { start = 0 } = state.value;\n let sum = 0;\n let capacity = 0;\n for (let i = start; i < source.value.length; i++) {\n const size = itemSize(i);\n sum += size;\n capacity = i;\n if (sum > containerSize)\n break;\n }\n return capacity - start;\n };\n}\nfunction createGetOffset(source, itemSize) {\n return (scrollDirection) => {\n if (typeof itemSize === \"number\")\n return Math.floor(scrollDirection / itemSize) + 1;\n let sum = 0;\n let offset = 0;\n for (let i = 0; i < source.value.length; i++) {\n const size = itemSize(i);\n sum += size;\n if (sum >= scrollDirection) {\n offset = i;\n break;\n }\n }\n return offset + 1;\n };\n}\nfunction createCalculateRange(type, overscan, getOffset, getViewCapacity, { containerRef, state, currentList, source }) {\n return () => {\n const element = containerRef.value;\n if (element) {\n const offset = getOffset(type === \"vertical\" ? element.scrollTop : element.scrollLeft);\n const viewCapacity = getViewCapacity(type === \"vertical\" ? element.clientHeight : element.clientWidth);\n const from = offset - overscan;\n const to = offset + viewCapacity + overscan;\n state.value = {\n start: from < 0 ? 0 : from,\n end: to > source.value.length ? source.value.length : to\n };\n currentList.value = source.value.slice(state.value.start, state.value.end).map((ele, index) => ({\n data: ele,\n index: index + state.value.start\n }));\n }\n };\n}\nfunction createGetDistance(itemSize, source) {\n return (index) => {\n if (typeof itemSize === \"number\") {\n const size2 = index * itemSize;\n return size2;\n }\n const size = source.value.slice(0, index).reduce((sum, _, i) => sum + itemSize(i), 0);\n return size;\n };\n}\nfunction useWatchForSizes(size, list, containerRef, calculateRange) {\n watch([size.width, size.height, list, containerRef], () => {\n calculateRange();\n });\n}\nfunction createComputedTotalSize(itemSize, source) {\n return computed(() => {\n if (typeof itemSize === \"number\")\n return source.value.length * itemSize;\n return source.value.reduce((sum, _, index) => sum + itemSize(index), 0);\n });\n}\nconst scrollToDictionaryForElementScrollKey = {\n horizontal: \"scrollLeft\",\n vertical: \"scrollTop\"\n};\nfunction createScrollTo(type, calculateRange, getDistance, containerRef) {\n return (index) => {\n if (containerRef.value) {\n containerRef.value[scrollToDictionaryForElementScrollKey[type]] = getDistance(index);\n calculateRange();\n }\n };\n}\nfunction useHorizontalVirtualList(options, list) {\n const resources = useVirtualListResources(list);\n const { state, source, currentList, size, containerRef } = resources;\n const containerStyle = { overflowX: \"auto\" };\n const { itemWidth, overscan = 5 } = options;\n const getViewCapacity = createGetViewCapacity(state, source, itemWidth);\n const getOffset = createGetOffset(source, itemWidth);\n const calculateRange = createCalculateRange(\"horizontal\", overscan, getOffset, getViewCapacity, resources);\n const getDistanceLeft = createGetDistance(itemWidth, source);\n const offsetLeft = computed(() => getDistanceLeft(state.value.start));\n const totalWidth = createComputedTotalSize(itemWidth, source);\n useWatchForSizes(size, list, containerRef, calculateRange);\n const scrollTo = createScrollTo(\"horizontal\", calculateRange, getDistanceLeft, containerRef);\n const wrapperProps = computed(() => {\n return {\n style: {\n height: \"100%\",\n width: `${totalWidth.value - offsetLeft.value}px`,\n marginLeft: `${offsetLeft.value}px`,\n display: \"flex\"\n }\n };\n });\n return {\n scrollTo,\n calculateRange,\n wrapperProps,\n containerStyle,\n currentList,\n containerRef\n };\n}\nfunction useVerticalVirtualList(options, list) {\n const resources = useVirtualListResources(list);\n const { state, source, currentList, size, containerRef } = resources;\n const containerStyle = { overflowY: \"auto\" };\n const { itemHeight, overscan = 5 } = options;\n const getViewCapacity = createGetViewCapacity(state, source, itemHeight);\n const getOffset = createGetOffset(source, itemHeight);\n const calculateRange = createCalculateRange(\"vertical\", overscan, getOffset, getViewCapacity, resources);\n const getDistanceTop = createGetDistance(itemHeight, source);\n const offsetTop = computed(() => getDistanceTop(state.value.start));\n const totalHeight = createComputedTotalSize(itemHeight, source);\n useWatchForSizes(size, list, containerRef, calculateRange);\n const scrollTo = createScrollTo(\"vertical\", calculateRange, getDistanceTop, containerRef);\n const wrapperProps = computed(() => {\n return {\n style: {\n width: \"100%\",\n height: `${totalHeight.value - offsetTop.value}px`,\n marginTop: `${offsetTop.value}px`\n }\n };\n });\n return {\n calculateRange,\n scrollTo,\n containerStyle,\n wrapperProps,\n currentList,\n containerRef\n };\n}\n\nfunction useWakeLock(options = {}) {\n const {\n navigator = defaultNavigator,\n document = defaultDocument\n } = options;\n const requestedType = ref(false);\n const sentinel = shallowRef(null);\n const documentVisibility = useDocumentVisibility({ document });\n const isSupported = useSupported(() => navigator && \"wakeLock\" in navigator);\n const isActive = computed(() => !!sentinel.value && documentVisibility.value === \"visible\");\n if (isSupported.value) {\n useEventListener(sentinel, \"release\", () => {\n var _a, _b;\n requestedType.value = (_b = (_a = sentinel.value) == null ? void 0 : _a.type) != null ? _b : false;\n });\n whenever(\n () => documentVisibility.value === \"visible\" && (document == null ? void 0 : document.visibilityState) === \"visible\" && requestedType.value,\n (type) => {\n requestedType.value = false;\n forceRequest(type);\n }\n );\n }\n async function forceRequest(type) {\n var _a;\n await ((_a = sentinel.value) == null ? void 0 : _a.release());\n sentinel.value = isSupported.value ? await navigator.wakeLock.request(type) : null;\n }\n async function request(type) {\n if (documentVisibility.value === \"visible\")\n await forceRequest(type);\n else\n requestedType.value = type;\n }\n async function release() {\n requestedType.value = false;\n const s = sentinel.value;\n sentinel.value = null;\n await (s == null ? void 0 : s.release());\n }\n return {\n sentinel,\n isSupported,\n isActive,\n request,\n forceRequest,\n release\n };\n}\n\nfunction useWebNotification(options = {}) {\n const {\n window = defaultWindow,\n requestPermissions: _requestForPermissions = true\n } = options;\n const defaultWebNotificationOptions = options;\n const isSupported = useSupported(() => {\n if (!window || !(\"Notification\" in window))\n return false;\n try {\n new Notification(\"\");\n } catch (e) {\n return false;\n }\n return true;\n });\n const permissionGranted = ref(isSupported.value && \"permission\" in Notification && Notification.permission === \"granted\");\n const notification = ref(null);\n const ensurePermissions = async () => {\n if (!isSupported.value)\n return;\n if (!permissionGranted.value && Notification.permission !== \"denied\") {\n const result = await Notification.requestPermission();\n if (result === \"granted\")\n permissionGranted.value = true;\n }\n return permissionGranted.value;\n };\n const { on: onClick, trigger: clickTrigger } = createEventHook();\n const { on: onShow, trigger: showTrigger } = createEventHook();\n const { on: onError, trigger: errorTrigger } = createEventHook();\n const { on: onClose, trigger: closeTrigger } = createEventHook();\n const show = async (overrides) => {\n if (!isSupported.value || !permissionGranted.value)\n return;\n const options2 = Object.assign({}, defaultWebNotificationOptions, overrides);\n notification.value = new Notification(options2.title || \"\", options2);\n notification.value.onclick = clickTrigger;\n notification.value.onshow = showTrigger;\n notification.value.onerror = errorTrigger;\n notification.value.onclose = closeTrigger;\n return notification.value;\n };\n const close = () => {\n if (notification.value)\n notification.value.close();\n notification.value = null;\n };\n if (_requestForPermissions)\n tryOnMounted(ensurePermissions);\n tryOnScopeDispose(close);\n if (isSupported.value && window) {\n const document = window.document;\n useEventListener(document, \"visibilitychange\", (e) => {\n e.preventDefault();\n if (document.visibilityState === \"visible\") {\n close();\n }\n });\n }\n return {\n isSupported,\n notification,\n ensurePermissions,\n permissionGranted,\n show,\n close,\n onClick,\n onShow,\n onError,\n onClose\n };\n}\n\nconst DEFAULT_PING_MESSAGE = \"ping\";\nfunction resolveNestedOptions(options) {\n if (options === true)\n return {};\n return options;\n}\nfunction useWebSocket(url, options = {}) {\n const {\n onConnected,\n onDisconnected,\n onError,\n onMessage,\n immediate = true,\n autoClose = true,\n protocols = []\n } = options;\n const data = ref(null);\n const status = ref(\"CLOSED\");\n const wsRef = ref();\n const urlRef = toRef(url);\n let heartbeatPause;\n let heartbeatResume;\n let explicitlyClosed = false;\n let retried = 0;\n let bufferedData = [];\n let pongTimeoutWait;\n const _sendBuffer = () => {\n if (bufferedData.length && wsRef.value && status.value === \"OPEN\") {\n for (const buffer of bufferedData)\n wsRef.value.send(buffer);\n bufferedData = [];\n }\n };\n const resetHeartbeat = () => {\n clearTimeout(pongTimeoutWait);\n pongTimeoutWait = void 0;\n };\n const close = (code = 1e3, reason) => {\n if (!isClient || !wsRef.value)\n return;\n explicitlyClosed = true;\n resetHeartbeat();\n heartbeatPause == null ? void 0 : heartbeatPause();\n wsRef.value.close(code, reason);\n wsRef.value = void 0;\n };\n const send = (data2, useBuffer = true) => {\n if (!wsRef.value || status.value !== \"OPEN\") {\n if (useBuffer)\n bufferedData.push(data2);\n return false;\n }\n _sendBuffer();\n wsRef.value.send(data2);\n return true;\n };\n const _init = () => {\n if (explicitlyClosed || typeof urlRef.value === \"undefined\")\n return;\n const ws = new WebSocket(urlRef.value, protocols);\n wsRef.value = ws;\n status.value = \"CONNECTING\";\n ws.onopen = () => {\n status.value = \"OPEN\";\n retried = 0;\n onConnected == null ? void 0 : onConnected(ws);\n heartbeatResume == null ? void 0 : heartbeatResume();\n _sendBuffer();\n };\n ws.onclose = (ev) => {\n status.value = \"CLOSED\";\n onDisconnected == null ? void 0 : onDisconnected(ws, ev);\n if (!explicitlyClosed && options.autoReconnect && ws === wsRef.value) {\n const {\n retries = -1,\n delay = 1e3,\n onFailed\n } = resolveNestedOptions(options.autoReconnect);\n if (typeof retries === \"number\" && (retries < 0 || retried < retries)) {\n retried += 1;\n setTimeout(_init, delay);\n } else if (typeof retries === \"function\" && retries()) {\n setTimeout(_init, delay);\n } else {\n onFailed == null ? void 0 : onFailed();\n }\n }\n };\n ws.onerror = (e) => {\n onError == null ? void 0 : onError(ws, e);\n };\n ws.onmessage = (e) => {\n if (options.heartbeat) {\n resetHeartbeat();\n const {\n message = DEFAULT_PING_MESSAGE,\n responseMessage = message\n } = resolveNestedOptions(options.heartbeat);\n if (e.data === responseMessage)\n return;\n }\n data.value = e.data;\n onMessage == null ? void 0 : onMessage(ws, e);\n };\n };\n if (options.heartbeat) {\n const {\n message = DEFAULT_PING_MESSAGE,\n interval = 1e3,\n pongTimeout = 1e3\n } = resolveNestedOptions(options.heartbeat);\n const { pause, resume } = useIntervalFn(\n () => {\n send(message, false);\n if (pongTimeoutWait != null)\n return;\n pongTimeoutWait = setTimeout(() => {\n close();\n explicitlyClosed = false;\n }, pongTimeout);\n },\n interval,\n { immediate: false }\n );\n heartbeatPause = pause;\n heartbeatResume = resume;\n }\n if (autoClose) {\n if (isClient)\n useEventListener(\"beforeunload\", () => close());\n tryOnScopeDispose(close);\n }\n const open = () => {\n if (!isClient && !isWorker)\n return;\n close();\n explicitlyClosed = false;\n retried = 0;\n _init();\n };\n if (immediate)\n open();\n watch(urlRef, open);\n return {\n data,\n status,\n close,\n send,\n open,\n ws: wsRef\n };\n}\n\nfunction useWebWorker(arg0, workerOptions, options) {\n const {\n window = defaultWindow\n } = options != null ? options : {};\n const data = ref(null);\n const worker = shallowRef();\n const post = (...args) => {\n if (!worker.value)\n return;\n worker.value.postMessage(...args);\n };\n const terminate = function terminate2() {\n if (!worker.value)\n return;\n worker.value.terminate();\n };\n if (window) {\n if (typeof arg0 === \"string\")\n worker.value = new Worker(arg0, workerOptions);\n else if (typeof arg0 === \"function\")\n worker.value = arg0();\n else\n worker.value = arg0;\n worker.value.onmessage = (e) => {\n data.value = e.data;\n };\n tryOnScopeDispose(() => {\n if (worker.value)\n worker.value.terminate();\n });\n }\n return {\n data,\n post,\n terminate,\n worker\n };\n}\n\nfunction jobRunner(userFunc) {\n return (e) => {\n const userFuncArgs = e.data[0];\n return Promise.resolve(userFunc.apply(void 0, userFuncArgs)).then((result) => {\n postMessage([\"SUCCESS\", result]);\n }).catch((error) => {\n postMessage([\"ERROR\", error]);\n });\n };\n}\n\nfunction depsParser(deps, localDeps) {\n if (deps.length === 0 && localDeps.length === 0)\n return \"\";\n const depsString = deps.map((dep) => `'${dep}'`).toString();\n const depsFunctionString = localDeps.filter((dep) => typeof dep === \"function\").map((fn) => {\n const str = fn.toString();\n if (str.trim().startsWith(\"function\")) {\n return str;\n } else {\n const name = fn.name;\n return `const ${name} = ${str}`;\n }\n }).join(\";\");\n const importString = `importScripts(${depsString});`;\n return `${depsString.trim() === \"\" ? \"\" : importString} ${depsFunctionString}`;\n}\n\nfunction createWorkerBlobUrl(fn, deps, localDeps) {\n const blobCode = `${depsParser(deps, localDeps)}; onmessage=(${jobRunner})(${fn})`;\n const blob = new Blob([blobCode], { type: \"text/javascript\" });\n const url = URL.createObjectURL(blob);\n return url;\n}\n\nfunction useWebWorkerFn(fn, options = {}) {\n const {\n dependencies = [],\n localDependencies = [],\n timeout,\n window = defaultWindow\n } = options;\n const worker = ref();\n const workerStatus = ref(\"PENDING\");\n const promise = ref({});\n const timeoutId = ref();\n const workerTerminate = (status = \"PENDING\") => {\n if (worker.value && worker.value._url && window) {\n worker.value.terminate();\n URL.revokeObjectURL(worker.value._url);\n promise.value = {};\n worker.value = void 0;\n window.clearTimeout(timeoutId.value);\n workerStatus.value = status;\n }\n };\n workerTerminate();\n tryOnScopeDispose(workerTerminate);\n const generateWorker = () => {\n const blobUrl = createWorkerBlobUrl(fn, dependencies, localDependencies);\n const newWorker = new Worker(blobUrl);\n newWorker._url = blobUrl;\n newWorker.onmessage = (e) => {\n const { resolve = () => {\n }, reject = () => {\n } } = promise.value;\n const [status, result] = e.data;\n switch (status) {\n case \"SUCCESS\":\n resolve(result);\n workerTerminate(status);\n break;\n default:\n reject(result);\n workerTerminate(\"ERROR\");\n break;\n }\n };\n newWorker.onerror = (e) => {\n const { reject = () => {\n } } = promise.value;\n e.preventDefault();\n reject(e);\n workerTerminate(\"ERROR\");\n };\n if (timeout) {\n timeoutId.value = setTimeout(\n () => workerTerminate(\"TIMEOUT_EXPIRED\"),\n timeout\n );\n }\n return newWorker;\n };\n const callWorker = (...fnArgs) => new Promise((resolve, reject) => {\n var _a;\n promise.value = {\n resolve,\n reject\n };\n (_a = worker.value) == null ? void 0 : _a.postMessage([[...fnArgs]]);\n workerStatus.value = \"RUNNING\";\n });\n const workerFn = (...fnArgs) => {\n if (workerStatus.value === \"RUNNING\") {\n console.error(\n \"[useWebWorkerFn] You can only run one instance of the worker at a time.\"\n );\n return Promise.reject();\n }\n worker.value = generateWorker();\n return callWorker(...fnArgs);\n };\n return {\n workerFn,\n workerStatus,\n workerTerminate\n };\n}\n\nfunction useWindowFocus(options = {}) {\n const { window = defaultWindow } = options;\n if (!window)\n return ref(false);\n const focused = ref(window.document.hasFocus());\n useEventListener(window, \"blur\", () => {\n focused.value = false;\n });\n useEventListener(window, \"focus\", () => {\n focused.value = true;\n });\n return focused;\n}\n\nfunction useWindowScroll(options = {}) {\n const { window = defaultWindow, behavior = \"auto\" } = options;\n if (!window) {\n return {\n x: ref(0),\n y: ref(0)\n };\n }\n const internalX = ref(window.scrollX);\n const internalY = ref(window.scrollY);\n const x = computed({\n get() {\n return internalX.value;\n },\n set(x2) {\n scrollTo({ left: x2, behavior });\n }\n });\n const y = computed({\n get() {\n return internalY.value;\n },\n set(y2) {\n scrollTo({ top: y2, behavior });\n }\n });\n useEventListener(\n window,\n \"scroll\",\n () => {\n internalX.value = window.scrollX;\n internalY.value = window.scrollY;\n },\n {\n capture: false,\n passive: true\n }\n );\n return { x, y };\n}\n\nfunction useWindowSize(options = {}) {\n const {\n window = defaultWindow,\n initialWidth = Number.POSITIVE_INFINITY,\n initialHeight = Number.POSITIVE_INFINITY,\n listenOrientation = true,\n includeScrollbar = true,\n type = \"inner\"\n } = options;\n const width = ref(initialWidth);\n const height = ref(initialHeight);\n const update = () => {\n if (window) {\n if (type === \"outer\") {\n width.value = window.outerWidth;\n height.value = window.outerHeight;\n } else if (includeScrollbar) {\n width.value = window.innerWidth;\n height.value = window.innerHeight;\n } else {\n width.value = window.document.documentElement.clientWidth;\n height.value = window.document.documentElement.clientHeight;\n }\n }\n };\n update();\n tryOnMounted(update);\n useEventListener(\"resize\", update, { passive: true });\n if (listenOrientation) {\n const matches = useMediaQuery(\"(orientation: portrait)\");\n watch(matches, () => update());\n }\n return { width, height };\n}\n\nexport { DefaultMagicKeysAliasMap, StorageSerializers, TransitionPresets, computedAsync as asyncComputed, breakpointsAntDesign, breakpointsBootstrapV5, breakpointsMasterCss, breakpointsPrimeFlex, breakpointsQuasar, breakpointsSematic, breakpointsTailwind, breakpointsVuetify, breakpointsVuetifyV2, breakpointsVuetifyV3, cloneFnJSON, computedAsync, computedInject, createFetch, createReusableTemplate, createTemplatePromise, createUnrefFn, customStorageEventName, defaultDocument, defaultLocation, defaultNavigator, defaultWindow, executeTransition, formatTimeAgo, getSSRHandler, mapGamepadToXbox360Controller, onClickOutside, onKeyDown, onKeyPressed, onKeyStroke, onKeyUp, onLongPress, onStartTyping, setSSRHandler, templateRef, unrefElement, useActiveElement, useAnimate, useAsyncQueue, useAsyncState, useBase64, useBattery, useBluetooth, useBreakpoints, useBroadcastChannel, useBrowserLocation, useCached, useClipboard, useClipboardItems, useCloned, useColorMode, useConfirmDialog, useCssVar, useCurrentElement, useCycleList, useDark, useDebouncedRefHistory, useDeviceMotion, useDeviceOrientation, useDevicePixelRatio, useDevicesList, useDisplayMedia, useDocumentVisibility, useDraggable, useDropZone, useElementBounding, useElementByPoint, useElementHover, useElementSize, useElementVisibility, useEventBus, useEventListener, useEventSource, useEyeDropper, useFavicon, useFetch, useFileDialog, useFileSystemAccess, useFocus, useFocusWithin, useFps, useFullscreen, useGamepad, useGeolocation, useIdle, useImage, useInfiniteScroll, useIntersectionObserver, useKeyModifier, useLocalStorage, useMagicKeys, useManualRefHistory, useMediaControls, useMediaQuery, useMemoize, useMemory, useMounted, useMouse, useMouseInElement, useMousePressed, useMutationObserver, useNavigatorLanguage, useNetwork, useNow, useObjectUrl, useOffsetPagination, useOnline, usePageLeave, useParallax, useParentElement, usePerformanceObserver, usePermission, usePointer, usePointerLock, usePointerSwipe, usePreferredColorScheme, usePreferredContrast, usePreferredDark, usePreferredLanguages, usePreferredReducedMotion, usePrevious, useRafFn, useRefHistory, useResizeObserver, useScreenOrientation, useScreenSafeArea, useScriptTag, useScroll, useScrollLock, useSessionStorage, useShare, useSorted, useSpeechRecognition, useSpeechSynthesis, useStepper, useStorage, useStorageAsync, useStyleTag, useSupported, useSwipe, useTemplateRefsList, useTextDirection, useTextSelection, useTextareaAutosize, useThrottledRefHistory, useTimeAgo, useTimeoutPoll, useTimestamp, useTitle, useTransition, useUrlSearchParams, useUserMedia, useVModel, useVModels, useVibrate, useVirtualList, useWakeLock, useWebNotification, useWebSocket, useWebWorker, useWebWorkerFn, useWindowFocus, useWindowScroll, useWindowSize };\n","function debounce(function_, wait = 100, options = {}) {\n\tif (typeof function_ !== 'function') {\n\t\tthrow new TypeError(`Expected the first parameter to be a function, got \\`${typeof function_}\\`.`);\n\t}\n\n\tif (wait < 0) {\n\t\tthrow new RangeError('`wait` must not be negative.');\n\t}\n\n\t// TODO: Deprecate the boolean parameter at some point.\n\tconst {immediate} = typeof options === 'boolean' ? {immediate: options} : options;\n\n\tlet storedContext;\n\tlet storedArguments;\n\tlet timeoutId;\n\tlet timestamp;\n\tlet result;\n\n\tfunction run() {\n\t\tconst callContext = storedContext;\n\t\tconst callArguments = storedArguments;\n\t\tstoredContext = undefined;\n\t\tstoredArguments = undefined;\n\t\tresult = function_.apply(callContext, callArguments);\n\t\treturn result;\n\t}\n\n\tfunction later() {\n\t\tconst last = Date.now() - timestamp;\n\n\t\tif (last < wait && last >= 0) {\n\t\t\ttimeoutId = setTimeout(later, wait - last);\n\t\t} else {\n\t\t\ttimeoutId = undefined;\n\n\t\t\tif (!immediate) {\n\t\t\t\tresult = run();\n\t\t\t}\n\t\t}\n\t}\n\n\tconst debounced = function (...arguments_) {\n\t\tif (\n\t\t\tstoredContext\n\t\t\t&& this !== storedContext\n\t\t\t&& Object.getPrototypeOf(this) === Object.getPrototypeOf(storedContext)\n\t\t) {\n\t\t\tthrow new Error('Debounced method called with different contexts of the same prototype.');\n\t\t}\n\n\t\tstoredContext = this; // eslint-disable-line unicorn/no-this-assignment\n\t\tstoredArguments = arguments_;\n\t\ttimestamp = Date.now();\n\n\t\tconst callNow = immediate && !timeoutId;\n\n\t\tif (!timeoutId) {\n\t\t\ttimeoutId = setTimeout(later, wait);\n\t\t}\n\n\t\tif (callNow) {\n\t\t\tresult = run();\n\t\t}\n\n\t\treturn result;\n\t};\n\n\tObject.defineProperty(debounced, 'isPending', {\n\t\tget() {\n\t\t\treturn timeoutId !== undefined;\n\t\t},\n\t});\n\n\tdebounced.clear = () => {\n\t\tif (!timeoutId) {\n\t\t\treturn;\n\t\t}\n\n\t\tclearTimeout(timeoutId);\n\t\ttimeoutId = undefined;\n\t};\n\n\tdebounced.flush = () => {\n\t\tif (!timeoutId) {\n\t\t\treturn;\n\t\t}\n\n\t\tdebounced.trigger();\n\t};\n\n\tdebounced.trigger = () => {\n\t\tresult = run();\n\n\t\tdebounced.clear();\n\t};\n\n\treturn debounced;\n}\n\n// Adds compatibility for ES modules\nmodule.exports.debounce = debounce;\n\nmodule.exports = debounce;\n","function GenRandomId(length) {\n return Math.random().toString(36).replace(/[^a-z]+/g, \"\").slice(0, length || 5);\n}\nexport {\n GenRandomId as G\n};\n//# sourceMappingURL=GenRandomId-F5ebeBB_.mjs.map\n","import { a as getLanguage, e as getPlural, t as translate, d as translatePlural } from \"./chunks/translation-DoG5ZELJ.mjs\";\n/*!\n * SPDX-FileCopyrightText: 2019 Nextcloud GmbH and Nextcloud contributors\n * SPDX-License-Identifier: GPL-3.0-or-later\n */\nclass GettextWrapper {\n bundle;\n constructor(pluralFunction) {\n this.bundle = {\n pluralFunction,\n translations: {}\n };\n }\n /**\n * Append new translations to the wrapper.\n *\n * This is useful if translations should be added on demand,\n * e.g. depending on component usage.\n *\n * @param bundle - The new translation bundle to append\n */\n addTranslations(bundle) {\n const dict = Object.values(bundle.translations[\"\"] ?? {}).map(({ msgid, msgid_plural: msgidPlural, msgstr }) => {\n if (msgidPlural !== void 0) {\n return [`_${msgid}_::_${msgidPlural}_`, msgstr];\n }\n return [msgid, msgstr[0]];\n });\n this.bundle.translations = {\n ...this.bundle.translations,\n ...Object.fromEntries(dict)\n };\n }\n /**\n * Get translated string (singular form), optionally with placeholders\n *\n * @param original original string to translate\n * @param placeholders map of placeholder key to value\n */\n gettext(original, placeholders = {}) {\n return translate(\"\", original, placeholders, void 0, { bundle: this.bundle });\n }\n /**\n * Get translated string with plural forms\n *\n * @param singular Singular text form\n * @param plural Plural text form to be used if `count` requires it\n * @param count The number to insert into the text\n * @param placeholders optional map of placeholder key to value\n */\n ngettext(singular, plural, count, placeholders = {}) {\n return translatePlural(\"\", singular, plural, count, placeholders, { bundle: this.bundle });\n }\n}\nclass GettextBuilder {\n debug = false;\n language = \"en\";\n translations = {};\n setLanguage(language) {\n this.language = language;\n return this;\n }\n /**\n * Try to detect locale from context with `en` as fallback value\n * This only works within a Nextcloud page context.\n *\n * @deprecated use `detectLanguage` instead.\n */\n detectLocale() {\n return this.detectLanguage();\n }\n /**\n * Try to detect locale from context with `en` as fallback value.\n * This only works within a Nextcloud page context.\n */\n detectLanguage() {\n return this.setLanguage(getLanguage().replace(\"-\", \"_\"));\n }\n /**\n * Register a new translation bundle for a specified language.\n *\n * Please note that existing translations for that language will be overwritten.\n *\n * @param language - Language this is the translation for\n * @param data - The translation bundle\n */\n addTranslation(language, data) {\n this.translations[language] = data;\n return this;\n }\n enableDebugMode() {\n this.debug = true;\n return this;\n }\n build() {\n if (this.debug) {\n console.debug(`Creating gettext instance for language ${this.language}`);\n }\n const wrapper = new GettextWrapper((n) => getPlural(n, this.language));\n if (this.language in this.translations) {\n wrapper.addTranslations(this.translations[this.language]);\n }\n return wrapper;\n }\n}\nfunction getGettextBuilder() {\n return new GettextBuilder();\n}\nexport {\n getGettextBuilder\n};\n//# sourceMappingURL=gettext.mjs.map\n","import { getLanguage } from \"@nextcloud/l10n\";\nimport { getGettextBuilder } from \"@nextcloud/l10n/gettext\";\n/*!\n * SPDX-FileCopyrightText: Nextcloud GmbH and Nextcloud contributors\n * SPDX-License-Identifier: AGPL-3.0-or-later\n */\nconst gettext = getGettextBuilder().detectLanguage().build();\nconst n = (...args) => gettext.ngettext(...args);\nconst t = (...args) => gettext.gettext(...args);\nfunction register(...chunks) {\n for (const chunk of chunks) {\n if (chunk.registered) {\n continue;\n }\n for (const { l: language, t: translations } of chunk) {\n if (language !== getLanguage() || !translations) {\n continue;\n }\n const decompressed = Object.fromEntries(Object.entries(translations).map(([id, value]) => [\n id,\n {\n msgid: id,\n msgid_plural: value.p,\n msgstr: value.v\n }\n ]));\n gettext.addTranslations({\n translations: {\n \"\": decompressed\n }\n });\n }\n chunk.registered = true;\n }\n}\nconst t0 = [{ \"l\": \"ar\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (مقيد)\"] }, \"Select a tag\": { \"v\": [\"اختر وسم\"] } } }, { \"l\": \"ast\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restrinxóse)\"] }, \"Select a tag\": { \"v\": [\"Seleicionar una etiqueta\"] } } }, { \"l\": \"br\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (bevennet)\"] }, \"Select a tag\": { \"v\": [\"Choaz ur c'hlav\"] } } }, { \"l\": \"ca\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restringit)\"] }, \"Select a tag\": { \"v\": [\"Seleccioneu una etiqueta\"] } } }, { \"l\": \"cs\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (omezené)\"] }, \"Select a tag\": { \"v\": [\"Vybrat štítek\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (omezené)\"] }, \"Select a tag\": { \"v\": [\"Vybrat štítek\"] } } }, { \"l\": \"da\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (begrænset)\"] }, \"Select a tag\": { \"v\": [\"Vælg et mærke\"] } } }, { \"l\": \"de\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (eingeschränkt)\"] }, \"Select a tag\": { \"v\": [\"Schlagwort auswählen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (eingeschränkt)\"] }, \"Select a tag\": { \"v\": [\"Schlagwort auswählen\"] } } }, { \"l\": \"el\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (περιορισμένο)\"] }, \"Select a tag\": { \"v\": [\"Επιλογή ετικέτας\"] } } }, { \"l\": \"en-GB\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restricted)\"] }, \"Select a tag\": { \"v\": [\"Select a tag\"] } } }, { \"l\": \"eo\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (limigita)\"] }, \"Select a tag\": { \"v\": [\"Elektu etikedon\"] } } }, { \"l\": \"es\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restringido)\"] }, \"Select a tag\": { \"v\": [\"Seleccione una etiqueta\"] } } }, { \"l\": \"es-AR\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restringido)\"] }, \"Select a tag\": { \"v\": [\"Elija una etiqueta\"] } } }, { \"l\": \"es-EC\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restricted)\"] }, \"Select a tag\": { \"v\": [\"Seleccionar una etiqueta\"] } } }, { \"l\": \"es-MX\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restringido)\"] }, \"Select a tag\": { \"v\": [\"Seleccionar una etiqueta\"] } } }, { \"l\": \"et-EE\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (piiratud)\"] }, \"Select a tag\": { \"v\": [\"Vali silt\"] } } }, { \"l\": \"eu\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (mugatua)\"] }, \"Select a tag\": { \"v\": [\"Hautatu etiketa bat\"] } } }, { \"l\": \"fa\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} محدود شده\"] }, \"Select a tag\": { \"v\": [\"انتخاب یک برچسب\"] } } }, { \"l\": \"fi\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (rajoitettu)\"] }, \"Select a tag\": { \"v\": [\"Valitse tunniste\"] } } }, { \"l\": \"fr\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restreint)\"] }, \"Select a tag\": { \"v\": [\"Sélectionnez une balise\"] } } }, { \"l\": \"ga\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (srianta)\"] }, \"Select a tag\": { \"v\": [\"Roghnaigh clib\"] } } }, { \"l\": \"gl\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restrinxido)\"] }, \"Select a tag\": { \"v\": [\"Seleccione unha etiqueta\"] } } }, { \"l\": \"he\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (מוגבל)\"] }, \"Select a tag\": { \"v\": [\"בחירת תגית\"] } } }, { \"l\": \"hu\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (korlátozott)\"] }, \"Select a tag\": { \"v\": [\"Válasszon címkét\"] } } }, { \"l\": \"id\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (dibatasi)\"] }, \"Select a tag\": { \"v\": [\"Pilih tag\"] } } }, { \"l\": \"is\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (takmarkað)\"] }, \"Select a tag\": { \"v\": [\"Veldu merki\"] } } }, { \"l\": \"it\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (limitato)\"] }, \"Select a tag\": { \"v\": [\"Seleziona un'etichetta\"] } } }, { \"l\": \"ja\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (制限付)\"] }, \"Select a tag\": { \"v\": [\"タグを選択\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (制限付)\"] }, \"Select a tag\": { \"v\": [\"タグを選択\"] } } }, { \"l\": \"ko\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag}(제한)\"] }, \"Select a tag\": { \"v\": [\"태그 선택\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (apribota)\"] }, \"Select a tag\": { \"v\": [\"Pasirinkti žymę\"] } } }, { \"l\": \"lv\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (ierobežots)\"] }, \"Select a tag\": { \"v\": [\"Izvēlēties birku\"] } } }, { \"l\": \"mk\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (ограничено)\"] }, \"Select a tag\": { \"v\": [\"Избери ознака\"] } } }, { \"l\": \"my\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (ကန့်သတ်)\"] }, \"Select a tag\": { \"v\": [\"tag ရွေးချယ်ရန်\"] } } }, { \"l\": \"nb\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (beskyttet)\"] }, \"Select a tag\": { \"v\": [\"Velg en merkelapp\"] } } }, { \"l\": \"nl\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (beperkt)\"] }, \"Select a tag\": { \"v\": [\"Selecteer een label\"] } } }, { \"l\": \"oc\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (limit)\"] }, \"Select a tag\": { \"v\": [\"Seleccionar una etiqueta\"] } } }, { \"l\": \"pl\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (ograniczona)\"] }, \"Select a tag\": { \"v\": [\"Wybierz etykietę\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restrito) \"] }, \"Select a tag\": { \"v\": [\"Selecionar uma etiqueta\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restrito)\"] }, \"Select a tag\": { \"v\": [\"Selecionar uma etiqueta\"] } } }, { \"l\": \"ro\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (restricționat)\"] }, \"Select a tag\": { \"v\": [\"Selectați o etichetă\"] } } }, { \"l\": \"ru\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (ограниченное)\"] }, \"Select a tag\": { \"v\": [\"Выберите метку\"] } } }, { \"l\": \"sk\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (obmedzený)\"] }, \"Select a tag\": { \"v\": [\"Vybrať štítok\"] } } }, { \"l\": \"sl\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (omejeno)\"] }, \"Select a tag\": { \"v\": [\"Izbor oznake\"] } } }, { \"l\": \"sr\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (ограничено)\"] }, \"Select a tag\": { \"v\": [\"Изаберите ознаку\"] } } }, { \"l\": \"sv\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (begränsad)\"] }, \"Select a tag\": { \"v\": [\"Välj en tag\"] } } }, { \"l\": \"tr\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (kısıtlı)\"] }, \"Select a tag\": { \"v\": [\"Bir etiket seçin\"] } } }, { \"l\": \"uk\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (обмежений)\"] }, \"Select a tag\": { \"v\": [\"Виберіть позначку\"] } } }, { \"l\": \"uz\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (cheklangan)\"] }, \"Select a tag\": { \"v\": [\"Teg tanlang\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (受限)\"] }, \"Select a tag\": { \"v\": [\"选择一个标签\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag} (受限)\"] }, \"Select a tag\": { \"v\": [\"選擇標籤\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"{tag} (restricted)\": { \"v\": [\"{tag}(受限)\"] }, \"Select a tag\": { \"v\": [\"選擇標籤\"] } } }];\nconst t2 = [{ \"l\": \"ar\", \"t\": { \"a few seconds ago\": { \"v\": [\"منذ عدة ثوانٍ\"] }, \"sec. ago\": { \"v\": [\"ثانية مضت\"] }, \"seconds ago\": { \"v\": [\"ثوانٍ مضت\"] } } }, { \"l\": \"ast\", \"t\": { \"a few seconds ago\": { \"v\": [\"hai unos segundos\"] }, \"sec. ago\": { \"v\": [\"hai segs\"] }, \"seconds ago\": { \"v\": [\"hai segundos\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"a few seconds ago\": { \"v\": [\"před několika sekundami\"] }, \"sec. ago\": { \"v\": [\"sek. před\"] }, \"seconds ago\": { \"v\": [\"sekund předtím\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"a few seconds ago\": { \"v\": [\"před několika sekundami\"] }, \"sec. ago\": { \"v\": [\"sek. před\"] }, \"seconds ago\": { \"v\": [\"sekund předtím\"] } } }, { \"l\": \"da\", \"t\": { \"a few seconds ago\": { \"v\": [\"et par sekunder siden\"] }, \"sec. ago\": { \"v\": [\"sek. siden\"] }, \"seconds ago\": { \"v\": [\"sekunder siden\"] } } }, { \"l\": \"de\", \"t\": { \"a few seconds ago\": { \"v\": [\"vor ein paar Sekunden\"] }, \"sec. ago\": { \"v\": [\"Sek. zuvor\"] }, \"seconds ago\": { \"v\": [\"Sekunden zuvor\"] } } }, { \"l\": \"de-DE\", \"t\": { \"a few seconds ago\": { \"v\": [\"vor ein paar Sekunden\"] }, \"sec. ago\": { \"v\": [\"Sek. zuvor\"] }, \"seconds ago\": { \"v\": [\"Sekunden zuvor\"] } } }, { \"l\": \"el\", \"t\": { \"a few seconds ago\": { \"v\": [\"πριν λίγα δευτερόλεπτα\"] }, \"sec. ago\": { \"v\": [\"δευτ. πριν\"] }, \"seconds ago\": { \"v\": [\"δευτερόλεπτα πριν\"] } } }, { \"l\": \"en-GB\", \"t\": { \"a few seconds ago\": { \"v\": [\"a few seconds ago\"] }, \"sec. ago\": { \"v\": [\"sec. ago\"] }, \"seconds ago\": { \"v\": [\"seconds ago\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"a few seconds ago\": { \"v\": [\"hace unos pocos segundos\"] }, \"sec. ago\": { \"v\": [\"hace segundos\"] }, \"seconds ago\": { \"v\": [\"segundos atrás\"] } } }, { \"l\": \"es-AR\", \"t\": { \"a few seconds ago\": { \"v\": [\"hace unos segundos\"] }, \"sec. ago\": { \"v\": [\"seg. atrás\"] }, \"seconds ago\": { \"v\": [\"segundos atrás\"] } } }, { \"l\": \"es-EC\", \"t\": { \"a few seconds ago\": { \"v\": [\"hace unos segundos\"] }, \"sec. ago\": { \"v\": [\"hace segundos\"] }, \"seconds ago\": { \"v\": [\"Segundos atrás\"] } } }, { \"l\": \"es-MX\", \"t\": { \"a few seconds ago\": { \"v\": [\"hace unos segundos\"] }, \"sec. ago\": { \"v\": [\"seg. atrás\"] }, \"seconds ago\": { \"v\": [\"segundos atrás\"] } } }, { \"l\": \"et-EE\", \"t\": { \"a few seconds ago\": { \"v\": [\"mõni sekund tagasi\"] }, \"sec. ago\": { \"v\": [\"sek. tagasi\"] }, \"seconds ago\": { \"v\": [\"sekundit tagasi\"] } } }, { \"l\": \"eu\", \"t\": { \"a few seconds ago\": { \"v\": [\"duela segundo batzuk\"] }, \"sec. ago\": { \"v\": [\"duela seg.\"] }, \"seconds ago\": { \"v\": [\"duela segundo\"] } } }, { \"l\": \"fa\", \"t\": { \"a few seconds ago\": { \"v\": [\"چند ثانیه پیش\"] }, \"sec. ago\": { \"v\": [\"چند ثانیه پیش\"] }, \"seconds ago\": { \"v\": [\"چند ثانیه پیش\"] } } }, { \"l\": \"fi\", \"t\": { \"a few seconds ago\": { \"v\": [\"muutamia sekunteja sitten\"] }, \"sec. ago\": { \"v\": [\"sek. sitten\"] }, \"seconds ago\": { \"v\": [\"sekunteja sitten\"] } } }, { \"l\": \"fr\", \"t\": { \"a few seconds ago\": { \"v\": [\"il y a quelques instants\"] }, \"sec. ago\": { \"v\": [\"il y a sec.\"] }, \"seconds ago\": { \"v\": [\"il y a quelques secondes\"] } } }, { \"l\": \"ga\", \"t\": { \"a few seconds ago\": { \"v\": [\"cúpla soicind ó shin\"] }, \"sec. ago\": { \"v\": [\"soic. ó shin\"] }, \"seconds ago\": { \"v\": [\"soicind ó shin\"] } } }, { \"l\": \"gl\", \"t\": { \"a few seconds ago\": { \"v\": [\"hai uns segundos\"] }, \"sec. ago\": { \"v\": [\"segs. atrás\"] }, \"seconds ago\": { \"v\": [\"segundos atrás\"] } } }, { \"l\": \"he\", \"t\": { \"a few seconds ago\": { \"v\": [\"לפני מספר שניות\"] }, \"sec. ago\": { \"v\": [\"לפני מספר שניות\"] }, \"seconds ago\": { \"v\": [\"לפני מס׳ שניות\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"a few seconds ago\": { \"v\": [\"beberapa detik yang lalu\"] }, \"sec. ago\": { \"v\": [\"dtk. yang lalu\"] }, \"seconds ago\": { \"v\": [\"beberapa detik lalu\"] } } }, { \"l\": \"is\", \"t\": { \"a few seconds ago\": { \"v\": [\"fyrir örfáum sekúndum síðan\"] }, \"sec. ago\": { \"v\": [\"sek. síðan\"] }, \"seconds ago\": { \"v\": [\"sekúndum síðan\"] } } }, { \"l\": \"it\", \"t\": { \"a few seconds ago\": { \"v\": [\"pochi secondi fa\"] }, \"sec. ago\": { \"v\": [\"sec. fa\"] }, \"seconds ago\": { \"v\": [\"secondi fa\"] } } }, { \"l\": \"ja\", \"t\": { \"a few seconds ago\": { \"v\": [\"数秒前\"] }, \"sec. ago\": { \"v\": [\"秒前\"] }, \"seconds ago\": { \"v\": [\"数秒前\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"a few seconds ago\": { \"v\": [\"数秒前\"] }, \"sec. ago\": { \"v\": [\"秒前\"] }, \"seconds ago\": { \"v\": [\"数秒前\"] } } }, { \"l\": \"ko\", \"t\": { \"a few seconds ago\": { \"v\": [\"방금 전\"] }, \"sec. ago\": { \"v\": [\"몇 초 전\"] }, \"seconds ago\": { \"v\": [\"초 전\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"a few seconds ago\": { \"v\": [\"noen få sekunder siden\"] }, \"sec. ago\": { \"v\": [\"sek. siden\"] }, \"seconds ago\": { \"v\": [\"sekunder siden\"] } } }, { \"l\": \"nl\", \"t\": { \"a few seconds ago\": { \"v\": [\"enkele seconden terug\"] }, \"sec. ago\": { \"v\": [\"sec. geleden\"] }, \"seconds ago\": { \"v\": [\"seconden geleden\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"a few seconds ago\": { \"v\": [\"kilka sekund temu\"] }, \"sec. ago\": { \"v\": [\"sek. temu\"] }, \"seconds ago\": { \"v\": [\"sekund temu\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"a few seconds ago\": { \"v\": [\"alguns segundos atrás\"] }, \"sec. ago\": { \"v\": [\"seg. atrás\"] }, \"seconds ago\": { \"v\": [\"segundos atrás\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"a few seconds ago\": { \"v\": [\"há alguns segundos\"] }, \"sec. ago\": { \"v\": [\"seg. atrás\"] }, \"seconds ago\": { \"v\": [\"segundos atrás\"] } } }, { \"l\": \"ro\", \"t\": { \"a few seconds ago\": { \"v\": [\"acum câteva secunde\"] }, \"sec. ago\": { \"v\": [\"sec. în urmă\"] }, \"seconds ago\": { \"v\": [\"secunde în urmă\"] } } }, { \"l\": \"ru\", \"t\": { \"a few seconds ago\": { \"v\": [\"несколько секунд назад\"] }, \"sec. ago\": { \"v\": [\"сек. назад\"] }, \"seconds ago\": { \"v\": [\"секунд назад\"] } } }, { \"l\": \"sk\", \"t\": { \"a few seconds ago\": { \"v\": [\"pred chvíľou\"] }, \"sec. ago\": { \"v\": [\"pred pár sekundami\"] }, \"seconds ago\": { \"v\": [\"pred sekundami\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"a few seconds ago\": { \"v\": [\"пре неколико секунди\"] }, \"sec. ago\": { \"v\": [\"сек. раније\"] }, \"seconds ago\": { \"v\": [\"секунди раније\"] } } }, { \"l\": \"sv\", \"t\": { \"a few seconds ago\": { \"v\": [\"några sekunder sedan\"] }, \"sec. ago\": { \"v\": [\"sek. sedan\"] }, \"seconds ago\": { \"v\": [\"sekunder sedan\"] } } }, { \"l\": \"tr\", \"t\": { \"a few seconds ago\": { \"v\": [\"birkaç saniye önce\"] }, \"sec. ago\": { \"v\": [\"sn. önce\"] }, \"seconds ago\": { \"v\": [\"saniye önce\"] } } }, { \"l\": \"uk\", \"t\": { \"a few seconds ago\": { \"v\": [\"декілька секунд тому\"] }, \"sec. ago\": { \"v\": [\"с тому\"] }, \"seconds ago\": { \"v\": [\"с тому\"] } } }, { \"l\": \"uz\", \"t\": { \"a few seconds ago\": { \"v\": [\"bir necha soniya oldin\"] }, \"sec. ago\": { \"v\": [\"sek. oldin\"] }, \"seconds ago\": { \"v\": [\"soniyalar oldin\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"a few seconds ago\": { \"v\": [\"几秒前\"] }, \"sec. ago\": { \"v\": [\"几秒前\"] }, \"seconds ago\": { \"v\": [\"几秒前\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"a few seconds ago\": { \"v\": [\"幾秒前\"] }, \"sec. ago\": { \"v\": [\"秒前\"] }, \"seconds ago\": { \"v\": [\"秒前\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"a few seconds ago\": { \"v\": [\"幾秒前\"] }, \"sec. ago\": { \"v\": [\"秒前\"] }, \"seconds ago\": { \"v\": [\"秒前\"] } } }];\nconst t3 = [{ \"l\": \"ar\", \"t\": { \"Acapulco\": { \"v\": [\"بازلائي مطفي\"] }, \"Blue Violet\": { \"v\": [\"بنفسجي مشعشع\"] }, \"Boston Blue\": { \"v\": [\"سماوي مطفي\"] }, \"Deluge\": { \"v\": [\"بنفسجي مطفي\"] }, \"Feldspar\": { \"v\": [\"وردي صخري\"] }, \"Gold\": { \"v\": [\"ذهبي\"] }, \"Mariner\": { \"v\": [\"أزرق بحري\"] }, \"Nextcloud blue\": { \"v\": [\"أزرق نكست كلاود\"] }, \"Olivine\": { \"v\": [\"زيتي\"] }, \"Purple\": { \"v\": [\"بنفسجي\"] }, \"Rosy brown\": { \"v\": [\"بُنِّي زهري\"] }, \"Whiskey\": { \"v\": [\"نبيذي\"] } } }, { \"l\": \"ast\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulcu\"] }, \"Blue Violet\": { \"v\": [\"Viola azulao\"] }, \"Boston Blue\": { \"v\": [\"Azul Boston\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Oru\"] }, \"Mariner\": { \"v\": [\"Marineru\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud azul\"] }, \"Olivine\": { \"v\": [\"Olivina\"] }, \"Purple\": { \"v\": [\"Moráu\"] }, \"Rosy brown\": { \"v\": [\"Marrón arrosao\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Acapulco\": { \"v\": [\"Akapulko\"] }, \"Blue Violet\": { \"v\": [\"Modrofialová\"] }, \"Boston Blue\": { \"v\": [\"Bostonská modrá\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Živicová\"] }, \"Gold\": { \"v\": [\"Zlatá\"] }, \"Mariner\": { \"v\": [\"Námořnická\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud modrá\"] }, \"Olivine\": { \"v\": [\"Olivínová\"] }, \"Purple\": { \"v\": [\"Fialová\"] }, \"Rosy brown\": { \"v\": [\"Růžovohnědá\"] }, \"Whiskey\": { \"v\": [\"Whisky\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Acapulco\": { \"v\": [\"Akapulko\"] }, \"Blue Violet\": { \"v\": [\"Modrofialová\"] }, \"Boston Blue\": { \"v\": [\"Bostonská modrá\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Živicová\"] }, \"Gold\": { \"v\": [\"Zlatá\"] }, \"Mariner\": { \"v\": [\"Námořnická\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud modrá\"] }, \"Olivine\": { \"v\": [\"Olivínová\"] }, \"Purple\": { \"v\": [\"Fialová\"] }, \"Rosy brown\": { \"v\": [\"Růžovohnědá\"] }, \"Whiskey\": { \"v\": [\"Whisky\"] } } }, { \"l\": \"da\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Blue Violet\"] }, \"Boston Blue\": { \"v\": [\"Boston Blue\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Guld\"] }, \"Mariner\": { \"v\": [\"Mariner\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud blue\"] }, \"Olivine\": { \"v\": [\"Olivine\"] }, \"Purple\": { \"v\": [\"Lilla\"] }, \"Rosy brown\": { \"v\": [\"Rosy brown\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"de\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Blau Violett\"] }, \"Boston Blue\": { \"v\": [\"Boston-Blau\"] }, \"Deluge\": { \"v\": [\"Sintflut\"] }, \"Feldspar\": { \"v\": [\"Feldspat\"] }, \"Gold\": { \"v\": [\"Gold\"] }, \"Mariner\": { \"v\": [\"Seemann\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud Blau\"] }, \"Olivine\": { \"v\": [\"Olivin\"] }, \"Purple\": { \"v\": [\"Lila\"] }, \"Rosy brown\": { \"v\": [\"Rosiges Braun\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Blau Violett\"] }, \"Boston Blue\": { \"v\": [\"Boston-Blau\"] }, \"Deluge\": { \"v\": [\"Sintflut\"] }, \"Feldspar\": { \"v\": [\"Feldspat\"] }, \"Gold\": { \"v\": [\"Gold\"] }, \"Mariner\": { \"v\": [\"Seemann\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud Blau\"] }, \"Olivine\": { \"v\": [\"Olivin\"] }, \"Purple\": { \"v\": [\"Lila\"] }, \"Rosy brown\": { \"v\": [\"Rosiges Braun\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"el\", \"t\": { \"Acapulco\": { \"v\": [\"Ακαπούλκο\"] }, \"Blue Violet\": { \"v\": [\"Μπλε Βιολέτ\"] }, \"Boston Blue\": { \"v\": [\"Μπλε Βοστώνης\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Χρυσό\"] }, \"Mariner\": { \"v\": [\"Mariner\"] }, \"Nextcloud blue\": { \"v\": [\"Μπλε Nextcloud\"] }, \"Olivine\": { \"v\": [\"Olivine\"] }, \"Purple\": { \"v\": [\"Μωβ\"] }, \"Rosy brown\": { \"v\": [\"Ροζ καφέ\"] }, \"Whiskey\": { \"v\": [\"Ουίσκι\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Blue Violet\"] }, \"Boston Blue\": { \"v\": [\"Boston Blue\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Gold\"] }, \"Mariner\": { \"v\": [\"Mariner\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud blue\"] }, \"Olivine\": { \"v\": [\"Olivine\"] }, \"Purple\": { \"v\": [\"Purple\"] }, \"Rosy brown\": { \"v\": [\"Rosy brown\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Violeta Azul\"] }, \"Boston Blue\": { \"v\": [\"Azul Boston\"] }, \"Deluge\": { \"v\": [\"Diluvio\"] }, \"Feldspar\": { \"v\": [\"Feldespato\"] }, \"Gold\": { \"v\": [\"Oro\"] }, \"Mariner\": { \"v\": [\"Marinero\"] }, \"Nextcloud blue\": { \"v\": [\"Azul Nextcloud\"] }, \"Olivine\": { \"v\": [\"Olivino\"] }, \"Purple\": { \"v\": [\"Púrpura\"] }, \"Rosy brown\": { \"v\": [\"Marrón rosáceo\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Violeta Azul\"] }, \"Boston Blue\": { \"v\": [\"Azul Boston\"] }, \"Deluge\": { \"v\": [\"Diluvio\"] }, \"Feldspar\": { \"v\": [\"Feldespato\"] }, \"Gold\": { \"v\": [\"Oro\"] }, \"Mariner\": { \"v\": [\"Marinero\"] }, \"Nextcloud blue\": { \"v\": [\"Azul Nextcloud\"] }, \"Olivine\": { \"v\": [\"Olivino\"] }, \"Purple\": { \"v\": [\"Púrpura\"] }, \"Rosy brown\": { \"v\": [\"Marrón rosáceo\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Violeta Azul\"] }, \"Boston Blue\": { \"v\": [\"Azul Boston\"] }, \"Deluge\": { \"v\": [\"Diluvio\"] }, \"Feldspar\": { \"v\": [\"Feldespato\"] }, \"Gold\": { \"v\": [\"Oro\"] }, \"Mariner\": { \"v\": [\"Marinero\"] }, \"Nextcloud blue\": { \"v\": [\"Azul Nextcloud\"] }, \"Olivine\": { \"v\": [\"Olivino\"] }, \"Purple\": { \"v\": [\"Púrpura\"] }, \"Rosy brown\": { \"v\": [\"Marrón rosáceo\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco meresinine\"] }, \"Blue Violet\": { \"v\": [\"Sinakasvioletne\"] }, \"Boston Blue\": { \"v\": [\"Bostoni rohekassinine\"] }, \"Deluge\": { \"v\": [\"Tulvavee lilla\"] }, \"Feldspar\": { \"v\": [\"Põlevkivipruun\"] }, \"Gold\": { \"v\": [\"Kuldne\"] }, \"Mariner\": { \"v\": [\"Meresinine\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloudi sinine\"] }, \"Olivine\": { \"v\": [\"Oliiviroheline\"] }, \"Purple\": { \"v\": [\"Purpurpunane\"] }, \"Rosy brown\": { \"v\": [\"Roosikarva pruun\"] }, \"Whiskey\": { \"v\": [\"Viskikarva kollakaspruun\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"Acapulco\": { \"v\": [\"آکاپولکو\"] }, \"Blue Violet\": { \"v\": [\"بنفش آبی\"] }, \"Boston Blue\": { \"v\": [\"آبی بوستونی\"] }, \"Deluge\": { \"v\": [\"سیل\"] }, \"Feldspar\": { \"v\": [\"فلدسپات\"] }, \"Gold\": { \"v\": [\"طلا\"] }, \"Mariner\": { \"v\": [\"مارینر\"] }, \"Nextcloud blue\": { \"v\": [\"نکس کلود آبی\"] }, \"Olivine\": { \"v\": [\"الیوین\"] }, \"Purple\": { \"v\": [\"بنفش\"] }, \"Rosy brown\": { \"v\": [\"قهوه‌ای رز\"] }, \"Whiskey\": { \"v\": [\"ویسکی\"] } } }, { \"l\": \"fi\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Sinivioletti\"] }, \"Boston Blue\": { \"v\": [\"Bostoninsininen\"] }, \"Deluge\": { \"v\": [\"Tulva\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Kulta\"] }, \"Mariner\": { \"v\": [\"Merenkulkija\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloudin sininen\"] }, \"Olivine\": { \"v\": [\"Oliviini\"] }, \"Purple\": { \"v\": [\"Purppura\"] }, \"Rosy brown\": { \"v\": [\"Ruusunruskea\"] }, \"Whiskey\": { \"v\": [\"Viski\"] } } }, { \"l\": \"fr\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Bleu violet\"] }, \"Boston Blue\": { \"v\": [\"Bleu de Boston\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Doré\"] }, \"Mariner\": { \"v\": [\"Mariner\"] }, \"Nextcloud blue\": { \"v\": [\"Bleu Nextcloud\"] }, \"Olivine\": { \"v\": [\"Olivine\"] }, \"Purple\": { \"v\": [\"Violet\"] }, \"Rosy brown\": { \"v\": [\"Brun rosé\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"ga\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Gorm Violet\"] }, \"Boston Blue\": { \"v\": [\"Bostún Gorm\"] }, \"Deluge\": { \"v\": [\"Díle\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Óir\"] }, \"Mariner\": { \"v\": [\"Mairnéalach\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud gorm\"] }, \"Olivine\": { \"v\": [\"Olaivín\"] }, \"Purple\": { \"v\": [\"Corcra\"] }, \"Rosy brown\": { \"v\": [\"Rosach donn\"] }, \"Whiskey\": { \"v\": [\"Fuisce\"] } } }, { \"l\": \"gl\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Azul violeta\"] }, \"Boston Blue\": { \"v\": [\"Azul Boston\"] }, \"Deluge\": { \"v\": [\"Diluvio\"] }, \"Feldspar\": { \"v\": [\"Feldespato\"] }, \"Gold\": { \"v\": [\"Ouro\"] }, \"Mariner\": { \"v\": [\"Marino\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud azul\"] }, \"Olivine\": { \"v\": [\"Olivina\"] }, \"Purple\": { \"v\": [\"Púrpura\"] }, \"Rosy brown\": { \"v\": [\"Pardo rosado\"] }, \"Whiskey\": { \"v\": [\"Whisky\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Gold\": { \"v\": [\"Emas\"] }, \"Nextcloud blue\": { \"v\": [\"Biru Nextcloud\"] }, \"Purple\": { \"v\": [\"Ungu\"] } } }, { \"l\": \"is\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Bláklukka\"] }, \"Boston Blue\": { \"v\": [\"Bostonblátt\"] }, \"Deluge\": { \"v\": [\"Fjólublátt\"] }, \"Feldspar\": { \"v\": [\"Feldspat\"] }, \"Gold\": { \"v\": [\"Gull\"] }, \"Mariner\": { \"v\": [\"Sjóarablátt\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud blátt\"] }, \"Olivine\": { \"v\": [\"Ólivín\"] }, \"Purple\": { \"v\": [\"Purpurablátt\"] }, \"Rosy brown\": { \"v\": [\"Rósabrúnt\"] }, \"Whiskey\": { \"v\": [\"Viský\"] } } }, { \"l\": \"it\", \"t\": { \"Gold\": { \"v\": [\"Oro\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud blue\"] }, \"Purple\": { \"v\": [\"Viola\"] } } }, { \"l\": \"ja\", \"t\": { \"Acapulco\": { \"v\": [\"アカプルコ\"] }, \"Blue Violet\": { \"v\": [\"ブルーバイオレット\"] }, \"Boston Blue\": { \"v\": [\"ボストンブルー\"] }, \"Deluge\": { \"v\": [\"豪雨\"] }, \"Feldspar\": { \"v\": [\"長石\"] }, \"Gold\": { \"v\": [\"黄金\"] }, \"Mariner\": { \"v\": [\"船乗り\"] }, \"Nextcloud blue\": { \"v\": [\"ネクストクラウド・ブルー\"] }, \"Olivine\": { \"v\": [\"カンラン石\"] }, \"Purple\": { \"v\": [\"紫色\"] }, \"Rosy brown\": { \"v\": [\"バラ色\"] }, \"Whiskey\": { \"v\": [\"ウイスキー\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Acapulco\": { \"v\": [\"アカプルコ\"] }, \"Blue Violet\": { \"v\": [\"ブルーバイオレット\"] }, \"Boston Blue\": { \"v\": [\"ボストンブルー\"] }, \"Deluge\": { \"v\": [\"豪雨\"] }, \"Feldspar\": { \"v\": [\"長石\"] }, \"Gold\": { \"v\": [\"黄金\"] }, \"Mariner\": { \"v\": [\"船乗り\"] }, \"Nextcloud blue\": { \"v\": [\"ネクストクラウド・ブルー\"] }, \"Olivine\": { \"v\": [\"カンラン石\"] }, \"Purple\": { \"v\": [\"紫色\"] }, \"Rosy brown\": { \"v\": [\"バラ色\"] }, \"Whiskey\": { \"v\": [\"ウイスキー\"] } } }, { \"l\": \"ko\", \"t\": { \"Acapulco\": { \"v\": [\"아카풀코\"] }, \"Blue Violet\": { \"v\": [\"푸른 보라\"] }, \"Boston Blue\": { \"v\": [\"보스턴 블루\"] }, \"Deluge\": { \"v\": [\"폭우\"] }, \"Feldspar\": { \"v\": [\"장석\"] }, \"Gold\": { \"v\": [\"금\"] }, \"Mariner\": { \"v\": [\"뱃사람\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud 파랑\"] }, \"Olivine\": { \"v\": [\"감람석\"] }, \"Purple\": { \"v\": [\"보라\"] }, \"Rosy brown\": { \"v\": [\"로지 브라운\"] }, \"Whiskey\": { \"v\": [\"위스키\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Blå fiolett\"] }, \"Boston Blue\": { \"v\": [\"Boston blå\"] }, \"Deluge\": { \"v\": [\"Syndflod\"] }, \"Feldspar\": { \"v\": [\"Feltspat\"] }, \"Gold\": { \"v\": [\"Gull\"] }, \"Mariner\": { \"v\": [\"Mariner\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud-blå\"] }, \"Olivine\": { \"v\": [\"Olivin\"] }, \"Purple\": { \"v\": [\"Lilla\"] }, \"Rosy brown\": { \"v\": [\"Rosenrød brun\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"nl\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Blauw Paars\"] }, \"Boston Blue\": { \"v\": [\"Boston Blauw\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Veldspaat\"] }, \"Gold\": { \"v\": [\"Goud\"] }, \"Mariner\": { \"v\": [\"Marine blauw\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud blauw\"] }, \"Olivine\": { \"v\": [\"Olivijn\"] }, \"Purple\": { \"v\": [\"Paars\"] }, \"Rosy brown\": { \"v\": [\"Rozig bruin\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Niebieski fiolet\"] }, \"Boston Blue\": { \"v\": [\"Błękit Bostonu\"] }, \"Deluge\": { \"v\": [\"Potop\"] }, \"Feldspar\": { \"v\": [\"Skaleń\"] }, \"Gold\": { \"v\": [\"Złote\"] }, \"Mariner\": { \"v\": [\"Marynarz\"] }, \"Nextcloud blue\": { \"v\": [\"Niebieskie Nextcloud\"] }, \"Olivine\": { \"v\": [\"Oliwin\"] }, \"Purple\": { \"v\": [\"Fioletowy\"] }, \"Rosy brown\": { \"v\": [\"Różowy brąz\"] }, \"Whiskey\": { \"v\": [\"Whisky\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Violeta Azul\"] }, \"Boston Blue\": { \"v\": [\"Azul Boston\"] }, \"Deluge\": { \"v\": [\"Dilúvio\"] }, \"Feldspar\": { \"v\": [\"Feldspato\"] }, \"Gold\": { \"v\": [\"Ouro\"] }, \"Mariner\": { \"v\": [\"Marinheiro\"] }, \"Nextcloud blue\": { \"v\": [\"azul Nextcloud\"] }, \"Olivine\": { \"v\": [\"Olivina\"] }, \"Purple\": { \"v\": [\"Roxo\"] }, \"Rosy brown\": { \"v\": [\"Castanho rosado\"] }, \"Whiskey\": { \"v\": [\"Uísque\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Azul violeta\"] }, \"Boston Blue\": { \"v\": [\"Azul Boston\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Ouro\"] }, \"Mariner\": { \"v\": [\"Mariner\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud azul\"] }, \"Olivine\": { \"v\": [\"Olivine\"] }, \"Purple\": { \"v\": [\"Púrpura\"] }, \"Rosy brown\": { \"v\": [\"Castanho rosado\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"ro\", \"t\": { \"Gold\": { \"v\": [\"Aur\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud albastru\"] }, \"Purple\": { \"v\": [\"Purpuriu\"] } } }, { \"l\": \"ru\", \"t\": { \"Acapulco\": { \"v\": [\"Акапулько\"] }, \"Blue Violet\": { \"v\": [\"Синий фиолет\"] }, \"Boston Blue\": { \"v\": [\"Синий Бостон\"] }, \"Deluge\": { \"v\": [\"Перламутрово-фиолетовый\"] }, \"Feldspar\": { \"v\": [\"Античная латунь\"] }, \"Gold\": { \"v\": [\"Золотой\"] }, \"Mariner\": { \"v\": [\"Морской\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud голубой\"] }, \"Olivine\": { \"v\": [\" Оливковый\"] }, \"Purple\": { \"v\": [\"Фиолетовый\"] }, \"Rosy brown\": { \"v\": [\"Розово-коричневый\"] }, \"Whiskey\": { \"v\": [\"Виски\"] } } }, { \"l\": \"sk\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Modro fialová\"] }, \"Boston Blue\": { \"v\": [\"Bostonská modrá\"] }, \"Deluge\": { \"v\": [\"Deluge\"] }, \"Feldspar\": { \"v\": [\"Živec\"] }, \"Gold\": { \"v\": [\"Zlatá\"] }, \"Mariner\": { \"v\": [\"Námorník\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud modrá\"] }, \"Olivine\": { \"v\": [\"Olivová\"] }, \"Purple\": { \"v\": [\"Fialová\"] }, \"Rosy brown\": { \"v\": [\"Ružovo hnedá\"] }, \"Whiskey\": { \"v\": [\"Whisky\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Acapulco\": { \"v\": [\"Акапулко\"] }, \"Blue Violet\": { \"v\": [\"Плаво љубичаста\"] }, \"Boston Blue\": { \"v\": [\"Бостон плава\"] }, \"Deluge\": { \"v\": [\"Поплава\"] }, \"Feldspar\": { \"v\": [\"Фелдспар\"] }, \"Gold\": { \"v\": [\"Злато\"] }, \"Mariner\": { \"v\": [\"Морнар\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud плава\"] }, \"Olivine\": { \"v\": [\"Маслинаста\"] }, \"Purple\": { \"v\": [\"Пурпурна\"] }, \"Rosy brown\": { \"v\": [\"Роси браон\"] }, \"Whiskey\": { \"v\": [\"Виски\"] } } }, { \"l\": \"sv\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"Blåviolett\"] }, \"Boston Blue\": { \"v\": [\"Bostonblå\"] }, \"Deluge\": { \"v\": [\"Skyfallsblå\"] }, \"Feldspar\": { \"v\": [\"Feldspat\"] }, \"Gold\": { \"v\": [\"Guld\"] }, \"Mariner\": { \"v\": [\"Marinblå\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud-blå\"] }, \"Olivine\": { \"v\": [\"Olivin\"] }, \"Purple\": { \"v\": [\"Lila\"] }, \"Rosy brown\": { \"v\": [\"Rosabrun\"] }, \"Whiskey\": { \"v\": [\"Whisky\"] } } }, { \"l\": \"tr\", \"t\": { \"Acapulco\": { \"v\": [\"Akapulko\"] }, \"Blue Violet\": { \"v\": [\"Mavi mor\"] }, \"Boston Blue\": { \"v\": [\"Boston mavisi\"] }, \"Deluge\": { \"v\": [\"Sel\"] }, \"Feldspar\": { \"v\": [\"Feldispat\"] }, \"Gold\": { \"v\": [\"Altın\"] }, \"Mariner\": { \"v\": [\"Denizci\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud mavi\"] }, \"Olivine\": { \"v\": [\"Zeytinlik\"] }, \"Purple\": { \"v\": [\"Mor\"] }, \"Rosy brown\": { \"v\": [\"Kırmızımsı kahverengi\"] }, \"Whiskey\": { \"v\": [\"Viski\"] } } }, { \"l\": \"uk\", \"t\": { \"Acapulco\": { \"v\": [\"Акапулько\"] }, \"Blue Violet\": { \"v\": [\"Блакитна фіалка\"] }, \"Boston Blue\": { \"v\": [\"Бостонський синій\"] }, \"Deluge\": { \"v\": [\"Злива\"] }, \"Feldspar\": { \"v\": [\"Польові шпати\"] }, \"Gold\": { \"v\": [\"Золотий\"] }, \"Mariner\": { \"v\": [\"Морський\"] }, \"Nextcloud blue\": { \"v\": [\"Блакитний Nextcloud\"] }, \"Olivine\": { \"v\": [\"Олива\"] }, \"Purple\": { \"v\": [\"Фіолетовий\"] }, \"Rosy brown\": { \"v\": [\"Темно-рожевий\"] }, \"Whiskey\": { \"v\": [\"Кола\"] } } }, { \"l\": \"uz\", \"t\": { \"Acapulco\": { \"v\": [\"Akapulko\"] }, \"Blue Violet\": { \"v\": [\"Moviy binafsha\"] }, \"Boston Blue\": { \"v\": [\"Boston ko'k\"] }, \"Deluge\": { \"v\": [\"To'fon\"] }, \"Feldspar\": { \"v\": [\"Feldspar\"] }, \"Gold\": { \"v\": [\"Oltin\"] }, \"Mariner\": { \"v\": [\"Dengizchi\"] }, \"Nextcloud blue\": { \"v\": [\"Ko'k Nextcloud \"] }, \"Olivine\": { \"v\": [\"Olivine\"] }, \"Purple\": { \"v\": [\"Binafsha\"] }, \"Rosy brown\": { \"v\": [\"Qizil jigarrang\"] }, \"Whiskey\": { \"v\": [\"Whiskey\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Acapulco\": { \"v\": [\"Acapulco\"] }, \"Blue Violet\": { \"v\": [\"瓦罗兰特蓝\"] }, \"Boston Blue\": { \"v\": [\"波士顿蓝\"] }, \"Deluge\": { \"v\": [\"洪水色\"] }, \"Feldspar\": { \"v\": [\"长石\"] }, \"Gold\": { \"v\": [\"金色\"] }, \"Mariner\": { \"v\": [\"水手\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud 蓝\"] }, \"Olivine\": { \"v\": [\"橄榄石色\"] }, \"Purple\": { \"v\": [\"紫色\"] }, \"Rosy brown\": { \"v\": [\"玫瑰棕色\"] }, \"Whiskey\": { \"v\": [\"威士忌\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Acapulco\": { \"v\": [\"阿卡普爾科\"] }, \"Blue Violet\": { \"v\": [\"藍紫色\"] }, \"Boston Blue\": { \"v\": [\"波士頓藍\"] }, \"Deluge\": { \"v\": [\"大洪水\"] }, \"Feldspar\": { \"v\": [\"長石\"] }, \"Gold\": { \"v\": [\"Gold\"] }, \"Mariner\": { \"v\": [\"海軍藍\"] }, \"Nextcloud blue\": { \"v\": [\"Nextcloud 藍色\"] }, \"Olivine\": { \"v\": [\"橄欖石色\"] }, \"Purple\": { \"v\": [\"紫色\"] }, \"Rosy brown\": { \"v\": [\"玫瑰棕色\"] }, \"Whiskey\": { \"v\": [\"威士忌\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t4 = [{ \"l\": \"ar\", \"t\": { \"Actions\": { \"v\": [\"إجراءات\"] } } }, { \"l\": \"ast\", \"t\": { \"Actions\": { \"v\": [\"Aiciones\"] } } }, { \"l\": \"br\", \"t\": { \"Actions\": { \"v\": [\"Oberioù\"] } } }, { \"l\": \"ca\", \"t\": { \"Actions\": { \"v\": [\"Accions\"] } } }, { \"l\": \"cs\", \"t\": { \"Actions\": { \"v\": [\"Akce\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Actions\": { \"v\": [\"Akce\"] } } }, { \"l\": \"da\", \"t\": { \"Actions\": { \"v\": [\"Handlinger\"] } } }, { \"l\": \"de\", \"t\": { \"Actions\": { \"v\": [\"Aktionen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Actions\": { \"v\": [\"Aktionen\"] } } }, { \"l\": \"el\", \"t\": { \"Actions\": { \"v\": [\"Ενέργειες\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Actions\": { \"v\": [\"Actions\"] } } }, { \"l\": \"eo\", \"t\": { \"Actions\": { \"v\": [\"Agoj\"] } } }, { \"l\": \"es\", \"t\": { \"Actions\": { \"v\": [\"Acciones\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Actions\": { \"v\": [\"Acciones\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Actions\": { \"v\": [\"Acciones\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Actions\": { \"v\": [\"Acciones\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Actions\": { \"v\": [\"Tegevus\"] } } }, { \"l\": \"eu\", \"t\": { \"Actions\": { \"v\": [\"Ekintzak\"] } } }, { \"l\": \"fa\", \"t\": { \"Actions\": { \"v\": [\"کنش‌ها\"] } } }, { \"l\": \"fi\", \"t\": { \"Actions\": { \"v\": [\"Toiminnot\"] } } }, { \"l\": \"fr\", \"t\": { \"Actions\": { \"v\": [\"Actions\"] } } }, { \"l\": \"ga\", \"t\": { \"Actions\": { \"v\": [\"Gníomhartha\"] } } }, { \"l\": \"gl\", \"t\": { \"Actions\": { \"v\": [\"Accións\"] } } }, { \"l\": \"he\", \"t\": { \"Actions\": { \"v\": [\"פעולות\"] } } }, { \"l\": \"hu\", \"t\": { \"Actions\": { \"v\": [\"Műveletek\"] } } }, { \"l\": \"id\", \"t\": { \"Actions\": { \"v\": [\"Tindakan\"] } } }, { \"l\": \"is\", \"t\": { \"Actions\": { \"v\": [\"Aðgerðir\"] } } }, { \"l\": \"it\", \"t\": { \"Actions\": { \"v\": [\"Azioni\"] } } }, { \"l\": \"ja\", \"t\": { \"Actions\": { \"v\": [\"操作\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Actions\": { \"v\": [\"操作\"] } } }, { \"l\": \"ko\", \"t\": { \"Actions\": { \"v\": [\"동작\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"Actions\": { \"v\": [\"Veiksmai\"] } } }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Actions\": { \"v\": [\"Акции\"] } } }, { \"l\": \"my\", \"t\": { \"Actions\": { \"v\": [\"လုပ်ဆောင်ချက်များ\"] } } }, { \"l\": \"nb\", \"t\": { \"Actions\": { \"v\": [\"Handlinger\"] } } }, { \"l\": \"nl\", \"t\": { \"Actions\": { \"v\": [\"Acties\"] } } }, { \"l\": \"oc\", \"t\": { \"Actions\": { \"v\": [\"Accions\"] } } }, { \"l\": \"pl\", \"t\": { \"Actions\": { \"v\": [\"Działania\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Actions\": { \"v\": [\"Ações\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Actions\": { \"v\": [\"Ações\"] } } }, { \"l\": \"ro\", \"t\": { \"Actions\": { \"v\": [\"Acțiuni\"] } } }, { \"l\": \"ru\", \"t\": { \"Actions\": { \"v\": [\"Действия \"] } } }, { \"l\": \"sk\", \"t\": { \"Actions\": { \"v\": [\"Akcie\"] } } }, { \"l\": \"sl\", \"t\": { \"Actions\": { \"v\": [\"Dejanja\"] } } }, { \"l\": \"sr\", \"t\": { \"Actions\": { \"v\": [\"Радње\"] } } }, { \"l\": \"sv\", \"t\": { \"Actions\": { \"v\": [\"Åtgärder\"] } } }, { \"l\": \"tr\", \"t\": { \"Actions\": { \"v\": [\"İşlemler\"] } } }, { \"l\": \"uk\", \"t\": { \"Actions\": { \"v\": [\"Дії\"] } } }, { \"l\": \"uz\", \"t\": { \"Actions\": { \"v\": [\"Harakatlar\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Actions\": { \"v\": [\"行为\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Actions\": { \"v\": [\"動作\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Actions\": { \"v\": [\"動作\"] } } }];\nconst t5 = [{ \"l\": \"ar\", \"t\": { \"Activities\": { \"v\": [\"سجل الأنشطة\"] }, \"Animals & Nature\": { \"v\": [\"الحيوانات والطبيعة\"] }, \"Custom\": { \"v\": [\"مُخصَّص\"] }, \"Dark skin tone\": { \"v\": [\"أسمر البُشرة\"] }, \"Emoji picker\": { \"v\": [\"لاقط الإيموجي\"] }, \"Flags\": { \"v\": [\"الأعلام\"] }, \"Food & Drink\": { \"v\": [\"الطعام والشراب\"] }, \"Frequently used\": { \"v\": [\"شائعة الاستعمال\"] }, \"Light skin tone\": { \"v\": [\"فاتح البُشرة\"] }, \"Medium dark skin tone\": { \"v\": [\"بشرة متوسطة الاسمرار\"] }, \"Medium light skin tone\": { \"v\": [\"بشرة متوسطة البياض\"] }, \"Medium skin tone\": { \"v\": [\"بشرة وسطية اللون\"] }, \"Neutral skin color\": { \"v\": [\"لون بُشرة طبيعي\"] }, \"Objects\": { \"v\": [\"أشياء\"] }, \"People & Body\": { \"v\": [\"أشخاص و أجسام\"] }, \"Pick an emoji\": { \"v\": [\"إختَر رمز إيموجي emoji\"] }, \"Search emoji\": { \"v\": [\"البحث عن إيموجي emoji\"] }, \"Search results\": { \"v\": [\"نتائج البحث\"] }, \"Selected\": { \"v\": [\"محدّدة\"] }, \"Skin tone\": { \"v\": [\"لون البُشرة\"] }, \"Smileys & Emotion\": { \"v\": [\"وجوهٌ ضاحكة و مشاعر\"] }, \"Symbols\": { \"v\": [\"رموز\"] }, \"Travel & Places\": { \"v\": [\"سفر و أماكن\"] } } }, { \"l\": \"ast\", \"t\": { \"Activities\": { \"v\": [\"Actividaes\"] }, \"Animals & Nature\": { \"v\": [\"Animales y natura\"] }, \"Custom\": { \"v\": [\"Personalizar\"] }, \"Dark skin tone\": { \"v\": [\"Tonu d'aspeutu escuru\"] }, \"Emoji picker\": { \"v\": [\"Selector de fustaxes\"] }, \"Flags\": { \"v\": [\"Banderes\"] }, \"Food & Drink\": { \"v\": [\"Cómida y bébora\"] }, \"Frequently used\": { \"v\": [\"D'usu frecuente\"] }, \"Light skin tone\": { \"v\": [\"Tonu d'aspeutu claru\"] }, \"Medium dark skin tone\": { \"v\": [\"Tonu d'aspeutu medio escuru\"] }, \"Medium light skin tone\": { \"v\": [\"Tonu d'aspeutu medio claru\"] }, \"Medium skin tone\": { \"v\": [\"Tonu d'aspeutu mediu\"] }, \"Neutral skin color\": { \"v\": [\"Color d'aspeutu neutral\"] }, \"Objects\": { \"v\": [\"Oxetos\"] }, \"People & Body\": { \"v\": [\"Persones y cuerpu\"] }, \"Pick an emoji\": { \"v\": [\"Escueyi un fustaxe\"] }, \"Search emoji\": { \"v\": [\"Buscar nos fustaxes\"] }, \"Search results\": { \"v\": [\"Resultaos de la busca\"] }, \"Selected\": { \"v\": [\"Na seleición\"] }, \"Skin tone\": { \"v\": [\"Tonu d'aspeutu\"] }, \"Smileys & Emotion\": { \"v\": [\"Sorrises y emociones\"] }, \"Symbols\": { \"v\": [\"Símbolos\"] }, \"Travel & Places\": { \"v\": [\"Viaxes y llugares\"] } } }, { \"l\": \"br\", \"t\": { \"Activities\": { \"v\": [\"Oberiantizoù\"] }, \"Animals & Nature\": { \"v\": [\"Loened & Natur\"] }, \"Custom\": { \"v\": [\"Personelañ\"] }, \"Flags\": { \"v\": [\"Bannieloù\"] }, \"Food & Drink\": { \"v\": [\"Boued & Evajoù\"] }, \"Frequently used\": { \"v\": [\"Implijet alies\"] }, \"Objects\": { \"v\": [\"Traoù\"] }, \"People & Body\": { \"v\": [\"Tud & Korf\"] }, \"Pick an emoji\": { \"v\": [\"Choaz un emoji\"] }, \"Search results\": { \"v\": [\"Disoc'hoù an enklask\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileyioù & Fromoù\"] }, \"Symbols\": { \"v\": [\"Arouezioù\"] }, \"Travel & Places\": { \"v\": [\"Beaj & Lec'hioù\"] } } }, { \"l\": \"ca\", \"t\": { \"Activities\": { \"v\": [\"Activitats\"] }, \"Animals & Nature\": { \"v\": [\"Animals i natura\"] }, \"Custom\": { \"v\": [\"Personalitzat\"] }, \"Flags\": { \"v\": [\"Marques\"] }, \"Food & Drink\": { \"v\": [\"Menjar i begudes\"] }, \"Frequently used\": { \"v\": [\"Utilitzats recentment\"] }, \"Objects\": { \"v\": [\"Objectes\"] }, \"People & Body\": { \"v\": [\"Persones i cos\"] }, \"Pick an emoji\": { \"v\": [\"Trieu un emoji\"] }, \"Search results\": { \"v\": [\"Resultats de cerca\"] }, \"Smileys & Emotion\": { \"v\": [\"Cares i emocions\"] }, \"Symbols\": { \"v\": [\"Símbols\"] }, \"Travel & Places\": { \"v\": [\"Viatges i llocs\"] } } }, { \"l\": \"cs\", \"t\": { \"Activities\": { \"v\": [\"Aktivity\"] }, \"Animals & Nature\": { \"v\": [\"Zvířata a příroda\"] }, \"Custom\": { \"v\": [\"Uživatelsky určené\"] }, \"Dark skin tone\": { \"v\": [\"Tmavý tělový tón\"] }, \"Emoji picker\": { \"v\": [\"Výběr emotikon\"] }, \"Flags\": { \"v\": [\"Příznaky\"] }, \"Food & Drink\": { \"v\": [\"Jídlo a pití\"] }, \"Frequently used\": { \"v\": [\"Často používané\"] }, \"Light skin tone\": { \"v\": [\"Světlý tělový tón\"] }, \"Medium dark skin tone\": { \"v\": [\"Středně tmavý tělový tón\"] }, \"Medium light skin tone\": { \"v\": [\"Středně světlý tělový tón\"] }, \"Medium skin tone\": { \"v\": [\"Střední tělový tón\"] }, \"Neutral skin color\": { \"v\": [\"Neutřální tělová barva\"] }, \"Objects\": { \"v\": [\"Objekty\"] }, \"People & Body\": { \"v\": [\"Lidé a tělo\"] }, \"Pick an emoji\": { \"v\": [\"Vybrat emoji\"] }, \"Search emoji\": { \"v\": [\"Hledat emoji\"] }, \"Search results\": { \"v\": [\"Výsledky hledání\"] }, \"Selected\": { \"v\": [\"Vybráno\"] }, \"Skin tone\": { \"v\": [\"Tělový tón\"] }, \"Smileys & Emotion\": { \"v\": [\"Úsměvy a emoce\"] }, \"Symbols\": { \"v\": [\"Symboly\"] }, \"Travel & Places\": { \"v\": [\"Cestování a místa\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Activities\": { \"v\": [\"Aktivity\"] }, \"Animals & Nature\": { \"v\": [\"Zvířata a příroda\"] }, \"Custom\": { \"v\": [\"Uživatelsky určené\"] }, \"Dark skin tone\": { \"v\": [\"Tmavý tělový tón\"] }, \"Emoji picker\": { \"v\": [\"Výběr emotikon\"] }, \"Flags\": { \"v\": [\"Příznaky\"] }, \"Food & Drink\": { \"v\": [\"Jídlo a pití\"] }, \"Frequently used\": { \"v\": [\"Často používané\"] }, \"Light skin tone\": { \"v\": [\"Světlý tělový tón\"] }, \"Medium dark skin tone\": { \"v\": [\"Středně tmavý tělový tón\"] }, \"Medium light skin tone\": { \"v\": [\"Středně světlý tělový tón\"] }, \"Medium skin tone\": { \"v\": [\"Střední tělový tón\"] }, \"Neutral skin color\": { \"v\": [\"Neutřální tělová barva\"] }, \"Objects\": { \"v\": [\"Objekty\"] }, \"People & Body\": { \"v\": [\"Lidé a tělo\"] }, \"Pick an emoji\": { \"v\": [\"Vybrat emoji\"] }, \"Search emoji\": { \"v\": [\"Hledat emoji\"] }, \"Search results\": { \"v\": [\"Výsledky hledání\"] }, \"Selected\": { \"v\": [\"Vybráno\"] }, \"Skin tone\": { \"v\": [\"Tělový tón\"] }, \"Smileys & Emotion\": { \"v\": [\"Úsměvy a emoce\"] }, \"Symbols\": { \"v\": [\"Symboly\"] }, \"Travel & Places\": { \"v\": [\"Cestování a místa\"] } } }, { \"l\": \"da\", \"t\": { \"Activities\": { \"v\": [\"Aktiviteter\"] }, \"Animals & Nature\": { \"v\": [\"Dyr & Natur\"] }, \"Custom\": { \"v\": [\"Brugerdefineret\"] }, \"Dark skin tone\": { \"v\": [\"Mørk skin tone\"] }, \"Emoji picker\": { \"v\": [\"Emoji vælger\"] }, \"Flags\": { \"v\": [\"Flag\"] }, \"Food & Drink\": { \"v\": [\"Mad & Drikke\"] }, \"Frequently used\": { \"v\": [\"Ofte brugt\"] }, \"Light skin tone\": { \"v\": [\"Lys skin tone\"] }, \"Medium dark skin tone\": { \"v\": [\"Medium mørk skin tone\"] }, \"Medium light skin tone\": { \"v\": [\"Medium lys skin tone\"] }, \"Medium skin tone\": { \"v\": [\"Medium skin tone\"] }, \"Neutral skin color\": { \"v\": [\"Neutral skin color\"] }, \"Objects\": { \"v\": [\"Objekter\"] }, \"People & Body\": { \"v\": [\"Mennesker & Menneskekroppen\"] }, \"Pick an emoji\": { \"v\": [\"Vælg en emoji\"] }, \"Search emoji\": { \"v\": [\"Søg emoji\"] }, \"Search results\": { \"v\": [\"Søgeresultater\"] }, \"Selected\": { \"v\": [\"Valgt\"] }, \"Skin tone\": { \"v\": [\"Skin tone\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileys & Emotion\"] }, \"Symbols\": { \"v\": [\"Symboler\"] }, \"Travel & Places\": { \"v\": [\"Rejser & Rejsemål\"] } } }, { \"l\": \"de\", \"t\": { \"Activities\": { \"v\": [\"Aktivitäten\"] }, \"Animals & Nature\": { \"v\": [\"Tiere & Natur\"] }, \"Custom\": { \"v\": [\"Benutzerdefiniert\"] }, \"Dark skin tone\": { \"v\": [\"Dunkler Hautfarbton\"] }, \"Emoji picker\": { \"v\": [\"Emoji-Auswahl\"] }, \"Flags\": { \"v\": [\"Flaggen\"] }, \"Food & Drink\": { \"v\": [\"Essen & Trinken\"] }, \"Frequently used\": { \"v\": [\"Häufig verwendet\"] }, \"Light skin tone\": { \"v\": [\"Heller Hautfarbton\"] }, \"Medium dark skin tone\": { \"v\": [\"Mitteldunkler Hautfarbton\"] }, \"Medium light skin tone\": { \"v\": [\"Mittelheller Hautfarbton\"] }, \"Medium skin tone\": { \"v\": [\"Mittlerer Hautfarbton\"] }, \"Neutral skin color\": { \"v\": [\"Neutraler Hautfarbton\"] }, \"Objects\": { \"v\": [\"Objekte\"] }, \"People & Body\": { \"v\": [\"Menschen & Körper\"] }, \"Pick an emoji\": { \"v\": [\"Ein Emoji auswählen\"] }, \"Search emoji\": { \"v\": [\"Emoji suchen\"] }, \"Search results\": { \"v\": [\"Suchergebnisse\"] }, \"Selected\": { \"v\": [\"Ausgewählt\"] }, \"Skin tone\": { \"v\": [\"Hautfarbton\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileys & Emotionen\"] }, \"Symbols\": { \"v\": [\"Symbole\"] }, \"Travel & Places\": { \"v\": [\"Reisen & Orte\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Activities\": { \"v\": [\"Aktivitäten\"] }, \"Animals & Nature\": { \"v\": [\"Tiere & Natur\"] }, \"Custom\": { \"v\": [\"Benutzerdefiniert\"] }, \"Dark skin tone\": { \"v\": [\"Dunkler Hautfarbton\"] }, \"Emoji picker\": { \"v\": [\"Emoji-Auswahl\"] }, \"Flags\": { \"v\": [\"Flaggen\"] }, \"Food & Drink\": { \"v\": [\"Essen & Trinken\"] }, \"Frequently used\": { \"v\": [\"Häufig verwendet\"] }, \"Light skin tone\": { \"v\": [\"Heller Hautfarbton\"] }, \"Medium dark skin tone\": { \"v\": [\"Mitteldunkler Hautfarbton\"] }, \"Medium light skin tone\": { \"v\": [\"Mittelheller Hautfarbton\"] }, \"Medium skin tone\": { \"v\": [\"Mittlerer Hautfarbton\"] }, \"Neutral skin color\": { \"v\": [\"Neutraler Hautfarbton\"] }, \"Objects\": { \"v\": [\"Objekte\"] }, \"People & Body\": { \"v\": [\"Menschen & Körper\"] }, \"Pick an emoji\": { \"v\": [\"Ein Emoji auswählen\"] }, \"Search emoji\": { \"v\": [\"Emoji suchen\"] }, \"Search results\": { \"v\": [\"Suchergebnisse\"] }, \"Selected\": { \"v\": [\"Ausgewählt\"] }, \"Skin tone\": { \"v\": [\"Hautfarbton\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileys & Emotionen\"] }, \"Symbols\": { \"v\": [\"Symbole\"] }, \"Travel & Places\": { \"v\": [\"Reisen & Orte\"] } } }, { \"l\": \"el\", \"t\": { \"Activities\": { \"v\": [\"Δραστηριότητες\"] }, \"Animals & Nature\": { \"v\": [\"Ζώα & Φύση\"] }, \"Custom\": { \"v\": [\"Προσαρμογή\"] }, \"Dark skin tone\": { \"v\": [\"Σκούρο θέμα\"] }, \"Emoji picker\": { \"v\": [\"Επιλογέας emoji\"] }, \"Flags\": { \"v\": [\"Σημαίες\"] }, \"Food & Drink\": { \"v\": [\"Φαγητό & Ποτό\"] }, \"Frequently used\": { \"v\": [\"Συχνά χρησιμοποιούμενο\"] }, \"Light skin tone\": { \"v\": [\"Ανοιχτό θέμα\"] }, \"Medium dark skin tone\": { \"v\": [\"Μέτριο σκούρο θέμα\"] }, \"Medium light skin tone\": { \"v\": [\"Μέτριο ανοιχτό θέμα\"] }, \"Medium skin tone\": { \"v\": [\"Μέτριος τόνος θέματος\"] }, \"Neutral skin color\": { \"v\": [\"Ουδέτερο χρώμα θέματος\"] }, \"Objects\": { \"v\": [\"Αντικείμενα\"] }, \"People & Body\": { \"v\": [\"Άνθρωποι & Σώμα\"] }, \"Pick an emoji\": { \"v\": [\"Επιλέξτε ένα emoji\"] }, \"Search emoji\": { \"v\": [\"Αναζήτηση emoji\"] }, \"Search results\": { \"v\": [\"Αποτελέσματα αναζήτησης\"] }, \"Selected\": { \"v\": [\"Επιλεγμένο\"] }, \"Skin tone\": { \"v\": [\"Τόνος δέρματος\"] }, \"Smileys & Emotion\": { \"v\": [\"Φατσούλες & Συναίσθημα\"] }, \"Symbols\": { \"v\": [\"Σύμβολα\"] }, \"Travel & Places\": { \"v\": [\"Ταξίδια & Τοποθεσίες\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Activities\": { \"v\": [\"Activities\"] }, \"Animals & Nature\": { \"v\": [\"Animals & Nature\"] }, \"Custom\": { \"v\": [\"Custom\"] }, \"Dark skin tone\": { \"v\": [\"Dark skin tone\"] }, \"Emoji picker\": { \"v\": [\"Emoji picker\"] }, \"Flags\": { \"v\": [\"Flags\"] }, \"Food & Drink\": { \"v\": [\"Food & Drink\"] }, \"Frequently used\": { \"v\": [\"Frequently used\"] }, \"Light skin tone\": { \"v\": [\"Light skin tone\"] }, \"Medium dark skin tone\": { \"v\": [\"Medium dark skin tone\"] }, \"Medium light skin tone\": { \"v\": [\"Medium light skin tone\"] }, \"Medium skin tone\": { \"v\": [\"Medium skin tone\"] }, \"Neutral skin color\": { \"v\": [\"Neutral skin colour\"] }, \"Objects\": { \"v\": [\"Objects\"] }, \"People & Body\": { \"v\": [\"People & Body\"] }, \"Pick an emoji\": { \"v\": [\"Pick an emoji\"] }, \"Search emoji\": { \"v\": [\"Search emoji\"] }, \"Search results\": { \"v\": [\"Search results\"] }, \"Selected\": { \"v\": [\"Selected\"] }, \"Skin tone\": { \"v\": [\"Skin tone\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileys & Emotion\"] }, \"Symbols\": { \"v\": [\"Symbols\"] }, \"Travel & Places\": { \"v\": [\"Travel & Places\"] } } }, { \"l\": \"eo\", \"t\": { \"Activities\": { \"v\": [\"Aktiveco\"] }, \"Animals & Nature\": { \"v\": [\"Bestoj & Naturo\"] }, \"Custom\": { \"v\": [\"Propra\"] }, \"Flags\": { \"v\": [\"Flagoj\"] }, \"Food & Drink\": { \"v\": [\"Manĝaĵo & Trinkaĵo\"] }, \"Frequently used\": { \"v\": [\"Ofte uzataj\"] }, \"Objects\": { \"v\": [\"Objektoj\"] }, \"People & Body\": { \"v\": [\"Homoj & Korpo\"] }, \"Pick an emoji\": { \"v\": [\"Elekti emoĝion \"] }, \"Search results\": { \"v\": [\"Serĉrezultoj\"] }, \"Smileys & Emotion\": { \"v\": [\"Ridoj kaj Emocioj\"] }, \"Symbols\": { \"v\": [\"Signoj\"] }, \"Travel & Places\": { \"v\": [\"Vojaĵoj & Lokoj\"] } } }, { \"l\": \"es\", \"t\": { \"Activities\": { \"v\": [\"Actividades\"] }, \"Animals & Nature\": { \"v\": [\"Animales y naturaleza\"] }, \"Custom\": { \"v\": [\"Personalizado\"] }, \"Dark skin tone\": { \"v\": [\"Tono de piel obscuro\"] }, \"Emoji picker\": { \"v\": [\"Selector de emojis\"] }, \"Flags\": { \"v\": [\"Banderas\"] }, \"Food & Drink\": { \"v\": [\"Comida y bebida\"] }, \"Frequently used\": { \"v\": [\"Usado con frecuencia\"] }, \"Light skin tone\": { \"v\": [\"Tono de piel claro\"] }, \"Medium dark skin tone\": { \"v\": [\"Tono de piel medio oscuro\"] }, \"Medium light skin tone\": { \"v\": [\"Tono de piel medio claro\"] }, \"Medium skin tone\": { \"v\": [\"Tono de piel medio\"] }, \"Neutral skin color\": { \"v\": [\"Color de piel neutral\"] }, \"Objects\": { \"v\": [\"Objetos\"] }, \"People & Body\": { \"v\": [\"Personas y Cuerpo\"] }, \"Pick an emoji\": { \"v\": [\"Elegir un emoji\"] }, \"Search emoji\": { \"v\": [\"Buscar emoji\"] }, \"Search results\": { \"v\": [\"Resultados de la búsqueda\"] }, \"Selected\": { \"v\": [\"Seleccionado\"] }, \"Skin tone\": { \"v\": [\"Tono de piel\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileys y emoticonos\"] }, \"Symbols\": { \"v\": [\"Símbolos\"] }, \"Travel & Places\": { \"v\": [\"Viajes y lugares\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Activities\": { \"v\": [\"Actividades\"] }, \"Animals & Nature\": { \"v\": [\"Animales y Naturaleza\"] }, \"Custom\": { \"v\": [\"Personalizado\"] }, \"Dark skin tone\": { \"v\": [\"Tono de piel oscuro\"] }, \"Emoji picker\": { \"v\": [\"Selector de emojis\"] }, \"Flags\": { \"v\": [\"Marcas\"] }, \"Food & Drink\": { \"v\": [\"Comida y Bebida\"] }, \"Frequently used\": { \"v\": [\"Usados frecuentemente\"] }, \"Light skin tone\": { \"v\": [\"Tono de piel claro\"] }, \"Medium dark skin tone\": { \"v\": [\"Tono de piel medio oscuro\"] }, \"Medium light skin tone\": { \"v\": [\"Tono de piel medio claro\"] }, \"Medium skin tone\": { \"v\": [\"Tono de piel medio\"] }, \"Neutral skin color\": { \"v\": [\"Color de piel neutral\"] }, \"Objects\": { \"v\": [\"Objetos\"] }, \"People & Body\": { \"v\": [\"Personas y Cuerpo\"] }, \"Pick an emoji\": { \"v\": [\"Elija un emoji\"] }, \"Search emoji\": { \"v\": [\"Buscar emoji\"] }, \"Search results\": { \"v\": [\"Resultados de la búsqueda\"] }, \"Selected\": { \"v\": [\"Seleccionado\"] }, \"Skin tone\": { \"v\": [\"Tono de piel\"] }, \"Smileys & Emotion\": { \"v\": [\"Caritas y Emociones\"] }, \"Symbols\": { \"v\": [\"Símbolos\"] }, \"Travel & Places\": { \"v\": [\"Viajes y Lugares\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Activities\": { \"v\": [\"Actividades\"] }, \"Animals & Nature\": { \"v\": [\"Animales y Naturaleza\"] }, \"Custom\": { \"v\": [\"Personalizado\"] }, \"Flags\": { \"v\": [\"Marcas\"] }, \"Food & Drink\": { \"v\": [\"Comida y Bebida\"] }, \"Frequently used\": { \"v\": [\"Frecuentemente utilizado\"] }, \"Objects\": { \"v\": [\"Objetos\"] }, \"People & Body\": { \"v\": [\"Personas y Cuerpo\"] }, \"Pick an emoji\": { \"v\": [\"Seleccionar un emoji\"] }, \"Search emoji\": { \"v\": [\"Buscar emoji\"] }, \"Search results\": { \"v\": [\"Resultados de búsqueda\"] }, \"Smileys & Emotion\": { \"v\": [\"Caritas y Emociones\"] }, \"Symbols\": { \"v\": [\"Símbolos\"] }, \"Travel & Places\": { \"v\": [\"Viajes y Lugares\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Activities\": { \"v\": [\"Actividades\"] }, \"Animals & Nature\": { \"v\": [\"Animales y naturaleza\"] }, \"Custom\": { \"v\": [\"Personalizado\"] }, \"Dark skin tone\": { \"v\": [\"Tono de piel oscuro\"] }, \"Emoji picker\": { \"v\": [\"Selector de emojis\"] }, \"Flags\": { \"v\": [\"Banderas\"] }, \"Food & Drink\": { \"v\": [\"Comida y Bebida\"] }, \"Frequently used\": { \"v\": [\"Usado frecuentemente\"] }, \"Light skin tone\": { \"v\": [\"Tono de piel claro\"] }, \"Medium dark skin tone\": { \"v\": [\"Tono de piel medio oscuro\"] }, \"Medium light skin tone\": { \"v\": [\"Tono de piel medio claro\"] }, \"Medium skin tone\": { \"v\": [\"Tono de piel medio\"] }, \"Neutral skin color\": { \"v\": [\"Color de piel neutral\"] }, \"Objects\": { \"v\": [\"Objetos\"] }, \"People & Body\": { \"v\": [\"Personas y cuerpos\"] }, \"Pick an emoji\": { \"v\": [\"Seleccionar un emoji\"] }, \"Search emoji\": { \"v\": [\"Buscar emoji\"] }, \"Search results\": { \"v\": [\"Resultados de la búsqueda\"] }, \"Selected\": { \"v\": [\"Seleccionado\"] }, \"Skin tone\": { \"v\": [\"Tono de piel\"] }, \"Smileys & Emotion\": { \"v\": [\"Caritas y Emociones\"] }, \"Symbols\": { \"v\": [\"Símbolos\"] }, \"Travel & Places\": { \"v\": [\"Viajes y lugares\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Activities\": { \"v\": [\"Tegevused\"] }, \"Animals & Nature\": { \"v\": [\"Loomad ja loodus\"] }, \"Custom\": { \"v\": [\"Kohanda\"] }, \"Dark skin tone\": { \"v\": [\"Kesta tume toon\"] }, \"Emoji picker\": { \"v\": [\"Emojide valija\"] }, \"Flags\": { \"v\": [\"Lipud\"] }, \"Food & Drink\": { \"v\": [\"Söök ja jook\"] }, \"Frequently used\": { \"v\": [\"Sageli kasutatud\"] }, \"Light skin tone\": { \"v\": [\"Kesta hele toon\"] }, \"Medium dark skin tone\": { \"v\": [\"Kesta keskmiselt tume toon\"] }, \"Medium light skin tone\": { \"v\": [\"Kesta keskmiselt hele toon\"] }, \"Medium skin tone\": { \"v\": [\"Kesta keskmine toon\"] }, \"Neutral skin color\": { \"v\": [\"Kesta neutraalne toon\"] }, \"Objects\": { \"v\": [\"Objektid\"] }, \"People & Body\": { \"v\": [\"Inimesed ja keha\"] }, \"Pick an emoji\": { \"v\": [\"Vali emoji\"] }, \"Search emoji\": { \"v\": [\"Otsi emojit\"] }, \"Search results\": { \"v\": [\"Otsi tulemustest\"] }, \"Selected\": { \"v\": [\"Valitud\"] }, \"Skin tone\": { \"v\": [\"Kesta toon\"] }, \"Smileys & Emotion\": { \"v\": [\"Smailid ja emotsioonid\"] }, \"Symbols\": { \"v\": [\"Sümbolid\"] }, \"Travel & Places\": { \"v\": [\"Reisimine ja kohad\"] } } }, { \"l\": \"eu\", \"t\": { \"Activities\": { \"v\": [\"Jarduerak\"] }, \"Animals & Nature\": { \"v\": [\"Animaliak eta Natura\"] }, \"Custom\": { \"v\": [\"Pertsonalizatua\"] }, \"Flags\": { \"v\": [\"Banderak\"] }, \"Food & Drink\": { \"v\": [\"Janaria eta edariak\"] }, \"Frequently used\": { \"v\": [\"Askotan erabilia\"] }, \"Objects\": { \"v\": [\"Objektuak\"] }, \"People & Body\": { \"v\": [\"Jendea eta gorputza\"] }, \"Pick an emoji\": { \"v\": [\"Hautatu emoji bat\"] }, \"Search emoji\": { \"v\": [\"Bilatu emojiak\"] }, \"Search results\": { \"v\": [\"Bilaketa emaitzak\"] }, \"Selected\": { \"v\": [\"Hautatuta\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileyak eta emozioa\"] }, \"Symbols\": { \"v\": [\"Sinboloak\"] }, \"Travel & Places\": { \"v\": [\"Bidaiak eta lekuak\"] } } }, { \"l\": \"fa\", \"t\": { \"Activities\": { \"v\": [\"فعالیت‌ها\"] }, \"Animals & Nature\": { \"v\": [\"حیوانات و طبیعت\"] }, \"Custom\": { \"v\": [\"سفارشی\"] }, \"Dark skin tone\": { \"v\": [\"رنگ پوسته تیره\"] }, \"Emoji picker\": { \"v\": [\"انتخاب‌گر شکلک\"] }, \"Flags\": { \"v\": [\"پرچم‌ها\"] }, \"Food & Drink\": { \"v\": [\"غذا و نوشیدنی\"] }, \"Frequently used\": { \"v\": [\"پرکاربرد\"] }, \"Light skin tone\": { \"v\": [\"رنگ پوسته روشن\"] }, \"Medium dark skin tone\": { \"v\": [\"رنگ پوسته تیره متوسط\"] }, \"Medium light skin tone\": { \"v\": [\"رنگ پوسته روشن متوسط\"] }, \"Medium skin tone\": { \"v\": [\"رنگ پوسته متوسط\"] }, \"Neutral skin color\": { \"v\": [\"رنگ پوسته خنثی\"] }, \"Objects\": { \"v\": [\"اشیاء\"] }, \"People & Body\": { \"v\": [\"مردم و بدن\"] }, \"Pick an emoji\": { \"v\": [\"انتخاب شکلک\"] }, \"Search emoji\": { \"v\": [\"جستجوی شکلک\"] }, \"Search results\": { \"v\": [\"نتایج جستجو\"] }, \"Selected\": { \"v\": [\"انتخاب شده\"] }, \"Skin tone\": { \"v\": [\"رنگ پوسته\"] }, \"Smileys & Emotion\": { \"v\": [\"شکلک‌ها و احساسات\"] }, \"Symbols\": { \"v\": [\"نمادها\"] }, \"Travel & Places\": { \"v\": [\"سفر و مکان‌ها\"] } } }, { \"l\": \"fi\", \"t\": { \"Activities\": { \"v\": [\"Aktiviteetit\"] }, \"Animals & Nature\": { \"v\": [\"Eläimet & luonto\"] }, \"Custom\": { \"v\": [\"Mukautettu\"] }, \"Dark skin tone\": { \"v\": [\"Tumma ihonväri\"] }, \"Emoji picker\": { \"v\": [\"Emojivalitsin\"] }, \"Flags\": { \"v\": [\"Liput\"] }, \"Food & Drink\": { \"v\": [\"Ruoka & juoma\"] }, \"Frequently used\": { \"v\": [\"Usein käytetyt\"] }, \"Light skin tone\": { \"v\": [\"Vaalea ihonväri\"] }, \"Medium dark skin tone\": { \"v\": [\"Keskitumma ihonväri\"] }, \"Medium light skin tone\": { \"v\": [\"Keskivaalea ihonväri\"] }, \"Medium skin tone\": { \"v\": [\"Keskimääräinen ihonväri\"] }, \"Neutral skin color\": { \"v\": [\"Neutraali ihonväri\"] }, \"Objects\": { \"v\": [\"Esineet & asiat\"] }, \"People & Body\": { \"v\": [\"Ihmiset & keho\"] }, \"Pick an emoji\": { \"v\": [\"Valitse emoji\"] }, \"Search emoji\": { \"v\": [\"Etsi emojia\"] }, \"Search results\": { \"v\": [\"Hakutulokset\"] }, \"Selected\": { \"v\": [\"Valittu\"] }, \"Skin tone\": { \"v\": [\"Ihonväri\"] }, \"Smileys & Emotion\": { \"v\": [\"Hymiöt & tunteet\"] }, \"Symbols\": { \"v\": [\"Symbolit\"] }, \"Travel & Places\": { \"v\": [\"Matkustus & kohteet\"] } } }, { \"l\": \"fr\", \"t\": { \"Activities\": { \"v\": [\"Activités\"] }, \"Animals & Nature\": { \"v\": [\"Animaux & Nature\"] }, \"Custom\": { \"v\": [\"Personnalisé\"] }, \"Dark skin tone\": { \"v\": [\"Teint foncé\"] }, \"Emoji picker\": { \"v\": [\"Sélecteur d'émojis\"] }, \"Flags\": { \"v\": [\"Drapeaux\"] }, \"Food & Drink\": { \"v\": [\"Nourriture & Boissons\"] }, \"Frequently used\": { \"v\": [\"Utilisés fréquemment\"] }, \"Light skin tone\": { \"v\": [\"Teint clair\"] }, \"Medium dark skin tone\": { \"v\": [\"Teint moyennement foncé\"] }, \"Medium light skin tone\": { \"v\": [\"Teint moyen clair\"] }, \"Medium skin tone\": { \"v\": [\"Teint moyen\"] }, \"Neutral skin color\": { \"v\": [\"Teint neutre\"] }, \"Objects\": { \"v\": [\"Objets\"] }, \"People & Body\": { \"v\": [\"Personnes & Corps\"] }, \"Pick an emoji\": { \"v\": [\"Choisissez un émoji\"] }, \"Search emoji\": { \"v\": [\"Rechercher un emoji\"] }, \"Search results\": { \"v\": [\"Résultats de recherche\"] }, \"Selected\": { \"v\": [\"sélectionné\"] }, \"Skin tone\": { \"v\": [\"Teint de peau\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileys & Émotions\"] }, \"Symbols\": { \"v\": [\"Symboles\"] }, \"Travel & Places\": { \"v\": [\"Voyage & Lieux\"] } } }, { \"l\": \"ga\", \"t\": { \"Activities\": { \"v\": [\"Gníomhaíochtaí\"] }, \"Animals & Nature\": { \"v\": [\"Ainmhithe & Dúlra\"] }, \"Custom\": { \"v\": [\"Saincheaptha\"] }, \"Dark skin tone\": { \"v\": [\"Ton craiceann dorcha\"] }, \"Emoji picker\": { \"v\": [\"Roghnóir Emoji\"] }, \"Flags\": { \"v\": [\"Bratacha\"] }, \"Food & Drink\": { \"v\": [\"Bia & Deoch\"] }, \"Frequently used\": { \"v\": [\"Úsáidtear go minic\"] }, \"Light skin tone\": { \"v\": [\"Ton craiceann éadrom\"] }, \"Medium dark skin tone\": { \"v\": [\"Ton craiceann meánach dorcha\"] }, \"Medium light skin tone\": { \"v\": [\"Ton craiceann meánach éadrom\"] }, \"Medium skin tone\": { \"v\": [\"Ton craiceann meánach\"] }, \"Neutral skin color\": { \"v\": [\"Dath craiceann neodrach\"] }, \"Objects\": { \"v\": [\"Réada\"] }, \"People & Body\": { \"v\": [\"Daoine & Corp\"] }, \"Pick an emoji\": { \"v\": [\"Roghnaigh emoji\"] }, \"Search emoji\": { \"v\": [\"Cuardaigh emoji\"] }, \"Search results\": { \"v\": [\"Torthaí cuardaigh\"] }, \"Selected\": { \"v\": [\"Roghnaithe\"] }, \"Skin tone\": { \"v\": [\"Ton craicinn\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileys & Mothúchán\"] }, \"Symbols\": { \"v\": [\"Siombailí\"] }, \"Travel & Places\": { \"v\": [\"Taisteal & Áiteanna\"] } } }, { \"l\": \"gl\", \"t\": { \"Activities\": { \"v\": [\"Actividades\"] }, \"Animals & Nature\": { \"v\": [\"Animais e natureza\"] }, \"Custom\": { \"v\": [\"Personalizado\"] }, \"Dark skin tone\": { \"v\": [\"Ton de pel escuro\"] }, \"Emoji picker\": { \"v\": [\"Selector de «emojis»\"] }, \"Flags\": { \"v\": [\"Bandeiras\"] }, \"Food & Drink\": { \"v\": [\"Comida e bebida\"] }, \"Frequently used\": { \"v\": [\"Usado con frecuencia\"] }, \"Light skin tone\": { \"v\": [\"Ton de pel claro\"] }, \"Medium dark skin tone\": { \"v\": [\"Ton de pel medio escuro\"] }, \"Medium light skin tone\": { \"v\": [\"Ton de pel medio claro\"] }, \"Medium skin tone\": { \"v\": [\"Ton de pel medio\"] }, \"Neutral skin color\": { \"v\": [\"Cor de pel neutra\"] }, \"Objects\": { \"v\": [\"Obxectos\"] }, \"People & Body\": { \"v\": [\"Persoas e corpo\"] }, \"Pick an emoji\": { \"v\": [\"Escolla un «emoji»\"] }, \"Search emoji\": { \"v\": [\"Buscar «emoji»\"] }, \"Search results\": { \"v\": [\"Resultados da busca\"] }, \"Selected\": { \"v\": [\"Seleccionado\"] }, \"Skin tone\": { \"v\": [\"Ton de pel\"] }, \"Smileys & Emotion\": { \"v\": [\"Sorrisos e emocións\"] }, \"Symbols\": { \"v\": [\"Símbolos\"] }, \"Travel & Places\": { \"v\": [\"Viaxes e lugares\"] } } }, { \"l\": \"he\", \"t\": { \"Activities\": { \"v\": [\"פעילויות\"] }, \"Animals & Nature\": { \"v\": [\"חיות וטבע\"] }, \"Custom\": { \"v\": [\"בהתאמה אישית\"] }, \"Flags\": { \"v\": [\"דגלים\"] }, \"Food & Drink\": { \"v\": [\"מזון ומשקאות\"] }, \"Frequently used\": { \"v\": [\"בשימוש תדיר\"] }, \"Objects\": { \"v\": [\"חפצים\"] }, \"People & Body\": { \"v\": [\"אנשים וגוף\"] }, \"Pick an emoji\": { \"v\": [\"נא לבחור אמוג׳י\"] }, \"Search emoji\": { \"v\": [\"חיפוש אמוג׳י\"] }, \"Search results\": { \"v\": [\"תוצאות חיפוש\"] }, \"Smileys & Emotion\": { \"v\": [\"חייכנים ורגשונים\"] }, \"Symbols\": { \"v\": [\"סמלים\"] }, \"Travel & Places\": { \"v\": [\"טיולים ומקומות\"] } } }, { \"l\": \"hu\", \"t\": { \"Activities\": { \"v\": [\"Tevékenységek\"] }, \"Animals & Nature\": { \"v\": [\"Állatok és természet\"] }, \"Custom\": { \"v\": [\"Egyéni\"] }, \"Flags\": { \"v\": [\"Zászlók\"] }, \"Food & Drink\": { \"v\": [\"Étel és ital\"] }, \"Frequently used\": { \"v\": [\"Gyakran használt\"] }, \"Objects\": { \"v\": [\"Tárgyak\"] }, \"People & Body\": { \"v\": [\"Emberek és test\"] }, \"Pick an emoji\": { \"v\": [\"Válasszon egy emodzsit\"] }, \"Search results\": { \"v\": [\"Találatok\"] }, \"Smileys & Emotion\": { \"v\": [\"Mosolyok és érzelmek\"] }, \"Symbols\": { \"v\": [\"Szimbólumok\"] }, \"Travel & Places\": { \"v\": [\"Utazás és helyek\"] } } }, { \"l\": \"id\", \"t\": { \"Activities\": { \"v\": [\"Aktivitas\"] }, \"Animals & Nature\": { \"v\": [\"Satwa dan Alam\"] }, \"Custom\": { \"v\": [\"Khusus\"] }, \"Flags\": { \"v\": [\"Tanda\"] }, \"Food & Drink\": { \"v\": [\"Makanan dan Minuman\"] }, \"Frequently used\": { \"v\": [\"Sering digunakan\"] }, \"Objects\": { \"v\": [\"Objek\"] }, \"People & Body\": { \"v\": [\"Orang & Badan\"] }, \"Pick an emoji\": { \"v\": [\"Pilih emoji\"] }, \"Search emoji\": { \"v\": [\"Cari emoji\"] }, \"Search results\": { \"v\": [\"Hasil pencarian\"] }, \"Selected\": { \"v\": [\"Dipilih\"] }, \"Smileys & Emotion\": { \"v\": [\"Senyuman & Perasaan\"] }, \"Symbols\": { \"v\": [\"Simbol\"] }, \"Travel & Places\": { \"v\": [\"Perjalanan & Tempat\"] } } }, { \"l\": \"is\", \"t\": { \"Activities\": { \"v\": [\"Aðgerðir\"] }, \"Animals & Nature\": { \"v\": [\"Dýr og náttúra\"] }, \"Custom\": { \"v\": [\"Sérsniðið\"] }, \"Dark skin tone\": { \"v\": [\"Dökkur húðlitur\"] }, \"Emoji picker\": { \"v\": [\"Emoji-táknmyndaval\"] }, \"Flags\": { \"v\": [\"Flögg\"] }, \"Food & Drink\": { \"v\": [\"Matur og drykkur\"] }, \"Frequently used\": { \"v\": [\"Oftast notað\"] }, \"Light skin tone\": { \"v\": [\"Ljós húðlitur\"] }, \"Medium dark skin tone\": { \"v\": [\"Meðaldökkur húðlitur\"] }, \"Medium light skin tone\": { \"v\": [\"Meðalljós húðlitur\"] }, \"Medium skin tone\": { \"v\": [\"Meðaltónn húðar\"] }, \"Neutral skin color\": { \"v\": [\"Hlutlaus húðlitur\"] }, \"Objects\": { \"v\": [\"Hlutir\"] }, \"People & Body\": { \"v\": [\"Fólk og líkami\"] }, \"Pick an emoji\": { \"v\": [\"Veldu tjáningartákn\"] }, \"Search emoji\": { \"v\": [\"Leita að tjáningartákni\"] }, \"Search results\": { \"v\": [\"Leitarniðurstöður\"] }, \"Selected\": { \"v\": [\"Valið\"] }, \"Skin tone\": { \"v\": [\"Húðlitur\"] }, \"Smileys & Emotion\": { \"v\": [\"Broskallar og tilfinningar\"] }, \"Symbols\": { \"v\": [\"Tákn\"] }, \"Travel & Places\": { \"v\": [\"Staðir og ferðalög\"] } } }, { \"l\": \"it\", \"t\": { \"Activities\": { \"v\": [\"Attività\"] }, \"Animals & Nature\": { \"v\": [\"Animali e natura\"] }, \"Custom\": { \"v\": [\"Personalizzato\"] }, \"Flags\": { \"v\": [\"Bandiere\"] }, \"Food & Drink\": { \"v\": [\"Cibo e bevande\"] }, \"Frequently used\": { \"v\": [\"Usati di frequente\"] }, \"Objects\": { \"v\": [\"Oggetti\"] }, \"People & Body\": { \"v\": [\"Persone e corpo\"] }, \"Pick an emoji\": { \"v\": [\"Scegli un emoji\"] }, \"Search emoji\": { \"v\": [\"Ricerca emoji\"] }, \"Search results\": { \"v\": [\"Risultati di ricerca\"] }, \"Selected\": { \"v\": [\"Selezionato\"] }, \"Smileys & Emotion\": { \"v\": [\"Faccine ed emozioni\"] }, \"Symbols\": { \"v\": [\"Simboli\"] }, \"Travel & Places\": { \"v\": [\"Viaggi e luoghi\"] } } }, { \"l\": \"ja\", \"t\": { \"Activities\": { \"v\": [\"アクティビティ\"] }, \"Animals & Nature\": { \"v\": [\"動物と自然\"] }, \"Custom\": { \"v\": [\"カスタム\"] }, \"Dark skin tone\": { \"v\": [\"暗い肌のトーン\"] }, \"Emoji picker\": { \"v\": [\"絵文字ピッカー\"] }, \"Flags\": { \"v\": [\"国旗\"] }, \"Food & Drink\": { \"v\": [\"食べ物と飲み物\"] }, \"Frequently used\": { \"v\": [\"よく使うもの\"] }, \"Light skin tone\": { \"v\": [\"明るい肌のトーン\"] }, \"Medium dark skin tone\": { \"v\": [\"やや暗い肌のトーン\"] }, \"Medium light skin tone\": { \"v\": [\"やや明るい肌のトーン\"] }, \"Medium skin tone\": { \"v\": [\"中間の肌のトーン\"] }, \"Neutral skin color\": { \"v\": [\"ニュートラルな肌の色\"] }, \"Objects\": { \"v\": [\"物\"] }, \"People & Body\": { \"v\": [\"様々な人と体の部位\"] }, \"Pick an emoji\": { \"v\": [\"絵文字を選択\"] }, \"Search emoji\": { \"v\": [\"絵文字を検索\"] }, \"Search results\": { \"v\": [\"検索結果\"] }, \"Selected\": { \"v\": [\"選択済み\"] }, \"Skin tone\": { \"v\": [\"肌のトーン\"] }, \"Smileys & Emotion\": { \"v\": [\"感情表現\"] }, \"Symbols\": { \"v\": [\"記号\"] }, \"Travel & Places\": { \"v\": [\"旅行と場所\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Activities\": { \"v\": [\"アクティビティ\"] }, \"Animals & Nature\": { \"v\": [\"動物と自然\"] }, \"Custom\": { \"v\": [\"カスタム\"] }, \"Dark skin tone\": { \"v\": [\"暗い肌のトーン\"] }, \"Emoji picker\": { \"v\": [\"絵文字ピッカー\"] }, \"Flags\": { \"v\": [\"国旗\"] }, \"Food & Drink\": { \"v\": [\"食べ物と飲み物\"] }, \"Frequently used\": { \"v\": [\"よく使うもの\"] }, \"Light skin tone\": { \"v\": [\"明るい肌のトーン\"] }, \"Medium dark skin tone\": { \"v\": [\"やや暗い肌のトーン\"] }, \"Medium light skin tone\": { \"v\": [\"やや明るい肌のトーン\"] }, \"Medium skin tone\": { \"v\": [\"中間の肌のトーン\"] }, \"Neutral skin color\": { \"v\": [\"ニュートラルな肌の色\"] }, \"Objects\": { \"v\": [\"物\"] }, \"People & Body\": { \"v\": [\"様々な人と体の部位\"] }, \"Pick an emoji\": { \"v\": [\"絵文字を選択\"] }, \"Search emoji\": { \"v\": [\"絵文字を検索\"] }, \"Search results\": { \"v\": [\"検索結果\"] }, \"Selected\": { \"v\": [\"選択済み\"] }, \"Skin tone\": { \"v\": [\"肌のトーン\"] }, \"Smileys & Emotion\": { \"v\": [\"感情表現\"] }, \"Symbols\": { \"v\": [\"記号\"] }, \"Travel & Places\": { \"v\": [\"旅行と場所\"] } } }, { \"l\": \"ko\", \"t\": { \"Activities\": { \"v\": [\"활동\"] }, \"Animals & Nature\": { \"v\": [\"동물 & 자연\"] }, \"Custom\": { \"v\": [\"맞춤 설정\"] }, \"Dark skin tone\": { \"v\": [\"어두운 피부 톤\"] }, \"Emoji picker\": { \"v\": [\"이모지 선택기\"] }, \"Flags\": { \"v\": [\"깃발\"] }, \"Food & Drink\": { \"v\": [\"음식 & 음료\"] }, \"Frequently used\": { \"v\": [\"자주 쓰임\"] }, \"Light skin tone\": { \"v\": [\"밝은 피부 톤\"] }, \"Medium dark skin tone\": { \"v\": [\"약간 어두운 피부 톤\"] }, \"Medium light skin tone\": { \"v\": [\"약간 밝은 피부 톤\"] }, \"Medium skin tone\": { \"v\": [\"중간 피부 톤\"] }, \"Neutral skin color\": { \"v\": [\"중성적 피부 톤\"] }, \"Objects\": { \"v\": [\"물체\"] }, \"People & Body\": { \"v\": [\"사람 & 신체\"] }, \"Pick an emoji\": { \"v\": [\"이모지 선택\"] }, \"Search emoji\": { \"v\": [\"이모지 검색\"] }, \"Search results\": { \"v\": [\"검색 결과\"] }, \"Selected\": { \"v\": [\"선택됨\"] }, \"Skin tone\": { \"v\": [\"피부 톤\"] }, \"Smileys & Emotion\": { \"v\": [\"스마일리 & 이모티콘\"] }, \"Symbols\": { \"v\": [\"기호\"] }, \"Travel & Places\": { \"v\": [\"여행 & 장소\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"Activities\": { \"v\": [\"Veiklos\"] }, \"Animals & Nature\": { \"v\": [\"Gyvūnai ir gamta\"] }, \"Custom\": { \"v\": [\"Tinkinti\"] }, \"Flags\": { \"v\": [\"Vėliavos\"] }, \"Food & Drink\": { \"v\": [\"Maistas ir gėrimai\"] }, \"Frequently used\": { \"v\": [\"Dažniausiai naudoti\"] }, \"Objects\": { \"v\": [\"Objektai\"] }, \"People & Body\": { \"v\": [\"Žmonės ir kūnas\"] }, \"Pick an emoji\": { \"v\": [\"Pasirinkti jaustuką\"] }, \"Search results\": { \"v\": [\"Paieškos rezultatai\"] }, \"Smileys & Emotion\": { \"v\": [\"Šypsenos ir emocijos\"] }, \"Symbols\": { \"v\": [\"Simboliai\"] }, \"Travel & Places\": { \"v\": [\"Kelionės ir vietos\"] } } }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Activities\": { \"v\": [\"Активности\"] }, \"Animals & Nature\": { \"v\": [\"Животни & Природа\"] }, \"Custom\": { \"v\": [\"Прилагодени\"] }, \"Flags\": { \"v\": [\"Знамиња\"] }, \"Food & Drink\": { \"v\": [\"Храна & Пијалоци\"] }, \"Frequently used\": { \"v\": [\"Најчесто користени\"] }, \"Objects\": { \"v\": [\"Објекти\"] }, \"People & Body\": { \"v\": [\"Луѓе & Тело\"] }, \"Pick an emoji\": { \"v\": [\"Избери емотикон\"] }, \"Search results\": { \"v\": [\"Резултати од барувањето\"] }, \"Smileys & Emotion\": { \"v\": [\"Смешковци & Емотикони\"] }, \"Symbols\": { \"v\": [\"Симболи\"] }, \"Travel & Places\": { \"v\": [\"Патувања & Места\"] } } }, { \"l\": \"my\", \"t\": { \"Activities\": { \"v\": [\"ပြုလုပ်ဆောင်တာများ\"] }, \"Animals & Nature\": { \"v\": [\"တိရစ္ဆာန်များနှင့် သဘာဝ\"] }, \"Custom\": { \"v\": [\"အလိုကျချိန်ညှိမှု\"] }, \"Flags\": { \"v\": [\"အလံများ\"] }, \"Food & Drink\": { \"v\": [\"အစားအသောက်\"] }, \"Frequently used\": { \"v\": [\"မကြာခဏအသုံးပြုသော\"] }, \"Objects\": { \"v\": [\"အရာဝတ္ထုများ\"] }, \"People & Body\": { \"v\": [\"လူပုဂ္ဂိုလ်များနှင့် ခန္ဓာကိုယ်\"] }, \"Pick an emoji\": { \"v\": [\"အီမိုဂျီရွေးရန်\"] }, \"Search results\": { \"v\": [\"ရှာဖွေမှု ရလဒ်များ\"] }, \"Smileys & Emotion\": { \"v\": [\"စမိုင်လီများနှင့် အီမိုရှင်း\"] }, \"Symbols\": { \"v\": [\"သင်္ကေတများ\"] }, \"Travel & Places\": { \"v\": [\"ခရီးသွားလာခြင်းနှင့် နေရာများ\"] } } }, { \"l\": \"nb\", \"t\": { \"Activities\": { \"v\": [\"Aktiviteter\"] }, \"Animals & Nature\": { \"v\": [\"Dyr og natur\"] }, \"Custom\": { \"v\": [\"Tilpasset\"] }, \"Dark skin tone\": { \"v\": [\"Mørk hudtone\"] }, \"Emoji picker\": { \"v\": [\"Emoji-velger\"] }, \"Flags\": { \"v\": [\"Flagg\"] }, \"Food & Drink\": { \"v\": [\"Mat og drikke\"] }, \"Frequently used\": { \"v\": [\"Ofte brukt\"] }, \"Light skin tone\": { \"v\": [\"Lys hudtone\"] }, \"Medium dark skin tone\": { \"v\": [\"Middels mørk hudtone\"] }, \"Medium light skin tone\": { \"v\": [\"Middels lys hudtone\"] }, \"Medium skin tone\": { \"v\": [\"Middels hudtone\"] }, \"Neutral skin color\": { \"v\": [\"Nøytral hudfarge\"] }, \"Objects\": { \"v\": [\"Objekter\"] }, \"People & Body\": { \"v\": [\"Mennesker og kropp\"] }, \"Pick an emoji\": { \"v\": [\"Velg en emoji\"] }, \"Search emoji\": { \"v\": [\"Søk emoji\"] }, \"Search results\": { \"v\": [\"Søkeresultater\"] }, \"Selected\": { \"v\": [\"Valgt\"] }, \"Skin tone\": { \"v\": [\"Hudtone\"] }, \"Smileys & Emotion\": { \"v\": [\"Smilefjes og følelser\"] }, \"Symbols\": { \"v\": [\"Symboler\"] }, \"Travel & Places\": { \"v\": [\"Reise og steder\"] } } }, { \"l\": \"nl\", \"t\": { \"Activities\": { \"v\": [\"Activiteiten\"] }, \"Animals & Nature\": { \"v\": [\"Dieren & Natuur\"] }, \"Custom\": { \"v\": [\"Aangepast\"] }, \"Dark skin tone\": { \"v\": [\"Donkere tint\"] }, \"Emoji picker\": { \"v\": [\"Emoji-kiezer\"] }, \"Flags\": { \"v\": [\"Vlaggen\"] }, \"Food & Drink\": { \"v\": [\"Eten & Drinken\"] }, \"Frequently used\": { \"v\": [\"Vaak gebruikt\"] }, \"Light skin tone\": { \"v\": [\"Lichte tint\"] }, \"Medium dark skin tone\": { \"v\": [\"Gemiddelde donkere tint\"] }, \"Medium light skin tone\": { \"v\": [\"Gemiddeld lichte tint\"] }, \"Medium skin tone\": { \"v\": [\"Gemiddelde tint\"] }, \"Neutral skin color\": { \"v\": [\"Neutrale tint\"] }, \"Objects\": { \"v\": [\"Objecten\"] }, \"People & Body\": { \"v\": [\"Mensen & Lichaam\"] }, \"Pick an emoji\": { \"v\": [\"Kies een emoji\"] }, \"Search emoji\": { \"v\": [\"Zoek emoji\"] }, \"Search results\": { \"v\": [\"Zoekresultaten\"] }, \"Selected\": { \"v\": [\"Geselecteerd\"] }, \"Skin tone\": { \"v\": [\"Tint van de schil\"] }, \"Smileys & Emotion\": { \"v\": [\"Smileys & Emotie\"] }, \"Symbols\": { \"v\": [\"Symbolen\"] }, \"Travel & Places\": { \"v\": [\"Reizen & Plaatsen\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Activities\": { \"v\": [\"Aktywność\"] }, \"Animals & Nature\": { \"v\": [\"Zwierzęta i natura\"] }, \"Custom\": { \"v\": [\"Zwyczajne\"] }, \"Dark skin tone\": { \"v\": [\"Ciemna tonacja\"] }, \"Emoji picker\": { \"v\": [\"Wybierz Emoji\"] }, \"Flags\": { \"v\": [\"Flagi\"] }, \"Food & Drink\": { \"v\": [\"Jedzenie i picie\"] }, \"Frequently used\": { \"v\": [\"Często używane\"] }, \"Light skin tone\": { \"v\": [\"Jasny odcień skóry\"] }, \"Medium dark skin tone\": { \"v\": [\"Średnio ciemny odcień skóry\"] }, \"Medium light skin tone\": { \"v\": [\"Średnio jasny odcień skóry\"] }, \"Medium skin tone\": { \"v\": [\"Średni odcień skóry\"] }, \"Neutral skin color\": { \"v\": [\"Neutralny kolor skróry\"] }, \"Objects\": { \"v\": [\"Obiekty\"] }, \"People & Body\": { \"v\": [\"Ludzie i ciało\"] }, \"Pick an emoji\": { \"v\": [\"Wybierz emoji\"] }, \"Search emoji\": { \"v\": [\"Szukaj emoji\"] }, \"Search results\": { \"v\": [\"Wyniki wyszukiwania\"] }, \"Selected\": { \"v\": [\"Wybrane\"] }, \"Skin tone\": { \"v\": [\"Kolor skóry\"] }, \"Smileys & Emotion\": { \"v\": [\"Buźki i emotikony\"] }, \"Symbols\": { \"v\": [\"Symbole\"] }, \"Travel & Places\": { \"v\": [\"Podróże i miejsca\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Activities\": { \"v\": [\"Atividades\"] }, \"Animals & Nature\": { \"v\": [\"Animais & Natureza\"] }, \"Custom\": { \"v\": [\"Personalizado\"] }, \"Dark skin tone\": { \"v\": [\"Tom de pele escuro\"] }, \"Emoji picker\": { \"v\": [\"Seletor de emoji\"] }, \"Flags\": { \"v\": [\"Bandeiras\"] }, \"Food & Drink\": { \"v\": [\"Comida & Bebida\"] }, \"Frequently used\": { \"v\": [\"Mais usados\"] }, \"Light skin tone\": { \"v\": [\"Tome de pele claro\"] }, \"Medium dark skin tone\": { \"v\": [\"Tom de pele meio escuro\"] }, \"Medium light skin tone\": { \"v\": [\"Tom de pele meio claro\"] }, \"Medium skin tone\": { \"v\": [\"Tom de pele médio\"] }, \"Neutral skin color\": { \"v\": [\"Tom de pele neutro\"] }, \"Objects\": { \"v\": [\"Objetos\"] }, \"People & Body\": { \"v\": [\"Pessoas & Corpo\"] }, \"Pick an emoji\": { \"v\": [\"Escolha um emoji\"] }, \"Search emoji\": { \"v\": [\"Pesquisar emoji\"] }, \"Search results\": { \"v\": [\"Resultados da pesquisa\"] }, \"Selected\": { \"v\": [\"Selecionado\"] }, \"Skin tone\": { \"v\": [\"Tom de pele\"] }, \"Smileys & Emotion\": { \"v\": [\"Smiles & Emoções\"] }, \"Symbols\": { \"v\": [\"Símbolos\"] }, \"Travel & Places\": { \"v\": [\"Viagem & Lugares\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Activities\": { \"v\": [\"Atividades\"] }, \"Animals & Nature\": { \"v\": [\"Animais e Natureza\"] }, \"Custom\": { \"v\": [\"Personalizado\"] }, \"Dark skin tone\": { \"v\": [\"Tom de pele escuro\"] }, \"Emoji picker\": { \"v\": [\"seletor de emoji\"] }, \"Flags\": { \"v\": [\"Bandeiras\"] }, \"Food & Drink\": { \"v\": [\"Comida e Bebida\"] }, \"Frequently used\": { \"v\": [\"Mais utilizados\"] }, \"Light skin tone\": { \"v\": [\"Tom de pele claro\"] }, \"Medium dark skin tone\": { \"v\": [\"Tom de pele escuro médio\"] }, \"Medium light skin tone\": { \"v\": [\"Tom de pele claro médio\"] }, \"Medium skin tone\": { \"v\": [\"Tom de pele médio\"] }, \"Neutral skin color\": { \"v\": [\"Cor de pele neutra\"] }, \"Objects\": { \"v\": [\"Objetos\"] }, \"People & Body\": { \"v\": [\"Pessoas e Corpo\"] }, \"Pick an emoji\": { \"v\": [\"Escolha um emoji\"] }, \"Search emoji\": { \"v\": [\"Pesquisar emoji\"] }, \"Search results\": { \"v\": [\"Resultados da pesquisa\"] }, \"Selected\": { \"v\": [\"Selecionado\"] }, \"Skin tone\": { \"v\": [\"Tom de pele\"] }, \"Smileys & Emotion\": { \"v\": [\"Sorrisos e Emoções\"] }, \"Symbols\": { \"v\": [\"Símbolos\"] }, \"Travel & Places\": { \"v\": [\"Viagens e Lugares\"] } } }, { \"l\": \"ro\", \"t\": { \"Activities\": { \"v\": [\"Activități\"] }, \"Animals & Nature\": { \"v\": [\"Animale și natură\"] }, \"Custom\": { \"v\": [\"Personalizat\"] }, \"Flags\": { \"v\": [\"Marcaje\"] }, \"Food & Drink\": { \"v\": [\"Alimente și băuturi\"] }, \"Frequently used\": { \"v\": [\"Utilizate frecvent\"] }, \"Objects\": { \"v\": [\"Obiecte\"] }, \"People & Body\": { \"v\": [\"Oameni și corp\"] }, \"Pick an emoji\": { \"v\": [\"Alege un emoji\"] }, \"Search emoji\": { \"v\": [\"Căutare emoji\"] }, \"Search results\": { \"v\": [\"Rezultatele căutării\"] }, \"Selected\": { \"v\": [\"Selectat\"] }, \"Smileys & Emotion\": { \"v\": [\"Zâmbete și emoții\"] }, \"Symbols\": { \"v\": [\"Simboluri\"] }, \"Travel & Places\": { \"v\": [\"Călătorii și locuri\"] } } }, { \"l\": \"ru\", \"t\": { \"Activities\": { \"v\": [\"События\"] }, \"Animals & Nature\": { \"v\": [\"Животные и природа \"] }, \"Custom\": { \"v\": [\"Пользовательское\"] }, \"Dark skin tone\": { \"v\": [\"Темный оттенок\"] }, \"Emoji picker\": { \"v\": [\"Подборщик эмодзи\"] }, \"Flags\": { \"v\": [\"Флаги\"] }, \"Food & Drink\": { \"v\": [\"Еда, напиток\"] }, \"Frequently used\": { \"v\": [\"Часто используемый\"] }, \"Light skin tone\": { \"v\": [\"Светлый оттенок\"] }, \"Medium dark skin tone\": { \"v\": [\"Средний темный оттенок\"] }, \"Medium light skin tone\": { \"v\": [\"Средний светлый оттенок\"] }, \"Medium skin tone\": { \"v\": [\"Средний оттенок\"] }, \"Neutral skin color\": { \"v\": [\"Нейтральный оттенок\"] }, \"Objects\": { \"v\": [\"Объекты\"] }, \"People & Body\": { \"v\": [\"Люди и тело\"] }, \"Pick an emoji\": { \"v\": [\"Выберите эмодзи\"] }, \"Search emoji\": { \"v\": [\"Поиск эмодзи\"] }, \"Search results\": { \"v\": [\"Результаты поиска\"] }, \"Selected\": { \"v\": [\"Выбрано\"] }, \"Skin tone\": { \"v\": [\"Оттенок скина\"] }, \"Smileys & Emotion\": { \"v\": [\"Смайлики и эмоции\"] }, \"Symbols\": { \"v\": [\"Символы\"] }, \"Travel & Places\": { \"v\": [\"Путешествия и места\"] } } }, { \"l\": \"sk\", \"t\": { \"Activities\": { \"v\": [\"Aktivity\"] }, \"Animals & Nature\": { \"v\": [\"Zvieratá a príroda\"] }, \"Custom\": { \"v\": [\"Vlastné\"] }, \"Dark skin tone\": { \"v\": [\"Tmavý vzhľad\"] }, \"Emoji picker\": { \"v\": [\"Výber emodži\"] }, \"Flags\": { \"v\": [\"Vlajky\"] }, \"Food & Drink\": { \"v\": [\"Jedlo a nápoje\"] }, \"Frequently used\": { \"v\": [\"Často používané\"] }, \"Light skin tone\": { \"v\": [\"Svetlý vzhľad\"] }, \"Medium dark skin tone\": { \"v\": [\"Stredne tmavý vzhľad\"] }, \"Medium light skin tone\": { \"v\": [\"Stredne svetlý vzhľad\"] }, \"Medium skin tone\": { \"v\": [\"Stredný vzhľad\"] }, \"Neutral skin color\": { \"v\": [\"Neutrálny vzhľad\"] }, \"Objects\": { \"v\": [\"Objekty\"] }, \"People & Body\": { \"v\": [\"Ľudia a telo\"] }, \"Pick an emoji\": { \"v\": [\"Vybrať emodži\"] }, \"Search emoji\": { \"v\": [\"Vyhľadať emoji\"] }, \"Search results\": { \"v\": [\"Výsledky vyhľadávania\"] }, \"Selected\": { \"v\": [\"Vybraný\"] }, \"Skin tone\": { \"v\": [\"Vzhľad\"] }, \"Smileys & Emotion\": { \"v\": [\"Smajlíky a emócie\"] }, \"Symbols\": { \"v\": [\"Symboly\"] }, \"Travel & Places\": { \"v\": [\"Cestovanie a miesta\"] } } }, { \"l\": \"sl\", \"t\": { \"Activities\": { \"v\": [\"Dejavnosti\"] }, \"Animals & Nature\": { \"v\": [\"Živali in Narava\"] }, \"Custom\": { \"v\": [\"Po meri\"] }, \"Flags\": { \"v\": [\"Zastavice\"] }, \"Food & Drink\": { \"v\": [\"Hrana in Pijača\"] }, \"Frequently used\": { \"v\": [\"Pogostost uporabe\"] }, \"Objects\": { \"v\": [\"Predmeti\"] }, \"People & Body\": { \"v\": [\"Ljudje in Telo\"] }, \"Pick an emoji\": { \"v\": [\"Izbor izrazne ikone\"] }, \"Search results\": { \"v\": [\"Zadetki iskanja\"] }, \"Smileys & Emotion\": { \"v\": [\"Izrazne ikone\"] }, \"Symbols\": { \"v\": [\"Simboli\"] }, \"Travel & Places\": { \"v\": [\"Potovanja in Kraji\"] } } }, { \"l\": \"sr\", \"t\": { \"Activities\": { \"v\": [\"Активности\"] }, \"Animals & Nature\": { \"v\": [\"Животиње и природа\"] }, \"Custom\": { \"v\": [\"Произвољно\"] }, \"Dark skin tone\": { \"v\": [\"Тамни тен коже\"] }, \"Emoji picker\": { \"v\": [\"Бирач емођија\"] }, \"Flags\": { \"v\": [\"Заставе\"] }, \"Food & Drink\": { \"v\": [\"Храна и пиће\"] }, \"Frequently used\": { \"v\": [\"Често коришћено\"] }, \"Light skin tone\": { \"v\": [\"Светли тен коже\"] }, \"Medium dark skin tone\": { \"v\": [\"Средње тамни тен коже\"] }, \"Medium light skin tone\": { \"v\": [\"Средње светли тен коже\"] }, \"Medium skin tone\": { \"v\": [\"Средњи тен коже\"] }, \"Neutral skin color\": { \"v\": [\"Неутрална боја коже\"] }, \"Objects\": { \"v\": [\"Предмети\"] }, \"People & Body\": { \"v\": [\"Људи и тело\"] }, \"Pick an emoji\": { \"v\": [\"Изаберите емођи\"] }, \"Search emoji\": { \"v\": [\"Претражи емођи\"] }, \"Search results\": { \"v\": [\"Резултати претраге\"] }, \"Selected\": { \"v\": [\"Изабрано\"] }, \"Skin tone\": { \"v\": [\"Тен коже\"] }, \"Smileys & Emotion\": { \"v\": [\"Смајлији и емоције\"] }, \"Symbols\": { \"v\": [\"Симболи\"] }, \"Travel & Places\": { \"v\": [\"Путовање и места\"] } } }, { \"l\": \"sv\", \"t\": { \"Activities\": { \"v\": [\"Aktiviteter\"] }, \"Animals & Nature\": { \"v\": [\"Djur & Natur\"] }, \"Custom\": { \"v\": [\"Anpassad\"] }, \"Dark skin tone\": { \"v\": [\"Mörk hudton\"] }, \"Emoji picker\": { \"v\": [\"Emoji-väljare\"] }, \"Flags\": { \"v\": [\"Flaggor\"] }, \"Food & Drink\": { \"v\": [\"Mat & Dryck\"] }, \"Frequently used\": { \"v\": [\"Används ofta\"] }, \"Light skin tone\": { \"v\": [\"Ljus hudton\"] }, \"Medium dark skin tone\": { \"v\": [\"Medium mörk hudton\"] }, \"Medium light skin tone\": { \"v\": [\"Medium ljus hudton\"] }, \"Medium skin tone\": { \"v\": [\"Medium hudton\"] }, \"Neutral skin color\": { \"v\": [\"Neutral hudfärg\"] }, \"Objects\": { \"v\": [\"Objekt\"] }, \"People & Body\": { \"v\": [\"Kropp & Själ\"] }, \"Pick an emoji\": { \"v\": [\"Välj en emoji\"] }, \"Search emoji\": { \"v\": [\"Sök emoji\"] }, \"Search results\": { \"v\": [\"Sökresultat\"] }, \"Selected\": { \"v\": [\"Vald\"] }, \"Skin tone\": { \"v\": [\"Hudton\"] }, \"Smileys & Emotion\": { \"v\": [\"Selfies & Känslor\"] }, \"Symbols\": { \"v\": [\"Symboler\"] }, \"Travel & Places\": { \"v\": [\"Resor & Sevärdigheter\"] } } }, { \"l\": \"tr\", \"t\": { \"Activities\": { \"v\": [\"Etkinlikler\"] }, \"Animals & Nature\": { \"v\": [\"Hayvanlar ve Doğa\"] }, \"Custom\": { \"v\": [\"Özel\"] }, \"Dark skin tone\": { \"v\": [\"Koyu deri rengi\"] }, \"Emoji picker\": { \"v\": [\"Emoji seçici\"] }, \"Flags\": { \"v\": [\"Bayraklar\"] }, \"Food & Drink\": { \"v\": [\"Yeme ve içme\"] }, \"Frequently used\": { \"v\": [\"Sık kullanılanlar\"] }, \"Light skin tone\": { \"v\": [\"Açık deri rengi\"] }, \"Medium dark skin tone\": { \"v\": [\"Orta koyu deri rengi\"] }, \"Medium light skin tone\": { \"v\": [\"Orta açık deri rengi\"] }, \"Medium skin tone\": { \"v\": [\"Orta deri rengi\"] }, \"Neutral skin color\": { \"v\": [\"Nötr deri rengi\"] }, \"Objects\": { \"v\": [\"Nesneler\"] }, \"People & Body\": { \"v\": [\"İnsanlar ve beden\"] }, \"Pick an emoji\": { \"v\": [\"Bir emoji seçin\"] }, \"Search emoji\": { \"v\": [\"Emoji ara\"] }, \"Search results\": { \"v\": [\"Arama sonuçları\"] }, \"Selected\": { \"v\": [\"Seçilmiş\"] }, \"Skin tone\": { \"v\": [\"Deri rengi\"] }, \"Smileys & Emotion\": { \"v\": [\"İfadeler ve duygular\"] }, \"Symbols\": { \"v\": [\"Simgeler\"] }, \"Travel & Places\": { \"v\": [\"Gezi ve yerler\"] } } }, { \"l\": \"uk\", \"t\": { \"Activities\": { \"v\": [\"Діяльність\"] }, \"Animals & Nature\": { \"v\": [\"Тварини та природа\"] }, \"Custom\": { \"v\": [\"Власне\"] }, \"Dark skin tone\": { \"v\": [\"Смаглявий\"] }, \"Emoji picker\": { \"v\": [\"Вибір емоційки\"] }, \"Flags\": { \"v\": [\"Прапори\"] }, \"Food & Drink\": { \"v\": [\"Їжа та напої\"] }, \"Frequently used\": { \"v\": [\"Найчастіші\"] }, \"Light skin tone\": { \"v\": [\"Світла шкіра\"] }, \"Medium dark skin tone\": { \"v\": [\"Какао\"] }, \"Medium light skin tone\": { \"v\": [\"Лате\"] }, \"Medium skin tone\": { \"v\": [\"Середній колір шкіри\"] }, \"Neutral skin color\": { \"v\": [\"Нейтральний колір шкіри\"] }, \"Objects\": { \"v\": [\"Об'єкти\"] }, \"People & Body\": { \"v\": [\"Люди та жести\"] }, \"Pick an emoji\": { \"v\": [\"Виберіть емоційку\"] }, \"Search emoji\": { \"v\": [\"Шукати емоційки\"] }, \"Search results\": { \"v\": [\"Результати пошуку\"] }, \"Selected\": { \"v\": [\"Вибрано\"] }, \"Skin tone\": { \"v\": [\"Колір шкіри\"] }, \"Smileys & Emotion\": { \"v\": [\"Смайли та емоції\"] }, \"Symbols\": { \"v\": [\"Символи\"] }, \"Travel & Places\": { \"v\": [\"Поїздки та місця\"] } } }, { \"l\": \"uz\", \"t\": { \"Activities\": { \"v\": [\"Faolliklar\"] }, \"Animals & Nature\": { \"v\": [\"Hayvonlar va Tabiat\"] }, \"Custom\": { \"v\": [\"Moslashtirilgan\"] }, \"Dark skin tone\": { \"v\": [\"Qora rangdagi qoplama\"] }, \"Emoji picker\": { \"v\": [\"Emoji tanlagich\"] }, \"Flags\": { \"v\": [\"Bayroqlar\"] }, \"Food & Drink\": { \"v\": [\"Oziq-ovqat va ichimliklar\"] }, \"Frequently used\": { \"v\": [\"Tez-tez ishlatiladi\"] }, \"Light skin tone\": { \"v\": [\"Yorug` rangdagi qoplama\"] }, \"Medium dark skin tone\": { \"v\": [\"O`rtacha qorong`u rangdagi qoplama\"] }, \"Medium light skin tone\": { \"v\": [\"O`rtacha yorug`lik rangdagi qoplama\"] }, \"Medium skin tone\": { \"v\": [\"O`rtacha rangdagi qoplama\"] }, \"Neutral skin color\": { \"v\": [\"Neytral rang\"] }, \"Objects\": { \"v\": [\"Obyekt\"] }, \"People & Body\": { \"v\": [\"Odamlar va Tana\"] }, \"Pick an emoji\": { \"v\": [\"Emojini tanlang\"] }, \"Search emoji\": { \"v\": [\"Emoji qidirish\"] }, \"Search results\": { \"v\": [\"Qidiruv natijalari\"] }, \"Selected\": { \"v\": [\"Tanlangan\"] }, \"Skin tone\": { \"v\": [\"Odatiy rangdagi qoplama\"] }, \"Smileys & Emotion\": { \"v\": [\"Smayllar va Hissiyotlar\"] }, \"Symbols\": { \"v\": [\"Belgilar\"] }, \"Travel & Places\": { \"v\": [\"Sayohat va Joylar\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Activities\": { \"v\": [\"活动\"] }, \"Animals & Nature\": { \"v\": [\"动物 & 自然\"] }, \"Custom\": { \"v\": [\"自定义\"] }, \"Dark skin tone\": { \"v\": [\"深色皮肤\"] }, \"Emoji picker\": { \"v\": [\"表情拾取器\"] }, \"Flags\": { \"v\": [\"旗帜\"] }, \"Food & Drink\": { \"v\": [\"食物 & 饮品\"] }, \"Frequently used\": { \"v\": [\"经常使用\"] }, \"Light skin tone\": { \"v\": [\"浅色皮肤\"] }, \"Medium dark skin tone\": { \"v\": [\"中等深色皮肤\"] }, \"Medium light skin tone\": { \"v\": [\"中等浅色皮肤\"] }, \"Medium skin tone\": { \"v\": [\"中等皮肤\"] }, \"Neutral skin color\": { \"v\": [\"中性皮肤颜色\"] }, \"Objects\": { \"v\": [\"物体\"] }, \"People & Body\": { \"v\": [\"人 & 身体\"] }, \"Pick an emoji\": { \"v\": [\"选择一个表情\"] }, \"Search emoji\": { \"v\": [\"搜索表情\"] }, \"Search results\": { \"v\": [\"搜索结果\"] }, \"Selected\": { \"v\": [\"选择\"] }, \"Skin tone\": { \"v\": [\"皮肤\"] }, \"Smileys & Emotion\": { \"v\": [\"笑脸 & 情感\"] }, \"Symbols\": { \"v\": [\"符号\"] }, \"Travel & Places\": { \"v\": [\"旅游 & 地点\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Activities\": { \"v\": [\"活動\"] }, \"Animals & Nature\": { \"v\": [\"動物與自然\"] }, \"Custom\": { \"v\": [\"自定義\"] }, \"Dark skin tone\": { \"v\": [\"深膚色\"] }, \"Emoji picker\": { \"v\": [\"表情符號選擇器\"] }, \"Flags\": { \"v\": [\"旗幟\"] }, \"Food & Drink\": { \"v\": [\"食物與飲料\"] }, \"Frequently used\": { \"v\": [\"經常使用\"] }, \"Light skin tone\": { \"v\": [\"淺膚色\"] }, \"Medium dark skin tone\": { \"v\": [\"中等深膚色\"] }, \"Medium light skin tone\": { \"v\": [\"中等淺膚色\"] }, \"Medium skin tone\": { \"v\": [\"中等膚色\"] }, \"Neutral skin color\": { \"v\": [\"中性色膚色\"] }, \"Objects\": { \"v\": [\"物件\"] }, \"People & Body\": { \"v\": [\"人物\"] }, \"Pick an emoji\": { \"v\": [\"選擇表情符號\"] }, \"Search emoji\": { \"v\": [\"搜尋表情符號\"] }, \"Search results\": { \"v\": [\"搜尋結果\"] }, \"Selected\": { \"v\": [\"已選\"] }, \"Skin tone\": { \"v\": [\"膚色\"] }, \"Smileys & Emotion\": { \"v\": [\"表情\"] }, \"Symbols\": { \"v\": [\"標誌\"] }, \"Travel & Places\": { \"v\": [\"旅遊與景點\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Activities\": { \"v\": [\"活動\"] }, \"Animals & Nature\": { \"v\": [\"動物與自然\"] }, \"Custom\": { \"v\": [\"自定義\"] }, \"Flags\": { \"v\": [\"旗幟\"] }, \"Food & Drink\": { \"v\": [\"食物與飲料\"] }, \"Frequently used\": { \"v\": [\"最近使用\"] }, \"Objects\": { \"v\": [\"物件\"] }, \"People & Body\": { \"v\": [\"人物\"] }, \"Pick an emoji\": { \"v\": [\"選擇表情符號\"] }, \"Search emoji\": { \"v\": [\"搜尋表情符號\"] }, \"Search results\": { \"v\": [\"搜尋結果\"] }, \"Selected\": { \"v\": [\"已選取\"] }, \"Smileys & Emotion\": { \"v\": [\"表情\"] }, \"Symbols\": { \"v\": [\"標誌\"] }, \"Travel & Places\": { \"v\": [\"旅遊與景點\"] } } }];\nconst t6 = [{ \"l\": \"ar\", \"t\": { \"Add to a project\": { \"v\": [\"أضف إلى مشروع\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"ربط عناصر بمشروع لتسهيل العثور عليها\"] }, \"Failed to add the item to the project\": { \"v\": [\"تعذر ربط عنصر بمشروع\"] }, \"Failed to create a project\": { \"v\": [\"تعذر إنشاء مشروع\"] }, \"Failed to rename the project\": { \"v\": [\"تعذّر تغيير اسم المشروع\"] }, \"Type to search for existing projects\": { \"v\": [\"أكتُب للبحث في المشاريع الموجودة\"] } } }, { \"l\": \"ast\", \"t\": {} }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Add to a project\": { \"v\": [\"Přidat do projektu\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Připojte položky k projektu, čímž budou snáze dohledatelné\"] }, \"Failed to add the item to the project\": { \"v\": [\"Položku se nepodařilo přidat do projektu\"] }, \"Failed to create a project\": { \"v\": [\"Projekt se nepodařilo vytvořit\"] }, \"Failed to rename the project\": { \"v\": [\"Projekt se nepodařilo přejmenovat\"] }, \"Type to search for existing projects\": { \"v\": [\"Psaním vyhledávejte existující projekty\"] } } }, { \"l\": \"cs-CZ\", \"t\": {} }, { \"l\": \"da\", \"t\": { \"Add to a project\": { \"v\": [\"Tilføj til et projekt\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Forbind elementer til et projekt for at gøre dem nemmere at finde\"] }, \"Failed to add the item to the project\": { \"v\": [\"Kunne ikke føje elementet til projektet\"] }, \"Failed to create a project\": { \"v\": [\"Kunne ikke oprette et projekt\"] }, \"Failed to rename the project\": { \"v\": [\"Projektet kunne ikke omdøbes\"] }, \"Type to search for existing projects\": { \"v\": [\"Skriv for at søge efter eksisterende projekter\"] } } }, { \"l\": \"de\", \"t\": { \"Add to a project\": { \"v\": [\"Einem Projekt hinzufügen\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Verbinde Elemente mit einem Projekt, um sie leichter zu finden\"] }, \"Failed to add the item to the project\": { \"v\": [\"Das Element konnte nicht zum Projekt hinzugefügt werden\"] }, \"Failed to create a project\": { \"v\": [\"Fehler beim Erstellen eines Projektes\"] }, \"Failed to rename the project\": { \"v\": [\"Fehler beim Umbenennen eines Projektes\"] }, \"Type to search for existing projects\": { \"v\": [\"Tippen, um nach vorhandenen Projekten zu suchen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Add to a project\": { \"v\": [\"Einem Projekt hinzufügen\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Verbinden Sie Elemente mit einem Projekt, um sie leichter zu finden\"] }, \"Failed to add the item to the project\": { \"v\": [\"Das Element konnte nicht zum Projekt hinzugefügt werden\"] }, \"Failed to create a project\": { \"v\": [\"Fehler beim Erstellen eines Projektes\"] }, \"Failed to rename the project\": { \"v\": [\"Fehler beim Umbenennen eines Projektes\"] }, \"Type to search for existing projects\": { \"v\": [\"Tippen, um nach vorhandenen Projekten zu suchen\"] } } }, { \"l\": \"el\", \"t\": { \"Add to a project\": { \"v\": [\"Προσθήκη σε ένα έργο\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Συνδέστε αντικείμενα σε ένα έργο για να τα βρίσκετε πιο εύκολα\"] }, \"Failed to add the item to the project\": { \"v\": [\"Αποτυχία προσθήκης του αντικειμένου στο έργο\"] }, \"Failed to create a project\": { \"v\": [\"Αποτυχία δημιουργίας έργου\"] }, \"Failed to rename the project\": { \"v\": [\"Αποτυχία μετονομασίας του έργου\"] }, \"Type to search for existing projects\": { \"v\": [\"Πληκτρολογήστε για αναζήτηση υπαρχόντων έργων\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Add to a project\": { \"v\": [\"Add to a project\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Connect items to a project to make them easier to find\"] }, \"Failed to add the item to the project\": { \"v\": [\"Failed to add the item to the project\"] }, \"Failed to create a project\": { \"v\": [\"Failed to create a project\"] }, \"Failed to rename the project\": { \"v\": [\"Failed to rename the project\"] }, \"Type to search for existing projects\": { \"v\": [\"Type to search for existing projects\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": {} }, { \"l\": \"es-AR\", \"t\": { \"Add to a project\": { \"v\": [\"Agregar a un proyecto\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Conecte items a un proyecto para hacerlos más fáciles de encontrar\"] }, \"Failed to add the item to the project\": { \"v\": [\"No se pudo agregar el elemento al proyecto\"] }, \"Failed to create a project\": { \"v\": [\"No se pudo crear un proyecto\"] }, \"Failed to rename the project\": { \"v\": [\"No se pudo renombrar el proyecto\"] }, \"Type to search for existing projects\": { \"v\": [\"Escriba para buscar proyectos existentes\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"Add to a project\": { \"v\": [\"Agregar a un proyecto\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Conecte elementos a un proyecto para hacerlos más fáciles de encontrar\"] }, \"Failed to add the item to the project\": { \"v\": [\"No se pudo agregar el elemento al proyecto\"] }, \"Failed to create a project\": { \"v\": [\"No se pudo crear el proyecto\"] }, \"Failed to rename the project\": { \"v\": [\"No se pudo renombrar el proyecto\"] }, \"Type to search for existing projects\": { \"v\": [\"Escriba para buscar proyectos existentes\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Add to a project\": { \"v\": [\"Lisa projekti\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Selleks, et objekte oleks lihtsam leida, seo nad projektiga\"] }, \"Failed to add the item to the project\": { \"v\": [\"Objekti lisamine projekti ei õnnestunud\"] }, \"Failed to create a project\": { \"v\": [\"Projekti loomine ei õnnestunud\"] }, \"Failed to rename the project\": { \"v\": [\"Projekti nime muutmine ei õnnestunud\"] }, \"Type to search for existing projects\": { \"v\": [\"Olemasolevate projektide otsimiseks kirjuta\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"Add to a project\": { \"v\": [\"افزودن به پروژه\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"برای پیدا کردن راحت‌تر، مواردی را به پروژه متصل کنید\"] }, \"Failed to add the item to the project\": { \"v\": [\"موارد به پروژه اضافه نشد\"] }, \"Failed to create a project\": { \"v\": [\"ایجاد پروژه نامؤفق بود\"] }, \"Failed to rename the project\": { \"v\": [\"تغییر نام پروژه انجام نشد\"] }, \"Type to search for existing projects\": { \"v\": [\"برای جستجوی پروژه‌های موجود تایپ کنید\"] } } }, { \"l\": \"fi\", \"t\": { \"Add to a project\": { \"v\": [\"Lisää projektiin\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Yhdistä kohteet projektiin, jotta ne olisivat helpompia löytää\"] }, \"Failed to add the item to the project\": { \"v\": [\"Kohteiden lisääminen projektiin epäonnistui\"] }, \"Failed to create a project\": { \"v\": [\"Projektin luominen epäonnistui\"] }, \"Failed to rename the project\": { \"v\": [\"Projektin nimeäminen epäonnistui\"] }, \"Type to search for existing projects\": { \"v\": [\"Kirjoita etsiäksesi olemassaolevia projekteja\"] } } }, { \"l\": \"fr\", \"t\": { \"Add to a project\": { \"v\": [\"Ajouter à un projet\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Connectez des éléments à un projet pour les retrouver plus facilement\"] }, \"Failed to add the item to the project\": { \"v\": [\"Impossible d'ajouter l'élément au projet\"] }, \"Failed to create a project\": { \"v\": [\"Impossible de créer un projet\"] }, \"Failed to rename the project\": { \"v\": [\"Impossible de renommer le projet\"] }, \"Type to search for existing projects\": { \"v\": [\"Tapez pour rechercher des projets existants\"] } } }, { \"l\": \"ga\", \"t\": { \"Add to a project\": { \"v\": [\"Cuir le tionscadal\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Ceangail míreanna le tionscadal chun iad a dhéanamh níos éasca iad a aimsiú\"] }, \"Failed to add the item to the project\": { \"v\": [\"Theip ar an mír a chur leis an tionscadal\"] }, \"Failed to create a project\": { \"v\": [\"Theip ar thionscadal a chruthú\"] }, \"Failed to rename the project\": { \"v\": [\"Theip ar an tionscadal a athainmniú\"] }, \"Type to search for existing projects\": { \"v\": [\"Clóscríobh chun tionscadail atá ann cheana a chuardach\"] } } }, { \"l\": \"gl\", \"t\": { \"Add to a project\": { \"v\": [\"Engadir a un proxecto\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Conectar elementos a un proxecto para facelos máis doados de atopar\"] }, \"Failed to add the item to the project\": { \"v\": [\"Produciuse un fallo ao engadir o elemento ao proxecto\"] }, \"Failed to create a project\": { \"v\": [\"Produciuse un fallo ao crear un proxecto\"] }, \"Failed to rename the project\": { \"v\": [\"Produciuse un fallo ao cambiarlle o nome ao proxecto\"] }, \"Type to search for existing projects\": { \"v\": [\"Escriba para buscar proxectos existentes\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": { \"Add to a project\": { \"v\": [\"Bæta við verkefni\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Tengdu atriði við verkefni til að gera einfaldara að finna þau\"] }, \"Failed to add the item to the project\": { \"v\": [\"Mistókst að bæta atriðinu í verkefnið\"] }, \"Failed to create a project\": { \"v\": [\"Mistókst að útbúa verkefni\"] }, \"Failed to rename the project\": { \"v\": [\"Mistókst að endurnefna verkefnið\"] }, \"Type to search for existing projects\": { \"v\": [\"Skrifaðu hér til að leita að fyrirliggjandi verkefnum\"] } } }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": { \"Add to a project\": { \"v\": [\"プロジェクトに追加する\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"項目をプロジェクトに接続して検索しやすくする\"] }, \"Failed to add the item to the project\": { \"v\": [\"プロジェクトへのアイテムの追加に失敗しました\"] }, \"Failed to create a project\": { \"v\": [\"プロジェクトの作成に失敗しました\"] }, \"Failed to rename the project\": { \"v\": [\"プロジェクトの名前変更に失敗しました\"] }, \"Type to search for existing projects\": { \"v\": [\"既存のプロジェクトを検索するために入力します\"] } } }, { \"l\": \"ja-JP\", \"t\": {} }, { \"l\": \"ko\", \"t\": { \"Add to a project\": { \"v\": [\"프로젝트에 추가\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"항목을 더 쉽게 찾을 수 있도록 프로젝트에 연결하세요.\"] }, \"Failed to add the item to the project\": { \"v\": [\"항목을 프로젝트에 추가하는 데 실패함\"] }, \"Failed to create a project\": { \"v\": [\"프로젝트를 만드는 데 실패함\"] }, \"Failed to rename the project\": { \"v\": [\"프로젝트의 이름을 바꾸는 데 실패함\"] }, \"Type to search for existing projects\": { \"v\": [\"입력하여 프로젝트를 검색\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Add to a project\": { \"v\": [\"Legge til i et prosjekt\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Koble elementer til et prosjekt for å gjøre det enklere å finne dem\"] }, \"Failed to add the item to the project\": { \"v\": [\"Kan ikke legge til elementet i prosjektet\"] }, \"Failed to create a project\": { \"v\": [\"Kan ikke opprette et prosjekt\"] }, \"Failed to rename the project\": { \"v\": [\"Kunne ikke gi prosjektet nytt navn\"] }, \"Type to search for existing projects\": { \"v\": [\"Skriv for å søke for eksisterende prosjekter\"] } } }, { \"l\": \"nl\", \"t\": { \"Add to a project\": { \"v\": [\"Toevoegen aan een project\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Vebind items aan een project zodat ze eenvoudiger te vinden zijn\"] }, \"Failed to add the item to the project\": { \"v\": [\"Toevoegen van item aan project mislukt\"] }, \"Failed to create a project\": { \"v\": [\"Aanmaken project mislukt\"] }, \"Failed to rename the project\": { \"v\": [\"Hernoemen project mislukt\"] }, \"Type to search for existing projects\": { \"v\": [\"Type om naar bestaande projecten te zoeken\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Add to a project\": { \"v\": [\"Dodaj do projektu\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Połącz elementy z projektem, aby ułatwić ich znalezienie\"] }, \"Failed to add the item to the project\": { \"v\": [\"Nie udało się dodać elementu do projektu\"] }, \"Failed to create a project\": { \"v\": [\"Nie udało się utworzyć projektu\"] }, \"Failed to rename the project\": { \"v\": [\"Nie udało się zmienić nazwy projektu\"] }, \"Type to search for existing projects\": { \"v\": [\"Wpisz, aby wyszukać istniejące projekty\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Add to a project\": { \"v\": [\"Adicionar a um projeto\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Conectar itens a um projeto para encontrá-los mais facilmente\"] }, \"Failed to add the item to the project\": { \"v\": [\"Falha ao adicionar itens ao projeto\"] }, \"Failed to create a project\": { \"v\": [\"Falha ao criar um projeto\"] }, \"Failed to rename the project\": { \"v\": [\"Falha ao renomear o projeto\"] }, \"Type to search for existing projects\": { \"v\": [\"Digite para pesquisar por projetos existentes\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Add to a project\": { \"v\": [\"Adicionar a um projeto\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Ligar itens a um projeto para serem mais facilmente encontrados\"] }, \"Failed to add the item to the project\": { \"v\": [\"Não foi possível adicionar item ao projeto\"] }, \"Failed to create a project\": { \"v\": [\"Não foi possível criar um projeto\"] }, \"Failed to rename the project\": { \"v\": [\"Não foi possível alterar o nome do projeto\"] }, \"Type to search for existing projects\": { \"v\": [\"Digite para procurar projetos existentes\"] } } }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": { \"Add to a project\": { \"v\": [\"Добавить в проект\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Подключайте элементы к проекту, чтобы их было легче найти\"] }, \"Failed to add the item to the project\": { \"v\": [\"Не удалось добавить элемент в проект\"] }, \"Failed to create a project\": { \"v\": [\"Не удалось создать проект\"] }, \"Failed to rename the project\": { \"v\": [\"Не удалось переименовать проект\"] }, \"Type to search for existing projects\": { \"v\": [\"Введите для поиска существующих проектов\"] } } }, { \"l\": \"sk\", \"t\": { \"Add to a project\": { \"v\": [\"Pridať do projektu\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Pridať položky do projektu pre jednoduchšie vyhľadávanie\"] }, \"Failed to add the item to the project\": { \"v\": [\"Nepodarilo sa pridať položku do projektu\"] }, \"Failed to create a project\": { \"v\": [\"Nepodarilo sa vytvoriť projekt\"] }, \"Failed to rename the project\": { \"v\": [\"Nepodarilo sa premenovať projekt\"] }, \"Type to search for existing projects\": { \"v\": [\"Začnite písať pre vyhľadávanie v existujúcich projektoch\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Add to a project\": { \"v\": [\"Додај у пројекат\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Повезује ставке у пројекат како би се лакше пронашле\"] }, \"Failed to add the item to the project\": { \"v\": [\"Није успело додавање ставке у пројекат\"] }, \"Failed to create a project\": { \"v\": [\"Није успело креирање пројекта\"] }, \"Failed to rename the project\": { \"v\": [\"Није успела промена имена пројекта\"] }, \"Type to search for existing projects\": { \"v\": [\"Куцајте да претражите постојеће пројекте\"] } } }, { \"l\": \"sv\", \"t\": { \"Add to a project\": { \"v\": [\"Lägg till i ett projekt\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Anslut objekt till ett projekt för att göra dem lättare att hitta\"] }, \"Failed to add the item to the project\": { \"v\": [\"Det gick inte att lägga till objektet i projektet\"] }, \"Failed to create a project\": { \"v\": [\"Det gick inte att skapa ett projekt\"] }, \"Failed to rename the project\": { \"v\": [\"Kunde inte byta namn på projektet\"] }, \"Type to search for existing projects\": { \"v\": [\"Skriv för att söka efter befintliga projekt\"] } } }, { \"l\": \"tr\", \"t\": { \"Add to a project\": { \"v\": [\"Bir projeye ekle\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Ögeleri daha kolay bulmak için bir proje ile ilişkilendirin\"] }, \"Failed to add the item to the project\": { \"v\": [\"Öge projeye eklenemedi\"] }, \"Failed to create a project\": { \"v\": [\"Bir proje oluşturulamadı\"] }, \"Failed to rename the project\": { \"v\": [\"Proje yeniden adlandırılamadı\"] }, \"Type to search for existing projects\": { \"v\": [\"Var olan projeleri aramak için yazmaya başlayın\"] } } }, { \"l\": \"uk\", \"t\": { \"Add to a project\": { \"v\": [\"Додати др проєкту\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Приєднайте ресурси до проєкту для швидшого пошуку\"] }, \"Failed to add the item to the project\": { \"v\": [\"Не вдалося приєднати ресурс до проєкту\"] }, \"Failed to create a project\": { \"v\": [\"Не вдалося створити проєкт\"] }, \"Failed to rename the project\": { \"v\": [\"Не вдалося перейменувати проєкт\"] }, \"Type to search for existing projects\": { \"v\": [\"Почніть вводити, щоб знайти проєкт\"] } } }, { \"l\": \"uz\", \"t\": { \"Add to a project\": { \"v\": [\"Loyihaga qo'shish\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"Elementlarni topishni osonlashtirish uchun ularni loyihaga ulang\"] }, \"Failed to add the item to the project\": { \"v\": [\"Ob'ektni loyihaga qo'shib bo'lmadi\"] }, \"Failed to create a project\": { \"v\": [\"Loyiha yaratib bo‘lmadi\"] }, \"Failed to rename the project\": { \"v\": [\"Loyiha nomini o‘zgartirib bo‘lmadi\"] }, \"Type to search for existing projects\": { \"v\": [\"Mavjud loyihalarni qidirish uchun kiriting\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Add to a project\": { \"v\": [\"添加至一个项目\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"将条目连接至一个项目以易于查找\"] }, \"Failed to add the item to the project\": { \"v\": [\"添加条目至项目失败\"] }, \"Failed to create a project\": { \"v\": [\"创建项目失败\"] }, \"Failed to rename the project\": { \"v\": [\"重命名项目失败\"] }, \"Type to search for existing projects\": { \"v\": [\"输入以搜索现存项目\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Add to a project\": { \"v\": [\"添加到方案中\"] }, \"Connect items to a project to make them easier to find\": { \"v\": [\"將項目連接到方案中,以便更容易找到。\"] }, \"Failed to add the item to the project\": { \"v\": [\"無法將項目添加到方案中\"] }, \"Failed to create a project\": { \"v\": [\"無法創建方案\"] }, \"Failed to rename the project\": { \"v\": [\"無法重命名方案\"] }, \"Type to search for existing projects\": { \"v\": [\"輸入以搜索現有方案\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t8 = [{ \"l\": \"ar\", \"t\": { \"Any link\": { \"v\": [\"أيَّ رابط\"] } } }, { \"l\": \"ast\", \"t\": { \"Any link\": { \"v\": [\"Cualesquier enllaz\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Any link\": { \"v\": [\"Jakýkoli odkaz\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Any link\": { \"v\": [\"Jakýkoli odkaz\"] } } }, { \"l\": \"da\", \"t\": { \"Any link\": { \"v\": [\"Ethvert link\"] } } }, { \"l\": \"de\", \"t\": { \"Any link\": { \"v\": [\"Irgendein Link\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Any link\": { \"v\": [\"Irgendein Link\"] } } }, { \"l\": \"el\", \"t\": { \"Any link\": { \"v\": [\"Οποιοσδήποτε σύνδεσμος\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Any link\": { \"v\": [\"Any link\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Any link\": { \"v\": [\"Cualquier enlace\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Any link\": { \"v\": [\"Cualquier enlace\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Any link\": { \"v\": [\"Cualquier enlace\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Any link\": { \"v\": [\"Cualquier enlace\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Any link\": { \"v\": [\"Mistahes link\"] } } }, { \"l\": \"eu\", \"t\": { \"Any link\": { \"v\": [\"Edozein esteka\"] } } }, { \"l\": \"fa\", \"t\": { \"Any link\": { \"v\": [\"هر پیوندی\"] } } }, { \"l\": \"fi\", \"t\": { \"Any link\": { \"v\": [\"Mikä tahansa linkki\"] } } }, { \"l\": \"fr\", \"t\": { \"Any link\": { \"v\": [\"N'importe quel lien\"] } } }, { \"l\": \"ga\", \"t\": { \"Any link\": { \"v\": [\"Aon nasc\"] } } }, { \"l\": \"gl\", \"t\": { \"Any link\": { \"v\": [\"Calquera ligazón\"] } } }, { \"l\": \"he\", \"t\": { \"Any link\": { \"v\": [\"קישור כלשהו\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Any link\": { \"v\": [\"Semua tautan\"] } } }, { \"l\": \"is\", \"t\": { \"Any link\": { \"v\": [\"Einhver tengill\"] } } }, { \"l\": \"it\", \"t\": { \"Any link\": { \"v\": [\"Qualsiasi link\"] } } }, { \"l\": \"ja\", \"t\": { \"Any link\": { \"v\": [\"任意のリンク\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Any link\": { \"v\": [\"任意のリンク\"] } } }, { \"l\": \"ko\", \"t\": { \"Any link\": { \"v\": [\"아무 링크\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Any link\": { \"v\": [\"Enhver lenke\"] } } }, { \"l\": \"nl\", \"t\": { \"Any link\": { \"v\": [\"Elke link\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Any link\": { \"v\": [\"Dowolny link\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Any link\": { \"v\": [\"Qualquer link\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Any link\": { \"v\": [\"Qualquer hiperligação\"] } } }, { \"l\": \"ro\", \"t\": { \"Any link\": { \"v\": [\"Orice link\"] } } }, { \"l\": \"ru\", \"t\": { \"Any link\": { \"v\": [\"Любая ссылка\"] } } }, { \"l\": \"sk\", \"t\": { \"Any link\": { \"v\": [\"Akýkoľvek odkaz\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Any link\": { \"v\": [\"Било који линк\"] } } }, { \"l\": \"sv\", \"t\": { \"Any link\": { \"v\": [\"Vilken länk som helst\"] } } }, { \"l\": \"tr\", \"t\": { \"Any link\": { \"v\": [\"Herhangi bir bağlantı\"] } } }, { \"l\": \"uk\", \"t\": { \"Any link\": { \"v\": [\"Будь-яке посилання\"] } } }, { \"l\": \"uz\", \"t\": { \"Any link\": { \"v\": [\"Har qanday havola\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Any link\": { \"v\": [\"任何链接\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Any link\": { \"v\": [\"任何連結\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Any link\": { \"v\": [\"任何連結\"] } } }];\nconst t9 = [{ \"l\": \"ar\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"أيّ مادة تمت مشاركتها مع نفس المجموعة من الأشخاص سيتم عرضها هنا\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"خطأ في الحصول على الموارد ذات الصلة. يرجى الاتصال بمشرف النظام عندك إذا كان لديك أيّ أسئلة.\"] }, \"Related resources\": { \"v\": [\"مصادر ذات صلة\"] } } }, { \"l\": \"ast\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Equí va apaecer tolo que compartas col mesmu grupu de persones\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Hebo un error al consiguir los recursos rellacionaos. Ponte en contautu col alministrador del sistema si tienes dalguna entruga.\"] }, \"Related resources\": { \"v\": [\"Recursos rellacionao\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Qualsevol cosa compartida amb el mateix grup de persones es mostrarà aquí\"] }, \"Related resources\": { \"v\": [\"Recursos relacionats\"] } } }, { \"l\": \"cs\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Cokoli nasdíleného stejné skupině lidí se zobrazí zde\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Chyba při získávání souvisejících prostředků. Pokud máte jakékoli dotazy, obraťte se na správce vámi využívaného systému.\"] }, \"Related resources\": { \"v\": [\"Související prostředky\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Cokoli nasdíleného stejné skupině lidí se zobrazí zde\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Chyba při získávání souvisejících prostředků. Pokud máte jakékoli dotazy, obraťte se na správce vámi využívaného systému.\"] }, \"Related resources\": { \"v\": [\"Související prostředky\"] } } }, { \"l\": \"da\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Alt der deles med samme gruppe af personer vil vises her\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Fejl ved hentning af relaterede ressourcer. Kontakt venligst din systemadministrator, hvis du har spørgsmål.\"] }, \"Related resources\": { \"v\": [\"Relaterede emner\"] } } }, { \"l\": \"de\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Alles, das mit derselben Gruppe von Personen geteilt wird, wird hier angezeigt\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Fehler beim Abrufen verwandter Ressourcen. Bei Fragen wende dich bitte an deinen Systemadministrator.\"] }, \"Related resources\": { \"v\": [\"Verwandte Ressourcen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Alles, das mit derselben Gruppe von Personen geteilt wird, wird hier angezeigt\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Fehler beim Abrufen verwandter Ressourcen. Bei Fragen wenden Sie sich bitte an Ihre Systemadministration.\"] }, \"Related resources\": { \"v\": [\"Verwandte Ressourcen\"] } } }, { \"l\": \"el\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Οτιδήποτε μοιράζεται με την ίδια ομάδα ατόμων θα εμφανίζεται εδώ\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Σφάλμα λήψης σχετικών πόρων. Παρακαλούμε επικοινωνήστε με τον διαχειριστή του συστήματός σας εάν έχετε οποιεσδήποτε ερωτήσεις.\"] }, \"Related resources\": { \"v\": [\"Σχετικοί πόροι\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Anything shared with the same group of people will show up here\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Error getting related resources. Please contact your system administrator if you have any questions.\"] }, \"Related resources\": { \"v\": [\"Related resources\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Cualquier cosa que esté compartida con el mismo grupo de personas se mostrará aquí\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Error al obtener recursos relacionados. Por favor, contacte a su administrador del sistema si tiene alguna pregunta.\"] }, \"Related resources\": { \"v\": [\"Recursos relacionados\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Cualquier cosa compartida con el mismo grupo de personas aparecerá aquí.\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Error al obtener recursos relacionados. Por favor, contacte a su administrador del sistema si tiene alguna pregunta.\"] }, \"Related resources\": { \"v\": [\"Recursos relacionados\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Cualquier cosa compartida con el mismo grupo de personas aparecerá aquí.\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Error al obtener recursos relacionados. Por favor, contacta a tu administrador del sistema si tienes alguna pregunta.\"] }, \"Related resources\": { \"v\": [\"Recursos relacionados\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Todo lo que se comparta con el mismo grupo de personas se mostrará aquí\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Error al obtener recursos relacionados. Por favor contacte al administrador si tiene alguna pregunta.\"] }, \"Related resources\": { \"v\": [\"Recursos relacionados\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Kõik, mida jagatakse sama grupi inimestega, kuvatakse siin.\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Viga seotud ressursside saamisel. Küsimuste korral võtke ühendust oma süsteemiadministraatoriga.\"] }, \"Related resources\": { \"v\": [\"Seotud ressursid\"] } } }, { \"l\": \"eu\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Pertsona-talde berarekin partekatutako edozer agertuko da hemen\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Errore bat gertatu da erlazionatutako baliabideak eskuratzean. Jarri harremanetan zure sistemaren administratzailearekin galderarik baduzu.\"] }, \"Related resources\": { \"v\": [\"Erlazionatutako baliabideak\"] } } }, { \"l\": \"fa\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"هر چیزی که با گروه مشابهی هم‌رسانی شود در این قسمت نمایش می‌یابد\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"خطا در دریافت منابع مرتبط. لطفاً در صورت داشتن هر گونه سؤال با مدیر سیستم خود تماس بگیرید.\"] }, \"Related resources\": { \"v\": [\"منابع مرتبط\"] } } }, { \"l\": \"fi\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Kaikki saman ryhmän kesken jaettu näkyy tässä\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Virhe resurssien haussa. Ota yhteyttä järjestelmän ylläpitäjään, mikäli sinulla on kysyttävää.\"] }, \"Related resources\": { \"v\": [\"Liittyvät resurssit\"] } } }, { \"l\": \"fr\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Tout ce qui est partagé avec le même groupe de personnes apparaîtra ici\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Erreur lors de la récupération des ressources liées. Contactez votre administrateur système pour répondre à vos éventuelles questions.\"] }, \"Related resources\": { \"v\": [\"Ressources liées\"] } } }, { \"l\": \"ga\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Taispeánfar aon rud a roinntear leis an ngrúpa céanna daoine anseo\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Earráid agus acmhainní gaolmhara á bhfáil. Déan teagmháil le riarthóir do chórais má tá aon cheist agat.\"] }, \"Related resources\": { \"v\": [\"Acmhainní gaolmhara\"] } } }, { \"l\": \"gl\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Todo o que se comparta co mesmo grupo de persoas aparecerá aquí\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Produciuse un erro ao obter os recursos relacionados. Póñase en contacto coa administración do seu sistema se ten algunha dúbida.\"] }, \"Related resources\": { \"v\": [\"Recursos relacionados\"] } } }, { \"l\": \"he\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"כל מה שמשותף עם אותה קבוצת האנשים יופיע כאן\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"שגיאה בקבלת המשאבים הקשורים. נא ליצור קשר עם הנהלת המערכת אם יש לך שאלות.\"] }, \"Related resources\": { \"v\": [\"משאבים קשורים\"] } } }, { \"l\": \"hu\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Minden, amit ugyanazzal a csoporttal oszt meg, itt fog megjelenni\"] }, \"Related resources\": { \"v\": [\"Kapcsolódó erőforrások\"] } } }, { \"l\": \"id\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Apa pun yang dibagikan dengan grup orang yang sama akan muncul di sini\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Kesalahan saat mengambil sumber daya terkait. Hubungi administrator sistem Anda jika ada pertanyaan.\"] }, \"Related resources\": { \"v\": [\"Sumber daya terkait\"] } } }, { \"l\": \"is\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Allt sem deilt er með sama hópi fólks mun birtast hér\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Villa við að sækja tengd tilföng. Hafðu samband við kerfisstjórann þinn ef þú ert með einhverjar spurningar.\"] }, \"Related resources\": { \"v\": [\"Tengd tilföng\"] } } }, { \"l\": \"it\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Tutto ciò che è stato condiviso con lo stesso gruppo di persone viene visualizzato qui\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Errore nell'ottenere le risorse correlate. Per qualsiasi domanda, contattare l'amministratore di sistema.\"] }, \"Related resources\": { \"v\": [\"Risorse correlate\"] } } }, { \"l\": \"ja\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"同じグループで共有しているものは、全てここに表示されます\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"関連リソースの取得エラー。ご不明な点がございましたら、システム管理者にお問い合わせください。\"] }, \"Related resources\": { \"v\": [\"関連リソース\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"同じグループで共有しているものは、全てここに表示されます\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"関連リソースの取得エラー。ご不明な点がございましたら、システム管理者にお問い合わせください。\"] }, \"Related resources\": { \"v\": [\"関連リソース\"] } } }, { \"l\": \"ko\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"같은 그룹의 사용자와 공유된 모든 것들이 이곳에 나타납니다.\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"관련 리소스를 가져오는 중 오류가 발생했습니다. 궁금한 것이 있는 경우 시스템 관리자에게 연락해 주세요.\"] }, \"Related resources\": { \"v\": [\"관련 리소스\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Alt som er delt med den samme gruppen vil vises her\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Feil ved henting av relaterte ressurser. Kontakt systemansvarlig hvis du har spørsmål.\"] }, \"Related resources\": { \"v\": [\"Relaterte ressurser\"] } } }, { \"l\": \"nl\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Alles dat gedeeld is met dezelfde groep mensen zal hier getoond worden\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Fout bij het verkrijgen van resources. Neem a.u.b. contact op met uw systeembeheerder als u vragen heeft.\"] }, \"Related resources\": { \"v\": [\"Gerelateerde bronnen\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Tutaj pojawi się wszystko, co zostało udostępnione tej samej grupie osób\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Błąd podczas pobierania powiązanych zasobów. Jeśli masz jakiekolwiek pytania, skontaktuj się z administratorem systemu.\"] }, \"Related resources\": { \"v\": [\"Powiązane zasoby\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Qualquer coisa compartilhada com o mesmo grupo de pessoas aparecerá aqui\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Erro ao obter recursos relacionados. Por favor entre em contato com o administrador do sistema se tiver alguma dúvida.\"] }, \"Related resources\": { \"v\": [\"Recursos relacionados\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Qualquer coisa partilhada com o mesmo grupo de pessoas irá aparecer aqui\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Erro ao obter os recursos relacionados. Por favor, contacte o administrador do sistema se tiver quaisquer perguntas.\"] }, \"Related resources\": { \"v\": [\"Recursos relacionados\"] } } }, { \"l\": \"ro\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Tot ceea ce este partajat cu același grup de persoane va fi afișat aici\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Eroare la preluarea resurselor adiționale. Vă rugăm să contactați administratorul pentru întrebări.\"] }, \"Related resources\": { \"v\": [\"Resurse legate\"] } } }, { \"l\": \"ru\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Всё, чем поделились с той же группой людей, будет отображаться здесь\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Ошибка при получении связанных ресурсов. Если у вас есть какие-либо вопросы, обратитесь к системному администратору.\"] }, \"Related resources\": { \"v\": [\"Связанные ресурсы\"] } } }, { \"l\": \"sk\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Tu sa zobrazí čokoľvek zdieľané s rovnakou skupinou ľudí\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Chyba pri získavaní súvisiacich zdrojov. V prípade otázok kontaktujte prosím svojho systemového administrátora.\"] }, \"Related resources\": { \"v\": [\"Súvisiace zdroje\"] } } }, { \"l\": \"sl\", \"t\": { \"Related resources\": { \"v\": [\"Povezani viri\"] } } }, { \"l\": \"sr\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Све што се дели са истом групом људи ће се појавити овде\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Грешка код прибављања везаних ресурса. Молимо вас да се обратите администратору ако имате питања.\"] }, \"Related resources\": { \"v\": [\"Повезани ресурси\"] } } }, { \"l\": \"sv\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Något som delats med samma grupp av personer kommer att visas här\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Det gick inte att hämta relaterade resurser. Kontakta din systemadministratör om du har några frågor.\"] }, \"Related resources\": { \"v\": [\"Relaterade resurser\"] } } }, { \"l\": \"tr\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Aynı kişi grubu ile paylaşılan herşey burada görüntülenir\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"İlgili kaynaklara ulaşılırken sorun çıktı. Herhangi bir sorunuz varsa lütfen sistem yöneticiniz ile görüşün \"] }, \"Related resources\": { \"v\": [\"İlgili kaynaklar\"] } } }, { \"l\": \"uk\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Будь-що доступне для цієї же групи людей буде показано тут\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Помилка під час отримання пов'язаних ресурсів. Будь ласка, сконтактуйте з системним адміністратором, якщо у вас виникли запитання.\"] }, \"Related resources\": { \"v\": [\"Пов'язані ресурси\"] } } }, { \"l\": \"uz\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"Xuddi shu guruhdagi odamlarga ulashilgan hamma narsa shu yerda chiqadi\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"Tegishli manbalarni olishda xatolik yuz berdi. Savollaringiz bo'lsa, tizim administratoriga murojaat qiling.\"] }, \"Related resources\": { \"v\": [\"Tegishli manbalar\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"与同组用户分享的所有内容都会显示于此\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"获取相关资源出现错误。如果你有任何问题,请联系系统管理员。\"] }, \"Related resources\": { \"v\": [\"相关资源\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"與同一組人共享的任何內容都會顯示在此處\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"取得相關資源時發生錯誤。如果有任何問題,請聯絡系統管理員。\"] }, \"Related resources\": { \"v\": [\"相關資源\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Anything shared with the same group of people will show up here\": { \"v\": [\"與相同群組分享的所有內容都會顯示於此\"] }, \"Error getting related resources. Please contact your system administrator if you have any questions.\": { \"v\": [\"取得相關資源時發生錯誤。如果有任何問題,請聯絡系統管理員。\"] }, \"Related resources\": { \"v\": [\"相關資源\"] } } }];\nconst t10 = [{ \"l\": \"ar\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"صورة الملف الشخصي الرمزية لــ {displayName} \"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"صورة الملف الشخصي الرمزية لــ {displayName}، {status}\"] } } }, { \"l\": \"ast\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de: {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de: {displayName}, {status}\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"cs\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Zástupný obrázek uživatele {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Zástupný obrázek uživatele {displayName}, {status}\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Zástupný obrázek uživatele {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Zástupný obrázek uživatele {displayName}, {status}\"] } } }, { \"l\": \"da\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar af {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar af {displayName}, {status}\"] } } }, { \"l\": \"de\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar von {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar von {displayName}, {status}\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar von {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar von {displayName}, {status}\"] } } }, { \"l\": \"el\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Άβαταρ του {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Άβαταρ του {displayName}, {status}\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar of {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar of {displayName}, {status}\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar {displayName}, {status}\"] } } }, { \"l\": \"eu\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName}-(e)n irudia\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName} -(e)n irudia, {status}\"] } } }, { \"l\": \"fa\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"آواتار {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"آواتار {displayName} ، {status}\"] } } }, { \"l\": \"fi\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName}n avatar\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}n avatar, {status}\"] } } }, { \"l\": \"fr\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"ga\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"gl\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"he\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"תמונה ייצוגית של {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"תמונה ייצוגית של {displayName}, {status}\"] } } }, { \"l\": \"hu\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName} profilképe\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName} profilképe, {status}\"] } } }, { \"l\": \"id\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar {displayName}, {status}\"] } } }, { \"l\": \"is\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Auðkennismynd fyrir {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Auðkennismynd fyrir {displayName}, {status}\"] } } }, { \"l\": \"it\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar di {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar di {displayName}, {status}\"] } } }, { \"l\": \"ja\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName} のアバター\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}, {status} のアバター\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName} のアバター\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}, {status} のアバター\"] } } }, { \"l\": \"ko\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName}님의 아바타\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}, {status}님의 아바타\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Аватар на {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Аватар на {displayName}, {status}\"] } } }, { \"l\": \"my\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName} ၏ ကိုယ်ပွား\"] } } }, { \"l\": \"nb\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avataren til {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}'s avatar, {status}\"] } } }, { \"l\": \"nl\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar van {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar van {displayName}, {status}\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Awatar {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Awatar {displayName}, {status}\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar de {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar de {displayName}, {status}\"] } } }, { \"l\": \"ro\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatarul lui {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatarul lui {displayName}, {status}\"] } } }, { \"l\": \"ru\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Аватар {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Фотография {displayName}, {status}\"] } } }, { \"l\": \"sk\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Avatar {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar {displayName}, {status}\"] } } }, { \"l\": \"sl\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Podoba {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Prikazna slika {displayName}, {status}\"] } } }, { \"l\": \"sr\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Аватар за {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Avatar za {displayName}, {status}\"] } } }, { \"l\": \"sv\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName}s avatar\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}s avatar, {status}\"] } } }, { \"l\": \"tr\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName} avatarı\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}, {status} avatarı\"] } } }, { \"l\": \"uk\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"Аватар {displayName}\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"Аватар {displayName}, {status}\"] } } }, { \"l\": \"uz\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\" {displayName}Avatari\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}, {status} Avatari\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName}的头像\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}的头像,{status}\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName} 的頭像\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName} 的頭像,{status}\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Avatar of {displayName}\": { \"v\": [\"{displayName} 的大頭照\"] }, \"Avatar of {displayName}, {status}\": { \"v\": [\"{displayName}, {status} 的大頭照\"] } } }];\nconst t11 = [{ \"l\": \"ar\", \"t\": { \"away\": { \"v\": [\"غير موجود\"] }, \"busy\": { \"v\": [\"مشغول\"] }, \"do not disturb\": { \"v\": [\"يُرجى عدم الإزعاج\"] }, \"invisible\": { \"v\": [\"غير مرئي\"] }, \"offline\": { \"v\": [\"غير متصل\"] }, \"online\": { \"v\": [\"متصل\"] } } }, { \"l\": \"ast\", \"t\": { \"away\": { \"v\": [\"ausente\"] }, \"busy\": { \"v\": [\"ocupáu\"] }, \"do not disturb\": { \"v\": [\"nun molestar\"] }, \"invisible\": { \"v\": [\"invisible\"] }, \"offline\": { \"v\": [\"desconectáu\"] }, \"online\": { \"v\": [\"en llinia\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"away\": { \"v\": [\"pryč\"] }, \"busy\": { \"v\": [\"zaneprádněn(a)\"] }, \"do not disturb\": { \"v\": [\"nerušit\"] }, \"invisible\": { \"v\": [\"neviditelné\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"away\": { \"v\": [\"pryč\"] }, \"busy\": { \"v\": [\"zaneprádněn(a)\"] }, \"do not disturb\": { \"v\": [\"nerušit\"] }, \"invisible\": { \"v\": [\"neviditelné\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"da\", \"t\": { \"away\": { \"v\": [\"væk\"] }, \"busy\": { \"v\": [\"optaget\"] }, \"do not disturb\": { \"v\": [\"forstyr ikke\"] }, \"invisible\": { \"v\": [\"usynlig\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"de\", \"t\": { \"away\": { \"v\": [\"Abwesend\"] }, \"busy\": { \"v\": [\"Beschäftigt\"] }, \"do not disturb\": { \"v\": [\"Bitte nicht stören\"] }, \"invisible\": { \"v\": [\"Unsichtbar\"] }, \"offline\": { \"v\": [\"Offline\"] }, \"online\": { \"v\": [\"Online\"] } } }, { \"l\": \"de-DE\", \"t\": { \"away\": { \"v\": [\"Abwesend\"] }, \"busy\": { \"v\": [\"Beschäftigt\"] }, \"do not disturb\": { \"v\": [\"Bitte nicht stören\"] }, \"invisible\": { \"v\": [\"Unsichtbar\"] }, \"offline\": { \"v\": [\"Offline\"] }, \"online\": { \"v\": [\"Online\"] } } }, { \"l\": \"el\", \"t\": { \"away\": { \"v\": [\"μακριά\"] }, \"busy\": { \"v\": [\"απασχολημένος\"] }, \"do not disturb\": { \"v\": [\"μην ενοχλείτε\"] }, \"invisible\": { \"v\": [\"αόρατο\"] }, \"offline\": { \"v\": [\"εκτός σύνδεσης\"] }, \"online\": { \"v\": [\"συνδεδεμένος\"] } } }, { \"l\": \"en-GB\", \"t\": { \"away\": { \"v\": [\"away\"] }, \"busy\": { \"v\": [\"busy\"] }, \"do not disturb\": { \"v\": [\"do not disturb\"] }, \"invisible\": { \"v\": [\"invisible\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"away\": { \"v\": [\"ausente\"] }, \"busy\": { \"v\": [\"ocupado\"] }, \"do not disturb\": { \"v\": [\"no molestar\"] }, \"invisible\": { \"v\": [\"invisible\"] }, \"offline\": { \"v\": [\"fuera de línea\"] }, \"online\": { \"v\": [\"en línea\"] } } }, { \"l\": \"es-AR\", \"t\": { \"away\": { \"v\": [\"ausente\"] }, \"busy\": { \"v\": [\"ocupado\"] }, \"do not disturb\": { \"v\": [\"no molestar\"] }, \"invisible\": { \"v\": [\"invisible\"] }, \"offline\": { \"v\": [\"desconectado\"] }, \"online\": { \"v\": [\"en línea\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"away\": { \"v\": [\"ausente\"] }, \"busy\": { \"v\": [\"ocupado\"] }, \"do not disturb\": { \"v\": [\"no molestar\"] }, \"invisible\": { \"v\": [\"invisible\"] }, \"offline\": { \"v\": [\"fuera de línea\"] }, \"online\": { \"v\": [\"en línea\"] } } }, { \"l\": \"et-EE\", \"t\": { \"away\": { \"v\": [\"eemal\"] }, \"busy\": { \"v\": [\"hõivatud\"] }, \"do not disturb\": { \"v\": [\"ära sega\"] }, \"invisible\": { \"v\": [\"nähtamatu\"] }, \"offline\": { \"v\": [\"pole võrgus\"] }, \"online\": { \"v\": [\"võrgus\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"away\": { \"v\": [\"دور از دستگاه\"] }, \"busy\": { \"v\": [\"مشغول\"] }, \"do not disturb\": { \"v\": [\"مزاحم نشوید\"] }, \"invisible\": { \"v\": [\"مخفی\"] }, \"offline\": { \"v\": [\"برون‌خط\"] }, \"online\": { \"v\": [\"برخط\"] } } }, { \"l\": \"fi\", \"t\": { \"away\": { \"v\": [\"poissa\"] }, \"busy\": { \"v\": [\"varattu\"] }, \"do not disturb\": { \"v\": [\"älä häiritse\"] }, \"invisible\": { \"v\": [\"näkymätön\"] }, \"offline\": { \"v\": [\"ei linjalla\"] }, \"online\": { \"v\": [\"linjalla\"] } } }, { \"l\": \"fr\", \"t\": { \"away\": { \"v\": [\"absent\"] }, \"busy\": { \"v\": [\"occupé\"] }, \"do not disturb\": { \"v\": [\"ne pas déranger\"] }, \"invisible\": { \"v\": [\"invisible\"] }, \"offline\": { \"v\": [\"hors ligne\"] }, \"online\": { \"v\": [\"en ligne\"] } } }, { \"l\": \"ga\", \"t\": { \"away\": { \"v\": [\"ar shiúl\"] }, \"busy\": { \"v\": [\"gnóthach\"] }, \"do not disturb\": { \"v\": [\"ná cur as\"] }, \"invisible\": { \"v\": [\"dofheicthe\"] }, \"offline\": { \"v\": [\"as líne\"] }, \"online\": { \"v\": [\"ar líne\"] } } }, { \"l\": \"gl\", \"t\": { \"away\": { \"v\": [\"ausente\"] }, \"busy\": { \"v\": [\"ocupado\"] }, \"do not disturb\": { \"v\": [\"non molestar\"] }, \"invisible\": { \"v\": [\"invisíbel\"] }, \"offline\": { \"v\": [\"desconectado\"] }, \"online\": { \"v\": [\"conectado\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"away\": { \"v\": [\"tidak tersedia\"] }, \"do not disturb\": { \"v\": [\"jangan ganggu\"] }, \"offline\": { \"v\": [\"luring\"] }, \"online\": { \"v\": [\"daring\"] } } }, { \"l\": \"is\", \"t\": { \"away\": { \"v\": [\"í burtu\"] }, \"busy\": { \"v\": [\"upptekin/n\"] }, \"do not disturb\": { \"v\": [\"ekki ónáða\"] }, \"invisible\": { \"v\": [\"ósýnilegt\"] }, \"offline\": { \"v\": [\"ónettengt\"] }, \"online\": { \"v\": [\"nettengt\"] } } }, { \"l\": \"it\", \"t\": { \"away\": { \"v\": [\"via\"] }, \"do not disturb\": { \"v\": [\"non disturbare\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"ja\", \"t\": { \"away\": { \"v\": [\"離れる\"] }, \"busy\": { \"v\": [\"ビジー\"] }, \"do not disturb\": { \"v\": [\"邪魔をしないでください\"] }, \"invisible\": { \"v\": [\"不可視\"] }, \"offline\": { \"v\": [\"オフライン\"] }, \"online\": { \"v\": [\"オンライン\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"away\": { \"v\": [\"離れる\"] }, \"busy\": { \"v\": [\"ビジー\"] }, \"do not disturb\": { \"v\": [\"邪魔をしないでください\"] }, \"invisible\": { \"v\": [\"不可視\"] }, \"offline\": { \"v\": [\"オフライン\"] }, \"online\": { \"v\": [\"オンライン\"] } } }, { \"l\": \"ko\", \"t\": { \"away\": { \"v\": [\"자리 비움\"] }, \"busy\": { \"v\": [\"바쁨\"] }, \"do not disturb\": { \"v\": [\"방해 금지\"] }, \"invisible\": { \"v\": [\"보이지 않음\"] }, \"offline\": { \"v\": [\"오프라인\"] }, \"online\": { \"v\": [\"온라인\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"away\": { \"v\": [\"borte\"] }, \"busy\": { \"v\": [\"opptatt\"] }, \"do not disturb\": { \"v\": [\"ikke forstyrr\"] }, \"invisible\": { \"v\": [\"usynlig\"] }, \"offline\": { \"v\": [\"frakoblet\"] }, \"online\": { \"v\": [\"tilkoblet\"] } } }, { \"l\": \"nl\", \"t\": { \"away\": { \"v\": [\"weg\"] }, \"busy\": { \"v\": [\"bezig\"] }, \"do not disturb\": { \"v\": [\"niet storen\"] }, \"invisible\": { \"v\": [\"Onzichtbaar\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"away\": { \"v\": [\"stąd\"] }, \"busy\": { \"v\": [\"zajęty\"] }, \"do not disturb\": { \"v\": [\"nie przeszkadzać\"] }, \"invisible\": { \"v\": [\"niewidzialny\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"away\": { \"v\": [\"ausente\"] }, \"busy\": { \"v\": [\"ocupado\"] }, \"do not disturb\": { \"v\": [\"não perturbe\"] }, \"invisible\": { \"v\": [\"invisível\"] }, \"offline\": { \"v\": [\"desligada\"] }, \"online\": { \"v\": [\"ligado\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"away\": { \"v\": [\"longe\"] }, \"busy\": { \"v\": [\"ocupado\"] }, \"do not disturb\": { \"v\": [\"não incomodar\"] }, \"invisible\": { \"v\": [\"invisível\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"ro\", \"t\": { \"away\": { \"v\": [\"plecat\"] }, \"do not disturb\": { \"v\": [\"nu deranjați\"] }, \"offline\": { \"v\": [\"deconectat\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"ru\", \"t\": { \"away\": { \"v\": [\"отсутствие\"] }, \"busy\": { \"v\": [\"занятый\"] }, \"do not disturb\": { \"v\": [\"не беспокоить\"] }, \"invisible\": { \"v\": [\"невидимый\"] }, \"offline\": { \"v\": [\"офлайн\"] }, \"online\": { \"v\": [\"онлайн\"] } } }, { \"l\": \"sk\", \"t\": { \"away\": { \"v\": [\"neprítomný\"] }, \"busy\": { \"v\": [\"zaneprázdnený\"] }, \"do not disturb\": { \"v\": [\"nerušiť\"] }, \"invisible\": { \"v\": [\"neviditeľný\"] }, \"offline\": { \"v\": [\"Odpojený - offline\"] }, \"online\": { \"v\": [\"Pripojený - online\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"away\": { \"v\": [\"одсутан\"] }, \"busy\": { \"v\": [\"заузет\"] }, \"do not disturb\": { \"v\": [\"не узнемиравај\"] }, \"invisible\": { \"v\": [\"невидљиво\"] }, \"offline\": { \"v\": [\"ван мреже\"] }, \"online\": { \"v\": [\"на мрежи\"] } } }, { \"l\": \"sv\", \"t\": { \"away\": { \"v\": [\"borta\"] }, \"busy\": { \"v\": [\"upptagen\"] }, \"do not disturb\": { \"v\": [\"stör ej\"] }, \"invisible\": { \"v\": [\"osynlig\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"tr\", \"t\": { \"away\": { \"v\": [\"Uzakta\"] }, \"busy\": { \"v\": [\"meşgul\"] }, \"do not disturb\": { \"v\": [\"Rahatsız etmeyin\"] }, \"invisible\": { \"v\": [\"görünmez\"] }, \"offline\": { \"v\": [\"Çevrim dışı\"] }, \"online\": { \"v\": [\"Çevrim içi\"] } } }, { \"l\": \"uk\", \"t\": { \"away\": { \"v\": [\"відсутній\"] }, \"busy\": { \"v\": [\"зайнято\"] }, \"do not disturb\": { \"v\": [\"не турбувати\"] }, \"invisible\": { \"v\": [\"Невидимий\"] }, \"offline\": { \"v\": [\"не в мережі\"] }, \"online\": { \"v\": [\"в мережі\"] } } }, { \"l\": \"uz\", \"t\": { \"away\": { \"v\": [\"uzoqda\"] }, \"busy\": { \"v\": [\"band\"] }, \"do not disturb\": { \"v\": [\"bezovta qilmang\"] }, \"invisible\": { \"v\": [\"ko'rinmas\"] }, \"offline\": { \"v\": [\"offline\"] }, \"online\": { \"v\": [\"online\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"away\": { \"v\": [\"离开\"] }, \"busy\": { \"v\": [\"繁忙\"] }, \"do not disturb\": { \"v\": [\"请勿打扰\"] }, \"invisible\": { \"v\": [\"隐藏的\"] }, \"offline\": { \"v\": [\"离线\"] }, \"online\": { \"v\": [\"在线\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"away\": { \"v\": [\"離開\"] }, \"busy\": { \"v\": [\"忙碌\"] }, \"do not disturb\": { \"v\": [\"請勿打擾\"] }, \"invisible\": { \"v\": [\"隐藏的\"] }, \"offline\": { \"v\": [\"離線\"] }, \"online\": { \"v\": [\"在線\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t12 = [{ \"l\": \"ar\", \"t\": { \"Back to provider selection\": { \"v\": [\"عودة إلى اختيار المزوّد\"] }, \"Close Smart Picker\": { \"v\": [\"إغلاق المحدد الذكي\"] }, \"Smart Picker\": { \"v\": [\"اللاقط الذكي smart picker\"] } } }, { \"l\": \"ast\", \"t\": { \"Back to provider selection\": { \"v\": [\"Volver a la seleición de fornidores\"] }, \"Close Smart Picker\": { \"v\": [\"Zarrar la seleición intelixente\"] }, \"Smart Picker\": { \"v\": [\"Selector intelixente\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Back to provider selection\": { \"v\": [\"Zpět na výběr poskytovatele\"] }, \"Close Smart Picker\": { \"v\": [\"Zavřít inteligentní výběr\"] }, \"Smart Picker\": { \"v\": [\"Inteligentní výběr\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Back to provider selection\": { \"v\": [\"Zpět na výběr poskytovatele\"] }, \"Close Smart Picker\": { \"v\": [\"Zavřít inteligentní výběr\"] }, \"Smart Picker\": { \"v\": [\"Inteligentní výběr\"] } } }, { \"l\": \"da\", \"t\": { \"Back to provider selection\": { \"v\": [\"Tilbage til udbydervalg\"] }, \"Close Smart Picker\": { \"v\": [\"Luk Smart Vælger\"] }, \"Smart Picker\": { \"v\": [\"Smart Vælger\"] } } }, { \"l\": \"de\", \"t\": { \"Back to provider selection\": { \"v\": [\"Zurück zur Anbieterauswahl\"] }, \"Close Smart Picker\": { \"v\": [\"Smart Picker schließen\"] }, \"Smart Picker\": { \"v\": [\"Smart Picker\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Back to provider selection\": { \"v\": [\"Zurück zur Anbieterauswahl\"] }, \"Close Smart Picker\": { \"v\": [\"Smart Picker schließen\"] }, \"Smart Picker\": { \"v\": [\"Smart Picker\"] } } }, { \"l\": \"el\", \"t\": { \"Back to provider selection\": { \"v\": [\"Επιστροφή στην επιλογή παρόχου\"] }, \"Close Smart Picker\": { \"v\": [\"Κλείσιμο Έξυπνης Επιλογής\"] }, \"Smart Picker\": { \"v\": [\"Έξυπνη Επιλογή\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Back to provider selection\": { \"v\": [\"Back to provider selection\"] }, \"Close Smart Picker\": { \"v\": [\"Close Smart Picker\"] }, \"Smart Picker\": { \"v\": [\"Smart Picker\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Back to provider selection\": { \"v\": [\"Volver a la selección de proveedor\"] }, \"Close Smart Picker\": { \"v\": [\"Cerrar selector inteligente\"] }, \"Smart Picker\": { \"v\": [\"Selector inteligente\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Back to provider selection\": { \"v\": [\"Volver a la selección de proveedor\"] }, \"Close Smart Picker\": { \"v\": [\"Cerrar selector inteligente\"] }, \"Smart Picker\": { \"v\": [\"Selector inteligente\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Back to provider selection\": { \"v\": [\"Volver a la selección de proveedor\"] }, \"Close Smart Picker\": { \"v\": [\"Cerrar selector inteligente\"] }, \"Smart Picker\": { \"v\": [\"Selector inteligente\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Back to provider selection\": { \"v\": [\"Volver a la selección de proveedor\"] }, \"Close Smart Picker\": { \"v\": [\"Cerrar selector inteligente\"] }, \"Smart Picker\": { \"v\": [\"Selector inteligente\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Back to provider selection\": { \"v\": [\"Tagasi teenusepakkuja valiku juurde\"] }, \"Close Smart Picker\": { \"v\": [\"Sulge nutikas valija\"] }, \"Smart Picker\": { \"v\": [\"Nutikas valija\"] } } }, { \"l\": \"eu\", \"t\": { \"Back to provider selection\": { \"v\": [\"Itzuli hornitzaileen hautapenera\"] }, \"Close Smart Picker\": { \"v\": [\"Itxi hautatzaile adimenduna\"] }, \"Smart Picker\": { \"v\": [\"Hautatzaile adimenduna\"] } } }, { \"l\": \"fa\", \"t\": { \"Back to provider selection\": { \"v\": [\"بازگشت به انتخاب ارائه دهنده\"] }, \"Close Smart Picker\": { \"v\": [\"بستن انتخاب‌گر هوشمند\"] }, \"Smart Picker\": { \"v\": [\"انتخابگر هوشمند\"] } } }, { \"l\": \"fi\", \"t\": { \"Back to provider selection\": { \"v\": [\"Takaisin toimittajavalintaan\"] }, \"Close Smart Picker\": { \"v\": [\"Sulje älykas valitsin\"] }, \"Smart Picker\": { \"v\": [\"Älykäs valitsin\"] } } }, { \"l\": \"fr\", \"t\": { \"Back to provider selection\": { \"v\": [\"Revenir à la sélection du fournisseur\"] }, \"Close Smart Picker\": { \"v\": [\"Fermer le sélecteur intelligent\"] }, \"Smart Picker\": { \"v\": [\"Sélecteur intelligent\"] } } }, { \"l\": \"ga\", \"t\": { \"Back to provider selection\": { \"v\": [\"Ar ais go roghnú soláthróra\"] }, \"Close Smart Picker\": { \"v\": [\"Dún Piocálaí Cliste\"] }, \"Smart Picker\": { \"v\": [\"Roghnóir Cliste\"] } } }, { \"l\": \"gl\", \"t\": { \"Back to provider selection\": { \"v\": [\"Volver á selección do provedor\"] }, \"Close Smart Picker\": { \"v\": [\"Pechar o Selector intelixente\"] }, \"Smart Picker\": { \"v\": [\"Selector intelixente\"] } } }, { \"l\": \"he\", \"t\": { \"Back to provider selection\": { \"v\": [\"חזרה לבחירת ספק\"] }, \"Close Smart Picker\": { \"v\": [\"סגירת הבורר החכם\"] }, \"Smart Picker\": { \"v\": [\"בורר חכם\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Back to provider selection\": { \"v\": [\"Kembali ke pemilihan penyedia\"] }, \"Close Smart Picker\": { \"v\": [\"Tutup Pemilih Cerdas\"] }, \"Smart Picker\": { \"v\": [\"Pemilih Cerdas\"] } } }, { \"l\": \"is\", \"t\": { \"Back to provider selection\": { \"v\": [\"Til baka í val á þjónustuveitu\"] }, \"Close Smart Picker\": { \"v\": [\"Loka snjall-veljara\"] }, \"Smart Picker\": { \"v\": [\"Snjall-veljari\"] } } }, { \"l\": \"it\", \"t\": { \"Back to provider selection\": { \"v\": [\"Torna alla selezione del provider\"] }, \"Close Smart Picker\": { \"v\": [\"Chiudere lo Smart Picker\"] }, \"Smart Picker\": { \"v\": [\"Picker intelligente\"] } } }, { \"l\": \"ja\", \"t\": { \"Back to provider selection\": { \"v\": [\"プロバイダーの選択に戻る\"] }, \"Close Smart Picker\": { \"v\": [\"スマートピッカーを閉じる\"] }, \"Smart Picker\": { \"v\": [\"スマートピッカー\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Back to provider selection\": { \"v\": [\"プロバイダーの選択に戻る\"] }, \"Close Smart Picker\": { \"v\": [\"スマートピッカーを閉じる\"] }, \"Smart Picker\": { \"v\": [\"スマートピッカー\"] } } }, { \"l\": \"ko\", \"t\": { \"Back to provider selection\": { \"v\": [\"제공자 선택으로 돌아가기\"] }, \"Close Smart Picker\": { \"v\": [\"스마트 선택기 닫기\"] }, \"Smart Picker\": { \"v\": [\"스마트 선택기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Back to provider selection\": { \"v\": [\"Tilbake til leverandørvalg\"] }, \"Close Smart Picker\": { \"v\": [\"Lukk Smart Velger\"] }, \"Smart Picker\": { \"v\": [\"Smart Velger\"] } } }, { \"l\": \"nl\", \"t\": { \"Back to provider selection\": { \"v\": [\"Terug naar provider selectie\"] }, \"Close Smart Picker\": { \"v\": [\"Sluit Slimme Kiezer\"] }, \"Smart Picker\": { \"v\": [\"Slimme Kiezer\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Back to provider selection\": { \"v\": [\"Powrót do wyboru dostawcy\"] }, \"Close Smart Picker\": { \"v\": [\"Zamknij inteligentny selektor\"] }, \"Smart Picker\": { \"v\": [\"Inteligentne wybieranie\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Back to provider selection\": { \"v\": [\"Voltar para seleção de provedor\"] }, \"Close Smart Picker\": { \"v\": [\"Fechar Seletor Inteligente\"] }, \"Smart Picker\": { \"v\": [\"Seletor Inteligente\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Back to provider selection\": { \"v\": [\"Voltar à seleção de fornecedor\"] }, \"Close Smart Picker\": { \"v\": ['Fechar \"Smart Picker\"'] }, \"Smart Picker\": { \"v\": [\"Smart Picker\"] } } }, { \"l\": \"ro\", \"t\": { \"Back to provider selection\": { \"v\": [\"Înapoi la selecția providerului\"] }, \"Close Smart Picker\": { \"v\": [\"Închide Smart Picker\"] }, \"Smart Picker\": { \"v\": [\"Smart Picker\"] } } }, { \"l\": \"ru\", \"t\": { \"Back to provider selection\": { \"v\": [\"Вернуться к выбору провайдера\"] }, \"Close Smart Picker\": { \"v\": [\"Закрыть интеллектуальный выбор\"] }, \"Smart Picker\": { \"v\": [\"Умный выбор\"] } } }, { \"l\": \"sk\", \"t\": { \"Back to provider selection\": { \"v\": [\"Späť na výber poskytovateľa\"] }, \"Close Smart Picker\": { \"v\": [\"Zavrieť inteligentný výber\"] }, \"Smart Picker\": { \"v\": [\"Inteligentný výber\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Back to provider selection\": { \"v\": [\"Назад на избор пружаоца\"] }, \"Close Smart Picker\": { \"v\": [\"Затвори паметни бирач\"] }, \"Smart Picker\": { \"v\": [\"Паметни бирач\"] } } }, { \"l\": \"sv\", \"t\": { \"Back to provider selection\": { \"v\": [\"Tillbaka till leverantörsval\"] }, \"Close Smart Picker\": { \"v\": [\"Stäng Smart Picker\"] }, \"Smart Picker\": { \"v\": [\"Smart Picker\"] } } }, { \"l\": \"tr\", \"t\": { \"Back to provider selection\": { \"v\": [\"Sağlayıcı seçimine dön\"] }, \"Close Smart Picker\": { \"v\": [\"Akıllı seçimi kapat\"] }, \"Smart Picker\": { \"v\": [\"Akıllı seçim\"] } } }, { \"l\": \"uk\", \"t\": { \"Back to provider selection\": { \"v\": [\"Назад до вибору постачальника\"] }, \"Close Smart Picker\": { \"v\": [\"Закрити асистент вибору\"] }, \"Smart Picker\": { \"v\": [\"Асистент вибору\"] } } }, { \"l\": \"uz\", \"t\": { \"Back to provider selection\": { \"v\": [\"Provayder tanloviga qaytish\"] }, \"Close Smart Picker\": { \"v\": [\"Smart Picker-ni yoping\"] }, \"Smart Picker\": { \"v\": [\"Aqlli tanlovchi\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Back to provider selection\": { \"v\": [\"返回至提供者选择列表\"] }, \"Close Smart Picker\": { \"v\": [\"关闭智能拾取器\"] }, \"Smart Picker\": { \"v\": [\"智能拾取器\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Back to provider selection\": { \"v\": [\"回到提供者選擇\"] }, \"Close Smart Picker\": { \"v\": [\"關閉 Smart Picker\"] }, \"Smart Picker\": { \"v\": [\"Smart Picker\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Back to provider selection\": { \"v\": [\"回到提供者選擇\"] }, \"Close Smart Picker\": { \"v\": [\"關閉智慧型挑選器\"] }, \"Smart Picker\": { \"v\": [\"智慧型挑選器\"] } } }];\nconst t13 = [{ \"l\": \"ar\", \"t\": { \"Cancel changes\": { \"v\": [\"إلغاء التغييرات\"] }, \"Confirm changes\": { \"v\": [\"تأكيد التغييرات\"] } } }, { \"l\": \"ast\", \"t\": { \"Cancel changes\": { \"v\": [\"Encaboxar los cambeos\"] }, \"Confirm changes\": { \"v\": [\"Confirmar los cambeos\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancel·la els canvis\"] }, \"Confirm changes\": { \"v\": [\"Confirmeu els canvis\"] } } }, { \"l\": \"cs\", \"t\": { \"Cancel changes\": { \"v\": [\"Zrušit změny\"] }, \"Confirm changes\": { \"v\": [\"Potvrdit změny\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Cancel changes\": { \"v\": [\"Zrušit změny\"] }, \"Confirm changes\": { \"v\": [\"Potvrdit změny\"] } } }, { \"l\": \"da\", \"t\": { \"Cancel changes\": { \"v\": [\"Annuller ændringer\"] }, \"Confirm changes\": { \"v\": [\"Bekræft ændringer\"] } } }, { \"l\": \"de\", \"t\": { \"Cancel changes\": { \"v\": [\"Änderungen verwerfen\"] }, \"Confirm changes\": { \"v\": [\"Änderungen bestätigen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Cancel changes\": { \"v\": [\"Änderungen verwerfen\"] }, \"Confirm changes\": { \"v\": [\"Änderungen bestätigen\"] } } }, { \"l\": \"el\", \"t\": { \"Cancel changes\": { \"v\": [\"Ακύρωση αλλαγών\"] }, \"Confirm changes\": { \"v\": [\"Επιβεβαίωση αλλαγών\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancel changes\"] }, \"Confirm changes\": { \"v\": [\"Confirm changes\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancelar cambios\"] }, \"Confirm changes\": { \"v\": [\"Confirmar cambios\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancelar cambios\"] }, \"Confirm changes\": { \"v\": [\"Confirmar cambios\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancelar cambios\"] }, \"Confirm changes\": { \"v\": [\"Confirmar cambios\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancelar cambios\"] }, \"Confirm changes\": { \"v\": [\"Confirmar cambios\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Cancel changes\": { \"v\": [\"Tühista muudatused\"] }, \"Confirm changes\": { \"v\": [\"Kinnitage muudatused\"] } } }, { \"l\": \"eu\", \"t\": { \"Cancel changes\": { \"v\": [\"Ezeztatu aldaketak\"] }, \"Confirm changes\": { \"v\": [\"Baieztatu aldaketak\"] } } }, { \"l\": \"fa\", \"t\": { \"Cancel changes\": { \"v\": [\"لغو تغییرات\"] }, \"Confirm changes\": { \"v\": [\"تایید تغییرات\"] } } }, { \"l\": \"fi\", \"t\": { \"Cancel changes\": { \"v\": [\"Peruuta muutokset\"] }, \"Confirm changes\": { \"v\": [\"Vahvista muutokset\"] } } }, { \"l\": \"fr\", \"t\": { \"Cancel changes\": { \"v\": [\"Annuler les modifications\"] }, \"Confirm changes\": { \"v\": [\"Confirmer les modifications\"] } } }, { \"l\": \"ga\", \"t\": { \"Cancel changes\": { \"v\": [\"Cealaigh athruithe\"] }, \"Confirm changes\": { \"v\": [\"Deimhnigh na hathruithe\"] } } }, { \"l\": \"gl\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancelar os cambios\"] }, \"Confirm changes\": { \"v\": [\"Confirma os cambios\"] } } }, { \"l\": \"he\", \"t\": { \"Cancel changes\": { \"v\": [\"ביטול שינויים\"] }, \"Confirm changes\": { \"v\": [\"אישור השינויים\"] } } }, { \"l\": \"hu\", \"t\": { \"Cancel changes\": { \"v\": [\"Változtatások elvetése\"] }, \"Confirm changes\": { \"v\": [\"Változtatások megerősítése\"] } } }, { \"l\": \"id\", \"t\": { \"Cancel changes\": { \"v\": [\"Batalkan perubahan\"] }, \"Confirm changes\": { \"v\": [\"Konfirmasikan perubahan\"] } } }, { \"l\": \"is\", \"t\": { \"Cancel changes\": { \"v\": [\"Hætta við breytingar\"] }, \"Confirm changes\": { \"v\": [\"Staðfesta breytingar\"] } } }, { \"l\": \"it\", \"t\": { \"Cancel changes\": { \"v\": [\"Annulla modifiche\"] }, \"Confirm changes\": { \"v\": [\"Conferma modifiche\"] } } }, { \"l\": \"ja\", \"t\": { \"Cancel changes\": { \"v\": [\"変更をキャンセル\"] }, \"Confirm changes\": { \"v\": [\"変更を承認\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Cancel changes\": { \"v\": [\"変更をキャンセル\"] }, \"Confirm changes\": { \"v\": [\"変更を承認\"] } } }, { \"l\": \"ko\", \"t\": { \"Cancel changes\": { \"v\": [\"변경 취소\"] }, \"Confirm changes\": { \"v\": [\"변경 사항 확인\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Cancel changes\": { \"v\": [\"Откажи ги промените\"] }, \"Confirm changes\": { \"v\": [\"Потврди ги промените\"] } } }, { \"l\": \"my\", \"t\": { \"Cancel changes\": { \"v\": [\"ပြောင်းလဲမှုများ ပယ်ဖျက်ရန်\"] }, \"Confirm changes\": { \"v\": [\"ပြောင်းလဲမှုများ အတည်ပြုရန်\"] } } }, { \"l\": \"nb\", \"t\": { \"Cancel changes\": { \"v\": [\"Avbryt endringer\"] }, \"Confirm changes\": { \"v\": [\"Bekreft endringer\"] } } }, { \"l\": \"nl\", \"t\": { \"Cancel changes\": { \"v\": [\"Wijzigingen annuleren\"] }, \"Confirm changes\": { \"v\": [\"Wijzigingen bevestigen\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Cancel changes\": { \"v\": [\"Anuluj zmiany\"] }, \"Confirm changes\": { \"v\": [\"Potwierdź zmiany\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancelar alterações\"] }, \"Confirm changes\": { \"v\": [\"Confirmar alterações\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Cancel changes\": { \"v\": [\"Cancelar alterações\"] }, \"Confirm changes\": { \"v\": [\"Confirmar alterações\"] } } }, { \"l\": \"ro\", \"t\": { \"Cancel changes\": { \"v\": [\"Anulează modificările\"] }, \"Confirm changes\": { \"v\": [\"Confirmați modificările\"] } } }, { \"l\": \"ru\", \"t\": { \"Cancel changes\": { \"v\": [\"Отменить изменения\"] }, \"Confirm changes\": { \"v\": [\"Подтвердить изменения\"] } } }, { \"l\": \"sk\", \"t\": { \"Cancel changes\": { \"v\": [\"Zrušiť zmeny\"] }, \"Confirm changes\": { \"v\": [\"Potvrdiť zmeny\"] } } }, { \"l\": \"sl\", \"t\": { \"Cancel changes\": { \"v\": [\"Prekliči spremembe\"] }, \"Confirm changes\": { \"v\": [\"Potrdi spremembe\"] } } }, { \"l\": \"sr\", \"t\": { \"Cancel changes\": { \"v\": [\"Откажи измене\"] }, \"Confirm changes\": { \"v\": [\"Потврдите измене\"] } } }, { \"l\": \"sv\", \"t\": { \"Cancel changes\": { \"v\": [\"Avbryt ändringar\"] }, \"Confirm changes\": { \"v\": [\"Bekräfta ändringar\"] } } }, { \"l\": \"tr\", \"t\": { \"Cancel changes\": { \"v\": [\"Değişiklikleri iptal et\"] }, \"Confirm changes\": { \"v\": [\"Değişiklikleri onayla\"] } } }, { \"l\": \"uk\", \"t\": { \"Cancel changes\": { \"v\": [\"Скасувати зміни\"] }, \"Confirm changes\": { \"v\": [\"Підтвердити зміни\"] } } }, { \"l\": \"uz\", \"t\": { \"Cancel changes\": { \"v\": [\"O'zgarishlarni bekor qilish\"] }, \"Confirm changes\": { \"v\": [\"O'zgarishlarni tasdiqlang\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Cancel changes\": { \"v\": [\"取消更改\"] }, \"Confirm changes\": { \"v\": [\"确认更改\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Cancel changes\": { \"v\": [\"取消更改\"] }, \"Confirm changes\": { \"v\": [\"確認更改\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Cancel changes\": { \"v\": [\"取消變更\"] }, \"Confirm changes\": { \"v\": [\"確認變更\"] } } }];\nconst t14 = [{ \"l\": \"ar\", \"t\": { \"Change name\": { \"v\": [\"تغيير الاسم\"] }, \"Close sidebar\": { \"v\": [\"قفل الشريط الجانبي\"] }, \"Favorite\": { \"v\": [\"المفضلة\"] }, \"Open sidebar\": { \"v\": [\"إفتَح الشريط الجانبي\"] } } }, { \"l\": \"ast\", \"t\": { \"Change name\": { \"v\": [\"Camudar el nome\"] }, \"Close sidebar\": { \"v\": [\"Zarrar la barra llateral\"] }, \"Favorite\": { \"v\": [\"Favoritu\"] }, \"Open sidebar\": { \"v\": [\"Abrir la barra llateral\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Close sidebar\": { \"v\": [\"Tancar la barra lateral\"] }, \"Favorite\": { \"v\": [\"Preferit\"] } } }, { \"l\": \"cs\", \"t\": { \"Change name\": { \"v\": [\"Změnit název\"] }, \"Close sidebar\": { \"v\": [\"Zavřít postranní panel\"] }, \"Favorite\": { \"v\": [\"Oblíbené\"] }, \"Open sidebar\": { \"v\": [\"Otevřít postranní panel\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Change name\": { \"v\": [\"Změnit název\"] }, \"Close sidebar\": { \"v\": [\"Zavřít postranní panel\"] }, \"Favorite\": { \"v\": [\"Oblíbené\"] } } }, { \"l\": \"da\", \"t\": { \"Change name\": { \"v\": [\"Ændre navn\"] }, \"Close sidebar\": { \"v\": [\"Luk sidepanel\"] }, \"Favorite\": { \"v\": [\"Favorit\"] }, \"Open sidebar\": { \"v\": [\"Åbn sidepanel\"] } } }, { \"l\": \"de\", \"t\": { \"Change name\": { \"v\": [\"Namen ändern\"] }, \"Close sidebar\": { \"v\": [\"Seitenleiste schließen\"] }, \"Favorite\": { \"v\": [\"Favorit\"] }, \"Open sidebar\": { \"v\": [\"Seitenleiste öffnen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Change name\": { \"v\": [\"Namen ändern\"] }, \"Close sidebar\": { \"v\": [\"Seitenleiste schließen\"] }, \"Favorite\": { \"v\": [\"Favorit\"] }, \"Open sidebar\": { \"v\": [\"Seitenleiste öffnen\"] } } }, { \"l\": \"el\", \"t\": { \"Change name\": { \"v\": [\"Αλλαγή ονόματος\"] }, \"Close sidebar\": { \"v\": [\"Κλείσιμο πλευρικής μπάρας\"] }, \"Favorite\": { \"v\": [\"Αγαπημένα\"] }, \"Open sidebar\": { \"v\": [\"Άνοιγμα πλευρικής μπάρας\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Change name\": { \"v\": [\"Change name\"] }, \"Close sidebar\": { \"v\": [\"Close sidebar\"] }, \"Favorite\": { \"v\": [\"Favourite\"] }, \"Open sidebar\": { \"v\": [\"Open sidebar\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Change name\": { \"v\": [\"Cambiar nombre\"] }, \"Close sidebar\": { \"v\": [\"Cerrar barra lateral\"] }, \"Favorite\": { \"v\": [\"Favorito\"] }, \"Open sidebar\": { \"v\": [\"Abrir barra lateral\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Change name\": { \"v\": [\"Cambiar nombre\"] }, \"Close sidebar\": { \"v\": [\"Cerrar barra lateral\"] }, \"Favorite\": { \"v\": [\"Favorito\"] }, \"Open sidebar\": { \"v\": [\"Abrir barra lateral\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Change name\": { \"v\": [\"Cambiar nombre\"] }, \"Close sidebar\": { \"v\": [\"Cerrar barra lateral\"] }, \"Favorite\": { \"v\": [\"Favorito\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Change name\": { \"v\": [\"Cambiar nombre\"] }, \"Close sidebar\": { \"v\": [\"Cerrar barra lateral\"] }, \"Favorite\": { \"v\": [\"Favorito\"] }, \"Open sidebar\": { \"v\": [\"Abrir barra lateral\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Change name\": { \"v\": [\"Muuda nime\"] }, \"Close sidebar\": { \"v\": [\"Sulge külgriba\"] }, \"Favorite\": { \"v\": [\"Lemmik\"] }, \"Open sidebar\": { \"v\": [\"Ava külgriba\"] } } }, { \"l\": \"eu\", \"t\": { \"Change name\": { \"v\": [\"Aldatu izena\"] }, \"Close sidebar\": { \"v\": [\"Itxi albo-barra\"] }, \"Favorite\": { \"v\": [\"Gogokoa\"] } } }, { \"l\": \"fa\", \"t\": { \"Change name\": { \"v\": [\"تغییر نام\"] }, \"Close sidebar\": { \"v\": [\"بستن نوار کناری\"] }, \"Favorite\": { \"v\": [\"مورد علاقه\"] }, \"Open sidebar\": { \"v\": [\"باز کردن نوار کنار\"] } } }, { \"l\": \"fi\", \"t\": { \"Change name\": { \"v\": [\"Vaihda nimi\"] }, \"Close sidebar\": { \"v\": [\"Sulje sivupalkki\"] }, \"Favorite\": { \"v\": [\"Suosikki\"] }, \"Open sidebar\": { \"v\": [\"Avaa sivupalkki\"] } } }, { \"l\": \"fr\", \"t\": { \"Change name\": { \"v\": [\"Modifier le nom\"] }, \"Close sidebar\": { \"v\": [\"Fermer la barre latérale\"] }, \"Favorite\": { \"v\": [\"Favori\"] }, \"Open sidebar\": { \"v\": [\"Ouvrir la barre latérale\"] } } }, { \"l\": \"ga\", \"t\": { \"Change name\": { \"v\": [\"Athrú ainm\"] }, \"Close sidebar\": { \"v\": [\"Dún barra taoibh\"] }, \"Favorite\": { \"v\": [\"is fearr leat\"] }, \"Open sidebar\": { \"v\": [\"Oscail barra taoibh\"] } } }, { \"l\": \"gl\", \"t\": { \"Change name\": { \"v\": [\"Cambiar o nome\"] }, \"Close sidebar\": { \"v\": [\"Pechar a barra lateral\"] }, \"Favorite\": { \"v\": [\"Favorito\"] }, \"Open sidebar\": { \"v\": [\"Abrir a barra lateral\"] } } }, { \"l\": \"he\", \"t\": { \"Change name\": { \"v\": [\"החלפת שם\"] }, \"Close sidebar\": { \"v\": [\"סגירת סרגל הצד\"] }, \"Favorite\": { \"v\": [\"למועדפים\"] } } }, { \"l\": \"hu\", \"t\": { \"Close sidebar\": { \"v\": [\"Oldalsáv bezárása\"] }, \"Favorite\": { \"v\": [\"Kedvenc\"] } } }, { \"l\": \"id\", \"t\": { \"Change name\": { \"v\": [\"Ubah nama\"] }, \"Close sidebar\": { \"v\": [\"Tutup bilah sisi\"] }, \"Favorite\": { \"v\": [\"Favorit\"] } } }, { \"l\": \"is\", \"t\": { \"Change name\": { \"v\": [\"Breyta nafni\"] }, \"Close sidebar\": { \"v\": [\"Loka hliðarstiku\"] }, \"Favorite\": { \"v\": [\"Eftirlæti\"] }, \"Open sidebar\": { \"v\": [\"Opna hliðarspjald\"] } } }, { \"l\": \"it\", \"t\": { \"Change name\": { \"v\": [\"Cambia nome\"] }, \"Close sidebar\": { \"v\": [\"Chiudi la barra laterale\"] }, \"Favorite\": { \"v\": [\"Preferito\"] } } }, { \"l\": \"ja\", \"t\": { \"Change name\": { \"v\": [\"名前の変更\"] }, \"Close sidebar\": { \"v\": [\"サイドバーを閉じる\"] }, \"Favorite\": { \"v\": [\"お気に入り\"] }, \"Open sidebar\": { \"v\": [\"サイドバーを開く\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Change name\": { \"v\": [\"名前の変更\"] }, \"Close sidebar\": { \"v\": [\"サイドバーを閉じる\"] }, \"Favorite\": { \"v\": [\"お気に入り\"] }, \"Open sidebar\": { \"v\": [\"サイドバーを開く\"] } } }, { \"l\": \"ko\", \"t\": { \"Change name\": { \"v\": [\"이름 변경\"] }, \"Close sidebar\": { \"v\": [\"사이드바 닫기\"] }, \"Favorite\": { \"v\": [\"즐겨찾기\"] }, \"Open sidebar\": { \"v\": [\"사이드바 열기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Favorite\": { \"v\": [\"Фаворити\"] } } }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Change name\": { \"v\": [\"Endre navn\"] }, \"Close sidebar\": { \"v\": [\"Lukk sidepanel\"] }, \"Favorite\": { \"v\": [\"Favoritt\"] }, \"Open sidebar\": { \"v\": [\"Åpne sidefelt\"] } } }, { \"l\": \"nl\", \"t\": { \"Change name\": { \"v\": [\"Verander naam\"] }, \"Close sidebar\": { \"v\": [\"Sluit sidebar\"] }, \"Favorite\": { \"v\": [\"Favoriet\"] }, \"Open sidebar\": { \"v\": [\"Open sidebar\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Change name\": { \"v\": [\"Zmień nazwę\"] }, \"Close sidebar\": { \"v\": [\"Zamknij pasek boczny\"] }, \"Favorite\": { \"v\": [\"Ulubiony\"] }, \"Open sidebar\": { \"v\": [\"Otwórz pasek boczny\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Change name\": { \"v\": [\"Mudar nome\"] }, \"Close sidebar\": { \"v\": [\"Fechar barra lateral\"] }, \"Favorite\": { \"v\": [\"Favorito\"] }, \"Open sidebar\": { \"v\": [\"Abrir barra lateral\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Change name\": { \"v\": [\"Alterar nome\"] }, \"Close sidebar\": { \"v\": [\"Fechar barra lateral\"] }, \"Favorite\": { \"v\": [\"Favorito\"] }, \"Open sidebar\": { \"v\": [\"Abrir barra lateral\"] } } }, { \"l\": \"ro\", \"t\": { \"Change name\": { \"v\": [\"Modifică numele\"] }, \"Close sidebar\": { \"v\": [\"Închide bara laterală\"] }, \"Favorite\": { \"v\": [\"Favorit\"] } } }, { \"l\": \"ru\", \"t\": { \"Change name\": { \"v\": [\"Изменить имя\"] }, \"Close sidebar\": { \"v\": [\"Закрыть сайдбар\"] }, \"Favorite\": { \"v\": [\"Избранное\"] }, \"Open sidebar\": { \"v\": [\"Открыть боковую панель\"] } } }, { \"l\": \"sk\", \"t\": { \"Change name\": { \"v\": [\"Zmeniť názov\"] }, \"Close sidebar\": { \"v\": [\"Zavrieť bočný panel\"] }, \"Favorite\": { \"v\": [\"Obľúbené\"] }, \"Open sidebar\": { \"v\": [\"Otvoriť bočný panel\"] } } }, { \"l\": \"sl\", \"t\": { \"Close sidebar\": { \"v\": [\"Zapri stransko vrstico\"] }, \"Favorite\": { \"v\": [\"Priljubljeno\"] } } }, { \"l\": \"sr\", \"t\": { \"Change name\": { \"v\": [\"Измени назив\"] }, \"Close sidebar\": { \"v\": [\"Затвори бочну траку\"] }, \"Favorite\": { \"v\": [\"Омиљени\"] }, \"Open sidebar\": { \"v\": [\"Отвори бочну траку\"] } } }, { \"l\": \"sv\", \"t\": { \"Change name\": { \"v\": [\"Ändra namn\"] }, \"Close sidebar\": { \"v\": [\"Stäng sidofältet\"] }, \"Favorite\": { \"v\": [\"Favorit\"] }, \"Open sidebar\": { \"v\": [\"Öppna sidofältet\"] } } }, { \"l\": \"tr\", \"t\": { \"Change name\": { \"v\": [\"Adı değiştir\"] }, \"Close sidebar\": { \"v\": [\"Yan çubuğu kapat\"] }, \"Favorite\": { \"v\": [\"Sık kullanılanlara ekle\"] }, \"Open sidebar\": { \"v\": [\"Yan çubuğu aç\"] } } }, { \"l\": \"uk\", \"t\": { \"Change name\": { \"v\": [\"Змінити назву\"] }, \"Close sidebar\": { \"v\": [\"Закрити бічну панель\"] }, \"Favorite\": { \"v\": [\"Із зірочкою\"] }, \"Open sidebar\": { \"v\": [\"Бокове меню\"] } } }, { \"l\": \"uz\", \"t\": { \"Change name\": { \"v\": [\"Ismni o'zgartirish\"] }, \"Close sidebar\": { \"v\": [\"Yon panelni yoping\"] }, \"Favorite\": { \"v\": [\"Tanlangan\"] }, \"Open sidebar\": { \"v\": [\"Yon panelni oching\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Change name\": { \"v\": [\"修改名称\"] }, \"Close sidebar\": { \"v\": [\"关闭侧边栏\"] }, \"Favorite\": { \"v\": [\"喜爱\"] }, \"Open sidebar\": { \"v\": [\"打开侧边栏\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Change name\": { \"v\": [\"更改名稱\"] }, \"Close sidebar\": { \"v\": [\"關閉側邊欄\"] }, \"Favorite\": { \"v\": [\"喜愛\"] }, \"Open sidebar\": { \"v\": [\"打開側邊欄\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Change name\": { \"v\": [\"變更名稱\"] }, \"Close sidebar\": { \"v\": [\"關閉側邊欄\"] }, \"Favorite\": { \"v\": [\"最愛\"] } } }];\nconst t15 = [{ \"l\": \"ar\", \"t\": { \"Clear search\": { \"v\": [\"محو البحث\"] } } }, { \"l\": \"ast\", \"t\": { \"Clear search\": { \"v\": [\"Borrar la busca\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Clear search\": { \"v\": [\"Vyčistit vyhledávání\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Clear search\": { \"v\": [\"Vyčistit vyhledávání\"] } } }, { \"l\": \"da\", \"t\": { \"Clear search\": { \"v\": [\"Ryd søgning\"] } } }, { \"l\": \"de\", \"t\": { \"Clear search\": { \"v\": [\"Suche leeren\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Clear search\": { \"v\": [\"Suche leeren\"] } } }, { \"l\": \"el\", \"t\": { \"Clear search\": { \"v\": [\"Εκκαθάριση αναζήτησης\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Clear search\": { \"v\": [\"Clear search\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Clear search\": { \"v\": [\"Limpiar búsqueda\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Clear search\": { \"v\": [\"Limpiar búsqueda\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Clear search\": { \"v\": [\"Limpiar búsqueda\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Clear search\": { \"v\": [\"Limpiar búsqueda\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Clear search\": { \"v\": [\"Tühjenda otsing\"] } } }, { \"l\": \"eu\", \"t\": { \"Clear search\": { \"v\": [\"Garbitu bilaketa\"] } } }, { \"l\": \"fa\", \"t\": { \"Clear search\": { \"v\": [\"پاک کردن جستجو\"] } } }, { \"l\": \"fi\", \"t\": { \"Clear search\": { \"v\": [\"Tyhjennä haku\"] } } }, { \"l\": \"fr\", \"t\": { \"Clear search\": { \"v\": [\"Effacer la recherche\"] } } }, { \"l\": \"ga\", \"t\": { \"Clear search\": { \"v\": [\"Glan cuardach\"] } } }, { \"l\": \"gl\", \"t\": { \"Clear search\": { \"v\": [\"Limpar a busca\"] } } }, { \"l\": \"he\", \"t\": { \"Clear search\": { \"v\": [\"פינוי חיפוש\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Clear search\": { \"v\": [\"Bersihkan pencarian\"] } } }, { \"l\": \"is\", \"t\": { \"Clear search\": { \"v\": [\"Hreinsa leit\"] } } }, { \"l\": \"it\", \"t\": { \"Clear search\": { \"v\": [\"online\"] } } }, { \"l\": \"ja\", \"t\": { \"Clear search\": { \"v\": [\"検索をクリア\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Clear search\": { \"v\": [\"検索をクリア\"] } } }, { \"l\": \"ko\", \"t\": { \"Clear search\": { \"v\": [\"검색 지우기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Clear search\": { \"v\": [\"Tøm søk\"] } } }, { \"l\": \"nl\", \"t\": { \"Clear search\": { \"v\": [\"Wis zoekopdracht\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Clear search\": { \"v\": [\"Wyczyść wyszukiwanie\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Clear search\": { \"v\": [\"Limpar pesquisa\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Clear search\": { \"v\": [\"Limpar pesquisa\"] } } }, { \"l\": \"ro\", \"t\": { \"Clear search\": { \"v\": [\"Șterge căutarea\"] } } }, { \"l\": \"ru\", \"t\": { \"Clear search\": { \"v\": [\"Очистить поиск\"] } } }, { \"l\": \"sk\", \"t\": { \"Clear search\": { \"v\": [\"Vymazať vyhľadávanie\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Clear search\": { \"v\": [\"Обриши претрагу\"] } } }, { \"l\": \"sv\", \"t\": { \"Clear search\": { \"v\": [\"Rensa sökning\"] } } }, { \"l\": \"tr\", \"t\": { \"Clear search\": { \"v\": [\"Aramayı temizle\"] } } }, { \"l\": \"uk\", \"t\": { \"Clear search\": { \"v\": [\"Очистити пошук\"] } } }, { \"l\": \"uz\", \"t\": { \"Clear search\": { \"v\": [\"Qidiruvni tozalash\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Clear search\": { \"v\": [\"清除搜索\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Clear search\": { \"v\": [\"清除搜索\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Clear search\": { \"v\": [\"清除搜尋\"] } } }];\nconst t16 = [{ \"l\": \"ar\", \"t\": { \"Clear selected\": { \"v\": [\"محو المحدّد\"] }, \"Deselect {option}\": { \"v\": [\"إلغاء تحديد {option}\"] }, \"Options\": { \"v\": [\"خيارات\"] } } }, { \"l\": \"ast\", \"t\": { \"Clear selected\": { \"v\": [\"Borrar lo seleicionao\"] }, \"Deselect {option}\": { \"v\": [\"Deseleicionar «{option}»\"] }, \"Options\": { \"v\": [\"Opciones\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Clear selected\": { \"v\": [\"Vyčistit vybrané\"] }, \"Deselect {option}\": { \"v\": [\"Zrušit výběr {option}\"] }, \"Options\": { \"v\": [\"Možnosti\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Clear selected\": { \"v\": [\"Vyčistit vybrané\"] }, \"Deselect {option}\": { \"v\": [\"Zrušit výběr {option}\"] }, \"Options\": { \"v\": [\"Možnosti\"] } } }, { \"l\": \"da\", \"t\": { \"Clear selected\": { \"v\": [\"Ryd valgt\"] }, \"Deselect {option}\": { \"v\": [\"Fravælg {option}\"] }, \"Options\": { \"v\": [\"Indstillinger\"] } } }, { \"l\": \"de\", \"t\": { \"Clear selected\": { \"v\": [\"Auswahl leeren\"] }, \"Deselect {option}\": { \"v\": [\"{option} abwählen\"] }, \"Options\": { \"v\": [\"Optionen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Clear selected\": { \"v\": [\"Auswahl leeren\"] }, \"Deselect {option}\": { \"v\": [\"{option} abwählen\"] }, \"Options\": { \"v\": [\"Optionen\"] } } }, { \"l\": \"el\", \"t\": { \"Clear selected\": { \"v\": [\"Εκκαθάριση επιλογής\"] }, \"Deselect {option}\": { \"v\": [\"Αποεπιλογή {option}\"] }, \"Options\": { \"v\": [\"Επιλογές\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Clear selected\": { \"v\": [\"Clear selected\"] }, \"Deselect {option}\": { \"v\": [\"Deselect {option}\"] }, \"Options\": { \"v\": [\"Options\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Clear selected\": { \"v\": [\"Limpiar selección\"] }, \"Deselect {option}\": { \"v\": [\"Deseleccionar {option}\"] }, \"Options\": { \"v\": [\"Opciones\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Clear selected\": { \"v\": [\"Limpiar selección\"] }, \"Deselect {option}\": { \"v\": [\"Deseleccionar {option}\"] }, \"Options\": { \"v\": [\"Opciones\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"Clear selected\": { \"v\": [\"Limpiar selección\"] }, \"Deselect {option}\": { \"v\": [\"Deseleccionar {option}\"] }, \"Options\": { \"v\": [\"Opciones\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Clear selected\": { \"v\": [\"Tühjenad valik\"] }, \"Deselect {option}\": { \"v\": [\"Eemalda {option} valik\"] }, \"Options\": { \"v\": [\"Valikud\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"Clear selected\": { \"v\": [\"پاک کردن مورد انتخاب شده\"] }, \"Deselect {option}\": { \"v\": [\"لغو انتخاب {option}\"] }, \"Options\": { \"v\": [\"گزینه‌ها\"] } } }, { \"l\": \"fi\", \"t\": { \"Clear selected\": { \"v\": [\"Tyhjennä valitut\"] }, \"Deselect {option}\": { \"v\": [\"Poista valinta {option}\"] }, \"Options\": { \"v\": [\"Valinnat\"] } } }, { \"l\": \"fr\", \"t\": { \"Clear selected\": { \"v\": [\"Vider la sélection\"] }, \"Deselect {option}\": { \"v\": [\"Désélectionner {option}\"] }, \"Options\": { \"v\": [\"Options\"] } } }, { \"l\": \"ga\", \"t\": { \"Clear selected\": { \"v\": [\"Glan roghnaithe\"] }, \"Deselect {option}\": { \"v\": [\"Díroghnaigh {option}\"] }, \"Options\": { \"v\": [\"Roghanna\"] } } }, { \"l\": \"gl\", \"t\": { \"Clear selected\": { \"v\": [\"Limpar o seleccionado\"] }, \"Deselect {option}\": { \"v\": [\"Desmarcar {opción}\"] }, \"Options\": { \"v\": [\"Opcións\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Clear selected\": { \"v\": [\"Hapus terpilih\"] }, \"Deselect {option}\": { \"v\": [\"Batalkan pemilihan {option}\"] } } }, { \"l\": \"is\", \"t\": { \"Clear selected\": { \"v\": [\"Hreinsa valið\"] }, \"Deselect {option}\": { \"v\": [\"Afvelja {option}\"] }, \"Options\": { \"v\": [\"Valkostir\"] } } }, { \"l\": \"it\", \"t\": { \"Clear selected\": { \"v\": [\"Cancella selezionati\"] }, \"Deselect {option}\": { \"v\": [\"Deselezionare {option}\"] } } }, { \"l\": \"ja\", \"t\": { \"Clear selected\": { \"v\": [\"選択を解除\"] }, \"Deselect {option}\": { \"v\": [\"{option} の選択を解除\"] }, \"Options\": { \"v\": [\"オプション\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Clear selected\": { \"v\": [\"選択を解除\"] }, \"Deselect {option}\": { \"v\": [\"{option} の選択を解除\"] }, \"Options\": { \"v\": [\"オプション\"] } } }, { \"l\": \"ko\", \"t\": { \"Clear selected\": { \"v\": [\"선택 항목 지우기\"] }, \"Deselect {option}\": { \"v\": [\"{option} 선택 해제\"] }, \"Options\": { \"v\": [\"옵션\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Clear selected\": { \"v\": [\"Tøm merket\"] }, \"Deselect {option}\": { \"v\": [\"Opphev valg {option}\"] }, \"Options\": { \"v\": [\"Alternativer\"] } } }, { \"l\": \"nl\", \"t\": { \"Clear selected\": { \"v\": [\"Selectie wissen\"] }, \"Deselect {option}\": { \"v\": [\"Deselecteer {optie}\"] }, \"Options\": { \"v\": [\"Opties\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Clear selected\": { \"v\": [\"Wyczyść wybrane\"] }, \"Deselect {option}\": { \"v\": [\"Odznacz {option}\"] }, \"Options\": { \"v\": [\"Opcje\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Clear selected\": { \"v\": [\"Limpar selecionados\"] }, \"Deselect {option}\": { \"v\": [\"Desmacar {option}\"] }, \"Options\": { \"v\": [\"Opções\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Clear selected\": { \"v\": [\"Limpeza selecionada\"] }, \"Deselect {option}\": { \"v\": [\"Desmarcar {option}\"] }, \"Options\": { \"v\": [\"Opções\"] } } }, { \"l\": \"ro\", \"t\": { \"Clear selected\": { \"v\": [\"Șterge selecția\"] }, \"Deselect {option}\": { \"v\": [\"Deselctează {option}\"] } } }, { \"l\": \"ru\", \"t\": { \"Clear selected\": { \"v\": [\"Очистить выбранный\"] }, \"Deselect {option}\": { \"v\": [\"Отменить выбор {option}\"] }, \"Options\": { \"v\": [\"Варианты\"] } } }, { \"l\": \"sk\", \"t\": { \"Clear selected\": { \"v\": [\"Vymazať vybraté\"] }, \"Deselect {option}\": { \"v\": [\"Zrušiť výber {option}\"] }, \"Options\": { \"v\": [\"možnosti\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Clear selected\": { \"v\": [\"Обриши изабрано\"] }, \"Deselect {option}\": { \"v\": [\"Уклони избор {option}\"] }, \"Options\": { \"v\": [\"Опције\"] } } }, { \"l\": \"sv\", \"t\": { \"Clear selected\": { \"v\": [\"Rensa val\"] }, \"Deselect {option}\": { \"v\": [\"Avmarkera {option}\"] }, \"Options\": { \"v\": [\"Alternativ\"] } } }, { \"l\": \"tr\", \"t\": { \"Clear selected\": { \"v\": [\"Seçilmişleri temizle\"] }, \"Deselect {option}\": { \"v\": [\"{option} bırak\"] }, \"Options\": { \"v\": [\"Seçenekler\"] } } }, { \"l\": \"uk\", \"t\": { \"Clear selected\": { \"v\": [\"Очистити вибране\"] }, \"Deselect {option}\": { \"v\": [\"Зняти вибір {option}\"] }, \"Options\": { \"v\": [\"Параметри\"] } } }, { \"l\": \"uz\", \"t\": { \"Clear selected\": { \"v\": [\"Tanlanganni tozalash\"] }, \"Deselect {option}\": { \"v\": [\"{option}tanlovni bekor qiling\"] }, \"Options\": { \"v\": [\"Variantlar\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Clear selected\": { \"v\": [\"清除所选\"] }, \"Deselect {option}\": { \"v\": [\"取消选择 {option}\"] }, \"Options\": { \"v\": [\"选项\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Clear selected\": { \"v\": [\"清除所選項目\"] }, \"Deselect {option}\": { \"v\": [\"取消選擇 {option}\"] }, \"Options\": { \"v\": [\"選項\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t17 = [{ \"l\": \"ar\", \"t\": { \"Clear text\": { \"v\": [\"محو النص\"] }, \"Save changes\": { \"v\": [\"حفظ التغييرات\"] } } }, { \"l\": \"ast\", \"t\": { \"Clear text\": { \"v\": [\"Borrar el testu\"] }, \"Save changes\": { \"v\": [\"Guardar los cambeos\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Clear text\": { \"v\": [\"Netejar text\"] } } }, { \"l\": \"cs\", \"t\": { \"Clear text\": { \"v\": [\"Čitelný text\"] }, \"Save changes\": { \"v\": [\"Uložit změny\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Clear text\": { \"v\": [\"Čitelný text\"] }, \"Save changes\": { \"v\": [\"Uložit změny\"] } } }, { \"l\": \"da\", \"t\": { \"Clear text\": { \"v\": [\"Ryd tekst\"] }, \"Save changes\": { \"v\": [\"Gem ændringer\"] } } }, { \"l\": \"de\", \"t\": { \"Clear text\": { \"v\": [\"Klartext\"] }, \"Save changes\": { \"v\": [\"Änderungen speichern\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Clear text\": { \"v\": [\"Klartext\"] }, \"Save changes\": { \"v\": [\"Änderungen speichern\"] } } }, { \"l\": \"el\", \"t\": { \"Clear text\": { \"v\": [\"Εκκαθάριση κειμένου\"] }, \"Save changes\": { \"v\": [\"Αποθήκευση αλλαγών\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Clear text\": { \"v\": [\"Clear text\"] }, \"Save changes\": { \"v\": [\"Save changes\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Clear text\": { \"v\": [\"Limpiar texto\"] }, \"Save changes\": { \"v\": [\"Guardar cambios\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Clear text\": { \"v\": [\"Limpiar texto\"] }, \"Save changes\": { \"v\": [\"Guardar cambios\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Clear text\": { \"v\": [\"Limpiar texto\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Clear text\": { \"v\": [\"Limpiar texto\"] }, \"Save changes\": { \"v\": [\"Guardar cambios\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Clear text\": { \"v\": [\"Kustuta tekst\"] }, \"Save changes\": { \"v\": [\"Salvesta muudatused\"] } } }, { \"l\": \"eu\", \"t\": { \"Clear text\": { \"v\": [\"Garbitu testua\"] } } }, { \"l\": \"fa\", \"t\": { \"Clear text\": { \"v\": [\"پاک کردن متن\"] }, \"Save changes\": { \"v\": [\"ذخیرهٔ تغییرات\"] } } }, { \"l\": \"fi\", \"t\": { \"Clear text\": { \"v\": [\"Tyhjennä teksti\"] }, \"Save changes\": { \"v\": [\"Tallenna muutokset\"] } } }, { \"l\": \"fr\", \"t\": { \"Clear text\": { \"v\": [\"Effacer le texte\"] }, \"Save changes\": { \"v\": [\"Sauvegarder les changements\"] } } }, { \"l\": \"ga\", \"t\": { \"Clear text\": { \"v\": [\"Glan téacs\"] }, \"Save changes\": { \"v\": [\"Sabháil na hathruithe\"] } } }, { \"l\": \"gl\", \"t\": { \"Clear text\": { \"v\": [\"Limpar o texto\"] }, \"Save changes\": { \"v\": [\"Gardar os cambios\"] } } }, { \"l\": \"he\", \"t\": { \"Clear text\": { \"v\": [\"פינוי טקסט\"] } } }, { \"l\": \"hu\", \"t\": { \"Clear text\": { \"v\": [\"Szöveg törlése\"] } } }, { \"l\": \"id\", \"t\": { \"Clear text\": { \"v\": [\"Bersihkan teks\"] }, \"Save changes\": { \"v\": [\"Simpan perubahan\"] } } }, { \"l\": \"is\", \"t\": { \"Clear text\": { \"v\": [\"Hreinsa texta\"] }, \"Save changes\": { \"v\": [\"Vista breytingar\"] } } }, { \"l\": \"it\", \"t\": { \"Clear text\": { \"v\": [\"Cancella il testo\"] }, \"Save changes\": { \"v\": [\"Salva le modifiche\"] } } }, { \"l\": \"ja\", \"t\": { \"Clear text\": { \"v\": [\"テキストをクリア\"] }, \"Save changes\": { \"v\": [\"変更を保存\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Clear text\": { \"v\": [\"テキストをクリア\"] }, \"Save changes\": { \"v\": [\"変更を保存\"] } } }, { \"l\": \"ko\", \"t\": { \"Clear text\": { \"v\": [\"텍스트 지우기\"] }, \"Save changes\": { \"v\": [\"변경 사항 저장\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Clear text\": { \"v\": [\"Fjern tekst\"] }, \"Save changes\": { \"v\": [\"Lagre endringer\"] } } }, { \"l\": \"nl\", \"t\": { \"Clear text\": { \"v\": [\"Wis tekst\"] }, \"Save changes\": { \"v\": [\"Wijzigingen opslaan\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Clear text\": { \"v\": [\"Wyczyść tekst\"] }, \"Save changes\": { \"v\": [\"Zapisz zmiany\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Clear text\": { \"v\": [\"Limpar texto\"] }, \"Save changes\": { \"v\": [\"Salvar alterações\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Clear text\": { \"v\": [\"Limpar texto\"] }, \"Save changes\": { \"v\": [\"Gravar alterações\"] } } }, { \"l\": \"ro\", \"t\": { \"Clear text\": { \"v\": [\"Șterge textul\"] }, \"Save changes\": { \"v\": [\"Salvează modificările\"] } } }, { \"l\": \"ru\", \"t\": { \"Clear text\": { \"v\": [\"Очистить текст\"] }, \"Save changes\": { \"v\": [\"Сохранить изменения\"] } } }, { \"l\": \"sk\", \"t\": { \"Clear text\": { \"v\": [\"Vamazať text\"] }, \"Save changes\": { \"v\": [\"Uložiť zmeny\"] } } }, { \"l\": \"sl\", \"t\": { \"Clear text\": { \"v\": [\"Počisti besedilo\"] } } }, { \"l\": \"sr\", \"t\": { \"Clear text\": { \"v\": [\"Обриши текст\"] }, \"Save changes\": { \"v\": [\"Сачувај измене\"] } } }, { \"l\": \"sv\", \"t\": { \"Clear text\": { \"v\": [\"Ta bort text\"] }, \"Save changes\": { \"v\": [\"Spara ändringar\"] } } }, { \"l\": \"tr\", \"t\": { \"Clear text\": { \"v\": [\"Metni temizle\"] }, \"Save changes\": { \"v\": [\"Değişiklikleri kaydet\"] } } }, { \"l\": \"uk\", \"t\": { \"Clear text\": { \"v\": [\"Очистити текст\"] }, \"Save changes\": { \"v\": [\"Зберегти зміни\"] } } }, { \"l\": \"uz\", \"t\": { \"Clear text\": { \"v\": [\"Matnni tozalash\"] }, \"Save changes\": { \"v\": [\"O'zgarishlarni saqlang\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Clear text\": { \"v\": [\"清除文本\"] }, \"Save changes\": { \"v\": [\"保存修改\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Clear text\": { \"v\": [\"清除文本\"] }, \"Save changes\": { \"v\": [\"保存更改\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Clear text\": { \"v\": [\"清除文字\"] } } }];\nconst t18 = [{ \"l\": \"ar\", \"t\": { \"Close\": { \"v\": [\"إغلاق\"] } } }, { \"l\": \"ast\", \"t\": { \"Close\": { \"v\": [\"Zarrar\"] } } }, { \"l\": \"br\", \"t\": { \"Close\": { \"v\": [\"Serriñ\"] } } }, { \"l\": \"ca\", \"t\": { \"Close\": { \"v\": [\"Tanca\"] } } }, { \"l\": \"cs\", \"t\": { \"Close\": { \"v\": [\"Zavřít\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Close\": { \"v\": [\"Zavřít\"] } } }, { \"l\": \"da\", \"t\": { \"Close\": { \"v\": [\"Luk\"] } } }, { \"l\": \"de\", \"t\": { \"Close\": { \"v\": [\"Schließen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Close\": { \"v\": [\"Schließen\"] } } }, { \"l\": \"el\", \"t\": { \"Close\": { \"v\": [\"Κλείσιμο\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Close\": { \"v\": [\"Close\"] } } }, { \"l\": \"eo\", \"t\": { \"Close\": { \"v\": [\"Fermu\"] } } }, { \"l\": \"es\", \"t\": { \"Close\": { \"v\": [\"Cerrar\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Close\": { \"v\": [\"Cerrar\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Close\": { \"v\": [\"Cerrar\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Close\": { \"v\": [\"Cerrar\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Close\": { \"v\": [\"Sulge\"] } } }, { \"l\": \"eu\", \"t\": { \"Close\": { \"v\": [\"Itxi\"] } } }, { \"l\": \"fa\", \"t\": { \"Close\": { \"v\": [\"بستن\"] } } }, { \"l\": \"fi\", \"t\": { \"Close\": { \"v\": [\"Sulje\"] } } }, { \"l\": \"fr\", \"t\": { \"Close\": { \"v\": [\"Fermer\"] } } }, { \"l\": \"ga\", \"t\": { \"Close\": { \"v\": [\"Dún\"] } } }, { \"l\": \"gl\", \"t\": { \"Close\": { \"v\": [\"Pechar\"] } } }, { \"l\": \"he\", \"t\": { \"Close\": { \"v\": [\"סגירה\"] } } }, { \"l\": \"hu\", \"t\": { \"Close\": { \"v\": [\"Bezárás\"] } } }, { \"l\": \"id\", \"t\": { \"Close\": { \"v\": [\"Tutup\"] } } }, { \"l\": \"is\", \"t\": { \"Close\": { \"v\": [\"Loka\"] } } }, { \"l\": \"it\", \"t\": { \"Close\": { \"v\": [\"Chiudi\"] } } }, { \"l\": \"ja\", \"t\": { \"Close\": { \"v\": [\"閉じる\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Close\": { \"v\": [\"閉じる\"] } } }, { \"l\": \"ko\", \"t\": { \"Close\": { \"v\": [\"닫기\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"Close\": { \"v\": [\"Užverti\"] } } }, { \"l\": \"lv\", \"t\": { \"Close\": { \"v\": [\"Aizvērt\"] } } }, { \"l\": \"mk\", \"t\": { \"Close\": { \"v\": [\"Затвори\"] } } }, { \"l\": \"my\", \"t\": { \"Close\": { \"v\": [\"ပိတ်ရန်\"] } } }, { \"l\": \"nb\", \"t\": { \"Close\": { \"v\": [\"Lukk\"] } } }, { \"l\": \"nl\", \"t\": { \"Close\": { \"v\": [\"Sluiten\"] } } }, { \"l\": \"oc\", \"t\": { \"Close\": { \"v\": [\"Tampar\"] } } }, { \"l\": \"pl\", \"t\": { \"Close\": { \"v\": [\"Zamknij\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Close\": { \"v\": [\"Fechar\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Close\": { \"v\": [\"Fechar\"] } } }, { \"l\": \"ro\", \"t\": { \"Close\": { \"v\": [\"Închideți\"] } } }, { \"l\": \"ru\", \"t\": { \"Close\": { \"v\": [\"Закрыть\"] } } }, { \"l\": \"sk\", \"t\": { \"Close\": { \"v\": [\"Zavrieť\"] } } }, { \"l\": \"sl\", \"t\": { \"Close\": { \"v\": [\"Zapri\"] } } }, { \"l\": \"sr\", \"t\": { \"Close\": { \"v\": [\"Затвори\"] } } }, { \"l\": \"sv\", \"t\": { \"Close\": { \"v\": [\"Stäng\"] } } }, { \"l\": \"tr\", \"t\": { \"Close\": { \"v\": [\"Kapat\"] } } }, { \"l\": \"uk\", \"t\": { \"Close\": { \"v\": [\"Закрити\"] } } }, { \"l\": \"uz\", \"t\": { \"Close\": { \"v\": [\"Yopish\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Close\": { \"v\": [\"关闭\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Close\": { \"v\": [\"關閉\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Close\": { \"v\": [\"關閉\"] } } }];\nconst t19 = [{ \"l\": \"ar\", \"t\": { \"Close navigation\": { \"v\": [\"إغلاق التصفح\"] }, \"Open navigation {shortcut}\": { \"v\": [\"إفتَح المتصفح {shortcut}\"] } } }, { \"l\": \"ast\", \"t\": { \"Close navigation\": { \"v\": [\"Zarrar la navegación\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Close navigation\": { \"v\": [\"Tanca la navegació\"] } } }, { \"l\": \"cs\", \"t\": { \"Close navigation\": { \"v\": [\"Zavřít navigaci\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Otevřít navigaci {shortcut}\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Close navigation\": { \"v\": [\"Zavřít navigaci\"] } } }, { \"l\": \"da\", \"t\": { \"Close navigation\": { \"v\": [\"Luk navigation\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Åbn navigation {shortcut}\"] } } }, { \"l\": \"de\", \"t\": { \"Close navigation\": { \"v\": [\"Navigation schließen\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Navigation öffnen {shortcut}\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Close navigation\": { \"v\": [\"Navigation schließen\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Navigation öffnen {shortcut}\"] } } }, { \"l\": \"el\", \"t\": { \"Close navigation\": { \"v\": [\"Κλείσιμο πλοήγησης\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Άνοιγμα πλοήγησης {shortcut}\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Close navigation\": { \"v\": [\"Close navigation\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Open navigation {shortcut}\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Close navigation\": { \"v\": [\"Cerrar navegación\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Close navigation\": { \"v\": [\"Cerrar navegación\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Close navigation\": { \"v\": [\"Cerrar navegación\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Close navigation\": { \"v\": [\"Cerrar navegación\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Close navigation\": { \"v\": [\"Sulge navigatsioon\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Ava valik {shortcut}\"] } } }, { \"l\": \"eu\", \"t\": { \"Close navigation\": { \"v\": [\"Itxi nabigazioa\"] } } }, { \"l\": \"fa\", \"t\": { \"Close navigation\": { \"v\": [\"بستن بخش ناوبری\"] } } }, { \"l\": \"fi\", \"t\": { \"Close navigation\": { \"v\": [\"Sulje navigaatio\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Avaa navigaatio {shortcut}\"] } } }, { \"l\": \"fr\", \"t\": { \"Close navigation\": { \"v\": [\"Fermer la navigation\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Ouvrir la navigation {shortcut}\"] } } }, { \"l\": \"ga\", \"t\": { \"Close navigation\": { \"v\": [\"Dún nascleanúint\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Oscail nascleanúint {shortcut}\"] } } }, { \"l\": \"gl\", \"t\": { \"Close navigation\": { \"v\": [\"Pechar a navegación\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Abrir a navegación {shortcut}\"] } } }, { \"l\": \"he\", \"t\": { \"Close navigation\": { \"v\": [\"סגירת הניווט\"] } } }, { \"l\": \"hu\", \"t\": { \"Close navigation\": { \"v\": [\"Navigáció bezárása\"] } } }, { \"l\": \"id\", \"t\": { \"Close navigation\": { \"v\": [\"Tutup navigasi\"] } } }, { \"l\": \"is\", \"t\": { \"Close navigation\": { \"v\": [\"Loka leiðsagnarsleða\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Opna flakkstýringu {shortcut}\"] } } }, { \"l\": \"it\", \"t\": { \"Close navigation\": { \"v\": [\"Chiudi la navigazione\"] } } }, { \"l\": \"ja\", \"t\": { \"Close navigation\": { \"v\": [\"ナビゲーションを閉じる\"] }, \"Open navigation {shortcut}\": { \"v\": [\"ナビゲーションを開く {shortcut}\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Close navigation\": { \"v\": [\"ナビゲーションを閉じる\"] } } }, { \"l\": \"ko\", \"t\": { \"Close navigation\": { \"v\": [\"탐색 닫기\"] }, \"Open navigation {shortcut}\": { \"v\": [\"{shortcut} 탐색 열기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Close navigation\": { \"v\": [\"Затвори навигација\"] } } }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Close navigation\": { \"v\": [\"Lukk navigasjon\"] } } }, { \"l\": \"nl\", \"t\": { \"Close navigation\": { \"v\": [\"Navigatie sluiten\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Navigatie openen {shortcut}\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Close navigation\": { \"v\": [\"Zamknij nawigację\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Otwórz nawigację {shortcut}\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Close navigation\": { \"v\": [\"Fechar navegação\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Abrir navegação {shortcut}\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Close navigation\": { \"v\": [\"Fechar navegação\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Abrir navegação {shortcut}\"] } } }, { \"l\": \"ro\", \"t\": { \"Close navigation\": { \"v\": [\"Închideți navigarea\"] } } }, { \"l\": \"ru\", \"t\": { \"Close navigation\": { \"v\": [\"Закрыть навигацию\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Открыть навигацию {shortcut}\"] } } }, { \"l\": \"sk\", \"t\": { \"Close navigation\": { \"v\": [\"Zavrieť navigáciu\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Otvoriť navigáciu {shortcut}\"] } } }, { \"l\": \"sl\", \"t\": { \"Close navigation\": { \"v\": [\"Zapri krmarjenje\"] } } }, { \"l\": \"sr\", \"t\": { \"Close navigation\": { \"v\": [\"Затвори навигацију\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Отвори навигацију {shortcut}\"] } } }, { \"l\": \"sv\", \"t\": { \"Close navigation\": { \"v\": [\"Stäng navigering\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Öppna navigering {shortcut}\"] } } }, { \"l\": \"tr\", \"t\": { \"Close navigation\": { \"v\": [\"Gezinmeyi kapat\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Gezinmeyi aç {shortcut}\"] } } }, { \"l\": \"uk\", \"t\": { \"Close navigation\": { \"v\": [\"Закрити навігацію\"] }, \"Open navigation {shortcut}\": { \"v\": [\"Відкрити навігацію {shortcut}\"] } } }, { \"l\": \"uz\", \"t\": { \"Close navigation\": { \"v\": [\"Navigatsiyani yopish\"] }, \"Open navigation {shortcut}\": { \"v\": [\" {shortcut} navigatsiyani oching\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Close navigation\": { \"v\": [\"关闭导航\"] }, \"Open navigation {shortcut}\": { \"v\": [\"打开导览{shortcut}\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Close navigation\": { \"v\": [\"關閉導航\"] }, \"Open navigation {shortcut}\": { \"v\": [\"開啟導航 {shortcut}\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Close navigation\": { \"v\": [\"關閉導航\"] } } }];\nconst t20 = [{ \"l\": \"ar\", \"t\": { \"Collapse menu\": { \"v\": [\"طي القائمة\"] }, \"Open menu\": { \"v\": [\"إفتَح القائمة\"] } } }, { \"l\": \"ast\", \"t\": { \"Collapse menu\": { \"v\": [\"Recoyer el menú\"] }, \"Open menu\": { \"v\": [\"Abrir le menú\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Collapse menu\": { \"v\": [\"Sbalit nabídku\"] }, \"Open menu\": { \"v\": [\"Otevřít nabídku\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Collapse menu\": { \"v\": [\"Sbalit nabídku\"] }, \"Open menu\": { \"v\": [\"Otevřít nabídku\"] } } }, { \"l\": \"da\", \"t\": { \"Collapse menu\": { \"v\": [\"Skjul menuen\"] }, \"Open menu\": { \"v\": [\"Åben menu\"] } } }, { \"l\": \"de\", \"t\": { \"Collapse menu\": { \"v\": [\"Menü einklappen\"] }, \"Open menu\": { \"v\": [\"Menü öffnen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Collapse menu\": { \"v\": [\"Menü einklappen\"] }, \"Open menu\": { \"v\": [\"Menü öffnen\"] } } }, { \"l\": \"el\", \"t\": { \"Collapse menu\": { \"v\": [\"Σύμπτυξη μενού\"] }, \"Open menu\": { \"v\": [\"Άνοιγμα μενού\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Collapse menu\": { \"v\": [\"Collapse menu\"] }, \"Open menu\": { \"v\": [\"Open menu\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Collapse menu\": { \"v\": [\"Ocultar menú\"] }, \"Open menu\": { \"v\": [\"Abrir menú\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Collapse menu\": { \"v\": [\"Ocultar menú\"] }, \"Open menu\": { \"v\": [\"Abrir menú\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Collapse menu\": { \"v\": [\"Ocultar menú\"] }, \"Open menu\": { \"v\": [\"Abrir menú\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Collapse menu\": { \"v\": [\"Ocultar menú\"] }, \"Open menu\": { \"v\": [\"Abrir menú\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Collapse menu\": { \"v\": [\"Menüü kokkuklappimine\"] }, \"Open menu\": { \"v\": [\"Ava menüü\"] } } }, { \"l\": \"eu\", \"t\": { \"Collapse menu\": { \"v\": [\"Tolestu menua\"] }, \"Open menu\": { \"v\": [\"Ireki menua\"] } } }, { \"l\": \"fa\", \"t\": { \"Collapse menu\": { \"v\": [\"بستن فهرست\"] }, \"Open menu\": { \"v\": [\"باز کردن فهرست\"] } } }, { \"l\": \"fi\", \"t\": { \"Collapse menu\": { \"v\": [\"Supista valikko\"] }, \"Open menu\": { \"v\": [\"Avaa valikko\"] } } }, { \"l\": \"fr\", \"t\": { \"Collapse menu\": { \"v\": [\"Réduire le menu\"] }, \"Open menu\": { \"v\": [\"Ouvrir le menu\"] } } }, { \"l\": \"ga\", \"t\": { \"Collapse menu\": { \"v\": [\"Roghchlár Laghdaigh\"] }, \"Open menu\": { \"v\": [\"Roghchlár a oscailt\"] } } }, { \"l\": \"gl\", \"t\": { \"Collapse menu\": { \"v\": [\"Contraer o menú\"] }, \"Open menu\": { \"v\": [\"Abrir o menú\"] } } }, { \"l\": \"he\", \"t\": { \"Collapse menu\": { \"v\": [\"צמצום התפריט\"] }, \"Open menu\": { \"v\": [\"פתיחת תפריט\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Collapse menu\": { \"v\": [\"Ciutkan menu\"] }, \"Open menu\": { \"v\": [\"Buka menu\"] } } }, { \"l\": \"is\", \"t\": { \"Collapse menu\": { \"v\": [\"Fella valmynd saman\"] }, \"Open menu\": { \"v\": [\"Opna valmynd\"] } } }, { \"l\": \"it\", \"t\": { \"Collapse menu\": { \"v\": [\"Chiudi Menu\"] }, \"Open menu\": { \"v\": [\"Apri il menu\"] } } }, { \"l\": \"ja\", \"t\": { \"Collapse menu\": { \"v\": [\"メニューの折りたたみ\"] }, \"Open menu\": { \"v\": [\"メニューを開く\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Collapse menu\": { \"v\": [\"メニューの折りたたみ\"] }, \"Open menu\": { \"v\": [\"メニューを開く\"] } } }, { \"l\": \"ko\", \"t\": { \"Collapse menu\": { \"v\": [\"메뉴 접기\"] }, \"Open menu\": { \"v\": [\"메뉴 열기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Collapse menu\": { \"v\": [\"Skjul meny\"] }, \"Open menu\": { \"v\": [\"Åpne meny\"] } } }, { \"l\": \"nl\", \"t\": { \"Collapse menu\": { \"v\": [\"Klap menu in\"] }, \"Open menu\": { \"v\": [\"Open menu\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Collapse menu\": { \"v\": [\"Zwiń menu\"] }, \"Open menu\": { \"v\": [\"Otwórz menu\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Collapse menu\": { \"v\": [\"Recolher menu\"] }, \"Open menu\": { \"v\": [\"Abrir menu\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Collapse menu\": { \"v\": [\"Ocultar menu\"] }, \"Open menu\": { \"v\": [\"Abrir menu\"] } } }, { \"l\": \"ro\", \"t\": { \"Collapse menu\": { \"v\": [\"Restrânge meniul\"] }, \"Open menu\": { \"v\": [\"Deschide meniul\"] } } }, { \"l\": \"ru\", \"t\": { \"Collapse menu\": { \"v\": [\"Свернуть меню\"] }, \"Open menu\": { \"v\": [\"Открыть меню\"] } } }, { \"l\": \"sk\", \"t\": { \"Collapse menu\": { \"v\": [\"Zbaliť menu\"] }, \"Open menu\": { \"v\": [\"Otvoriť menu\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Collapse menu\": { \"v\": [\"Сажми мени\"] }, \"Open menu\": { \"v\": [\"Отвори мени\"] } } }, { \"l\": \"sv\", \"t\": { \"Collapse menu\": { \"v\": [\"Dölj menyn\"] }, \"Open menu\": { \"v\": [\"Öppna menyn\"] } } }, { \"l\": \"tr\", \"t\": { \"Collapse menu\": { \"v\": [\"Menüyü daralt\"] }, \"Open menu\": { \"v\": [\"Menüyü aç\"] } } }, { \"l\": \"uk\", \"t\": { \"Collapse menu\": { \"v\": [\"Згорнути меню\"] }, \"Open menu\": { \"v\": [\"Відкрити меню\"] } } }, { \"l\": \"uz\", \"t\": { \"Collapse menu\": { \"v\": [\"Menyuni yig‘ish\"] }, \"Open menu\": { \"v\": [\"Menyuni oching\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Collapse menu\": { \"v\": [\"收起菜单\"] }, \"Open menu\": { \"v\": [\"打开菜单\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Collapse menu\": { \"v\": [\"折疊選單\"] }, \"Open menu\": { \"v\": [\"開啟選單\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Collapse menu\": { \"v\": [\"折疊選單\"] }, \"Open menu\": { \"v\": [\"開啟選單\"] } } }];\nconst t22 = [{ \"l\": \"ar\", \"t\": { \"Edit item\": { \"v\": [\"تعديل عنصر\"] } } }, { \"l\": \"ast\", \"t\": { \"Edit item\": { \"v\": [\"Editar l'elementu\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Edit item\": { \"v\": [\"Edita l'element\"] } } }, { \"l\": \"cs\", \"t\": { \"Edit item\": { \"v\": [\"Upravit položku\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Edit item\": { \"v\": [\"Upravit položku\"] } } }, { \"l\": \"da\", \"t\": { \"Edit item\": { \"v\": [\"Rediger emne\"] } } }, { \"l\": \"de\", \"t\": { \"Edit item\": { \"v\": [\"Objekt bearbeiten\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Edit item\": { \"v\": [\"Element bearbeiten\"] } } }, { \"l\": \"el\", \"t\": { \"Edit item\": { \"v\": [\"Επεξεργασία αντικειμένου\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Edit item\": { \"v\": [\"Edit item\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Edit item\": { \"v\": [\"Editar elemento\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Edit item\": { \"v\": [\"Editar elemento\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Edit item\": { \"v\": [\"Editar elemento\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Edit item\": { \"v\": [\"Editar elemento\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Edit item\": { \"v\": [\"Muuda objekti\"] } } }, { \"l\": \"eu\", \"t\": { \"Edit item\": { \"v\": [\"Editatu elementua\"] } } }, { \"l\": \"fa\", \"t\": { \"Edit item\": { \"v\": [\"ویرایش مورد\"] } } }, { \"l\": \"fi\", \"t\": { \"Edit item\": { \"v\": [\"Muokkaa kohdetta\"] } } }, { \"l\": \"fr\", \"t\": { \"Edit item\": { \"v\": [\"Éditer l'élément\"] } } }, { \"l\": \"ga\", \"t\": { \"Edit item\": { \"v\": [\"Cuir mír in eagar\"] } } }, { \"l\": \"gl\", \"t\": { \"Edit item\": { \"v\": [\"Editar o elemento\"] } } }, { \"l\": \"he\", \"t\": { \"Edit item\": { \"v\": [\"עריכת פריט\"] } } }, { \"l\": \"hu\", \"t\": { \"Edit item\": { \"v\": [\"Elem szerkesztése\"] } } }, { \"l\": \"id\", \"t\": { \"Edit item\": { \"v\": [\"Edit item\"] } } }, { \"l\": \"is\", \"t\": { \"Edit item\": { \"v\": [\"Breyta atriði\"] } } }, { \"l\": \"it\", \"t\": { \"Edit item\": { \"v\": [\"Modifica l'elemento\"] } } }, { \"l\": \"ja\", \"t\": { \"Edit item\": { \"v\": [\"編集\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Edit item\": { \"v\": [\"編集\"] } } }, { \"l\": \"ko\", \"t\": { \"Edit item\": { \"v\": [\"항목 수정\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Edit item\": { \"v\": [\"Уреди\"] } } }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Edit item\": { \"v\": [\"Rediger\"] } } }, { \"l\": \"nl\", \"t\": { \"Edit item\": { \"v\": [\"Item bewerken\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Edit item\": { \"v\": [\"Edytuj element\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Edit item\": { \"v\": [\"Editar item\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Edit item\": { \"v\": [\"Editar item\"] } } }, { \"l\": \"ro\", \"t\": { \"Edit item\": { \"v\": [\"Editați elementul\"] } } }, { \"l\": \"ru\", \"t\": { \"Edit item\": { \"v\": [\"Изменить элемент\"] } } }, { \"l\": \"sk\", \"t\": { \"Edit item\": { \"v\": [\"Upraviť položku\"] } } }, { \"l\": \"sl\", \"t\": { \"Edit item\": { \"v\": [\"Uredi predmet\"] } } }, { \"l\": \"sr\", \"t\": { \"Edit item\": { \"v\": [\"Уреди ставку\"] } } }, { \"l\": \"sv\", \"t\": { \"Edit item\": { \"v\": [\"Redigera objekt\"] } } }, { \"l\": \"tr\", \"t\": { \"Edit item\": { \"v\": [\"Ögeyi düzenle\"] } } }, { \"l\": \"uk\", \"t\": { \"Edit item\": { \"v\": [\"Редагувати елемент\"] } } }, { \"l\": \"uz\", \"t\": { \"Edit item\": { \"v\": [\"Elementni tahrirlash\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Edit item\": { \"v\": [\"编辑项目\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Edit item\": { \"v\": [\"編輯項目\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Edit item\": { \"v\": [\"編輯項目\"] } } }];\nconst t23 = [{ \"l\": \"ar\", \"t\": { \"Enable interactive view\": { \"v\": [\"تمكين المنظور التفاعلي\"] } } }, { \"l\": \"ast\", \"t\": { \"Enable interactive view\": { \"v\": [\"Activar la vista interactiva\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Enable interactive view\": { \"v\": [\"Zapnout interaktivní zobrazení\"] } } }, { \"l\": \"cs-CZ\", \"t\": {} }, { \"l\": \"da\", \"t\": { \"Enable interactive view\": { \"v\": [\"Aktiver interaktiv visning\"] } } }, { \"l\": \"de\", \"t\": { \"Enable interactive view\": { \"v\": [\"Die interaktive Ansicht aktivieren\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Enable interactive view\": { \"v\": [\"Die interaktive Ansicht aktivieren\"] } } }, { \"l\": \"el\", \"t\": { \"Enable interactive view\": { \"v\": [\"Ενεργοποίηση διαδραστικής προβολής\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Enable interactive view\": { \"v\": [\"Enable interactive view\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Enable interactive view\": { \"v\": [\"Habilitar vista interactiva\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Enable interactive view\": { \"v\": [\"Habilitar vista interactiva\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"Enable interactive view\": { \"v\": [\"Habilitar vista interactiva\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Enable interactive view\": { \"v\": [\"Lülita interaktiivne vaade sisse\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"Enable interactive view\": { \"v\": [\"فعال‌سازی نمای تعاملی\"] } } }, { \"l\": \"fi\", \"t\": { \"Enable interactive view\": { \"v\": [\"Näytä vuorovaikutteinen näkymä\"] } } }, { \"l\": \"fr\", \"t\": { \"Enable interactive view\": { \"v\": [\"Activer la vue interactive\"] } } }, { \"l\": \"ga\", \"t\": { \"Enable interactive view\": { \"v\": [\"Cumasaigh amharc idirghníomhach\"] } } }, { \"l\": \"gl\", \"t\": { \"Enable interactive view\": { \"v\": [\"Activar a vista interactiva\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": { \"Enable interactive view\": { \"v\": [\"Virkja gagnvirka sýn\"] } } }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": { \"Enable interactive view\": { \"v\": [\"インタラクティブ・ビューを有効にする\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Enable interactive view\": { \"v\": [\"インタラクティブ・ビューを有効にする\"] } } }, { \"l\": \"ko\", \"t\": { \"Enable interactive view\": { \"v\": [\"대화형 보기 활성화\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Enable interactive view\": { \"v\": [\"Aktiver interaktiv visning\"] } } }, { \"l\": \"nl\", \"t\": { \"Enable interactive view\": { \"v\": [\"Interactieve weergave inschakelen\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Enable interactive view\": { \"v\": [\"Włącz widok interaktywny\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Enable interactive view\": { \"v\": [\"Ativar visualização interativa\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Enable interactive view\": { \"v\": [\"Ativar vista interativa\"] } } }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": { \"Enable interactive view\": { \"v\": [\"Включить интерактивный просмотр\"] } } }, { \"l\": \"sk\", \"t\": { \"Enable interactive view\": { \"v\": [\"Povoliť interaktívny pohľad\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Enable interactive view\": { \"v\": [\"Укључи интерактивни приказ\"] } } }, { \"l\": \"sv\", \"t\": { \"Enable interactive view\": { \"v\": [\"Aktivera interaktiv vy\"] } } }, { \"l\": \"tr\", \"t\": { \"Enable interactive view\": { \"v\": [\"Etkileşimli görünümü aç\"] } } }, { \"l\": \"uk\", \"t\": { \"Enable interactive view\": { \"v\": [\"Увімкнути інтерактивний перегляд\"] } } }, { \"l\": \"uz\", \"t\": { \"Enable interactive view\": { \"v\": [\"Interaktiv ko'rinishni yoqing\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Enable interactive view\": { \"v\": [\"启用交互视窗\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Enable interactive view\": { \"v\": [\"啟用互動視圖\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t24 = [{ \"l\": \"ar\", \"t\": { \"Enter link\": { \"v\": [\"أدخِل الرابط\"] } } }, { \"l\": \"ast\", \"t\": { \"Enter link\": { \"v\": [\"Introducir l'enllaz\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Enter link\": { \"v\": [\"Zadat odkaz\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Enter link\": { \"v\": [\"Zadat odkaz\"] } } }, { \"l\": \"da\", \"t\": { \"Enter link\": { \"v\": [\"Indtast link\"] } } }, { \"l\": \"de\", \"t\": { \"Enter link\": { \"v\": [\"Link eingeben\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Enter link\": { \"v\": [\"Link eingeben\"] } } }, { \"l\": \"el\", \"t\": { \"Enter link\": { \"v\": [\"Εισάγετε σύνδεσμο\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Enter link\": { \"v\": [\"Enter link\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Enter link\": { \"v\": [\"Ingrese enlace\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Enter link\": { \"v\": [\"Ingresar enlace\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Enter link\": { \"v\": [\"Ingresar enlace\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Enter link\": { \"v\": [\"Ingresar enlace\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Enter link\": { \"v\": [\"Sisesta link\"] } } }, { \"l\": \"eu\", \"t\": { \"Enter link\": { \"v\": [\"Sartu esteka\"] } } }, { \"l\": \"fa\", \"t\": { \"Enter link\": { \"v\": [\"لینک را وارد کنید\"] } } }, { \"l\": \"fi\", \"t\": { \"Enter link\": { \"v\": [\"Kirjoita linkki\"] } } }, { \"l\": \"fr\", \"t\": { \"Enter link\": { \"v\": [\"Saisissez le lien\"] } } }, { \"l\": \"ga\", \"t\": { \"Enter link\": { \"v\": [\"Cuir isteach nasc\"] } } }, { \"l\": \"gl\", \"t\": { \"Enter link\": { \"v\": [\"Introducir a ligazón\"] } } }, { \"l\": \"he\", \"t\": { \"Enter link\": { \"v\": [\"מילוי קישור\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Enter link\": { \"v\": [\"Masukkan tautan\"] } } }, { \"l\": \"is\", \"t\": { \"Enter link\": { \"v\": [\"Settu inn tengil\"] } } }, { \"l\": \"it\", \"t\": { \"Enter link\": { \"v\": [\"Inserire il link\"] } } }, { \"l\": \"ja\", \"t\": { \"Enter link\": { \"v\": [\"リンクを入力する\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Enter link\": { \"v\": [\"リンクを入力する\"] } } }, { \"l\": \"ko\", \"t\": { \"Enter link\": { \"v\": [\"링크 입력\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Enter link\": { \"v\": [\"Skriv inn lenken\"] } } }, { \"l\": \"nl\", \"t\": { \"Enter link\": { \"v\": [\"Voer link in\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Enter link\": { \"v\": [\"Wprowadź link\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Enter link\": { \"v\": [\"Insira o link\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Enter link\": { \"v\": [\"Inserir hiperligação\"] } } }, { \"l\": \"ro\", \"t\": { \"Enter link\": { \"v\": [\"Introduceți link-ul\"] } } }, { \"l\": \"ru\", \"t\": { \"Enter link\": { \"v\": [\"Введите ссылку\"] } } }, { \"l\": \"sk\", \"t\": { \"Enter link\": { \"v\": [\"Vložiť link\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Enter link\": { \"v\": [\"Унесите линк\"] } } }, { \"l\": \"sv\", \"t\": { \"Enter link\": { \"v\": [\"Ange länk\"] } } }, { \"l\": \"tr\", \"t\": { \"Enter link\": { \"v\": [\"Bağlantıyı yazın\"] } } }, { \"l\": \"uk\", \"t\": { \"Enter link\": { \"v\": [\"Зазначте посилання\"] } } }, { \"l\": \"uz\", \"t\": { \"Enter link\": { \"v\": [\"Havolani kiriting\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Enter link\": { \"v\": [\"输入链接\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Enter link\": { \"v\": [\"輸入連結\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Enter link\": { \"v\": [\"輸入連結\"] } } }];\nconst t25 = [{ \"l\": \"ar\", \"t\": { \"External documentation for {name}\": { \"v\": [\"التوثيق الخارجي لـ {name}\"] } } }, { \"l\": \"ast\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentación esterna pa: {name}\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Externí dokumentace pro {name}\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Externí dokumentace pro {name}\"] } } }, { \"l\": \"da\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Ekstern dokumentation for {name}\"] } } }, { \"l\": \"de\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Externe Dokumentation für {name}\"] } } }, { \"l\": \"de-DE\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Externe Dokumentation für {name}\"] } } }, { \"l\": \"el\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Εξωτερική τεκμηρίωση για {name}\"] } } }, { \"l\": \"en-GB\", \"t\": { \"External documentation for {name}\": { \"v\": [\"External documentation for {name}\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentación externa para {name}\"] } } }, { \"l\": \"es-AR\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentación externa para {name}\"] } } }, { \"l\": \"es-EC\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentación externa para {name}\"] } } }, { \"l\": \"es-MX\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentación externa para {name}\"] } } }, { \"l\": \"et-EE\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Väline dokumentatsioon {nimi}\"] } } }, { \"l\": \"eu\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name}-ren kanpoko dokumentazioa\"] } } }, { \"l\": \"fa\", \"t\": { \"External documentation for {name}\": { \"v\": [\"اسناد بیرونی برای {name}\"] } } }, { \"l\": \"fi\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Ulkoinen dokumentaatio {name}lle\"] } } }, { \"l\": \"fr\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentation externe pour {name}\"] } } }, { \"l\": \"ga\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Doiciméadúchán seachtrach le haghaidh {name}\"] } } }, { \"l\": \"gl\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentación externa para {name}\"] } } }, { \"l\": \"he\", \"t\": { \"External documentation for {name}\": { \"v\": [\"תיעוד חיצוני עבור {name}\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Dokumentasi eksternal untuk {name}\"] } } }, { \"l\": \"is\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Utanaðkomandi leiðbeiningar fyrir {name}\"] } } }, { \"l\": \"it\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentazione esterna per {name}\"] } } }, { \"l\": \"ja\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name} の外部ドキュメント\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name} の外部ドキュメント\"] } } }, { \"l\": \"ko\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name}의 외부 문서\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Ekstern dokumentasjon for {name}\"] } } }, { \"l\": \"nl\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Externe documentatie voor {name}\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Dokumentacja zewnętrzna dla {name}\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentação externa para {name}\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentação externa para {name}\"] } } }, { \"l\": \"ro\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Documentație externă pentru {name}\"] } } }, { \"l\": \"ru\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Внешняя документация для {name}\"] } } }, { \"l\": \"sk\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Externá dokumentácia pre {name}\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Спољна документација за {name}\"] } } }, { \"l\": \"sv\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Extern dokumentation för {name}\"] } } }, { \"l\": \"tr\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name} için dış belgeler\"] } } }, { \"l\": \"uk\", \"t\": { \"External documentation for {name}\": { \"v\": [\"Зовнішня документація для {name}\"] } } }, { \"l\": \"uz\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name}uchun tashqi hujjatlar\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name} 的外部文档\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name} 的外部文件\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"External documentation for {name}\": { \"v\": [\"{name} 的外部文件\"] } } }];\nconst t26 = [{ \"l\": \"ar\", \"t\": { \"Global\": { \"v\": [\"شامل\"] } } }, { \"l\": \"ast\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"cs\", \"t\": { \"Global\": { \"v\": [\"Globální\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Global\": { \"v\": [\"Globální\"] } } }, { \"l\": \"da\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"de\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"el\", \"t\": { \"Global\": { \"v\": [\"Καθολικό\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Global\": { \"v\": [\"Globaalne\"] } } }, { \"l\": \"eu\", \"t\": { \"Global\": { \"v\": [\"Globala\"] } } }, { \"l\": \"fa\", \"t\": { \"Global\": { \"v\": [\"سراسری\"] } } }, { \"l\": \"fi\", \"t\": { \"Global\": { \"v\": [\"Globaali\"] } } }, { \"l\": \"fr\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"ga\", \"t\": { \"Global\": { \"v\": [\"Domhanda\"] } } }, { \"l\": \"gl\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"he\", \"t\": { \"Global\": { \"v\": [\"כללי\"] } } }, { \"l\": \"hu\", \"t\": { \"Global\": { \"v\": [\"Globális\"] } } }, { \"l\": \"id\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"is\", \"t\": { \"Global\": { \"v\": [\"Almennt\"] } } }, { \"l\": \"it\", \"t\": { \"Global\": { \"v\": [\"Globale\"] } } }, { \"l\": \"ja\", \"t\": { \"Global\": { \"v\": [\"全体\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Global\": { \"v\": [\"全体\"] } } }, { \"l\": \"ko\", \"t\": { \"Global\": { \"v\": [\"글로벌\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Global\": { \"v\": [\"Глобално\"] } } }, { \"l\": \"my\", \"t\": { \"Global\": { \"v\": [\"ကမ္ဘာလုံးဆိုင်ရာ\"] } } }, { \"l\": \"nb\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"nl\", \"t\": { \"Global\": { \"v\": [\"Globaal\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Global\": { \"v\": [\"Globalnie\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"ro\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"ru\", \"t\": { \"Global\": { \"v\": [\"Глобальный\"] } } }, { \"l\": \"sk\", \"t\": { \"Global\": { \"v\": [\"Globálne\"] } } }, { \"l\": \"sl\", \"t\": { \"Global\": { \"v\": [\"Splošno\"] } } }, { \"l\": \"sr\", \"t\": { \"Global\": { \"v\": [\"Глобално\"] } } }, { \"l\": \"sv\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"tr\", \"t\": { \"Global\": { \"v\": [\"Evrensel\"] } } }, { \"l\": \"uk\", \"t\": { \"Global\": { \"v\": [\"Глобальний\"] } } }, { \"l\": \"uz\", \"t\": { \"Global\": { \"v\": [\"Global\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Global\": { \"v\": [\"全局\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Global\": { \"v\": [\"全球的\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Global\": { \"v\": [\"全域\"] } } }];\nconst t27 = [{ \"l\": \"ar\", \"t\": { \"Go back to the list\": { \"v\": [\"عودة إلى القائمة\"] } } }, { \"l\": \"ast\", \"t\": { \"Go back to the list\": { \"v\": [\"Volver a la llista\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Go back to the list\": { \"v\": [\"Torna a la llista\"] } } }, { \"l\": \"cs\", \"t\": { \"Go back to the list\": { \"v\": [\"Jít zpět na seznam\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Go back to the list\": { \"v\": [\"Jít zpět na seznam\"] } } }, { \"l\": \"da\", \"t\": { \"Go back to the list\": { \"v\": [\"Tilbage til listen\"] } } }, { \"l\": \"de\", \"t\": { \"Go back to the list\": { \"v\": [\"Zurück zur Liste\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Go back to the list\": { \"v\": [\"Zurück zur Liste\"] } } }, { \"l\": \"el\", \"t\": { \"Go back to the list\": { \"v\": [\"Επιστροφή στην αρχική λίστα\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Go back to the list\": { \"v\": [\"Go back to the list\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Go back to the list\": { \"v\": [\"Volver a la lista\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Go back to the list\": { \"v\": [\"Volver a la lista\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Go back to the list\": { \"v\": [\"Volver a la lista\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Go back to the list\": { \"v\": [\"Regresar a la lista\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Go back to the list\": { \"v\": [\"Tagasi nimekirja juurde\"] } } }, { \"l\": \"eu\", \"t\": { \"Go back to the list\": { \"v\": [\"Bueltatu zerrendara\"] } } }, { \"l\": \"fa\", \"t\": { \"Go back to the list\": { \"v\": [\"برگشت به لیست\"] } } }, { \"l\": \"fi\", \"t\": { \"Go back to the list\": { \"v\": [\"Takaisin listaan\"] } } }, { \"l\": \"fr\", \"t\": { \"Go back to the list\": { \"v\": [\"Retourner à la liste\"] } } }, { \"l\": \"ga\", \"t\": { \"Go back to the list\": { \"v\": [\"Téigh ar ais go dtí an liosta\"] } } }, { \"l\": \"gl\", \"t\": { \"Go back to the list\": { \"v\": [\"Volver á lista\"] } } }, { \"l\": \"he\", \"t\": { \"Go back to the list\": { \"v\": [\"חזרה לרשימה\"] } } }, { \"l\": \"hu\", \"t\": { \"Go back to the list\": { \"v\": [\"Ugrás vissza a listához\"] } } }, { \"l\": \"id\", \"t\": { \"Go back to the list\": { \"v\": [\"Kembali ke daftar\"] } } }, { \"l\": \"is\", \"t\": { \"Go back to the list\": { \"v\": [\"Fara til baka í listann\"] } } }, { \"l\": \"it\", \"t\": { \"Go back to the list\": { \"v\": [\"Torna all'elenco\"] } } }, { \"l\": \"ja\", \"t\": { \"Go back to the list\": { \"v\": [\"リストに戻る\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Go back to the list\": { \"v\": [\"リストに戻る\"] } } }, { \"l\": \"ko\", \"t\": { \"Go back to the list\": { \"v\": [\"목록으로 돌아가기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Go back to the list\": { \"v\": [\"Врати се на листата\"] } } }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Go back to the list\": { \"v\": [\"Gå tilbake til listen\"] } } }, { \"l\": \"nl\", \"t\": { \"Go back to the list\": { \"v\": [\"Ga terug naar de lijst\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Go back to the list\": { \"v\": [\"Powrót do listy\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Go back to the list\": { \"v\": [\"Voltar para a lista\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Go back to the list\": { \"v\": [\"Voltar para a lista\"] } } }, { \"l\": \"ro\", \"t\": { \"Go back to the list\": { \"v\": [\"Întoarceți-vă la listă\"] } } }, { \"l\": \"ru\", \"t\": { \"Go back to the list\": { \"v\": [\"Вернуться к списку\"] } } }, { \"l\": \"sk\", \"t\": { \"Go back to the list\": { \"v\": [\"Späť na zoznam\"] } } }, { \"l\": \"sl\", \"t\": { \"Go back to the list\": { \"v\": [\"Vrni se na seznam\"] } } }, { \"l\": \"sr\", \"t\": { \"Go back to the list\": { \"v\": [\"Назад на листу\"] } } }, { \"l\": \"sv\", \"t\": { \"Go back to the list\": { \"v\": [\"Gå tillbaka till listan\"] } } }, { \"l\": \"tr\", \"t\": { \"Go back to the list\": { \"v\": [\"Listeye dön\"] } } }, { \"l\": \"uk\", \"t\": { \"Go back to the list\": { \"v\": [\"Повернутися до списку\"] } } }, { \"l\": \"uz\", \"t\": { \"Go back to the list\": { \"v\": [\"Ro'yxatga qayting\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Go back to the list\": { \"v\": [\"返回至列表\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Go back to the list\": { \"v\": [\"返回清單\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Go back to the list\": { \"v\": [\"回到清單\"] } } }];\nconst t28 = [{ \"l\": \"ar\", \"t\": { \"Hide details\": { \"v\": [\"أخفِ التفاصيل\"] }, \"Rename project\": { \"v\": [\"تغيير اسم المشروع\"] }, \"Show details\": { \"v\": [\"أظهِر التفاصيل\"] } } }, { \"l\": \"ast\", \"t\": {} }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Hide details\": { \"v\": [\"Skrýt podrobnosti\"] }, \"Rename project\": { \"v\": [\"Přejmenovat projekt\"] }, \"Show details\": { \"v\": [\"Zobrazit podrobnosti\"] } } }, { \"l\": \"cs-CZ\", \"t\": {} }, { \"l\": \"da\", \"t\": { \"Hide details\": { \"v\": [\"Skjul detaljer\"] }, \"Rename project\": { \"v\": [\"Omdøb projekt\"] }, \"Show details\": { \"v\": [\"Vis detaljer\"] } } }, { \"l\": \"de\", \"t\": { \"Hide details\": { \"v\": [\"Details ausblenden\"] }, \"Rename project\": { \"v\": [\"Projekt umbenennen\"] }, \"Show details\": { \"v\": [\"Details anzeigen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Hide details\": { \"v\": [\"Details ausblenden\"] }, \"Rename project\": { \"v\": [\"Projekt umbenennen\"] }, \"Show details\": { \"v\": [\"Details anzeigen\"] } } }, { \"l\": \"el\", \"t\": { \"Hide details\": { \"v\": [\"Απόκρυψη λεπτομερειών\"] }, \"Rename project\": { \"v\": [\"Μετονομασία έργου\"] }, \"Show details\": { \"v\": [\"Εμφάνιση λεπτομερειών\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Hide details\": { \"v\": [\"Hide details\"] }, \"Rename project\": { \"v\": [\"Rename project\"] }, \"Show details\": { \"v\": [\"Show details\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": {} }, { \"l\": \"es-AR\", \"t\": { \"Hide details\": { \"v\": [\"Ocultar detalles\"] }, \"Rename project\": { \"v\": [\"Renombrar proyecto\"] }, \"Show details\": { \"v\": [\"Mostrar detalles\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"Hide details\": { \"v\": [\"Ocultar detalles\"] }, \"Rename project\": { \"v\": [\"Renombrar proyecto\"] }, \"Show details\": { \"v\": [\"Mostrar detalles\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Hide details\": { \"v\": [\"Peida üksikasjad\"] }, \"Rename project\": { \"v\": [\"Muuda projekti nime\"] }, \"Show details\": { \"v\": [\"Näita üksikasju\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"Hide details\": { \"v\": [\"پنهان کردن جزئیات\"] }, \"Rename project\": { \"v\": [\"تغییر نام پروژه\"] }, \"Show details\": { \"v\": [\"نمایش جزئیات\"] } } }, { \"l\": \"fi\", \"t\": { \"Hide details\": { \"v\": [\"Piilota yksityiskohdat\"] }, \"Rename project\": { \"v\": [\"Nimeä projekti\"] }, \"Show details\": { \"v\": [\"Näytä yksityiskohdat\"] } } }, { \"l\": \"fr\", \"t\": { \"Hide details\": { \"v\": [\"Masquer les détails\"] }, \"Rename project\": { \"v\": [\"Renommer le projet\"] }, \"Show details\": { \"v\": [\"Afficher les détails\"] } } }, { \"l\": \"ga\", \"t\": { \"Hide details\": { \"v\": [\"Folaigh sonraí\"] }, \"Rename project\": { \"v\": [\"Athainmnigh an tionscadal\"] }, \"Show details\": { \"v\": [\"Taispeáin sonraí\"] } } }, { \"l\": \"gl\", \"t\": { \"Hide details\": { \"v\": [\"Agochar os detalles\"] }, \"Rename project\": { \"v\": [\"Cambiar o nome do proxecto\"] }, \"Show details\": { \"v\": [\"Amosar os detalles\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": { \"Hide details\": { \"v\": [\"Fela nánari upplýsingar\"] }, \"Rename project\": { \"v\": [\"Endurnefna verkefni\"] }, \"Show details\": { \"v\": [\"Birta nánari upplýsingar\"] } } }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": { \"Hide details\": { \"v\": [\"詳細を非表示\"] }, \"Rename project\": { \"v\": [\"プロジェクト名を変更\"] }, \"Show details\": { \"v\": [\"詳細の表示\"] } } }, { \"l\": \"ja-JP\", \"t\": {} }, { \"l\": \"ko\", \"t\": { \"Hide details\": { \"v\": [\"세부 사항 숨기기\"] }, \"Rename project\": { \"v\": [\"프로젝트 이름 변경\"] }, \"Show details\": { \"v\": [\"세부 사항 보기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Hide details\": { \"v\": [\"Skjul detaljer\"] }, \"Rename project\": { \"v\": [\"Gi prosjekt nytt navn\"] }, \"Show details\": { \"v\": [\"Vis detaljer\"] } } }, { \"l\": \"nl\", \"t\": { \"Hide details\": { \"v\": [\"Details verbergen\"] }, \"Rename project\": { \"v\": [\"Hernoem project\"] }, \"Show details\": { \"v\": [\"Toon details\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Hide details\": { \"v\": [\"Ukryj szczegóły\"] }, \"Rename project\": { \"v\": [\"Zmień nazwę projektu\"] }, \"Show details\": { \"v\": [\"Pokaż szczegóły\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Hide details\": { \"v\": [\"Ocultar detalhes\"] }, \"Rename project\": { \"v\": [\"Renomear projeto\"] }, \"Show details\": { \"v\": [\"Mostrar detalhes\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Hide details\": { \"v\": [\"Ocultar detalhes\"] }, \"Rename project\": { \"v\": [\"Alterar nome do projeto\"] }, \"Show details\": { \"v\": [\"Ver detalhes\"] } } }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": { \"Hide details\": { \"v\": [\"Скрыть подробности\"] }, \"Rename project\": { \"v\": [\"Переименовать проект\"] }, \"Show details\": { \"v\": [\"Показать детали\"] } } }, { \"l\": \"sk\", \"t\": { \"Hide details\": { \"v\": [\"Skryť detaily\"] }, \"Rename project\": { \"v\": [\"Premenovať projekt\"] }, \"Show details\": { \"v\": [\"Zobraziť detaily\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Hide details\": { \"v\": [\"Сакриј детаље\"] }, \"Rename project\": { \"v\": [\"Промени име пројекта\"] }, \"Show details\": { \"v\": [\"Прикажи детаље\"] } } }, { \"l\": \"sv\", \"t\": { \"Hide details\": { \"v\": [\"Göm detaljer\"] }, \"Rename project\": { \"v\": [\"Byt namn på projektet\"] }, \"Show details\": { \"v\": [\"Visa detaljer\"] } } }, { \"l\": \"tr\", \"t\": { \"Hide details\": { \"v\": [\"Ayrıntıları gizle\"] }, \"Rename project\": { \"v\": [\"Projeyi yeniden adlandır\"] }, \"Show details\": { \"v\": [\"Ayrıntıları görüntüle\"] } } }, { \"l\": \"uk\", \"t\": { \"Hide details\": { \"v\": [\"Сховати деталі\"] }, \"Rename project\": { \"v\": [\"Перейменувати проєкт\"] }, \"Show details\": { \"v\": [\"Показати деталі\"] } } }, { \"l\": \"uz\", \"t\": { \"Hide details\": { \"v\": [\"Tafsilotlarni yashirish\"] }, \"Rename project\": { \"v\": [\"Loyiha nomini o'zgartirish\"] }, \"Show details\": { \"v\": [\"Tafsilotlarni ko'rsatish\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Hide details\": { \"v\": [\"隐藏细节\"] }, \"Rename project\": { \"v\": [\"重命名项目\"] }, \"Show details\": { \"v\": [\"显示细节\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Hide details\": { \"v\": [\"隱藏詳情\"] }, \"Rename project\": { \"v\": [\"重命名方案\"] }, \"Show details\": { \"v\": [\"顯示詳情\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t29 = [{ \"l\": \"ar\", \"t\": { \"Hide password\": { \"v\": [\"إخفاء كلمة المرور\"] }, \"Password is secure\": { \"v\": [\"كلمة المرور آمنة\"] }, \"Show password\": { \"v\": [\"أظهِر كلمة المرور\"] } } }, { \"l\": \"ast\", \"t\": { \"Hide password\": { \"v\": [\"Anubrir la contraseña\"] }, \"Password is secure\": { \"v\": [\"La contraseña ye segura\"] }, \"Show password\": { \"v\": [\"Amosar la contraseña\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Hide password\": { \"v\": [\"Amagar contrasenya\"] }, \"Password is secure\": { \"v\": [\"Contrasenya segura
\"] }, \"Show password\": { \"v\": [\"Mostrar contrasenya\"] } } }, { \"l\": \"cs\", \"t\": { \"Hide password\": { \"v\": [\"Skrýt heslo\"] }, \"Password is secure\": { \"v\": [\"Heslo je bezpečné\"] }, \"Show password\": { \"v\": [\"Zobrazit heslo\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Hide password\": { \"v\": [\"Skrýt heslo\"] }, \"Password is secure\": { \"v\": [\"Heslo je bezpečné\"] }, \"Show password\": { \"v\": [\"Zobrazit heslo\"] } } }, { \"l\": \"da\", \"t\": { \"Hide password\": { \"v\": [\"Skjul kodeord\"] }, \"Password is secure\": { \"v\": [\"Kodeordet er sikkert\"] }, \"Show password\": { \"v\": [\"Vis kodeord\"] } } }, { \"l\": \"de\", \"t\": { \"Hide password\": { \"v\": [\"Passwort verbergen\"] }, \"Password is secure\": { \"v\": [\"Passwort ist sicher\"] }, \"Show password\": { \"v\": [\"Passwort anzeigen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Hide password\": { \"v\": [\"Passwort verbergen\"] }, \"Password is secure\": { \"v\": [\"Passwort ist sicher\"] }, \"Show password\": { \"v\": [\"Passwort anzeigen\"] } } }, { \"l\": \"el\", \"t\": { \"Hide password\": { \"v\": [\"Απόκρυψη συνθηματικού\"] }, \"Password is secure\": { \"v\": [\"Το συνθηματικό είναι ασφαλές\"] }, \"Show password\": { \"v\": [\"Εμφάνιση κωδικού πρόσβασης\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Hide password\": { \"v\": [\"Hide password\"] }, \"Password is secure\": { \"v\": [\"Password is secure\"] }, \"Show password\": { \"v\": [\"Show password\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Hide password\": { \"v\": [\"Ocultar contraseña\"] }, \"Password is secure\": { \"v\": [\"La contraseña es segura\"] }, \"Show password\": { \"v\": [\"Mostrar contraseña\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Hide password\": { \"v\": [\"Ocultar contraseña\"] }, \"Password is secure\": { \"v\": [\"La contraseña es segura\"] }, \"Show password\": { \"v\": [\"Mostrar contraseña\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Hide password\": { \"v\": [\"Ocultar contraseña\"] }, \"Password is secure\": { \"v\": [\"La contraseña es segura\"] }, \"Show password\": { \"v\": [\"Mostrar contraseña\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Hide password\": { \"v\": [\"Ocultar contraseña\"] }, \"Password is secure\": { \"v\": [\"La contraseña es segura\"] }, \"Show password\": { \"v\": [\"Mostrar contraseña\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Hide password\": { \"v\": [\"Peida salasõna\"] }, \"Password is secure\": { \"v\": [\"Salasõna on turvaline\"] }, \"Show password\": { \"v\": [\"Näita salasõna\"] } } }, { \"l\": \"eu\", \"t\": { \"Hide password\": { \"v\": [\"Ezkutatu pasahitza\"] }, \"Password is secure\": { \"v\": [\"Pasahitza segurua da\"] }, \"Show password\": { \"v\": [\"Erakutsi pasahitza\"] } } }, { \"l\": \"fa\", \"t\": { \"Hide password\": { \"v\": [\"پنهان کردن رمز عبور\"] }, \"Password is secure\": { \"v\": [\"گذرواژه امن است\"] }, \"Show password\": { \"v\": [\"نمایش گذرواژه\"] } } }, { \"l\": \"fi\", \"t\": { \"Hide password\": { \"v\": [\"Piilota salasana\"] }, \"Password is secure\": { \"v\": [\"Salasana on turvallinen\"] }, \"Show password\": { \"v\": [\"Näytä salasana\"] } } }, { \"l\": \"fr\", \"t\": { \"Hide password\": { \"v\": [\"Cacher le mot de passe\"] }, \"Password is secure\": { \"v\": [\"Le mot de passe est sécurisé\"] }, \"Show password\": { \"v\": [\"Afficher le mot de passe\"] } } }, { \"l\": \"ga\", \"t\": { \"Hide password\": { \"v\": [\"Folaigh pasfhocal\"] }, \"Password is secure\": { \"v\": [\"Tá pasfhocal slán\"] }, \"Show password\": { \"v\": [\"Taispeáin pasfhocal\"] } } }, { \"l\": \"gl\", \"t\": { \"Hide password\": { \"v\": [\"Agochar o contrasinal\"] }, \"Password is secure\": { \"v\": [\"O contrasinal é seguro\"] }, \"Show password\": { \"v\": [\"Amosar o contrasinal\"] } } }, { \"l\": \"he\", \"t\": { \"Hide password\": { \"v\": [\"הסתרת סיסמה\"] }, \"Password is secure\": { \"v\": [\"הסיסמה מאובטחת\"] }, \"Show password\": { \"v\": [\"הצגת סיסמה\"] } } }, { \"l\": \"hu\", \"t\": { \"Hide password\": { \"v\": [\"Jelszó elrejtése\"] }, \"Password is secure\": { \"v\": [\"A jelszó biztonságos\"] }, \"Show password\": { \"v\": [\"Jelszó megjelenítése\"] } } }, { \"l\": \"id\", \"t\": { \"Hide password\": { \"v\": [\"Sembunyikan sandi\"] }, \"Password is secure\": { \"v\": [\"Kata sandi sudah aman\"] }, \"Show password\": { \"v\": [\"Tampilkan sandi\"] } } }, { \"l\": \"is\", \"t\": { \"Hide password\": { \"v\": [\"Fela lykilorð\"] }, \"Password is secure\": { \"v\": [\"Lykilorðið er öruggt\"] }, \"Show password\": { \"v\": [\"Birta lykilorð\"] } } }, { \"l\": \"it\", \"t\": { \"Hide password\": { \"v\": [\"Nascondi la password\"] }, \"Password is secure\": { \"v\": [\"La password è sicura\"] }, \"Show password\": { \"v\": [\"Mostra la password\"] } } }, { \"l\": \"ja\", \"t\": { \"Hide password\": { \"v\": [\"パスワードを非表示\"] }, \"Password is secure\": { \"v\": [\"パスワードは保護されています\"] }, \"Show password\": { \"v\": [\"パスワードを表示\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Hide password\": { \"v\": [\"パスワードを非表示\"] }, \"Password is secure\": { \"v\": [\"パスワードは保護されています\"] }, \"Show password\": { \"v\": [\"パスワードを表示\"] } } }, { \"l\": \"ko\", \"t\": { \"Hide password\": { \"v\": [\"암호 숨기기\"] }, \"Password is secure\": { \"v\": [\"암호가 안전합니다.\"] }, \"Show password\": { \"v\": [\"암호 표시\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Hide password\": { \"v\": [\"Skjul passord\"] }, \"Password is secure\": { \"v\": [\"Passordet er sikkert\"] }, \"Show password\": { \"v\": [\"Vis passord\"] } } }, { \"l\": \"nl\", \"t\": { \"Hide password\": { \"v\": [\"Verberg wachtwoord\"] }, \"Password is secure\": { \"v\": [\"Wachtwoord is veilig\"] }, \"Show password\": { \"v\": [\"Toon wachtwoord\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Hide password\": { \"v\": [\"Ukryj hasło\"] }, \"Password is secure\": { \"v\": [\"Hasło jest bezpieczne\"] }, \"Show password\": { \"v\": [\"Pokaż hasło\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Hide password\": { \"v\": [\"Ocultar senha\"] }, \"Password is secure\": { \"v\": [\"A senha é segura\"] }, \"Show password\": { \"v\": [\"Mostrar senha\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Hide password\": { \"v\": [\"Ocultar palavra-passe\"] }, \"Password is secure\": { \"v\": [\"A palavra-passe é segura\"] }, \"Show password\": { \"v\": [\"Mostrar palavra-passe\"] } } }, { \"l\": \"ro\", \"t\": { \"Hide password\": { \"v\": [\"Ascunde parola\"] }, \"Password is secure\": { \"v\": [\"Parola este sigură\"] }, \"Show password\": { \"v\": [\"Arată parola\"] } } }, { \"l\": \"ru\", \"t\": { \"Hide password\": { \"v\": [\"Скрыть пароль\"] }, \"Password is secure\": { \"v\": [\"Пароль надежный\"] }, \"Show password\": { \"v\": [\"Показать пароль\"] } } }, { \"l\": \"sk\", \"t\": { \"Hide password\": { \"v\": [\"Skryť heslo\"] }, \"Password is secure\": { \"v\": [\"Heslo je bezpečné\"] }, \"Show password\": { \"v\": [\"Zobraziť heslo\"] } } }, { \"l\": \"sl\", \"t\": { \"Hide password\": { \"v\": [\"Skrij geslo\"] }, \"Password is secure\": { \"v\": [\"Geslo je varno\"] }, \"Show password\": { \"v\": [\"Pokaži geslo\"] } } }, { \"l\": \"sr\", \"t\": { \"Hide password\": { \"v\": [\"Сакриј лозинку\"] }, \"Password is secure\": { \"v\": [\"Лозинка је безбедна\"] }, \"Show password\": { \"v\": [\"Прикажи лозинку\"] } } }, { \"l\": \"sv\", \"t\": { \"Hide password\": { \"v\": [\"Göm lösenordet\"] }, \"Password is secure\": { \"v\": [\"Lössenordet är säkert\"] }, \"Show password\": { \"v\": [\"Visa lössenordet\"] } } }, { \"l\": \"tr\", \"t\": { \"Hide password\": { \"v\": [\"Parolayı gizle\"] }, \"Password is secure\": { \"v\": [\"Parola güvenli\"] }, \"Show password\": { \"v\": [\"Parolayı görüntüle\"] } } }, { \"l\": \"uk\", \"t\": { \"Hide password\": { \"v\": [\"Приховати пароль\"] }, \"Password is secure\": { \"v\": [\"Пароль безпечний\"] }, \"Show password\": { \"v\": [\"Показати пароль\"] } } }, { \"l\": \"uz\", \"t\": { \"Hide password\": { \"v\": [\"Parolni yashirish\"] }, \"Password is secure\": { \"v\": [\"Parol xavfsiz\"] }, \"Show password\": { \"v\": [\"Parolni ko'rsatish\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Hide password\": { \"v\": [\"隐藏密码\"] }, \"Password is secure\": { \"v\": [\"密码安全\"] }, \"Show password\": { \"v\": [\"显示密码\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Hide password\": { \"v\": [\"隱藏密碼\"] }, \"Password is secure\": { \"v\": [\"密碼是安全的\"] }, \"Show password\": { \"v\": [\"顯示密碼\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Hide password\": { \"v\": [\"隱藏密碼\"] }, \"Password is secure\": { \"v\": [\"密碼安全\"] }, \"Show password\": { \"v\": [\"顯示密碼\"] } } }];\nconst t30 = [{ \"l\": \"ar\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"مساعدة في التنقل باستعمال لوحة المفاتيح\"] }, \"Skip to app navigation\": { \"v\": [\"تجاوَز إلى التنقل في التطبيق\"] }, \"Skip to main content\": { \"v\": [\"تجاوَز إلى المحتوى الرئيسي\"] } } }, { \"l\": \"ast\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Ayuda de la navegación pente'l tecláu\"] }, \"Skip to app navigation\": { \"v\": [\"Dir a la navegación d'aplicaciones\"] }, \"Skip to main content\": { \"v\": [\"Dir al conteníu principal\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Nápověda pro pohyb pomocí klávesnice\"] }, \"Skip to app navigation\": { \"v\": [\"Přeskočit na navigaci aplikace\"] }, \"Skip to main content\": { \"v\": [\"Přeskočit na hlavní obsah\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Nápověda pro pohyb pomocí klávesnice\"] }, \"Skip to app navigation\": { \"v\": [\"Přeskočit na navigaci aplikace\"] }, \"Skip to main content\": { \"v\": [\"Přeskočit na hlavní obsah\"] } } }, { \"l\": \"da\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Hjælp til tastaturnavigation\"] }, \"Skip to app navigation\": { \"v\": [\"Spring til app navigation\"] }, \"Skip to main content\": { \"v\": [\"Spring til hovedindhold\"] } } }, { \"l\": \"de\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Tastatur-Navigationshilfe\"] }, \"Skip to app navigation\": { \"v\": [\"Zur App-Navigation springen\"] }, \"Skip to main content\": { \"v\": [\"Zum Hauptinhalt springen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Tastatur-Navigationshilfe\"] }, \"Skip to app navigation\": { \"v\": [\"Zur App-Navigation springen\"] }, \"Skip to main content\": { \"v\": [\"Zum Hauptinhalt springen\"] } } }, { \"l\": \"el\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Βοήθεια πλοήγησης με πληκτρολόγιο\"] }, \"Skip to app navigation\": { \"v\": [\"Μετάβαση στην πλοήγηση της εφαρμογής\"] }, \"Skip to main content\": { \"v\": [\"Μετάβαση στο κύριο περιεχόμενο\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Keyboard navigation help\"] }, \"Skip to app navigation\": { \"v\": [\"Skip to app navigation\"] }, \"Skip to main content\": { \"v\": [\"Skip to main content\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Ayuda de navegación del teclado\"] }, \"Skip to app navigation\": { \"v\": [\"Saltar a la navegación de apps\"] }, \"Skip to main content\": { \"v\": [\"Saltar al contenido principal\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Ayuda de navegación del teclado\"] }, \"Skip to app navigation\": { \"v\": [\"Saltar a la navegación de app\"] }, \"Skip to main content\": { \"v\": [\"Saltar al contenido principal\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Ayuda de navegación del teclado\"] }, \"Skip to app navigation\": { \"v\": [\"Saltar a la navegación de app\"] }, \"Skip to main content\": { \"v\": [\"Saltar al contenido principal\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Klahvistiku kasutuse abiteave\"] }, \"Skip to app navigation\": { \"v\": [\"Suundu rakenduses liikumise valikute juurde\"] }, \"Skip to main content\": { \"v\": [\"Suundu põhisisu juurde\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"راهنمای ناوبری صفحه کلید\"] }, \"Skip to app navigation\": { \"v\": [\"رفتن به پیمایش برنامه\"] }, \"Skip to main content\": { \"v\": [\"رفتن به محتوای اصلی\"] } } }, { \"l\": \"fi\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Näppäimistönavigoinnin ohje\"] }, \"Skip to app navigation\": { \"v\": [\"Siirry sovelluksen navigaatioon\"] }, \"Skip to main content\": { \"v\": [\"Siirry pääsisältöön\"] } } }, { \"l\": \"fr\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Aide à la navigation du clavier\"] }, \"Skip to app navigation\": { \"v\": [\"Passer à l'app navigation\"] }, \"Skip to main content\": { \"v\": [\"Passer au contenu principal\"] } } }, { \"l\": \"ga\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Cabhair le nascleanúint méarchláir\"] }, \"Skip to app navigation\": { \"v\": [\"Téigh ar aghaidh chuig nascleanúint aip\"] }, \"Skip to main content\": { \"v\": [\"Téigh ar aghaidh chuig an bpríomhábhar\"] } } }, { \"l\": \"gl\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Axuda á navegación co teclado\"] }, \"Skip to app navigation\": { \"v\": [\"Ir á navegación da aplicación\"] }, \"Skip to main content\": { \"v\": [\"Ir ao contido principal\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Aðstoð við rötun á lyklaborði\"] }, \"Skip to app navigation\": { \"v\": [\"Sleppa og fara í flakk innan forrits\"] }, \"Skip to main content\": { \"v\": [\"Sleppa og fara í meginefni\"] } } }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"キーボード・ナビゲーション・ヘルプ\"] }, \"Skip to app navigation\": { \"v\": [\"アプリのナビゲーションへ移動\"] }, \"Skip to main content\": { \"v\": [\"メインコンテンツへ移動\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"キーボード・ナビゲーション・ヘルプ\"] }, \"Skip to app navigation\": { \"v\": [\"アプリのナビゲーションへ移動\"] }, \"Skip to main content\": { \"v\": [\"メインコンテンツへ移動\"] } } }, { \"l\": \"ko\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"키보드 탐색 도움말\"] }, \"Skip to app navigation\": { \"v\": [\"앱 탐색으로 건너뛰기\"] }, \"Skip to main content\": { \"v\": [\"본 내용으로 건너뛰기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Hjelp for tastaturnavigering\"] }, \"Skip to app navigation\": { \"v\": [\"Hopp til appnavigering\"] }, \"Skip to main content\": { \"v\": [\"Hopp til hovedinnhold\"] } } }, { \"l\": \"nl\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Hulp voor toetsenbordnavigatie\"] }, \"Skip to app navigation\": { \"v\": [\"Doorgaan naar app-navigatie\"] }, \"Skip to main content\": { \"v\": [\"Naar hoofdinhoud gaan\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Pomoc w nawigacji za pomocą klawiatury\"] }, \"Skip to app navigation\": { \"v\": [\"Przewiń do nawigacji\"] }, \"Skip to main content\": { \"v\": [\"Przewiń do głównych treści\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Ajuda para navegação pelo teclado\"] }, \"Skip to app navigation\": { \"v\": [\"Ir para navegação\"] }, \"Skip to main content\": { \"v\": [\"Ir para conteúdo principal\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Ajuda à navegação no teclado\"] }, \"Skip to app navigation\": { \"v\": [\"Saltar para navegação da app\"] }, \"Skip to main content\": { \"v\": [\"Saltar para conteúdo principal\"] } } }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Справка по навигации с помощью клавиатуры\"] }, \"Skip to app navigation\": { \"v\": [\"Перейти к навигации по приложению\"] }, \"Skip to main content\": { \"v\": [\"Перейти к основному содержанию\"] } } }, { \"l\": \"sk\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Pomoc pri navigácii pomocou klávesnice\"] }, \"Skip to app navigation\": { \"v\": [\"Preskočiť na navigáciu v aplikácii\"] }, \"Skip to main content\": { \"v\": [\"Preskočiť na hlavný obsah\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Помоћ за навигацију тастатуром\"] }, \"Skip to app navigation\": { \"v\": [\"Прескочи на навигацију апликацијом\"] }, \"Skip to main content\": { \"v\": [\"Прескочи на главни садржај\"] } } }, { \"l\": \"sv\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Hjälp med tangentbordsnavigering\"] }, \"Skip to app navigation\": { \"v\": [\"Hoppa till appnavigering\"] }, \"Skip to main content\": { \"v\": [\"Hoppa till huvudinnehåll\"] } } }, { \"l\": \"tr\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Klavye ile gezinme yardımı\"] }, \"Skip to app navigation\": { \"v\": [\"Uygulama gezinmesine git\"] }, \"Skip to main content\": { \"v\": [\"Ana içeriğe git\"] } } }, { \"l\": \"uk\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Допомога з навігацією клавішами\"] }, \"Skip to app navigation\": { \"v\": [\"Пропустити навігацію по застосунках\"] }, \"Skip to main content\": { \"v\": [\"Перейти одразу до головного вмісту\"] } } }, { \"l\": \"uz\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"Klaviatura navigatsiyasi yordami\"] }, \"Skip to app navigation\": { \"v\": [\"Ilova navigatsiyasiga oʻtish\"] }, \"Skip to main content\": { \"v\": [\"Asosiy tarkibga o'tish\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"键盘导航栏帮助\"] }, \"Skip to app navigation\": { \"v\": [\"跳转至应用程序导航页\"] }, \"Skip to main content\": { \"v\": [\"跳转至主要内容\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Keyboard navigation help\": { \"v\": [\"鍵盤導航幫助\"] }, \"Skip to app navigation\": { \"v\": [\"跳至應用程式導航\"] }, \"Skip to main content\": { \"v\": [\"跳至主要內容\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t32 = [{ \"l\": \"ar\", \"t\": { 'Load more \"{options}\"': { \"v\": ['تحميل المزيد من \"{options}\" '] }, \"Raw link {options}\": { \"v\": [\" الرابط الخام raw link ـ {options}\"] }, \"Start typing to search\": { \"v\": [\"إبدإ كتابة مفردات البحث\"] } } }, { \"l\": \"ast\", \"t\": { 'Load more \"{options}\"': { \"v\": [\"Cargar más «{options}»\"] }, \"Raw link {options}\": { \"v\": [\"Enllaz en bruto {optiones}\"] }, \"Start typing to search\": { \"v\": [\"Comienza a escribir pa buscar\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { 'Load more \"{options}\"': { \"v\": [\"Načíst další „{options}“\"] }, \"Raw link {options}\": { \"v\": [\"Holý odkaz {options}\"] }, \"Start typing to search\": { \"v\": [\"Vyhledávejte psaním\"] } } }, { \"l\": \"cs-CZ\", \"t\": { 'Load more \"{options}\"': { \"v\": [\"Načíst další „{options}“\"] }, \"Raw link {options}\": { \"v\": [\"Holý odkaz {options}\"] }, \"Start typing to search\": { \"v\": [\"Vyhledávejte psaním\"] } } }, { \"l\": \"da\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Indlæs flere \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Rå link {options}\"] }, \"Start typing to search\": { \"v\": [\"Begynd at skrive for at søge\"] } } }, { \"l\": \"de\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Weitere \"{options}\" laden'] }, \"Raw link {options}\": { \"v\": [\"Unverarbeiteter Link {Optionen}\"] }, \"Start typing to search\": { \"v\": [\"Mit der Eingabe beginnen, um zu suchen\"] } } }, { \"l\": \"de-DE\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Weitere \"{options}\" laden'] }, \"Raw link {options}\": { \"v\": [\"Unverarbeiteter Link {Optionen}\"] }, \"Start typing to search\": { \"v\": [\"Mit der Eingabe beginnen, um zu suchen\"] } } }, { \"l\": \"el\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Φόρτωση περισσότερων \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Ακατέργαστος σύνδεσμος {options}\"] }, \"Start typing to search\": { \"v\": [\"Ξεκινήστε να πληκτρολογείτε για αναζήτηση\"] } } }, { \"l\": \"en-GB\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Load more \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Raw link {options}\"] }, \"Start typing to search\": { \"v\": [\"Start typing to search\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Cargar más \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Enlace directo {options}\"] }, \"Start typing to search\": { \"v\": [\"Comience a escribir para buscar\"] } } }, { \"l\": \"es-AR\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Cargar más \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Enlace directo {options}\"] }, \"Start typing to search\": { \"v\": [\"Comience a escribir para buscar\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Raw link {options}\": { \"v\": [\"Enlace directo {options}\"] }, \"Start typing to search\": { \"v\": [\"Comienza a escribir para buscar\"] } } }, { \"l\": \"es-MX\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Cargar más \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Enlace directo {options}\"] }, \"Start typing to search\": { \"v\": [\"Comience a escribir para buscar\"] } } }, { \"l\": \"et-EE\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Laadi rohkem \"{valikud}\"'] }, \"Raw link {options}\": { \"v\": [\"Raw link {valikud}\"] }, \"Start typing to search\": { \"v\": [\"Alusta otsinguks sisestamist\"] } } }, { \"l\": \"eu\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Kargatu \"{options}\" gehiago'] }, \"Raw link {options}\": { \"v\": [\"Formaturik gabeko esteka {aukerak}\"] }, \"Start typing to search\": { \"v\": [\"Hasi idazten bilatzeko\"] } } }, { \"l\": \"fa\", \"t\": { 'Load more \"{options}\"': { \"v\": ['بارگذاری بیشتر \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"پیوند خام {options}\"] }, \"Start typing to search\": { \"v\": [\"برای جستجو تایپ کنید\"] } } }, { \"l\": \"fi\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Lataa lisää \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Raaka linkki {options}\"] }, \"Start typing to search\": { \"v\": [\"Aloita kirjoittaminen hakeaksesi\"] } } }, { \"l\": \"fr\", \"t\": { 'Load more \"{options}\"': { \"v\": [`Charger d'avantage \"{options}\"`] }, \"Raw link {options}\": { \"v\": [\"Lien brut {options}\"] }, \"Start typing to search\": { \"v\": [\"Commencez à écrire pour rechercher\"] } } }, { \"l\": \"ga\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Luchtaigh tuilleadh \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Nasc amh {roghanna}\"] }, \"Start typing to search\": { \"v\": [\"Tosaigh ag clóscríobh chun cuardach a dhéanamh\"] } } }, { \"l\": \"gl\", \"t\": { 'Load more \"{options}\"': { \"v\": [\"Cargar máis «{options}»\"] }, \"Raw link {options}\": { \"v\": [\"Ligazón sen procesar {options}\"] }, \"Start typing to search\": { \"v\": [\"Comece a escribir para buscar\"] } } }, { \"l\": \"he\", \"t\": { \"Raw link {options}\": { \"v\": [\"קישור גולמי {options}\"] }, \"Start typing to search\": { \"v\": [\"התחלת הקלדה מחפשת\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Muat \"{options}\" lainnya'] }, \"Raw link {options}\": { \"v\": [\"Tautan mentah {options}\"] }, \"Start typing to search\": { \"v\": [\"Ketik untuk mulai mencari\"] } } }, { \"l\": \"is\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Hlaða inn fleiri \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Hrár tengill {options}\"] }, \"Start typing to search\": { \"v\": [\"Byrjaðu að skrifa til að leita\"] } } }, { \"l\": \"it\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Carica più \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Raw link {options}\"] }, \"Start typing to search\": { \"v\": [\"Iniziare a digitare per effettuare la ricerca\"] } } }, { \"l\": \"ja\", \"t\": { 'Load more \"{options}\"': { \"v\": ['\"{options}\" をもっと読み込む'] }, \"Raw link {options}\": { \"v\": [\"未加工のリンク {options}\"] }, \"Start typing to search\": { \"v\": [\"入力を開始して検索します\"] } } }, { \"l\": \"ja-JP\", \"t\": { 'Load more \"{options}\"': { \"v\": ['\"{options}\" をもっと読み込む'] }, \"Raw link {options}\": { \"v\": [\"未加工のリンク {options}\"] }, \"Start typing to search\": { \"v\": [\"入力を開始して検索します\"] } } }, { \"l\": \"ko\", \"t\": { 'Load more \"{options}\"': { \"v\": ['\"{options}\" 더 불러오기'] }, \"Raw link {options}\": { \"v\": [\"{options} 원본 링크\"] }, \"Start typing to search\": { \"v\": [\"입력하여 검색\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Last inn flere \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Rå lenke {options}\"] }, \"Start typing to search\": { \"v\": [\"Start å skrive for å søke\"] } } }, { \"l\": \"nl\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Laad meer \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Basis link {options}\"] }, \"Start typing to search\": { \"v\": [\"Start met typen om te zoeken\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Załaduj więcej \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Surowy odnośnik {options}\"] }, \"Start typing to search\": { \"v\": [\"Zacznij pisać, aby wyszukać\"] } } }, { \"l\": \"pt-BR\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Carregar mais \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Link bruto {options}\"] }, \"Start typing to search\": { \"v\": [\"Comece a digitar para pesquisar\"] } } }, { \"l\": \"pt-PT\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Carregar mais \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Link inicial {options}\"] }, \"Start typing to search\": { \"v\": [\"Comece a digitar para pesquisar\"] } } }, { \"l\": \"ro\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Încarcă mai multe \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Link brut {options}\"] }, \"Start typing to search\": { \"v\": [\"Tastați pentru căutare\"] } } }, { \"l\": \"ru\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Загрузить больше \"{options}\"\"'] }, \"Raw link {options}\": { \"v\": [\"Необработанная ссылка {options}\"] }, \"Start typing to search\": { \"v\": [\"Начните вводить текст для поиска\"] } } }, { \"l\": \"sk\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Načítať viac \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Raw odkaz {options}\"] }, \"Start typing to search\": { \"v\": [\"Začnite písať pre vyhľadávanie\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { 'Load more \"{options}\"': { \"v\": [\"Учитај још „{options}”\"] }, \"Raw link {options}\": { \"v\": [\"Сирови линк {options}\"] }, \"Start typing to search\": { \"v\": [\"Покрените претрагу куцањем\"] } } }, { \"l\": \"sv\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Ladda fler \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Oformaterad länk {options}\"] }, \"Start typing to search\": { \"v\": [\"Börja skriva för att söka\"] } } }, { \"l\": \"tr\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Diğer \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Ham bağlantı {options}\"] }, \"Start typing to search\": { \"v\": [\"Aramak için yazmaya başlayın\"] } } }, { \"l\": \"uk\", \"t\": { 'Load more \"{options}\"': { \"v\": ['Завантажити більше \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"Пряме посилання {options}\"] }, \"Start typing to search\": { \"v\": [\"Почніть вводити для пошуку\"] } } }, { \"l\": \"uz\", \"t\": { 'Load more \"{options}\"': { \"v\": [`Ko'proq yuklash \"{options}\"`] }, \"Raw link {options}\": { \"v\": [\" {options}satr havolasi\"] }, \"Start typing to search\": { \"v\": [\"Qidirish uchun yozishni boshlang\"] } } }, { \"l\": \"zh-CN\", \"t\": { 'Load more \"{options}\"': { \"v\": [\"加载更多 “{options}”\"] }, \"Raw link {options}\": { \"v\": [\"原始链接 {options}\"] }, \"Start typing to search\": { \"v\": [\"开始输入以进行搜索\"] } } }, { \"l\": \"zh-HK\", \"t\": { 'Load more \"{options}\"': { \"v\": ['載入更多 \"{options}\"'] }, \"Raw link {options}\": { \"v\": [\"原始連結 {options}\"] }, \"Start typing to search\": { \"v\": [\"開始輸入以進行搜尋\"] } } }, { \"l\": \"zh-TW\", \"t\": { 'Load more \"{options}\"': { \"v\": [\"載入更多「{options}」\"] }, \"Raw link {options}\": { \"v\": [\"原始連結 {options}\"] }, \"Start typing to search\": { \"v\": [\"開始輸入以進行搜尋\"] } } }];\nconst t33 = [{ \"l\": \"ar\", \"t\": {} }, { \"l\": \"ast\", \"t\": {} }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": {} }, { \"l\": \"cs-CZ\", \"t\": {} }, { \"l\": \"da\", \"t\": {} }, { \"l\": \"de\", \"t\": {} }, { \"l\": \"de-DE\", \"t\": {} }, { \"l\": \"el\", \"t\": {} }, { \"l\": \"en-GB\", \"t\": {} }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": {} }, { \"l\": \"es-AR\", \"t\": {} }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": {} }, { \"l\": \"et-EE\", \"t\": {} }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": {} }, { \"l\": \"fi\", \"t\": {} }, { \"l\": \"fr\", \"t\": {} }, { \"l\": \"ga\", \"t\": {} }, { \"l\": \"gl\", \"t\": {} }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": {} }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": {} }, { \"l\": \"ja-JP\", \"t\": {} }, { \"l\": \"ko\", \"t\": {} }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": {} }, { \"l\": \"nl\", \"t\": {} }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": {} }, { \"l\": \"pt-BR\", \"t\": {} }, { \"l\": \"pt-PT\", \"t\": {} }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": {} }, { \"l\": \"sk\", \"t\": {} }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": {} }, { \"l\": \"sv\", \"t\": {} }, { \"l\": \"tr\", \"t\": {} }, { \"l\": \"uk\", \"t\": {} }, { \"l\": \"uz\", \"t\": {} }, { \"l\": \"zh-CN\", \"t\": {} }, { \"l\": \"zh-HK\", \"t\": {} }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t34 = [{ \"l\": \"ar\", \"t\": { \"No link provider found\": { \"v\": [\"لا يوجد أيّ مزود روابط link provider\"] } } }, { \"l\": \"ast\", \"t\": { \"No link provider found\": { \"v\": [\"Nun s'atopó nengún fornidor d'enllaces\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"No link provider found\": { \"v\": [\"Nenalezen žádný poskytovatel odkazů\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"No link provider found\": { \"v\": [\"Nenalezen žádný poskytovatel odkazů\"] } } }, { \"l\": \"da\", \"t\": { \"No link provider found\": { \"v\": [\"Ingen linkudbyder fundet\"] } } }, { \"l\": \"de\", \"t\": { \"No link provider found\": { \"v\": [\"Kein Linkanbieter gefunden\"] } } }, { \"l\": \"de-DE\", \"t\": { \"No link provider found\": { \"v\": [\"Kein Linkanbieter gefunden\"] } } }, { \"l\": \"el\", \"t\": { \"No link provider found\": { \"v\": [\"Δεν βρέθηκε πάροχος συνδέσμου\"] } } }, { \"l\": \"en-GB\", \"t\": { \"No link provider found\": { \"v\": [\"No link provider found\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"No link provider found\": { \"v\": [\"No se encontró ningún proveedor de enlaces\"] } } }, { \"l\": \"es-AR\", \"t\": { \"No link provider found\": { \"v\": [\"No se encontró ningún proveedor de enlaces\"] } } }, { \"l\": \"es-EC\", \"t\": { \"No link provider found\": { \"v\": [\"No se encontró ningún proveedor de enlaces\"] } } }, { \"l\": \"es-MX\", \"t\": { \"No link provider found\": { \"v\": [\"No se encontró ningún proveedor de enlaces\"] } } }, { \"l\": \"et-EE\", \"t\": { \"No link provider found\": { \"v\": [\"Lingi pakkujat ei leitud\"] } } }, { \"l\": \"eu\", \"t\": { \"No link provider found\": { \"v\": [\"Ez da aurkitu esteka-hornitzailerik\"] } } }, { \"l\": \"fa\", \"t\": { \"No link provider found\": { \"v\": [\"هیچ ارائه‌دهنده پیوندی یافت نشد\"] } } }, { \"l\": \"fi\", \"t\": { \"No link provider found\": { \"v\": [\"Linkin tarjoajia ei löydetty\"] } } }, { \"l\": \"fr\", \"t\": { \"No link provider found\": { \"v\": [\"Aucun fournisseur de lien trouvé\"] } } }, { \"l\": \"ga\", \"t\": { \"No link provider found\": { \"v\": [\"Níor aimsíodh aon soláthraí naisc\"] } } }, { \"l\": \"gl\", \"t\": { \"No link provider found\": { \"v\": [\"Non se atopou ningún provedor de ligazóns\"] } } }, { \"l\": \"he\", \"t\": { \"No link provider found\": { \"v\": [\"לא נמצא ספק קישורים\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"No link provider found\": { \"v\": [\"Tidak ada penyedia tautan yang ditemukan\"] } } }, { \"l\": \"is\", \"t\": { \"No link provider found\": { \"v\": [\"Engin tenglaveita fannst\"] } } }, { \"l\": \"it\", \"t\": { \"No link provider found\": { \"v\": [\"Nessun fornitore di link trovato\"] } } }, { \"l\": \"ja\", \"t\": { \"No link provider found\": { \"v\": [\"リンクプロバイダーが見つかりません\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"No link provider found\": { \"v\": [\"リンクプロバイダーが見つかりません\"] } } }, { \"l\": \"ko\", \"t\": { \"No link provider found\": { \"v\": [\"링크 제공자 없음\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"No link provider found\": { \"v\": [\"Finner ingen lenkeleverandør\"] } } }, { \"l\": \"nl\", \"t\": { \"No link provider found\": { \"v\": [\"Geen link provider gevonden\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"No link provider found\": { \"v\": [\"Nie znaleziono dostawcy linków\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"No link provider found\": { \"v\": [\"Nenhum provedor de link encontrado\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"No link provider found\": { \"v\": [\"Nenhum fornecedor de link encontrado\"] } } }, { \"l\": \"ro\", \"t\": { \"No link provider found\": { \"v\": [\"Nu s-a găsit un provider pentru linkuri\"] } } }, { \"l\": \"ru\", \"t\": { \"No link provider found\": { \"v\": [\"Поставщик ссылок не найден\"] } } }, { \"l\": \"sk\", \"t\": { \"No link provider found\": { \"v\": [\"Žiaden odkaz poskytovateľa nebol nájdený\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"No link provider found\": { \"v\": [\"Није пронађен ниједан пружалац линка\"] } } }, { \"l\": \"sv\", \"t\": { \"No link provider found\": { \"v\": [\"Ingen länkleverantör hittades\"] } } }, { \"l\": \"tr\", \"t\": { \"No link provider found\": { \"v\": [\"Bağlantı sağlayıcısı bulunamadı\"] } } }, { \"l\": \"uk\", \"t\": { \"No link provider found\": { \"v\": [\"Не наведено посилання\"] } } }, { \"l\": \"uz\", \"t\": { \"No link provider found\": { \"v\": [\"Hech qanday havola provayderi topilmadi\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"No link provider found\": { \"v\": [\"未找到任何链接提供者\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"No link provider found\": { \"v\": [\"找不到連結提供者\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"No link provider found\": { \"v\": [\"找不到連結提供者\"] } } }];\nconst t35 = [{ \"l\": \"ar\", \"t\": {} }, { \"l\": \"ast\", \"t\": {} }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": {} }, { \"l\": \"cs-CZ\", \"t\": {} }, { \"l\": \"da\", \"t\": {} }, { \"l\": \"de\", \"t\": {} }, { \"l\": \"de-DE\", \"t\": {} }, { \"l\": \"el\", \"t\": {} }, { \"l\": \"en-GB\", \"t\": {} }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": {} }, { \"l\": \"es-AR\", \"t\": {} }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": {} }, { \"l\": \"et-EE\", \"t\": {} }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": {} }, { \"l\": \"fi\", \"t\": {} }, { \"l\": \"fr\", \"t\": {} }, { \"l\": \"ga\", \"t\": {} }, { \"l\": \"gl\", \"t\": {} }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": {} }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": {} }, { \"l\": \"ja-JP\", \"t\": {} }, { \"l\": \"ko\", \"t\": {} }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": {} }, { \"l\": \"nl\", \"t\": {} }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": {} }, { \"l\": \"pt-BR\", \"t\": {} }, { \"l\": \"pt-PT\", \"t\": {} }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": {} }, { \"l\": \"sk\", \"t\": {} }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": {} }, { \"l\": \"sv\", \"t\": {} }, { \"l\": \"tr\", \"t\": {} }, { \"l\": \"uk\", \"t\": {} }, { \"l\": \"uz\", \"t\": {} }, { \"l\": \"zh-CN\", \"t\": {} }, { \"l\": \"zh-HK\", \"t\": {} }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t36 = [{ \"l\": \"ar\", \"t\": { \"Next\": { \"v\": [\"التالي\"] }, \"Pause slideshow\": { \"v\": [\"تجميد عرض الشرائح\"] }, \"Previous\": { \"v\": [\"السابق\"] }, \"Start slideshow\": { \"v\": [\"إبدإ العرض\"] } } }, { \"l\": \"ast\", \"t\": { \"Next\": { \"v\": [\"Siguiente\"] }, \"Pause slideshow\": { \"v\": [\"Posar la presentación de diapositives\"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Aniciar la presentación de diapositives\"] } } }, { \"l\": \"br\", \"t\": { \"Next\": { \"v\": [\"Da heul\"] }, \"Pause slideshow\": { \"v\": [\"Arsav an diaporama\"] }, \"Previous\": { \"v\": [\"A-raok\"] }, \"Start slideshow\": { \"v\": [\"Kregiñ an diaporama\"] } } }, { \"l\": \"ca\", \"t\": { \"Next\": { \"v\": [\"Següent\"] }, \"Pause slideshow\": { \"v\": [\"Atura la presentació\"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Inicia la presentació\"] } } }, { \"l\": \"cs\", \"t\": { \"Next\": { \"v\": [\"Následující\"] }, \"Pause slideshow\": { \"v\": [\"Pozastavit prezentaci\"] }, \"Previous\": { \"v\": [\"Předchozí\"] }, \"Start slideshow\": { \"v\": [\"Spustit prezentaci\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Next\": { \"v\": [\"Následující\"] }, \"Pause slideshow\": { \"v\": [\"Pozastavit prezentaci\"] }, \"Previous\": { \"v\": [\"Předchozí\"] }, \"Start slideshow\": { \"v\": [\"Spustit prezentaci\"] } } }, { \"l\": \"da\", \"t\": { \"Next\": { \"v\": [\"Videre\"] }, \"Pause slideshow\": { \"v\": [\"Suspender fremvisning\"] }, \"Previous\": { \"v\": [\"Forrige\"] }, \"Start slideshow\": { \"v\": [\"Start fremvisning\"] } } }, { \"l\": \"de\", \"t\": { \"Next\": { \"v\": [\"Weiter\"] }, \"Pause slideshow\": { \"v\": [\"Diashow pausieren\"] }, \"Previous\": { \"v\": [\"Vorherige\"] }, \"Start slideshow\": { \"v\": [\"Diashow starten\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Next\": { \"v\": [\"Weiter\"] }, \"Pause slideshow\": { \"v\": [\"Diashow pausieren\"] }, \"Previous\": { \"v\": [\"Vorherige\"] }, \"Start slideshow\": { \"v\": [\"Diashow starten\"] } } }, { \"l\": \"el\", \"t\": { \"Next\": { \"v\": [\"Επόμενο\"] }, \"Pause slideshow\": { \"v\": [\"Παύση προβολής διαφανειών\"] }, \"Previous\": { \"v\": [\"Προηγούμενο\"] }, \"Start slideshow\": { \"v\": [\"Έναρξη προβολής διαφανειών\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Next\": { \"v\": [\"Next\"] }, \"Pause slideshow\": { \"v\": [\"Pause slideshow\"] }, \"Previous\": { \"v\": [\"Previous\"] }, \"Start slideshow\": { \"v\": [\"Start slideshow\"] } } }, { \"l\": \"eo\", \"t\": { \"Next\": { \"v\": [\"Sekva\"] }, \"Pause slideshow\": { \"v\": [\"Payzi bildprezenton\"] }, \"Previous\": { \"v\": [\"Antaŭa\"] }, \"Start slideshow\": { \"v\": [\"Komenci bildprezenton\"] } } }, { \"l\": \"es\", \"t\": { \"Next\": { \"v\": [\"Siguiente\"] }, \"Pause slideshow\": { \"v\": [\"Pausar la presentación \"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Iniciar la presentación\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Next\": { \"v\": [\"Siguiente\"] }, \"Pause slideshow\": { \"v\": [\"Pausar la presentación \"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Iniciar la presentación\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Next\": { \"v\": [\"Siguiente\"] }, \"Pause slideshow\": { \"v\": [\"Pausar presentación de diapositivas\"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Iniciar presentación de diapositivas\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Next\": { \"v\": [\"Siguiente\"] }, \"Pause slideshow\": { \"v\": [\"Pausar presentación de diapositivas\"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Iniciar presentación de diapositivas\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Next\": { \"v\": [\"Edasi\"] }, \"Pause slideshow\": { \"v\": [\"Slaidiesitluse paus\"] }, \"Previous\": { \"v\": [\"Eelmine\"] }, \"Start slideshow\": { \"v\": [\"Alusta slaidiesitust\"] } } }, { \"l\": \"eu\", \"t\": { \"Next\": { \"v\": [\"Hurrengoa\"] }, \"Pause slideshow\": { \"v\": [\"Pausatu diaporama\"] }, \"Previous\": { \"v\": [\"Aurrekoa\"] }, \"Start slideshow\": { \"v\": [\"Hasi diaporama\"] } } }, { \"l\": \"fa\", \"t\": { \"Next\": { \"v\": [\"بعدی\"] }, \"Pause slideshow\": { \"v\": [\"توقف نمایش اسلاید\"] }, \"Previous\": { \"v\": [\"قبلی\"] }, \"Start slideshow\": { \"v\": [\"شروع نمایش اسلاید\"] } } }, { \"l\": \"fi\", \"t\": { \"Next\": { \"v\": [\"Seuraava\"] }, \"Pause slideshow\": { \"v\": [\"Keskeytä diaesitys\"] }, \"Previous\": { \"v\": [\"Edellinen\"] }, \"Start slideshow\": { \"v\": [\"Aloita diaesitys\"] } } }, { \"l\": \"fr\", \"t\": { \"Next\": { \"v\": [\"Suivant\"] }, \"Pause slideshow\": { \"v\": [\"Mettre le diaporama en pause\"] }, \"Previous\": { \"v\": [\"Précédent\"] }, \"Start slideshow\": { \"v\": [\"Démarrer le diaporama\"] } } }, { \"l\": \"ga\", \"t\": { \"Next\": { \"v\": [\"Ar aghaidh\"] }, \"Pause slideshow\": { \"v\": [\"Cuir taispeántas sleamhnán ar sos\"] }, \"Previous\": { \"v\": [\"Roimhe Seo\"] }, \"Start slideshow\": { \"v\": [\"Tosaigh taispeántas sleamhnán\"] } } }, { \"l\": \"gl\", \"t\": { \"Next\": { \"v\": [\"Seguinte\"] }, \"Pause slideshow\": { \"v\": [\"Pausar o diaporama\"] }, \"Previous\": { \"v\": [\"Anterir\"] }, \"Start slideshow\": { \"v\": [\"Iniciar o diaporama\"] } } }, { \"l\": \"he\", \"t\": { \"Next\": { \"v\": [\"הבא\"] }, \"Pause slideshow\": { \"v\": [\"השהיית מצגת\"] }, \"Previous\": { \"v\": [\"הקודם\"] }, \"Start slideshow\": { \"v\": [\"התחלת המצגת\"] } } }, { \"l\": \"hu\", \"t\": { \"Next\": { \"v\": [\"Következő\"] }, \"Pause slideshow\": { \"v\": [\"Diavetítés szüneteltetése\"] }, \"Previous\": { \"v\": [\"Előző\"] }, \"Start slideshow\": { \"v\": [\"Diavetítés indítása\"] } } }, { \"l\": \"id\", \"t\": { \"Next\": { \"v\": [\"Selanjutnya\"] }, \"Pause slideshow\": { \"v\": [\"Jeda tayangan slide\"] }, \"Previous\": { \"v\": [\"Sebelumnya\"] }, \"Start slideshow\": { \"v\": [\"Mulai salindia\"] } } }, { \"l\": \"is\", \"t\": { \"Next\": { \"v\": [\"Næsta\"] }, \"Pause slideshow\": { \"v\": [\"Gera hlé á skyggnusýningu\"] }, \"Previous\": { \"v\": [\"Fyrri\"] }, \"Start slideshow\": { \"v\": [\"Byrja skyggnusýningu\"] } } }, { \"l\": \"it\", \"t\": { \"Next\": { \"v\": [\"Successivo\"] }, \"Pause slideshow\": { \"v\": [\"Presentazione in pausa\"] }, \"Previous\": { \"v\": [\"Precedente\"] }, \"Start slideshow\": { \"v\": [\"Avvia presentazione\"] } } }, { \"l\": \"ja\", \"t\": { \"Next\": { \"v\": [\"次\"] }, \"Pause slideshow\": { \"v\": [\"スライドショーを一時停止\"] }, \"Previous\": { \"v\": [\"前\"] }, \"Start slideshow\": { \"v\": [\"スライドショーを開始\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Next\": { \"v\": [\"次\"] }, \"Pause slideshow\": { \"v\": [\"スライドショーを一時停止\"] }, \"Previous\": { \"v\": [\"前\"] }, \"Start slideshow\": { \"v\": [\"スライドショーを開始\"] } } }, { \"l\": \"ko\", \"t\": { \"Next\": { \"v\": [\"다음\"] }, \"Pause slideshow\": { \"v\": [\"슬라이드쇼 일시정지\"] }, \"Previous\": { \"v\": [\"이전\"] }, \"Start slideshow\": { \"v\": [\"슬라이드쇼 시작\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"Next\": { \"v\": [\"Kitas\"] }, \"Pause slideshow\": { \"v\": [\"Pristabdyti skaidrių rodymą\"] }, \"Previous\": { \"v\": [\"Ankstesnis\"] }, \"Start slideshow\": { \"v\": [\"Pradėti skaidrių rodymą\"] } } }, { \"l\": \"lv\", \"t\": { \"Next\": { \"v\": [\"Nākamais\"] }, \"Pause slideshow\": { \"v\": [\"Pauzēt slaidrādi\"] }, \"Previous\": { \"v\": [\"Iepriekšējais\"] }, \"Start slideshow\": { \"v\": [\"Sākt slaidrādi\"] } } }, { \"l\": \"mk\", \"t\": { \"Next\": { \"v\": [\"Следно\"] }, \"Pause slideshow\": { \"v\": [\"Пузирај слајдшоу\"] }, \"Previous\": { \"v\": [\"Предходно\"] }, \"Start slideshow\": { \"v\": [\"Стартувај слајдшоу\"] } } }, { \"l\": \"my\", \"t\": { \"Next\": { \"v\": [\"နောက်သို့ဆက်ရန်\"] }, \"Pause slideshow\": { \"v\": [\"စလိုက်ရှိုး ခေတ္တရပ်ရန်\"] }, \"Previous\": { \"v\": [\"ယခင်\"] }, \"Start slideshow\": { \"v\": [\"စလိုက်ရှိုးအား စတင်ရန်\"] } } }, { \"l\": \"nb\", \"t\": { \"Next\": { \"v\": [\"Neste\"] }, \"Pause slideshow\": { \"v\": [\"Pause lysbildefremvisning\"] }, \"Previous\": { \"v\": [\"Forrige\"] }, \"Start slideshow\": { \"v\": [\"Start lysbildefremvisning\"] } } }, { \"l\": \"nl\", \"t\": { \"Next\": { \"v\": [\"Volgende\"] }, \"Pause slideshow\": { \"v\": [\"Pauzeer diavoorstelling\"] }, \"Previous\": { \"v\": [\"Vorige\"] }, \"Start slideshow\": { \"v\": [\"Start diavoorstelling\"] } } }, { \"l\": \"oc\", \"t\": { \"Next\": { \"v\": [\"Seguent\"] }, \"Pause slideshow\": { \"v\": [\"Metre en pausa lo diaporama\"] }, \"Previous\": { \"v\": [\"Precedent\"] }, \"Start slideshow\": { \"v\": [\"Lançar lo diaporama\"] } } }, { \"l\": \"pl\", \"t\": { \"Next\": { \"v\": [\"Następny\"] }, \"Pause slideshow\": { \"v\": [\"Wstrzymaj pokaz slajdów\"] }, \"Previous\": { \"v\": [\"Poprzedni\"] }, \"Start slideshow\": { \"v\": [\"Rozpocznij pokaz slajdów\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Next\": { \"v\": [\"Próximo\"] }, \"Pause slideshow\": { \"v\": [\"Pausar apresentação de slides\"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Iniciar apresentação de slides\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Next\": { \"v\": [\"Seguinte\"] }, \"Pause slideshow\": { \"v\": [\"Pausar diaporama\"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Iniciar diaporama\"] } } }, { \"l\": \"ro\", \"t\": { \"Next\": { \"v\": [\"Următorul\"] }, \"Pause slideshow\": { \"v\": [\"Pauză prezentare de diapozitive\"] }, \"Previous\": { \"v\": [\"Anterior\"] }, \"Start slideshow\": { \"v\": [\"Începeți prezentarea de diapozitive\"] } } }, { \"l\": \"ru\", \"t\": { \"Next\": { \"v\": [\"Следующее\"] }, \"Pause slideshow\": { \"v\": [\"Приостановить показ слйдов\"] }, \"Previous\": { \"v\": [\"Предыдущее\"] }, \"Start slideshow\": { \"v\": [\"Начать показ слайдов\"] } } }, { \"l\": \"sk\", \"t\": { \"Next\": { \"v\": [\"Ďalej\"] }, \"Pause slideshow\": { \"v\": [\"Pozastaviť prezentáciu\"] }, \"Previous\": { \"v\": [\"Predchádzajúce\"] }, \"Start slideshow\": { \"v\": [\"Začať prezentáciu\"] } } }, { \"l\": \"sl\", \"t\": { \"Next\": { \"v\": [\"Naslednji\"] }, \"Pause slideshow\": { \"v\": [\"Ustavi predstavitev\"] }, \"Previous\": { \"v\": [\"Predhodni\"] }, \"Start slideshow\": { \"v\": [\"Začni predstavitev\"] } } }, { \"l\": \"sr\", \"t\": { \"Next\": { \"v\": [\"Следеће\"] }, \"Pause slideshow\": { \"v\": [\"Паузирај слајд шоу\"] }, \"Previous\": { \"v\": [\"Претходно\"] }, \"Start slideshow\": { \"v\": [\"Покрени слајд шоу\"] } } }, { \"l\": \"sv\", \"t\": { \"Next\": { \"v\": [\"Nästa\"] }, \"Pause slideshow\": { \"v\": [\"Pausa bildspelet\"] }, \"Previous\": { \"v\": [\"Föregående\"] }, \"Start slideshow\": { \"v\": [\"Starta bildspelet\"] } } }, { \"l\": \"tr\", \"t\": { \"Next\": { \"v\": [\"Sonraki\"] }, \"Pause slideshow\": { \"v\": [\"Slayt sunumunu duraklat\"] }, \"Previous\": { \"v\": [\"Önceki\"] }, \"Start slideshow\": { \"v\": [\"Slayt sunumunu başlat\"] } } }, { \"l\": \"uk\", \"t\": { \"Next\": { \"v\": [\"Вперед\"] }, \"Pause slideshow\": { \"v\": [\"Пауза у показі слайдів\"] }, \"Previous\": { \"v\": [\"Назад\"] }, \"Start slideshow\": { \"v\": [\"Почати показ слайдів\"] } } }, { \"l\": \"uz\", \"t\": { \"Next\": { \"v\": [\"Keyingi\"] }, \"Pause slideshow\": { \"v\": [\"Slayd-shouni to'xtatib turish\"] }, \"Previous\": { \"v\": [\"Oldingi\"] }, \"Start slideshow\": { \"v\": [\"Slayd-shouni boshlash\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Next\": { \"v\": [\"下一个\"] }, \"Pause slideshow\": { \"v\": [\"暂停幻灯片\"] }, \"Previous\": { \"v\": [\"上一个\"] }, \"Start slideshow\": { \"v\": [\"开始幻灯片\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Next\": { \"v\": [\"下一個\"] }, \"Pause slideshow\": { \"v\": [\"暫停幻燈片\"] }, \"Previous\": { \"v\": [\"上一個\"] }, \"Start slideshow\": { \"v\": [\"開始幻燈片\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Next\": { \"v\": [\"下一個\"] }, \"Pause slideshow\": { \"v\": [\"暫停幻燈片\"] }, \"Previous\": { \"v\": [\"上一個\"] }, \"Start slideshow\": { \"v\": [\"開始幻燈片\"] } } }];\nconst t37 = [{ \"l\": \"ar\", \"t\": { \"No emoji found\": { \"v\": [\"لم يتم العثور على أي إيموجي emoji\"] } } }, { \"l\": \"ast\", \"t\": { \"No emoji found\": { \"v\": [\"Nun s'atopó nengún fustaxe\"] } } }, { \"l\": \"br\", \"t\": { \"No emoji found\": { \"v\": [\"Emoji ebet kavet\"] } } }, { \"l\": \"ca\", \"t\": { \"No emoji found\": { \"v\": [\"No s'ha trobat cap emoji\"] } } }, { \"l\": \"cs\", \"t\": { \"No emoji found\": { \"v\": [\"Nenalezeno žádné emoji\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"No emoji found\": { \"v\": [\"Nenalezeno žádné emoji\"] } } }, { \"l\": \"da\", \"t\": { \"No emoji found\": { \"v\": [\"Ingen emoji fundet\"] } } }, { \"l\": \"de\", \"t\": { \"No emoji found\": { \"v\": [\"Kein Emoji gefunden\"] } } }, { \"l\": \"de-DE\", \"t\": { \"No emoji found\": { \"v\": [\"Kein Emoji gefunden\"] } } }, { \"l\": \"el\", \"t\": { \"No emoji found\": { \"v\": [\"Δεν βρέθηκε emoji\"] } } }, { \"l\": \"en-GB\", \"t\": { \"No emoji found\": { \"v\": [\"No emoji found\"] } } }, { \"l\": \"eo\", \"t\": { \"No emoji found\": { \"v\": [\"La emoĝio forestas\"] } } }, { \"l\": \"es\", \"t\": { \"No emoji found\": { \"v\": [\"No se encontró ningún emoji\"] } } }, { \"l\": \"es-AR\", \"t\": { \"No emoji found\": { \"v\": [\"No se encontró ningún emoji\"] } } }, { \"l\": \"es-EC\", \"t\": { \"No emoji found\": { \"v\": [\"No se encontró ningún emoji\"] } } }, { \"l\": \"es-MX\", \"t\": { \"No emoji found\": { \"v\": [\"No se encontró ningún emoji\"] } } }, { \"l\": \"et-EE\", \"t\": { \"No emoji found\": { \"v\": [\"Emojit ei leitud\"] } } }, { \"l\": \"eu\", \"t\": { \"No emoji found\": { \"v\": [\"Ez da emojirik aurkitu\"] } } }, { \"l\": \"fa\", \"t\": { \"No emoji found\": { \"v\": [\"هیچ شکلکی یافت نشد\"] } } }, { \"l\": \"fi\", \"t\": { \"No emoji found\": { \"v\": [\"Emojia ei löytynyt\"] } } }, { \"l\": \"fr\", \"t\": { \"No emoji found\": { \"v\": [\"Pas d’émoji trouvé\"] } } }, { \"l\": \"ga\", \"t\": { \"No emoji found\": { \"v\": [\"Níor aimsíodh emoji\"] } } }, { \"l\": \"gl\", \"t\": { \"No emoji found\": { \"v\": [\"Non se atopou ningún «emoji»\"] } } }, { \"l\": \"he\", \"t\": { \"No emoji found\": { \"v\": [\"לא נמצא אמוג׳י\"] } } }, { \"l\": \"hu\", \"t\": { \"No emoji found\": { \"v\": [\"Nem található emodzsi\"] } } }, { \"l\": \"id\", \"t\": { \"No emoji found\": { \"v\": [\"Tidak ada emoji yang ditemukan\"] } } }, { \"l\": \"is\", \"t\": { \"No emoji found\": { \"v\": [\"Ekkert tjáningartákn fannst\"] } } }, { \"l\": \"it\", \"t\": { \"No emoji found\": { \"v\": [\"Nessun emoji trovato\"] } } }, { \"l\": \"ja\", \"t\": { \"No emoji found\": { \"v\": [\"絵文字が見つかりません\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"No emoji found\": { \"v\": [\"絵文字が見つかりません\"] } } }, { \"l\": \"ko\", \"t\": { \"No emoji found\": { \"v\": [\"이모지 없음\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"No emoji found\": { \"v\": [\"Nerasta jaustukų\"] } } }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"No emoji found\": { \"v\": [\"Не се пронајдени емотикони\"] } } }, { \"l\": \"my\", \"t\": { \"No emoji found\": { \"v\": [\"အီမိုဂျီ ရှာဖွေမတွေ့နိုင်ပါ\"] } } }, { \"l\": \"nb\", \"t\": { \"No emoji found\": { \"v\": [\"Fant ingen emoji\"] } } }, { \"l\": \"nl\", \"t\": { \"No emoji found\": { \"v\": [\"Geen emoji gevonden\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"No emoji found\": { \"v\": [\"Nie znaleziono emoji\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"No emoji found\": { \"v\": [\"Nenhum emoji encontrado\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"No emoji found\": { \"v\": [\"Nenhum emoji encontrado\"] } } }, { \"l\": \"ro\", \"t\": { \"No emoji found\": { \"v\": [\"Nu s-a găsit niciun emoji\"] } } }, { \"l\": \"ru\", \"t\": { \"No emoji found\": { \"v\": [\"Эмодзи не найдено\"] } } }, { \"l\": \"sk\", \"t\": { \"No emoji found\": { \"v\": [\"Nenašli sa žiadne emodži\"] } } }, { \"l\": \"sl\", \"t\": { \"No emoji found\": { \"v\": [\"Ni najdenih izraznih ikon\"] } } }, { \"l\": \"sr\", \"t\": { \"No emoji found\": { \"v\": [\"Није пронађен ниједан емођи\"] } } }, { \"l\": \"sv\", \"t\": { \"No emoji found\": { \"v\": [\"Hittade inga emojis\"] } } }, { \"l\": \"tr\", \"t\": { \"No emoji found\": { \"v\": [\"Herhangi bir emoji bulunamadı\"] } } }, { \"l\": \"uk\", \"t\": { \"No emoji found\": { \"v\": [\"Емоційки відсутні\"] } } }, { \"l\": \"uz\", \"t\": { \"No emoji found\": { \"v\": [\"Hech qanday emoji topilmadi\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"No emoji found\": { \"v\": [\"表情未找到\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"No emoji found\": { \"v\": [\"未找到表情符號\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"No emoji found\": { \"v\": [\"未找到表情符號\"] } } }];\nconst t38 = [{ \"l\": \"ar\", \"t\": { \"No results\": { \"v\": [\"ليس هناك أية نتيجة\"] } } }, { \"l\": \"ast\", \"t\": { \"No results\": { \"v\": [\"Nun hai nengún resultáu\"] } } }, { \"l\": \"br\", \"t\": { \"No results\": { \"v\": [\"Disoc'h ebet\"] } } }, { \"l\": \"ca\", \"t\": { \"No results\": { \"v\": [\"Sense resultats\"] } } }, { \"l\": \"cs\", \"t\": { \"No results\": { \"v\": [\"Nic nenalezeno\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"No results\": { \"v\": [\"Nic nenalezeno\"] } } }, { \"l\": \"da\", \"t\": { \"No results\": { \"v\": [\"Ingen resultater\"] } } }, { \"l\": \"de\", \"t\": { \"No results\": { \"v\": [\"Keine Ergebnisse\"] } } }, { \"l\": \"de-DE\", \"t\": { \"No results\": { \"v\": [\"Keine Ergebnisse\"] } } }, { \"l\": \"el\", \"t\": { \"No results\": { \"v\": [\"Κανένα αποτέλεσμα\"] } } }, { \"l\": \"en-GB\", \"t\": { \"No results\": { \"v\": [\"No results\"] } } }, { \"l\": \"eo\", \"t\": { \"No results\": { \"v\": [\"La rezulto forestas\"] } } }, { \"l\": \"es\", \"t\": { \"No results\": { \"v\": [\" Ningún resultado\"] } } }, { \"l\": \"es-AR\", \"t\": { \"No results\": { \"v\": [\"Sin resultados\"] } } }, { \"l\": \"es-EC\", \"t\": { \"No results\": { \"v\": [\"Sin resultados\"] } } }, { \"l\": \"es-MX\", \"t\": { \"No results\": { \"v\": [\"Sin resultados\"] } } }, { \"l\": \"et-EE\", \"t\": { \"No results\": { \"v\": [\"Tulemusi pole\"] } } }, { \"l\": \"eu\", \"t\": { \"No results\": { \"v\": [\"Emaitzarik ez\"] } } }, { \"l\": \"fa\", \"t\": { \"No results\": { \"v\": [\"بدون هیچ نتیجه‌ای\"] } } }, { \"l\": \"fi\", \"t\": { \"No results\": { \"v\": [\"Ei tuloksia\"] } } }, { \"l\": \"fr\", \"t\": { \"No results\": { \"v\": [\"Aucun résultat\"] } } }, { \"l\": \"ga\", \"t\": { \"No results\": { \"v\": [\"Gan torthaí\"] } } }, { \"l\": \"gl\", \"t\": { \"No results\": { \"v\": [\"Sen resultados\"] } } }, { \"l\": \"he\", \"t\": { \"No results\": { \"v\": [\"אין תוצאות\"] } } }, { \"l\": \"hu\", \"t\": { \"No results\": { \"v\": [\"Nincs találat\"] } } }, { \"l\": \"id\", \"t\": { \"No results\": { \"v\": [\"Tidak ada hasil\"] } } }, { \"l\": \"is\", \"t\": { \"No results\": { \"v\": [\"Engar niðurstöður\"] } } }, { \"l\": \"it\", \"t\": { \"No results\": { \"v\": [\"Nessun risultato\"] } } }, { \"l\": \"ja\", \"t\": { \"No results\": { \"v\": [\"結果無し\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"No results\": { \"v\": [\"結果無し\"] } } }, { \"l\": \"ko\", \"t\": { \"No results\": { \"v\": [\"결과 없음\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"No results\": { \"v\": [\"Nėra rezultatų\"] } } }, { \"l\": \"lv\", \"t\": { \"No results\": { \"v\": [\"Nav rezultātu\"] } } }, { \"l\": \"mk\", \"t\": { \"No results\": { \"v\": [\"Нема резултати\"] } } }, { \"l\": \"my\", \"t\": { \"No results\": { \"v\": [\"ရလဒ်မရှိပါ\"] } } }, { \"l\": \"nb\", \"t\": { \"No results\": { \"v\": [\"Ingen resultater\"] } } }, { \"l\": \"nl\", \"t\": { \"No results\": { \"v\": [\"Geen resultaten\"] } } }, { \"l\": \"oc\", \"t\": { \"No results\": { \"v\": [\"Cap de resultat\"] } } }, { \"l\": \"pl\", \"t\": { \"No results\": { \"v\": [\"Brak wyników\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"No results\": { \"v\": [\"Sem resultados\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"No results\": { \"v\": [\"Sem resultados\"] } } }, { \"l\": \"ro\", \"t\": { \"No results\": { \"v\": [\"Nu există rezultate\"] } } }, { \"l\": \"ru\", \"t\": { \"No results\": { \"v\": [\"Результаты отсуствуют\"] } } }, { \"l\": \"sk\", \"t\": { \"No results\": { \"v\": [\"Žiadne výsledky\"] } } }, { \"l\": \"sl\", \"t\": { \"No results\": { \"v\": [\"Ni zadetkov\"] } } }, { \"l\": \"sr\", \"t\": { \"No results\": { \"v\": [\"Нема резултата\"] } } }, { \"l\": \"sv\", \"t\": { \"No results\": { \"v\": [\"Inga resultat\"] } } }, { \"l\": \"tr\", \"t\": { \"No results\": { \"v\": [\"Herhangi bir sonuç bulunamadı\"] } } }, { \"l\": \"uk\", \"t\": { \"No results\": { \"v\": [\"Відсутні результати\"] } } }, { \"l\": \"uz\", \"t\": { \"No results\": { \"v\": [\"Natija yoʻq\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"No results\": { \"v\": [\"无结果\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"No results\": { \"v\": [\"無結果\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"No results\": { \"v\": [\"無結果\"] } } }];\nconst t39 = [{ \"l\": \"ar\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['إفتَح الرابط إلى \"{resourceName}\"'] } } }, { \"l\": \"ast\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"Abrir l'enllaz a «{resourceName}»\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"Otevřít odkaz na „{resourceName}“\"] } } }, { \"l\": \"cs-CZ\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"Otevřít odkaz na „{resourceName}“\"] } } }, { \"l\": \"da\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Åbn link til \"{resourceName}\"'] } } }, { \"l\": \"de\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Link zu \"{resourceName}“ öffnen'] } } }, { \"l\": \"de-DE\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Link zu \"{resourceName}“ öffnen'] } } }, { \"l\": \"el\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Άνοιγμα συνδέσμου για \"{resourceName}\"'] } } }, { \"l\": \"en-GB\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Open link to \"{resourceName}\"'] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Abrir enlace a \"{resourceName}\"'] } } }, { \"l\": \"es-AR\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Abrir enlace a \"{resourceName}\"'] } } }, { \"l\": \"es-EC\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Abrir enlace a \"{resourceName}\"'] } } }, { \"l\": \"es-MX\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Abrir enlace a \"{resourceName}\"'] } } }, { \"l\": \"et-EE\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Ava link \"{resourceName}\"'] } } }, { \"l\": \"eu\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Ireki \"{resourceName}\" esteka'] } } }, { \"l\": \"fa\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"باز کردن پیوند به «{resourceName}»\"] } } }, { \"l\": \"fi\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Avaa linkki \"{resourceName}\"'] } } }, { \"l\": \"fr\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Ouvrir le lien vers \"{resourceName}\"'] } } }, { \"l\": \"ga\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Oscail nasc chuig \"{resourceName}\"'] } } }, { \"l\": \"gl\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"Abrir a ligazón a «{resourceName}»\"] } } }, { \"l\": \"he\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"פתיחת קישור אל „{resourceName}”\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Buka tautan ke \"{resourceName}\"'] } } }, { \"l\": \"is\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Opna tengil í \"{resourceName}\"'] } } }, { \"l\": \"it\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Apri il link a \"{resourceName}\"'] } } }, { \"l\": \"ja\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['\"{resourceName}\" へのリンクを開く'] } } }, { \"l\": \"ja-JP\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['\"{resourceName}\" へのリンクを開く'] } } }, { \"l\": \"ko\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['\"{resourceName}\"의 링크 열기'] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Åpne lenken til \"{resourceName}\"'] } } }, { \"l\": \"nl\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Open link naar \"{resourceName}\"'] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Otwórz link do \"{resourceName}\"'] } } }, { \"l\": \"pt-BR\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Abrir o link para \"{resourceName}\"'] } } }, { \"l\": \"pt-PT\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Abrir link para \"{resourceName}\"'] } } }, { \"l\": \"ro\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Deschide linkul la \"{resourceName}\"'] } } }, { \"l\": \"ru\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Открыть ссылку на \"{resourceName}\"'] } } }, { \"l\": \"sk\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Otvoriť link v \"{resourceName}\"'] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"Отвори линк на „{resourceName}”\"] } } }, { \"l\": \"sv\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Öppna länken till \"{resourceName}\"'] } } }, { \"l\": \"tr\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"{resourceName} bağlantısını aç\"] } } }, { \"l\": \"uk\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": ['Відкрити посилання на \"{resourceName}\"'] } } }, { \"l\": \"uz\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [' \"{resourceName}\" ga havolani ochish'] } } }, { \"l\": \"zh-CN\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"打开 “{resourceName}” 的链接\"] } } }, { \"l\": \"zh-HK\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"開啟到「{resourceName}」的連結\"] } } }, { \"l\": \"zh-TW\", \"t\": { 'Open link to \"{resourceName}\"': { \"v\": [\"開啟到「{resourceName}」的連結\"] } } }];\nconst t40 = [{ \"l\": \"ar\", \"t\": { \"Pick a date\": { \"v\": [\"إختَر التاريخ\"] }, \"Pick a date and a time\": { \"v\": [\"إختَر التاريخ و الوقت\"] }, \"Pick a month\": { \"v\": [\"إختَر الشهر\"] }, \"Pick a time\": { \"v\": [\"إختَر الوقت\"] }, \"Pick a week\": { \"v\": [\"إختَر الأسبوع\"] }, \"Pick a year\": { \"v\": [\"إختَر السنة\"] }, \"Please select a time zone:\": { \"v\": [\"الرجاء تحديد المنطقة الزمنية:\"] } } }, { \"l\": \"ast\", \"t\": { \"Pick a date\": { \"v\": [\"Escueyi una data\"] }, \"Pick a date and a time\": { \"v\": [\"Escueyi una data y hora\"] }, \"Pick a month\": { \"v\": [\"Escueyi un mes\"] }, \"Pick a time\": { \"v\": [\"Escueyi una hora\"] }, \"Pick a week\": { \"v\": [\"Escueyi una selmana\"] }, \"Pick a year\": { \"v\": [\"Escueyi un añu\"] }, \"Please select a time zone:\": { \"v\": [\"Seleiciona un fusu horariu:\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Please select a time zone:\": { \"v\": [\"Seleccioneu una zona horària:\"] } } }, { \"l\": \"cs\", \"t\": { \"Pick a date\": { \"v\": [\"Vybrat datum\"] }, \"Pick a date and a time\": { \"v\": [\"Vybrat datum a čas\"] }, \"Pick a month\": { \"v\": [\"Vybrat měsíc\"] }, \"Pick a time\": { \"v\": [\"Vybrat čas\"] }, \"Pick a week\": { \"v\": [\"Vybrat týden\"] }, \"Pick a year\": { \"v\": [\"Vybrat rok\"] }, \"Please select a time zone:\": { \"v\": [\"Vyberte časovou zónu:\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Pick a date\": { \"v\": [\"Vybrat datum\"] }, \"Pick a date and a time\": { \"v\": [\"Vybrat datum a čas\"] }, \"Pick a month\": { \"v\": [\"Vybrat měsíc\"] }, \"Pick a time\": { \"v\": [\"Vybrat čas\"] }, \"Pick a week\": { \"v\": [\"Vybrat týden\"] }, \"Pick a year\": { \"v\": [\"Vybrat rok\"] }, \"Please select a time zone:\": { \"v\": [\"Vyberte časovou zónu:\"] } } }, { \"l\": \"da\", \"t\": { \"Pick a date\": { \"v\": [\"Vælg en dato\"] }, \"Pick a date and a time\": { \"v\": [\"Vælg en dato og tidspunkt\"] }, \"Pick a month\": { \"v\": [\"Vælg en måned\"] }, \"Pick a time\": { \"v\": [\"Vælg et tidspunkt\"] }, \"Pick a week\": { \"v\": [\"Vælg en uge\"] }, \"Pick a year\": { \"v\": [\"Vælg et år\"] }, \"Please select a time zone:\": { \"v\": [\"Vælg venligst en tidszone:\"] } } }, { \"l\": \"de\", \"t\": { \"Pick a date\": { \"v\": [\"Ein Datum auswählen\"] }, \"Pick a date and a time\": { \"v\": [\"Datum und Uhrzeit auswählen\"] }, \"Pick a month\": { \"v\": [\"Einen Monat auswählen\"] }, \"Pick a time\": { \"v\": [\"Eine Uhrzeit auswählen\"] }, \"Pick a week\": { \"v\": [\"Eine Woche auswählen\"] }, \"Pick a year\": { \"v\": [\"Ein Jahr auswählen\"] }, \"Please select a time zone:\": { \"v\": [\"Bitte eine Zeitzone auswählen:\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Pick a date\": { \"v\": [\"Ein Datum auswählen\"] }, \"Pick a date and a time\": { \"v\": [\"Datum und Uhrzeit auswählen\"] }, \"Pick a month\": { \"v\": [\"Einen Monat auswählen\"] }, \"Pick a time\": { \"v\": [\"Eine Uhrzeit auswählen\"] }, \"Pick a week\": { \"v\": [\"Eine Woche auswählen\"] }, \"Pick a year\": { \"v\": [\"Ein Jahr auswählen\"] }, \"Please select a time zone:\": { \"v\": [\"Bitte eine Zeitzone auswählen:\"] } } }, { \"l\": \"el\", \"t\": { \"Pick a date\": { \"v\": [\"Επιλέξτε ημερομηνία\"] }, \"Pick a date and a time\": { \"v\": [\"Επιλέξτε ημερομηνία και ώρα\"] }, \"Pick a month\": { \"v\": [\"Επιλέξτε μήνα\"] }, \"Pick a time\": { \"v\": [\"Επιλέξτε ώρα\"] }, \"Pick a week\": { \"v\": [\"Επιλέξτε εβδομάδα\"] }, \"Pick a year\": { \"v\": [\"Επιλέξτε έτος\"] }, \"Please select a time zone:\": { \"v\": [\"Παρακαλούμε επιλέξτε μια ζώνη ώρας:\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Pick a date\": { \"v\": [\"Pick a date\"] }, \"Pick a date and a time\": { \"v\": [\"Pick a date and a time\"] }, \"Pick a month\": { \"v\": [\"Pick a month\"] }, \"Pick a time\": { \"v\": [\"Pick a time\"] }, \"Pick a week\": { \"v\": [\"Pick a week\"] }, \"Pick a year\": { \"v\": [\"Pick a year\"] }, \"Please select a time zone:\": { \"v\": [\"Please select a time zone:\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Pick a date\": { \"v\": [\"Seleccione una fecha\"] }, \"Pick a date and a time\": { \"v\": [\"Seleccione una fecha y hora\"] }, \"Pick a month\": { \"v\": [\"Seleccione un mes\"] }, \"Pick a time\": { \"v\": [\"Seleccione una hora\"] }, \"Pick a week\": { \"v\": [\"Seleccione una semana\"] }, \"Pick a year\": { \"v\": [\"Seleccione un año\"] }, \"Please select a time zone:\": { \"v\": [\"Por favor elija un huso horario:\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Pick a date\": { \"v\": [\"Elija una fecha\"] }, \"Pick a date and a time\": { \"v\": [\"Elija una fecha y hora\"] }, \"Pick a month\": { \"v\": [\"Elija un mes\"] }, \"Pick a time\": { \"v\": [\"Elija una hora\"] }, \"Pick a week\": { \"v\": [\"Elija una semana\"] }, \"Pick a year\": { \"v\": [\"Elija un año\"] }, \"Please select a time zone:\": { \"v\": [\"Por favor, elija una zona horaria:\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Pick a date\": { \"v\": [\"Seleccionar una fecha\"] }, \"Pick a date and a time\": { \"v\": [\"Seleccionar una fecha y una hora\"] }, \"Pick a month\": { \"v\": [\"Seleccionar un mes\"] }, \"Pick a time\": { \"v\": [\"Seleccionar una semana\"] }, \"Pick a week\": { \"v\": [\"Seleccionar una semana\"] }, \"Pick a year\": { \"v\": [\"Seleccionar un año\"] }, \"Please select a time zone:\": { \"v\": [\"Por favor, selecciona una zona horaria:\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Pick a date\": { \"v\": [\"Seleccionar una fecha\"] }, \"Pick a date and a time\": { \"v\": [\"Seleccionar una fecha y hora\"] }, \"Pick a month\": { \"v\": [\"Seleccionar un mes\"] }, \"Pick a time\": { \"v\": [\"Seleccionar una hora\"] }, \"Pick a week\": { \"v\": [\"Seleccionar una semana\"] }, \"Pick a year\": { \"v\": [\"Seleccionar un año\"] }, \"Please select a time zone:\": { \"v\": [\"Por favor seleccione una zona horaria:\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Pick a date\": { \"v\": [\"Vali kuupäev\"] }, \"Pick a date and a time\": { \"v\": [\"Vali kuupäev ja kellaaeg\"] }, \"Pick a month\": { \"v\": [\"Vali kuu\"] }, \"Pick a time\": { \"v\": [\"Vali kellaaeg\"] }, \"Pick a week\": { \"v\": [\"Vali nädal\"] }, \"Pick a year\": { \"v\": [\"Vali aasta\"] }, \"Please select a time zone:\": { \"v\": [\"Vali ajatsoon\"] } } }, { \"l\": \"eu\", \"t\": { \"Pick a date\": { \"v\": [\"Aukeratu data bat\"] }, \"Pick a date and a time\": { \"v\": [\"Aukeratu data eta ordu bat\"] }, \"Pick a month\": { \"v\": [\"Aukeratu hilabete bat\"] }, \"Pick a time\": { \"v\": [\"Aukeratu ordu bat\"] }, \"Pick a week\": { \"v\": [\"Aukeratu aste bat\"] }, \"Pick a year\": { \"v\": [\"Aukeratu urte bat\"] }, \"Please select a time zone:\": { \"v\": [\"Mesedez hautatu ordu-zona bat:\"] } } }, { \"l\": \"fa\", \"t\": { \"Pick a date\": { \"v\": [\"انتخاب تاریخ\"] }, \"Pick a date and a time\": { \"v\": [\"انتخاب تاریخ و زمان\"] }, \"Pick a month\": { \"v\": [\"انتخاب ماه\"] }, \"Pick a time\": { \"v\": [\"انتخاب زمان\"] }, \"Pick a week\": { \"v\": [\"انتخاب هفته\"] }, \"Pick a year\": { \"v\": [\"انتخاب سال\"] }, \"Please select a time zone:\": { \"v\": [\"لطفا یک منطقهٔ زمانی را انتخاب کنید:\"] } } }, { \"l\": \"fi\", \"t\": { \"Pick a date\": { \"v\": [\"Valitse päivä\"] }, \"Pick a date and a time\": { \"v\": [\"Valitse päivä ja kellonaika\"] }, \"Pick a month\": { \"v\": [\"Valitse kuukausi\"] }, \"Pick a time\": { \"v\": [\"Valitse kellonaika\"] }, \"Pick a week\": { \"v\": [\"Valitse viikko\"] }, \"Pick a year\": { \"v\": [\"Valitse vuosi\"] }, \"Please select a time zone:\": { \"v\": [\"Valitse aikavyöhyke:\"] } } }, { \"l\": \"fr\", \"t\": { \"Pick a date\": { \"v\": [\"Sélectionner une date\"] }, \"Pick a date and a time\": { \"v\": [\"Sélectionner une date et une heure\"] }, \"Pick a month\": { \"v\": [\"Sélectionner un mois\"] }, \"Pick a time\": { \"v\": [\"Sélectionner une heure\"] }, \"Pick a week\": { \"v\": [\"Sélectionner une semaine\"] }, \"Pick a year\": { \"v\": [\"Sélectionner une année\"] }, \"Please select a time zone:\": { \"v\": [\"Sélectionnez un fuseau horaire : \"] } } }, { \"l\": \"ga\", \"t\": { \"Pick a date\": { \"v\": [\"Roghnaigh dáta\"] }, \"Pick a date and a time\": { \"v\": [\"Roghnaigh dáta agus am\"] }, \"Pick a month\": { \"v\": [\"Roghnaigh mí\"] }, \"Pick a time\": { \"v\": [\"Roghnaigh am\"] }, \"Pick a week\": { \"v\": [\"Roghnaigh seachtain\"] }, \"Pick a year\": { \"v\": [\"Roghnaigh bliain\"] }, \"Please select a time zone:\": { \"v\": [\"Roghnaigh crios ama le do thoil:\"] } } }, { \"l\": \"gl\", \"t\": { \"Pick a date\": { \"v\": [\"Escolla unha data\"] }, \"Pick a date and a time\": { \"v\": [\"Escolle unha data e unha hora\"] }, \"Pick a month\": { \"v\": [\"Escolla un mes\"] }, \"Pick a time\": { \"v\": [\"Escolla unha hora\"] }, \"Pick a week\": { \"v\": [\"Escolla unha semana\"] }, \"Pick a year\": { \"v\": [\"Escolla un ano\"] }, \"Please select a time zone:\": { \"v\": [\"Escolla un fuso horario:\"] } } }, { \"l\": \"he\", \"t\": { \"Pick a date\": { \"v\": [\"נא לבחור תאריך\"] }, \"Pick a date and a time\": { \"v\": [\"נא לבחור תאריך ושעה\"] }, \"Pick a month\": { \"v\": [\"נא לבחור חודש\"] }, \"Pick a time\": { \"v\": [\"נא לבחור שעה\"] }, \"Pick a week\": { \"v\": [\"נא לבחור שבוע\"] }, \"Pick a year\": { \"v\": [\"נא לבחור שנה\"] }, \"Please select a time zone:\": { \"v\": [\"נא לבחור אזור זמן:\"] } } }, { \"l\": \"hu\", \"t\": { \"Please select a time zone:\": { \"v\": [\"Válasszon időzónát:\"] } } }, { \"l\": \"id\", \"t\": { \"Pick a date\": { \"v\": [\"Pilih tanggal\"] }, \"Pick a date and a time\": { \"v\": [\"Pilih tanggal dan waktu\"] }, \"Pick a month\": { \"v\": [\"Pilih bulan\"] }, \"Pick a time\": { \"v\": [\"Pilih waktu\"] }, \"Pick a week\": { \"v\": [\"Pilih pekan\"] }, \"Pick a year\": { \"v\": [\"Pilih tahun\"] }, \"Please select a time zone:\": { \"v\": [\"Mohon pilih zona waktu\"] } } }, { \"l\": \"is\", \"t\": { \"Pick a date\": { \"v\": [\"Veldu dagsetningu\"] }, \"Pick a date and a time\": { \"v\": [\"Veldu dagsetningu og tíma\"] }, \"Pick a month\": { \"v\": [\"Veldu mánuð\"] }, \"Pick a time\": { \"v\": [\"Veldu tíma\"] }, \"Pick a week\": { \"v\": [\"Veldu viku\"] }, \"Pick a year\": { \"v\": [\"Veldu ár\"] }, \"Please select a time zone:\": { \"v\": [\"Veldu tímabelti:\"] } } }, { \"l\": \"it\", \"t\": { \"Pick a date\": { \"v\": [\"Scegli una data\"] }, \"Pick a date and a time\": { \"v\": [\"Scegli una data e un orario\"] }, \"Pick a month\": { \"v\": [\"Scegli un mese\"] }, \"Pick a time\": { \"v\": [\"Scegli un momento\"] }, \"Pick a week\": { \"v\": [\"Scegli una settimana\"] }, \"Pick a year\": { \"v\": [\"Scegli un anno\"] }, \"Please select a time zone:\": { \"v\": [\"Si prega di selezionare un fuso orario:\"] } } }, { \"l\": \"ja\", \"t\": { \"Pick a date\": { \"v\": [\"日付を選択してください\"] }, \"Pick a date and a time\": { \"v\": [\"日付と時刻を選択してください\"] }, \"Pick a month\": { \"v\": [\"月を選択してください\"] }, \"Pick a time\": { \"v\": [\"時間を選択してください\"] }, \"Pick a week\": { \"v\": [\"週を選択してください\"] }, \"Pick a year\": { \"v\": [\"年を選択してください\"] }, \"Please select a time zone:\": { \"v\": [\"タイムゾーンを選んで下さい:\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Pick a date\": { \"v\": [\"日付を選択してください\"] }, \"Pick a date and a time\": { \"v\": [\"日付と時刻を選択してください\"] }, \"Pick a month\": { \"v\": [\"月を選択してください\"] }, \"Pick a time\": { \"v\": [\"時間を選択してください\"] }, \"Pick a week\": { \"v\": [\"週を選択してください\"] }, \"Pick a year\": { \"v\": [\"年を選択してください\"] }, \"Please select a time zone:\": { \"v\": [\"タイムゾーンを選んで下さい:\"] } } }, { \"l\": \"ko\", \"t\": { \"Pick a date\": { \"v\": [\"날짜 선택\"] }, \"Pick a date and a time\": { \"v\": [\"날짜와 시간 선택\"] }, \"Pick a month\": { \"v\": [\"달 선택\"] }, \"Pick a time\": { \"v\": [\"시간 선택\"] }, \"Pick a week\": { \"v\": [\"주 선택\"] }, \"Pick a year\": { \"v\": [\"연도 선택\"] }, \"Please select a time zone:\": { \"v\": [\"시간대를 선택하세요:\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Please select a time zone:\": { \"v\": [\"Изберете временска зона:\"] } } }, { \"l\": \"my\", \"t\": { \"Please select a time zone:\": { \"v\": [\"ဒေသစံတော်ချိန် ရွေးချယ်ပေးပါ\"] } } }, { \"l\": \"nb\", \"t\": { \"Pick a date\": { \"v\": [\"Velg en dato\"] }, \"Pick a date and a time\": { \"v\": [\"Velg en dato og et tidspunkt\"] }, \"Pick a month\": { \"v\": [\"Velg en måned\"] }, \"Pick a time\": { \"v\": [\"Velg et tidspunkt\"] }, \"Pick a week\": { \"v\": [\"Velg en uke\"] }, \"Pick a year\": { \"v\": [\"Velg et år\"] }, \"Please select a time zone:\": { \"v\": [\"Vennligst velg tidssone\"] } } }, { \"l\": \"nl\", \"t\": { \"Pick a date\": { \"v\": [\"Selecteer een datum\"] }, \"Pick a date and a time\": { \"v\": [\"Selecteer een datum en tijd\"] }, \"Pick a month\": { \"v\": [\"Selecteer een maand\"] }, \"Pick a time\": { \"v\": [\"Selecteer een tijd\"] }, \"Pick a week\": { \"v\": [\"Selecteer een week\"] }, \"Pick a year\": { \"v\": [\"Selecteer een jaar\"] }, \"Please select a time zone:\": { \"v\": [\"Selecteer een tijdzone:\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Pick a date\": { \"v\": [\"Wybierz datę\"] }, \"Pick a date and a time\": { \"v\": [\"Wybierz datę i godzinę\"] }, \"Pick a month\": { \"v\": [\"Wybierz miesiąc\"] }, \"Pick a time\": { \"v\": [\"Wybierz czas\"] }, \"Pick a week\": { \"v\": [\"Wybierz tydzień\"] }, \"Pick a year\": { \"v\": [\"Wybierz rok\"] }, \"Please select a time zone:\": { \"v\": [\"Wybierz strefę czasową:\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Pick a date\": { \"v\": [\"Escolha uma data\"] }, \"Pick a date and a time\": { \"v\": [\"Escolha uma data e um horário\"] }, \"Pick a month\": { \"v\": [\"Escolha um mês\"] }, \"Pick a time\": { \"v\": [\"Escolha um horário\"] }, \"Pick a week\": { \"v\": [\"Escolha uma semana\"] }, \"Pick a year\": { \"v\": [\"Escolha um ano\"] }, \"Please select a time zone:\": { \"v\": [\"Selecione um fuso horário: \"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Pick a date\": { \"v\": [\"Escolha uma data\"] }, \"Pick a date and a time\": { \"v\": [\"Escolha uma data e uma hora\"] }, \"Pick a month\": { \"v\": [\"Escolha um mês\"] }, \"Pick a time\": { \"v\": [\"Escolha uma hora\"] }, \"Pick a week\": { \"v\": [\"Escolha uma semana\"] }, \"Pick a year\": { \"v\": [\"Escolha um ano\"] }, \"Please select a time zone:\": { \"v\": [\"Por favor, selecione um fuso horário: \"] } } }, { \"l\": \"ro\", \"t\": { \"Pick a date\": { \"v\": [\"Selectați o dată\"] }, \"Pick a date and a time\": { \"v\": [\"Selectați data și timpul\"] }, \"Pick a month\": { \"v\": [\"Selectați o lună\"] }, \"Pick a time\": { \"v\": [\"Selectați timpul\"] }, \"Pick a week\": { \"v\": [\"Selectați o săptămână\"] }, \"Pick a year\": { \"v\": [\"Selectați anul\"] }, \"Please select a time zone:\": { \"v\": [\"Vă rugăm să selectați un fus orar:\"] } } }, { \"l\": \"ru\", \"t\": { \"Pick a date\": { \"v\": [\"Выберите дату\"] }, \"Pick a date and a time\": { \"v\": [\"Выберите дату и время\"] }, \"Pick a month\": { \"v\": [\"Выберите месяц\"] }, \"Pick a time\": { \"v\": [\"Выберите время\"] }, \"Pick a week\": { \"v\": [\"Выберите неделю\"] }, \"Pick a year\": { \"v\": [\"Выберите год\"] }, \"Please select a time zone:\": { \"v\": [\"Пожалуйста, выберите часовой пояс:\"] } } }, { \"l\": \"sk\", \"t\": { \"Pick a date\": { \"v\": [\"Vybrať dátum\"] }, \"Pick a date and a time\": { \"v\": [\"Vybrať dátum a čas\"] }, \"Pick a month\": { \"v\": [\"Vybrať mesiac\"] }, \"Pick a time\": { \"v\": [\"Vybrať čas\"] }, \"Pick a week\": { \"v\": [\"Vybrať týždeň\"] }, \"Pick a year\": { \"v\": [\"Vybrať rok\"] }, \"Please select a time zone:\": { \"v\": [\"Prosím vyberte časovú zónu:\"] } } }, { \"l\": \"sl\", \"t\": { \"Pick a date\": { \"v\": [\"Izbor datuma\"] }, \"Pick a date and a time\": { \"v\": [\"Izbor datuma in časa\"] }, \"Pick a month\": { \"v\": [\"Izbor meseca\"] }, \"Pick a time\": { \"v\": [\"Izbor časa\"] }, \"Pick a week\": { \"v\": [\"Izbor tedna\"] }, \"Pick a year\": { \"v\": [\"Izbor leta\"] }, \"Please select a time zone:\": { \"v\": [\"Izbor časovnega pasu:\"] } } }, { \"l\": \"sr\", \"t\": { \"Pick a date\": { \"v\": [\"Изаберите датум\"] }, \"Pick a date and a time\": { \"v\": [\"Изаберите датум и време\"] }, \"Pick a month\": { \"v\": [\"Изаберите месец\"] }, \"Pick a time\": { \"v\": [\"Изаберите време\"] }, \"Pick a week\": { \"v\": [\"Изаберите недељу\"] }, \"Pick a year\": { \"v\": [\"Изаберите годину\"] }, \"Please select a time zone:\": { \"v\": [\"Молимо вас да изаберете временску зону:\"] } } }, { \"l\": \"sv\", \"t\": { \"Pick a date\": { \"v\": [\"Välj datum\"] }, \"Pick a date and a time\": { \"v\": [\"Välj datum och tid\"] }, \"Pick a month\": { \"v\": [\"Välj månad\"] }, \"Pick a time\": { \"v\": [\"Välj tid\"] }, \"Pick a week\": { \"v\": [\"Välj vecka\"] }, \"Pick a year\": { \"v\": [\"Välj år\"] }, \"Please select a time zone:\": { \"v\": [\"Välj tidszon:\"] } } }, { \"l\": \"tr\", \"t\": { \"Pick a date\": { \"v\": [\"Bir tarih seçin\"] }, \"Pick a date and a time\": { \"v\": [\"Bir tarih ve saat seçin\"] }, \"Pick a month\": { \"v\": [\"Bir ay seçin\"] }, \"Pick a time\": { \"v\": [\"Bir saat seçin\"] }, \"Pick a week\": { \"v\": [\"Bir hafta seçin\"] }, \"Pick a year\": { \"v\": [\"Bir yıl seçin\"] }, \"Please select a time zone:\": { \"v\": [\"Lütfen bir saat dilimi seçin:\"] } } }, { \"l\": \"uk\", \"t\": { \"Pick a date\": { \"v\": [\"Вибрати дату\"] }, \"Pick a date and a time\": { \"v\": [\"Виберіть дату та час\"] }, \"Pick a month\": { \"v\": [\"Виберіть місяць\"] }, \"Pick a time\": { \"v\": [\"Виберіть час\"] }, \"Pick a week\": { \"v\": [\"Виберіть тиждень\"] }, \"Pick a year\": { \"v\": [\"Виберіть рік\"] }, \"Please select a time zone:\": { \"v\": [\"Виберіть часовий пояс:\"] } } }, { \"l\": \"uz\", \"t\": { \"Pick a date\": { \"v\": [\"Sana tanlang\"] }, \"Pick a date and a time\": { \"v\": [\"Sana va vaqtni tanlang\"] }, \"Pick a month\": { \"v\": [\"Oyni tanlang\"] }, \"Pick a time\": { \"v\": [\"Vaqtni tanlang\"] }, \"Pick a week\": { \"v\": [\"Haftani tanlang\"] }, \"Pick a year\": { \"v\": [\"Yilni tanlang\"] }, \"Please select a time zone:\": { \"v\": [\"Vaqt mintaqasini tanlang:\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Pick a date\": { \"v\": [\"选择日期\"] }, \"Pick a date and a time\": { \"v\": [\"选择日期和时间\"] }, \"Pick a month\": { \"v\": [\"选择月份\"] }, \"Pick a time\": { \"v\": [\"选择时间\"] }, \"Pick a week\": { \"v\": [\"选择星期\"] }, \"Pick a year\": { \"v\": [\"选择年份\"] }, \"Please select a time zone:\": { \"v\": [\"请选择一个时区:\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Pick a date\": { \"v\": [\"挑選日期\"] }, \"Pick a date and a time\": { \"v\": [\"挑選日期與時間\"] }, \"Pick a month\": { \"v\": [\"挑選月份\"] }, \"Pick a time\": { \"v\": [\"挑選時間\"] }, \"Pick a week\": { \"v\": [\"挑選星期\"] }, \"Pick a year\": { \"v\": [\"挑選年份\"] }, \"Please select a time zone:\": { \"v\": [\"請選擇時區:\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Pick a date\": { \"v\": [\"挑選日期\"] }, \"Pick a date and a time\": { \"v\": [\"挑選日期與時間\"] }, \"Pick a month\": { \"v\": [\"挑選月份\"] }, \"Pick a time\": { \"v\": [\"挑選時間\"] }, \"Pick a week\": { \"v\": [\"挑選星期\"] }, \"Pick a year\": { \"v\": [\"挑選年份\"] }, \"Please select a time zone:\": { \"v\": [\"請選取時區:\"] } } }];\nconst t41 = [{ \"l\": \"ar\", \"t\": { \"Provider icon\": { \"v\": [\"أيقونة المزوّد\"] } } }, { \"l\": \"ast\", \"t\": { \"Provider icon\": { \"v\": [\"Iconu del fornidor\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Provider icon\": { \"v\": [\"Ikona poskytovatele\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Provider icon\": { \"v\": [\"Ikona poskytovatele\"] } } }, { \"l\": \"da\", \"t\": { \"Provider icon\": { \"v\": [\"Udbyder ikon\"] } } }, { \"l\": \"de\", \"t\": { \"Provider icon\": { \"v\": [\"Anbietersymbol\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Provider icon\": { \"v\": [\"Anbietersymbol\"] } } }, { \"l\": \"el\", \"t\": { \"Provider icon\": { \"v\": [\"Εικονίδιο παρόχου\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Provider icon\": { \"v\": [\"Provider icon\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Provider icon\": { \"v\": [\"Ícono del proveedor\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Provider icon\": { \"v\": [\"Ícono del proveedor\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Provider icon\": { \"v\": [\"Ícono del proveedor\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Provider icon\": { \"v\": [\"Ícono del proveedor\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Provider icon\": { \"v\": [\"Teenusepakkuja ikoon\"] } } }, { \"l\": \"eu\", \"t\": { \"Provider icon\": { \"v\": [\"Hornitzailearen ikonoa\"] } } }, { \"l\": \"fa\", \"t\": { \"Provider icon\": { \"v\": [\"آیکون ارائه دهنده\"] } } }, { \"l\": \"fi\", \"t\": { \"Provider icon\": { \"v\": [\"Palveluntarjoajan kuvake\"] } } }, { \"l\": \"fr\", \"t\": { \"Provider icon\": { \"v\": [\"Icône du fournisseur\"] } } }, { \"l\": \"ga\", \"t\": { \"Provider icon\": { \"v\": [\"Deilbhín soláthraí\"] } } }, { \"l\": \"gl\", \"t\": { \"Provider icon\": { \"v\": [\"Icona do provedor\"] } } }, { \"l\": \"he\", \"t\": { \"Provider icon\": { \"v\": [\"סמל ספק\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Provider icon\": { \"v\": [\"Ikon penyedia\"] } } }, { \"l\": \"is\", \"t\": { \"Provider icon\": { \"v\": [\"Táknmynd þjónustuveitu\"] } } }, { \"l\": \"it\", \"t\": { \"Provider icon\": { \"v\": [\"Icona del provider\"] } } }, { \"l\": \"ja\", \"t\": { \"Provider icon\": { \"v\": [\"プロバイダーのアイコン\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Provider icon\": { \"v\": [\"プロバイダーのアイコン\"] } } }, { \"l\": \"ko\", \"t\": { \"Provider icon\": { \"v\": [\"제공자 아이콘\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Provider icon\": { \"v\": [\"Leverandørikon\"] } } }, { \"l\": \"nl\", \"t\": { \"Provider icon\": { \"v\": [\"Provider icoon\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Provider icon\": { \"v\": [\"Dostawca ikony\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Provider icon\": { \"v\": [\"Ícone do provedor\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Provider icon\": { \"v\": [\"Ícone do fornecedor\"] } } }, { \"l\": \"ro\", \"t\": { \"Provider icon\": { \"v\": [\"Provider pentru icon\"] } } }, { \"l\": \"ru\", \"t\": { \"Provider icon\": { \"v\": [\"Значок поставщика\"] } } }, { \"l\": \"sk\", \"t\": { \"Provider icon\": { \"v\": [\"Ikonka poskytovateľa\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Provider icon\": { \"v\": [\"Икона пружаоца\"] } } }, { \"l\": \"sv\", \"t\": { \"Provider icon\": { \"v\": [\"Leverantörsikon\"] } } }, { \"l\": \"tr\", \"t\": { \"Provider icon\": { \"v\": [\"Sağlayıcı simgesi\"] } } }, { \"l\": \"uk\", \"t\": { \"Provider icon\": { \"v\": [\"Піктограма постачальника\"] } } }, { \"l\": \"uz\", \"t\": { \"Provider icon\": { \"v\": [\"Provayder belgisi\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Provider icon\": { \"v\": [\"提供者图标\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Provider icon\": { \"v\": [\"提供者圖示\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Provider icon\": { \"v\": [\"提供者圖示\"] } } }];\nconst t42 = [{ \"l\": \"ar\", \"t\": { \"Related team resources\": { \"v\": [\"موارد للفريق ذات صلة\"] }, \"View team\": { \"v\": [\"عرض الفريق\"] } } }, { \"l\": \"ast\", \"t\": { \"Related team resources\": { \"v\": [\"Recursos rellacionaos colos equipos\"] }, \"View team\": { \"v\": [\"Ver l'equipu\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Related team resources\": { \"v\": [\"Související prostředky kolektivu\"] }, \"View team\": { \"v\": [\"Zobrazit kolektiv\"] } } }, { \"l\": \"cs-CZ\", \"t\": {} }, { \"l\": \"da\", \"t\": { \"Related team resources\": { \"v\": [\"Relaterede teamressourcer\"] }, \"View team\": { \"v\": [\"Se teamet\"] } } }, { \"l\": \"de\", \"t\": { \"Related team resources\": { \"v\": [\"Verwandte Team-Ressourcen\"] }, \"View team\": { \"v\": [\"Team anzeigen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Related team resources\": { \"v\": [\"Verwandte Team-Ressourcen\"] }, \"View team\": { \"v\": [\"Team anzeigen\"] } } }, { \"l\": \"el\", \"t\": { \"Related team resources\": { \"v\": [\"Σχετικοί πόροι ομάδας\"] }, \"View team\": { \"v\": [\"Προβολή ομάδας\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Related team resources\": { \"v\": [\"Related team resources\"] }, \"View team\": { \"v\": [\"View team\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Related team resources\": { \"v\": [\"Recursos de equipo relacionados\"] }, \"View team\": { \"v\": [\"Ver equipo\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Related team resources\": { \"v\": [\"Recursos de equipo relacionados\"] }, \"View team\": { \"v\": [\"Ver equipo\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"Related team resources\": { \"v\": [\"Recursos de equipo relacionados\"] }, \"View team\": { \"v\": [\"Ver equipo\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Related team resources\": { \"v\": [\"Tiimi seotud ressursid\"] }, \"View team\": { \"v\": [\"Vaata tiimi\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"Related team resources\": { \"v\": [\"منابع تیمی مرتبط\"] }, \"View team\": { \"v\": [\"مشاهده گروه\"] } } }, { \"l\": \"fi\", \"t\": { \"Related team resources\": { \"v\": [\"Liittyvät tiimiresurssit\"] }, \"View team\": { \"v\": [\"Näytä tiimi\"] } } }, { \"l\": \"fr\", \"t\": { \"Related team resources\": { \"v\": [\"Ressources d'équipe associées\"] }, \"View team\": { \"v\": [\"Voir l'équipe\"] } } }, { \"l\": \"ga\", \"t\": { \"Related team resources\": { \"v\": [\"Acmhainní foirne gaolmhara\"] }, \"View team\": { \"v\": [\"Féach ar an bhfoireann\"] } } }, { \"l\": \"gl\", \"t\": { \"Related team resources\": { \"v\": [\"Recursos de equipo relacionados\"] }, \"View team\": { \"v\": [\"Ver o equipo\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": { \"Related team resources\": { \"v\": [\"Tengd tilföng teymis\"] }, \"View team\": { \"v\": [\"Skoða teymi\"] } } }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": { \"Related team resources\": { \"v\": [\"チームの関連リソース\"] }, \"View team\": { \"v\": [\"チームを表示\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Related team resources\": { \"v\": [\"チームの関連リソース\"] }, \"View team\": { \"v\": [\"チームを表示\"] } } }, { \"l\": \"ko\", \"t\": { \"Related team resources\": { \"v\": [\"관련 팀 리소스\"] }, \"View team\": { \"v\": [\"팀 보기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Related team resources\": { \"v\": [\"Relaterte lagressurser\"] }, \"View team\": { \"v\": [\"Se lag\"] } } }, { \"l\": \"nl\", \"t\": { \"Related team resources\": { \"v\": [\"Verwante teambronnen\"] }, \"View team\": { \"v\": [\"Team bekijken\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Related team resources\": { \"v\": [\"Powiązane zasoby grupowe\"] }, \"View team\": { \"v\": [\"Zobacz grupę\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Related team resources\": { \"v\": [\"Recursos de equipe relacionados\"] }, \"View team\": { \"v\": [\"Ver equipe\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Related team resources\": { \"v\": [\"Recursos relacionados com a equipa\"] }, \"View team\": { \"v\": [\"Ver equipa\"] } } }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": { \"Related team resources\": { \"v\": [\"Связанные командные ресурсы\"] }, \"View team\": { \"v\": [\"Просмотр команды\"] } } }, { \"l\": \"sk\", \"t\": { \"Related team resources\": { \"v\": [\"Súvisiace tímové zdroje\"] }, \"View team\": { \"v\": [\"Zobraziť tím\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Related team resources\": { \"v\": [\"Повезани тимски ресурси\"] }, \"View team\": { \"v\": [\"Прикажи тим\"] } } }, { \"l\": \"sv\", \"t\": { \"Related team resources\": { \"v\": [\"Relaterade teamresurser\"] }, \"View team\": { \"v\": [\"Visa team\"] } } }, { \"l\": \"tr\", \"t\": { \"Related team resources\": { \"v\": [\"İlgili takım kaynakları\"] }, \"View team\": { \"v\": [\"Takımı görüntüle\"] } } }, { \"l\": \"uk\", \"t\": { \"Related team resources\": { \"v\": [\"Пов'язані ресурси команди\"] }, \"View team\": { \"v\": [\"Переглянути команду\"] } } }, { \"l\": \"uz\", \"t\": { \"Related team resources\": { \"v\": [\"Tegishli jamoa resurslari\"] }, \"View team\": { \"v\": [\"Jamoani ko'rish\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Related team resources\": { \"v\": [\"相关团队资源\"] }, \"View team\": { \"v\": [\"查看团队\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Related team resources\": { \"v\": [\"相關團隊資源\"] }, \"View team\": { \"v\": [\"查看團隊\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t43 = [{ \"l\": \"ar\", \"t\": { \"Search\": { \"v\": [\"بحث\"] } } }, { \"l\": \"ast\", \"t\": { \"Search\": { \"v\": [\"Buscar\"] } } }, { \"l\": \"br\", \"t\": { \"Search\": { \"v\": [\"Klask\"] } } }, { \"l\": \"ca\", \"t\": { \"Search\": { \"v\": [\"Cerca\"] } } }, { \"l\": \"cs\", \"t\": { \"Search\": { \"v\": [\"Hledat\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Search\": { \"v\": [\"Hledat\"] } } }, { \"l\": \"da\", \"t\": { \"Search\": { \"v\": [\"Søg\"] } } }, { \"l\": \"de\", \"t\": { \"Search\": { \"v\": [\"Suche\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Search\": { \"v\": [\"Suche\"] } } }, { \"l\": \"el\", \"t\": { \"Search\": { \"v\": [\"Αναζήτηση\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Search\": { \"v\": [\"Search\"] } } }, { \"l\": \"eo\", \"t\": { \"Search\": { \"v\": [\"Serĉi\"] } } }, { \"l\": \"es\", \"t\": { \"Search\": { \"v\": [\"Buscar\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Search\": { \"v\": [\"Buscar\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Search\": { \"v\": [\"Buscar\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Search\": { \"v\": [\"Buscar\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Search\": { \"v\": [\"Otsing\"] } } }, { \"l\": \"eu\", \"t\": { \"Search\": { \"v\": [\"Bilatu\"] } } }, { \"l\": \"fa\", \"t\": { \"Search\": { \"v\": [\"جستجو\"] } } }, { \"l\": \"fi\", \"t\": { \"Search\": { \"v\": [\"Etsi\"] } } }, { \"l\": \"fr\", \"t\": { \"Search\": { \"v\": [\"Chercher\"] } } }, { \"l\": \"ga\", \"t\": { \"Search\": { \"v\": [\"Cuardach\"] } } }, { \"l\": \"gl\", \"t\": { \"Search\": { \"v\": [\"Buscar\"] } } }, { \"l\": \"he\", \"t\": { \"Search\": { \"v\": [\"חיפוש\"] } } }, { \"l\": \"hu\", \"t\": { \"Search\": { \"v\": [\"Keresés\"] } } }, { \"l\": \"id\", \"t\": { \"Search\": { \"v\": [\"Cari\"] } } }, { \"l\": \"is\", \"t\": { \"Search\": { \"v\": [\"Leita\"] } } }, { \"l\": \"it\", \"t\": { \"Search\": { \"v\": [\"Cerca\"] } } }, { \"l\": \"ja\", \"t\": { \"Search\": { \"v\": [\"検索\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Search\": { \"v\": [\"検索\"] } } }, { \"l\": \"ko\", \"t\": { \"Search\": { \"v\": [\"검색\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"Search\": { \"v\": [\"Ieškoti\"] } } }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Search\": { \"v\": [\"Барај\"] } } }, { \"l\": \"my\", \"t\": { \"Search\": { \"v\": [\"ရှာဖွေရန်\"] } } }, { \"l\": \"nb\", \"t\": { \"Search\": { \"v\": [\"Søk\"] } } }, { \"l\": \"nl\", \"t\": { \"Search\": { \"v\": [\"Zoeken\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Search\": { \"v\": [\"Szukaj\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Search\": { \"v\": [\"Pesquisar\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Search\": { \"v\": [\"Pesquisar\"] } } }, { \"l\": \"ro\", \"t\": { \"Search\": { \"v\": [\"Căutare\"] } } }, { \"l\": \"ru\", \"t\": { \"Search\": { \"v\": [\"Поиск\"] } } }, { \"l\": \"sk\", \"t\": { \"Search\": { \"v\": [\"Hľadať\"] } } }, { \"l\": \"sl\", \"t\": { \"Search\": { \"v\": [\"Iskanje\"] } } }, { \"l\": \"sr\", \"t\": { \"Search\": { \"v\": [\"Претражи\"] } } }, { \"l\": \"sv\", \"t\": { \"Search\": { \"v\": [\"Sök\"] } } }, { \"l\": \"tr\", \"t\": { \"Search\": { \"v\": [\"Arama\"] } } }, { \"l\": \"uk\", \"t\": { \"Search\": { \"v\": [\"Пошук\"] } } }, { \"l\": \"uz\", \"t\": { \"Search\": { \"v\": [\"Qidiruv\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Search\": { \"v\": [\"搜索\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Search\": { \"v\": [\"搜尋\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Search\": { \"v\": [\"搜尋\"] } } }];\nconst t44 = [{ \"l\": \"ar\", \"t\": {} }, { \"l\": \"ast\", \"t\": {} }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": {} }, { \"l\": \"cs-CZ\", \"t\": {} }, { \"l\": \"da\", \"t\": {} }, { \"l\": \"de\", \"t\": {} }, { \"l\": \"de-DE\", \"t\": {} }, { \"l\": \"el\", \"t\": {} }, { \"l\": \"en-GB\", \"t\": {} }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": {} }, { \"l\": \"es-AR\", \"t\": {} }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": {} }, { \"l\": \"et-EE\", \"t\": {} }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": {} }, { \"l\": \"fi\", \"t\": {} }, { \"l\": \"fr\", \"t\": {} }, { \"l\": \"ga\", \"t\": {} }, { \"l\": \"gl\", \"t\": {} }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": {} }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": {} }, { \"l\": \"ja-JP\", \"t\": {} }, { \"l\": \"ko\", \"t\": {} }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": {} }, { \"l\": \"nl\", \"t\": {} }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": {} }, { \"l\": \"pt-BR\", \"t\": {} }, { \"l\": \"pt-PT\", \"t\": {} }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": {} }, { \"l\": \"sk\", \"t\": {} }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": {} }, { \"l\": \"sv\", \"t\": {} }, { \"l\": \"tr\", \"t\": {} }, { \"l\": \"uk\", \"t\": {} }, { \"l\": \"uz\", \"t\": {} }, { \"l\": \"zh-CN\", \"t\": {} }, { \"l\": \"zh-HK\", \"t\": {} }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t45 = [{ \"l\": \"ar\", \"t\": { \"Search for time zone\": { \"v\": [\"البحث عن منطقة زمنية\"] }, \"Type to search time zone\": { \"v\": [\"أكتُب للبحث عن منطقة زمنية\"] } } }, { \"l\": \"ast\", \"t\": { \"Search for time zone\": { \"v\": [\"Buscar fusos horarios\"] }, \"Type to search time zone\": { \"v\": [\"Escribi pa buscar un fusu horariu\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Type to search time zone\": { \"v\": [\"Escriviu per cercar la zona horària\"] } } }, { \"l\": \"cs\", \"t\": { \"Search for time zone\": { \"v\": [\"Vyhledat časové pásmo\"] }, \"Type to search time zone\": { \"v\": [\"Psaním vyhledejte časovou zónu\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Search for time zone\": { \"v\": [\"Vyhledat časové pásmo\"] }, \"Type to search time zone\": { \"v\": [\"Psaním vyhledejte časovou zónu\"] } } }, { \"l\": \"da\", \"t\": { \"Search for time zone\": { \"v\": [\"Søg efter tidszone\"] }, \"Type to search time zone\": { \"v\": [\"Indtast for at søge efter tidszone\"] } } }, { \"l\": \"de\", \"t\": { \"Search for time zone\": { \"v\": [\"Nach Zeitzone suchen\"] }, \"Type to search time zone\": { \"v\": [\"Tippen, um eine Zeitzone zu suchen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Search for time zone\": { \"v\": [\"Nach Zeitzone suchen\"] }, \"Type to search time zone\": { \"v\": [\"Tippen, um eine Zeitzone zu suchen\"] } } }, { \"l\": \"el\", \"t\": { \"Search for time zone\": { \"v\": [\"Αναζήτηση ζώνης ώρας\"] }, \"Type to search time zone\": { \"v\": [\"Πληκτρολογήστε για αναζήτηση ζώνης ώρας\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Search for time zone\": { \"v\": [\"Search for time zone\"] }, \"Type to search time zone\": { \"v\": [\"Type to search time zone\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Search for time zone\": { \"v\": [\"Buscar huso horario\"] }, \"Type to search time zone\": { \"v\": [\"Escriba para buscar un huso horario\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Search for time zone\": { \"v\": [\"Buscar zona horaria\"] }, \"Type to search time zone\": { \"v\": [\"Escriba para buscar la zona horaria\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Type to search time zone\": { \"v\": [\"Escribe para buscar la zona horaria\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Search for time zone\": { \"v\": [\"Buscar zona horaria\"] }, \"Type to search time zone\": { \"v\": [\"Escriba para buscar la zona horaria\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Search for time zone\": { \"v\": [\"Otsi ajavööndit\"] }, \"Type to search time zone\": { \"v\": [\"Kirjuta, et otsida ajavööndit\"] } } }, { \"l\": \"eu\", \"t\": { \"Type to search time zone\": { \"v\": [\"Idatzi ordu-zona bat bilatzeko\"] } } }, { \"l\": \"fa\", \"t\": { \"Search for time zone\": { \"v\": [\"جستجو برای منطقهٔ زمانی\"] }, \"Type to search time zone\": { \"v\": [\"برای جستجوی منطقه زمانی تایپ کنید\"] } } }, { \"l\": \"fi\", \"t\": { \"Search for time zone\": { \"v\": [\"Etsi aikavyöhykettä\"] }, \"Type to search time zone\": { \"v\": [\"Kirjoita etsiäksesi aikavyöhykettä\"] } } }, { \"l\": \"fr\", \"t\": { \"Search for time zone\": { \"v\": [\"Rechercher le fuseau horaire\"] }, \"Type to search time zone\": { \"v\": [\"Saisissez les premiers lettres pour rechercher un fuseau horaire\"] } } }, { \"l\": \"ga\", \"t\": { \"Search for time zone\": { \"v\": [\"Cuardaigh crios ama\"] }, \"Type to search time zone\": { \"v\": [\"Clóscríobh chun crios ama a chuardach\"] } } }, { \"l\": \"gl\", \"t\": { \"Search for time zone\": { \"v\": [\"Buscar por fuso horario\"] }, \"Type to search time zone\": { \"v\": [\"Escriba para buscar o fuso horario\"] } } }, { \"l\": \"he\", \"t\": { \"Type to search time zone\": { \"v\": [\"יש להקליד כדי לחפש אזור זמן\"] } } }, { \"l\": \"hu\", \"t\": { \"Type to search time zone\": { \"v\": [\"Gépeljen az időzóna kereséséhez\"] } } }, { \"l\": \"id\", \"t\": { \"Search for time zone\": { \"v\": [\"Cari zona waktu\"] }, \"Type to search time zone\": { \"v\": [\"Ketik untuk mencari zona waktu\"] } } }, { \"l\": \"is\", \"t\": { \"Search for time zone\": { \"v\": [\"Leita að tímabelti\"] }, \"Type to search time zone\": { \"v\": [\"Skrifaðu til að leita að tímabelti\"] } } }, { \"l\": \"it\", \"t\": { \"Search for time zone\": { \"v\": [\"Ricerca del fuso orario\"] }, \"Type to search time zone\": { \"v\": [\"Digita per cercare un fuso orario\"] } } }, { \"l\": \"ja\", \"t\": { \"Search for time zone\": { \"v\": [\"タイムゾーンを検索\"] }, \"Type to search time zone\": { \"v\": [\"タイムゾーン検索のため入力してください\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Search for time zone\": { \"v\": [\"タイムゾーンを検索\"] }, \"Type to search time zone\": { \"v\": [\"タイムゾーン検索のため入力してください\"] } } }, { \"l\": \"ko\", \"t\": { \"Search for time zone\": { \"v\": [\"시간대 검색\"] }, \"Type to search time zone\": { \"v\": [\"입력하여 시간대를 검색\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Type to search time zone\": { \"v\": [\"Напишете за да пребарате временска зона\"] } } }, { \"l\": \"my\", \"t\": { \"Type to search time zone\": { \"v\": [\"ဒေသစံတော်ချိန်များ ရှာဖွေရန် စာရိုက်ပါ\"] } } }, { \"l\": \"nb\", \"t\": { \"Search for time zone\": { \"v\": [\"Søk etter tidssone\"] }, \"Type to search time zone\": { \"v\": [\"Tast for å søke etter tidssone\"] } } }, { \"l\": \"nl\", \"t\": { \"Search for time zone\": { \"v\": [\"Zoeken naar tijdzone\"] }, \"Type to search time zone\": { \"v\": [\"Type om een tijdzone te zoeken\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Search for time zone\": { \"v\": [\"Szukaj strefy czasowej\"] }, \"Type to search time zone\": { \"v\": [\"Wpisz, aby wyszukać strefę czasową\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Search for time zone\": { \"v\": [\"Pesquisar fuso horário\"] }, \"Type to search time zone\": { \"v\": [\"Digite para pesquisar o fuso horário \"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Search for time zone\": { \"v\": [\"Pesquisar fuso horário\"] }, \"Type to search time zone\": { \"v\": [\"Digite para pesquisar o fuso horário \"] } } }, { \"l\": \"ro\", \"t\": { \"Search for time zone\": { \"v\": [\"Căutare zonă de timp\"] }, \"Type to search time zone\": { \"v\": [\"Tastați pentru a căuta fusul orar\"] } } }, { \"l\": \"ru\", \"t\": { \"Search for time zone\": { \"v\": [\"Поиск часового пояса\"] }, \"Type to search time zone\": { \"v\": [\"Введите для поиска часового пояса\"] } } }, { \"l\": \"sk\", \"t\": { \"Search for time zone\": { \"v\": [\"Vyhľadať časové pásmo\"] }, \"Type to search time zone\": { \"v\": [\"Začníte písať pre vyhľadávanie časovej zóny\"] } } }, { \"l\": \"sl\", \"t\": { \"Type to search time zone\": { \"v\": [\"Vpišite niz za iskanje časovnega pasu\"] } } }, { \"l\": \"sr\", \"t\": { \"Search for time zone\": { \"v\": [\"Претрага временске зоне\"] }, \"Type to search time zone\": { \"v\": [\"Куцајте да претражите временске зоне\"] } } }, { \"l\": \"sv\", \"t\": { \"Search for time zone\": { \"v\": [\"Sök efter tidszon\"] }, \"Type to search time zone\": { \"v\": [\"Skriv för att välja tidszon\"] } } }, { \"l\": \"tr\", \"t\": { \"Search for time zone\": { \"v\": [\"Saat dilimi ara\"] }, \"Type to search time zone\": { \"v\": [\"Saat dilimi aramak için yazmaya başlayın\"] } } }, { \"l\": \"uk\", \"t\": { \"Search for time zone\": { \"v\": [\"Шукати часові зони\"] }, \"Type to search time zone\": { \"v\": [\"Введіть для пошуку часовий пояс\"] } } }, { \"l\": \"uz\", \"t\": { \"Search for time zone\": { \"v\": [\"Vaqt mintaqasini qidiring\"] }, \"Type to search time zone\": { \"v\": [\"Vaqt mintaqasini qidirish uchun kiriting\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Search for time zone\": { \"v\": [\"搜索时区\"] }, \"Type to search time zone\": { \"v\": [\"打字以搜索时区\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Search for time zone\": { \"v\": [\"搜索時區\"] }, \"Type to search time zone\": { \"v\": [\"鍵入以搜索時區\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Type to search time zone\": { \"v\": [\"輸入以搜尋時區\"] } } }];\nconst t46 = [{ \"l\": \"ar\", \"t\": {} }, { \"l\": \"ast\", \"t\": {} }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": {} }, { \"l\": \"cs-CZ\", \"t\": {} }, { \"l\": \"da\", \"t\": {} }, { \"l\": \"de\", \"t\": {} }, { \"l\": \"de-DE\", \"t\": {} }, { \"l\": \"el\", \"t\": {} }, { \"l\": \"en-GB\", \"t\": {} }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": {} }, { \"l\": \"es-AR\", \"t\": {} }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": {} }, { \"l\": \"et-EE\", \"t\": {} }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": {} }, { \"l\": \"fi\", \"t\": {} }, { \"l\": \"fr\", \"t\": {} }, { \"l\": \"ga\", \"t\": {} }, { \"l\": \"gl\", \"t\": {} }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": {} }, { \"l\": \"is\", \"t\": {} }, { \"l\": \"it\", \"t\": {} }, { \"l\": \"ja\", \"t\": {} }, { \"l\": \"ja-JP\", \"t\": {} }, { \"l\": \"ko\", \"t\": {} }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": {} }, { \"l\": \"nl\", \"t\": {} }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": {} }, { \"l\": \"pt-BR\", \"t\": {} }, { \"l\": \"pt-PT\", \"t\": {} }, { \"l\": \"ro\", \"t\": {} }, { \"l\": \"ru\", \"t\": {} }, { \"l\": \"sk\", \"t\": {} }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": {} }, { \"l\": \"sv\", \"t\": {} }, { \"l\": \"tr\", \"t\": {} }, { \"l\": \"uk\", \"t\": {} }, { \"l\": \"uz\", \"t\": {} }, { \"l\": \"zh-CN\", \"t\": {} }, { \"l\": \"zh-HK\", \"t\": {} }, { \"l\": \"zh-TW\", \"t\": {} }];\nconst t47 = [{ \"l\": \"ar\", \"t\": { \"Select provider\": { \"v\": [\"اختر مزود\"] } } }, { \"l\": \"ast\", \"t\": { \"Select provider\": { \"v\": [\"Seleicionar el fornidor\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"Select provider\": { \"v\": [\"Vybrat poskytovatele\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Select provider\": { \"v\": [\"Vybrat poskytovatele\"] } } }, { \"l\": \"da\", \"t\": { \"Select provider\": { \"v\": [\"Vælg udbyder\"] } } }, { \"l\": \"de\", \"t\": { \"Select provider\": { \"v\": [\"Anbieter auswählen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Select provider\": { \"v\": [\"Anbieter auswählen\"] } } }, { \"l\": \"el\", \"t\": { \"Select provider\": { \"v\": [\"Επιλογή παρόχου\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Select provider\": { \"v\": [\"Select provider\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Select provider\": { \"v\": [\"Seleccione proveedor\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Select provider\": { \"v\": [\"Elija proveedor\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Select provider\": { \"v\": [\"Seleccionar proveedor\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Select provider\": { \"v\": [\"Seleccionar proveedor\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Select provider\": { \"v\": [\"Vali teenuspakkuja\"] } } }, { \"l\": \"eu\", \"t\": { \"Select provider\": { \"v\": [\"Hautatu hornitzailea\"] } } }, { \"l\": \"fa\", \"t\": { \"Select provider\": { \"v\": [\"ارائه دهنده را انتخاب کنید\"] } } }, { \"l\": \"fi\", \"t\": { \"Select provider\": { \"v\": [\"Valitse tarjoaja\"] } } }, { \"l\": \"fr\", \"t\": { \"Select provider\": { \"v\": [\"Sélectionner un fournisseur\"] } } }, { \"l\": \"ga\", \"t\": { \"Select provider\": { \"v\": [\"Roghnaigh soláthraí\"] } } }, { \"l\": \"gl\", \"t\": { \"Select provider\": { \"v\": [\"Seleccionar provedor\"] } } }, { \"l\": \"he\", \"t\": { \"Select provider\": { \"v\": [\"בחירת ספק\"] } } }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"Select provider\": { \"v\": [\"Pilih penyedia\"] } } }, { \"l\": \"is\", \"t\": { \"Select provider\": { \"v\": [\"Veldu þjónustuveitu\"] } } }, { \"l\": \"it\", \"t\": { \"Select provider\": { \"v\": [\"Selezionare il provider\"] } } }, { \"l\": \"ja\", \"t\": { \"Select provider\": { \"v\": [\"プロバイダーを選択\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Select provider\": { \"v\": [\"プロバイダーを選択\"] } } }, { \"l\": \"ko\", \"t\": { \"Select provider\": { \"v\": [\"제공자 선택\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Select provider\": { \"v\": [\"Velg leverandør\"] } } }, { \"l\": \"nl\", \"t\": { \"Select provider\": { \"v\": [\"Selecteer provider\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Select provider\": { \"v\": [\"Wybierz dostawcę\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Select provider\": { \"v\": [\"Selecionar provedor\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Select provider\": { \"v\": [\"Selecionar fornecedor\"] } } }, { \"l\": \"ro\", \"t\": { \"Select provider\": { \"v\": [\"Selectați providerul\"] } } }, { \"l\": \"ru\", \"t\": { \"Select provider\": { \"v\": [\"Выбрать поставщика\"] } } }, { \"l\": \"sk\", \"t\": { \"Select provider\": { \"v\": [\"Vybrať poskytovateľa\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"Select provider\": { \"v\": [\"Изаберите пружаоца\"] } } }, { \"l\": \"sv\", \"t\": { \"Select provider\": { \"v\": [\"Välj leverantör\"] } } }, { \"l\": \"tr\", \"t\": { \"Select provider\": { \"v\": [\"Sağlayıcı seçin\"] } } }, { \"l\": \"uk\", \"t\": { \"Select provider\": { \"v\": [\"Виберіть постачальника\"] } } }, { \"l\": \"uz\", \"t\": { \"Select provider\": { \"v\": [\"Provayderni tanlang\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Select provider\": { \"v\": [\"选择提供者\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Select provider\": { \"v\": [\"選擇提供者\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Select provider\": { \"v\": [\"選取提供者\"] } } }];\nconst t48 = [{ \"l\": \"ar\", \"t\": { \"Settings\": { \"v\": [\"الإعدادات\"] } } }, { \"l\": \"ast\", \"t\": { \"Settings\": { \"v\": [\"Configuración\"] } } }, { \"l\": \"br\", \"t\": { \"Settings\": { \"v\": [\"Arventennoù\"] } } }, { \"l\": \"ca\", \"t\": { \"Settings\": { \"v\": [\"Paràmetres\"] } } }, { \"l\": \"cs\", \"t\": { \"Settings\": { \"v\": [\"Nastavení\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Settings\": { \"v\": [\"Nastavení\"] } } }, { \"l\": \"da\", \"t\": { \"Settings\": { \"v\": [\"Indstillinger\"] } } }, { \"l\": \"de\", \"t\": { \"Settings\": { \"v\": [\"Einstellungen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Settings\": { \"v\": [\"Einstellungen\"] } } }, { \"l\": \"el\", \"t\": { \"Settings\": { \"v\": [\"Ρυθμίσεις\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Settings\": { \"v\": [\"Settings\"] } } }, { \"l\": \"eo\", \"t\": { \"Settings\": { \"v\": [\"Agordo\"] } } }, { \"l\": \"es\", \"t\": { \"Settings\": { \"v\": [\"Ajustes\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Settings\": { \"v\": [\"Configuraciones\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Settings\": { \"v\": [\"Configuraciones\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Settings\": { \"v\": [\"Configuración\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Settings\": { \"v\": [\"Seadistused\"] } } }, { \"l\": \"eu\", \"t\": { \"Settings\": { \"v\": [\"Ezarpenak\"] } } }, { \"l\": \"fa\", \"t\": { \"Settings\": { \"v\": [\"تنظیمات\"] } } }, { \"l\": \"fi\", \"t\": { \"Settings\": { \"v\": [\"Asetukset\"] } } }, { \"l\": \"fr\", \"t\": { \"Settings\": { \"v\": [\"Paramètres\"] } } }, { \"l\": \"ga\", \"t\": { \"Settings\": { \"v\": [\"Socruithe\"] } } }, { \"l\": \"gl\", \"t\": { \"Settings\": { \"v\": [\"Axustes\"] } } }, { \"l\": \"he\", \"t\": { \"Settings\": { \"v\": [\"הגדרות\"] } } }, { \"l\": \"hu\", \"t\": { \"Settings\": { \"v\": [\"Beállítások\"] } } }, { \"l\": \"id\", \"t\": { \"Settings\": { \"v\": [\"Pengaturan\"] } } }, { \"l\": \"is\", \"t\": { \"Settings\": { \"v\": [\"Stillingar\"] } } }, { \"l\": \"it\", \"t\": { \"Settings\": { \"v\": [\"Impostazioni\"] } } }, { \"l\": \"ja\", \"t\": { \"Settings\": { \"v\": [\"設定\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Settings\": { \"v\": [\"設定\"] } } }, { \"l\": \"ko\", \"t\": { \"Settings\": { \"v\": [\"선택\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"Settings\": { \"v\": [\"Nustatymai\"] } } }, { \"l\": \"lv\", \"t\": { \"Settings\": { \"v\": [\"Iestatījumi\"] } } }, { \"l\": \"mk\", \"t\": { \"Settings\": { \"v\": [\"Параметри\"] } } }, { \"l\": \"my\", \"t\": { \"Settings\": { \"v\": [\"ချိန်ညှိချက်များ\"] } } }, { \"l\": \"nb\", \"t\": { \"Settings\": { \"v\": [\"Innstillinger\"] } } }, { \"l\": \"nl\", \"t\": { \"Settings\": { \"v\": [\"Instellingen\"] } } }, { \"l\": \"oc\", \"t\": { \"Settings\": { \"v\": [\"Paramètres\"] } } }, { \"l\": \"pl\", \"t\": { \"Settings\": { \"v\": [\"Ustawienia\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Settings\": { \"v\": [\"Configurações\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Settings\": { \"v\": [\"Definições\"] } } }, { \"l\": \"ro\", \"t\": { \"Settings\": { \"v\": [\"Setări\"] } } }, { \"l\": \"ru\", \"t\": { \"Settings\": { \"v\": [\"Параметры\"] } } }, { \"l\": \"sk\", \"t\": { \"Settings\": { \"v\": [\"Nastavenia\"] } } }, { \"l\": \"sl\", \"t\": { \"Settings\": { \"v\": [\"Nastavitve\"] } } }, { \"l\": \"sr\", \"t\": { \"Settings\": { \"v\": [\"Поставке\"] } } }, { \"l\": \"sv\", \"t\": { \"Settings\": { \"v\": [\"Inställningar\"] } } }, { \"l\": \"tr\", \"t\": { \"Settings\": { \"v\": [\"Ayarlar\"] } } }, { \"l\": \"uk\", \"t\": { \"Settings\": { \"v\": [\"Налаштування\"] } } }, { \"l\": \"uz\", \"t\": { \"Settings\": { \"v\": [\"Sozlamalar\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Settings\": { \"v\": [\"设置\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Settings\": { \"v\": [\"設定\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Settings\": { \"v\": [\"設定\"] } } }];\nconst t50 = [{ \"l\": \"ar\", \"t\": { \"Submit\": { \"v\": [\"إرسال\"] } } }, { \"l\": \"ast\", \"t\": { \"Submit\": { \"v\": [\"Unviar\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Submit\": { \"v\": [\"Envia\"] } } }, { \"l\": \"cs\", \"t\": { \"Submit\": { \"v\": [\"Odeslat\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Submit\": { \"v\": [\"Odeslat\"] } } }, { \"l\": \"da\", \"t\": { \"Submit\": { \"v\": [\"Send\"] } } }, { \"l\": \"de\", \"t\": { \"Submit\": { \"v\": [\"Einreichen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Submit\": { \"v\": [\"Einreichen\"] } } }, { \"l\": \"el\", \"t\": { \"Submit\": { \"v\": [\"Υποβολή\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Submit\": { \"v\": [\"Submit\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Submit\": { \"v\": [\"Enviar\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Submit\": { \"v\": [\"Enviar\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Submit\": { \"v\": [\"Enviar\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Submit\": { \"v\": [\"Enviar\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Submit\": { \"v\": [\"Saada\"] } } }, { \"l\": \"eu\", \"t\": { \"Submit\": { \"v\": [\"Bidali\"] } } }, { \"l\": \"fa\", \"t\": { \"Submit\": { \"v\": [\"ارسال\"] } } }, { \"l\": \"fi\", \"t\": { \"Submit\": { \"v\": [\"Lähetä\"] } } }, { \"l\": \"fr\", \"t\": { \"Submit\": { \"v\": [\"Valider\"] } } }, { \"l\": \"ga\", \"t\": { \"Submit\": { \"v\": [\"Cuir isteach\"] } } }, { \"l\": \"gl\", \"t\": { \"Submit\": { \"v\": [\"Enviar\"] } } }, { \"l\": \"he\", \"t\": { \"Submit\": { \"v\": [\"הגשה\"] } } }, { \"l\": \"hu\", \"t\": { \"Submit\": { \"v\": [\"Beküldés\"] } } }, { \"l\": \"id\", \"t\": { \"Submit\": { \"v\": [\"Kirimkan\"] } } }, { \"l\": \"is\", \"t\": { \"Submit\": { \"v\": [\"Senda inn\"] } } }, { \"l\": \"it\", \"t\": { \"Submit\": { \"v\": [\"Invia\"] } } }, { \"l\": \"ja\", \"t\": { \"Submit\": { \"v\": [\"提出\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Submit\": { \"v\": [\"提出\"] } } }, { \"l\": \"ko\", \"t\": { \"Submit\": { \"v\": [\"제출\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"Submit\": { \"v\": [\"Pateikti\"] } } }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Submit\": { \"v\": [\"Испрати\"] } } }, { \"l\": \"my\", \"t\": { \"Submit\": { \"v\": [\"တင်သွင်းရန်\"] } } }, { \"l\": \"nb\", \"t\": { \"Submit\": { \"v\": [\"Send\"] } } }, { \"l\": \"nl\", \"t\": { \"Submit\": { \"v\": [\"Verwerken\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Submit\": { \"v\": [\"Wyślij\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Submit\": { \"v\": [\"Enviar\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Submit\": { \"v\": [\"Submeter\"] } } }, { \"l\": \"ro\", \"t\": { \"Submit\": { \"v\": [\"Trimiteți\"] } } }, { \"l\": \"ru\", \"t\": { \"Submit\": { \"v\": [\"Утвердить\"] } } }, { \"l\": \"sk\", \"t\": { \"Submit\": { \"v\": [\"Odoslať\"] } } }, { \"l\": \"sl\", \"t\": { \"Submit\": { \"v\": [\"Pošlji\"] } } }, { \"l\": \"sr\", \"t\": { \"Submit\": { \"v\": [\"Поднеси\"] } } }, { \"l\": \"sv\", \"t\": { \"Submit\": { \"v\": [\"Skicka\"] } } }, { \"l\": \"tr\", \"t\": { \"Submit\": { \"v\": [\"Gönder\"] } } }, { \"l\": \"uk\", \"t\": { \"Submit\": { \"v\": [\"Надіслати\"] } } }, { \"l\": \"uz\", \"t\": { \"Submit\": { \"v\": [\"Yuborish\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Submit\": { \"v\": [\"提交\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Submit\": { \"v\": [\"提交\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Submit\": { \"v\": [\"遞交\"] } } }];\nconst t51 = [{ \"l\": \"ar\", \"t\": { \"Unable to search the group\": { \"v\": [\"تعذّر البحث في المجموعة\"] } } }, { \"l\": \"ast\", \"t\": { \"Unable to search the group\": { \"v\": [\"Nun ye posible buscar el grupu\"] } } }, { \"l\": \"br\", \"t\": { \"Unable to search the group\": { \"v\": [\"Dibosupl eo klask ar strollad\"] } } }, { \"l\": \"ca\", \"t\": { \"Unable to search the group\": { \"v\": [\"No es pot cercar el grup\"] } } }, { \"l\": \"cs\", \"t\": { \"Unable to search the group\": { \"v\": [\"Nedaří se hledat skupinu\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Unable to search the group\": { \"v\": [\"Nedaří se hledat skupinu\"] } } }, { \"l\": \"da\", \"t\": { \"Unable to search the group\": { \"v\": [\"Kan ikke søge på denne gruppe\"] } } }, { \"l\": \"de\", \"t\": { \"Unable to search the group\": { \"v\": [\"Die Gruppe kann nicht durchsucht werden\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Unable to search the group\": { \"v\": [\"Die Gruppe kann nicht durchsucht werden\"] } } }, { \"l\": \"el\", \"t\": { \"Unable to search the group\": { \"v\": [\"Δεν είναι δυνατή η αναζήτηση της ομάδας\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Unable to search the group\": { \"v\": [\"Unable to search the group\"] } } }, { \"l\": \"eo\", \"t\": { \"Unable to search the group\": { \"v\": [\"Ne eblas serĉi en la grupo\"] } } }, { \"l\": \"es\", \"t\": { \"Unable to search the group\": { \"v\": [\"No es posible buscar en el grupo\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Unable to search the group\": { \"v\": [\"No se puede buscar el grupo\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Unable to search the group\": { \"v\": [\"No se puede buscar en el grupo\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Unable to search the group\": { \"v\": [\"No fue posible buscar en el grupo\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Unable to search the group\": { \"v\": [\"Gruppi ei ole võimalik otsida\"] } } }, { \"l\": \"eu\", \"t\": { \"Unable to search the group\": { \"v\": [\"Ezin izan da taldea bilatu\"] } } }, { \"l\": \"fa\", \"t\": { \"Unable to search the group\": { \"v\": [\"امکان جستجوی گروه وجود ندارد\"] } } }, { \"l\": \"fi\", \"t\": { \"Unable to search the group\": { \"v\": [\"Ryhmää ei voi hakea\"] } } }, { \"l\": \"fr\", \"t\": { \"Unable to search the group\": { \"v\": [\"Impossible de chercher le groupe\"] } } }, { \"l\": \"ga\", \"t\": { \"Unable to search the group\": { \"v\": [\"Ní féidir an grúpa a chuardach\"] } } }, { \"l\": \"gl\", \"t\": { \"Unable to search the group\": { \"v\": [\"Non foi posíbel buscar o grupo\"] } } }, { \"l\": \"he\", \"t\": { \"Unable to search the group\": { \"v\": [\"לא ניתן לחפש בקבוצה\"] } } }, { \"l\": \"hu\", \"t\": { \"Unable to search the group\": { \"v\": [\"A csoport nem kereshető\"] } } }, { \"l\": \"id\", \"t\": { \"Unable to search the group\": { \"v\": [\"Tidak dapat mencari dalam grup\"] } } }, { \"l\": \"is\", \"t\": { \"Unable to search the group\": { \"v\": [\"Get ekki leitað í hópnum\"] } } }, { \"l\": \"it\", \"t\": { \"Unable to search the group\": { \"v\": [\"Impossibile cercare il gruppo\"] } } }, { \"l\": \"ja\", \"t\": { \"Unable to search the group\": { \"v\": [\"グループを検索できません\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Unable to search the group\": { \"v\": [\"グループを検索できません\"] } } }, { \"l\": \"ko\", \"t\": { \"Unable to search the group\": { \"v\": [\"그룹을 검색할 수 없음\"] } } }, { \"l\": \"lt-LT\", \"t\": { \"Unable to search the group\": { \"v\": [\"Nepavyko atlikti paiešką grupėje\"] } } }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Unable to search the group\": { \"v\": [\"Неможе да се принајде групата\"] } } }, { \"l\": \"my\", \"t\": { \"Unable to search the group\": { \"v\": [\"အဖွဲ့အား ရှာဖွေ၍ မရနိုင်ပါ\"] } } }, { \"l\": \"nb\", \"t\": { \"Unable to search the group\": { \"v\": [\"Kunne ikke søke i gruppen\"] } } }, { \"l\": \"nl\", \"t\": { \"Unable to search the group\": { \"v\": [\"Kan niet zoeken in de groep\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Unable to search the group\": { \"v\": [\"Nie można przeszukać grupy\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Unable to search the group\": { \"v\": [\"Não foi possível pesquisar o grupo\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Unable to search the group\": { \"v\": [\"Não é possível pesquisar o grupo\"] } } }, { \"l\": \"ro\", \"t\": { \"Unable to search the group\": { \"v\": [\"Imposibilitatea de a căuta în grup\"] } } }, { \"l\": \"ru\", \"t\": { \"Unable to search the group\": { \"v\": [\"Невозможно найти группу\"] } } }, { \"l\": \"sk\", \"t\": { \"Unable to search the group\": { \"v\": [\"Skupinu sa nepodarilo nájsť\"] } } }, { \"l\": \"sl\", \"t\": { \"Unable to search the group\": { \"v\": [\"Ni mogoče iskati po skupini\"] } } }, { \"l\": \"sr\", \"t\": { \"Unable to search the group\": { \"v\": [\"Група не може да се претражи\"] } } }, { \"l\": \"sv\", \"t\": { \"Unable to search the group\": { \"v\": [\"Kunde inte söka i gruppen\"] } } }, { \"l\": \"tr\", \"t\": { \"Unable to search the group\": { \"v\": [\"Grupta arama yapılamadı\"] } } }, { \"l\": \"uk\", \"t\": { \"Unable to search the group\": { \"v\": [\"Неможливо шукати в групі\"] } } }, { \"l\": \"uz\", \"t\": { \"Unable to search the group\": { \"v\": [\"Guruhni qidirish imkonsiz\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Unable to search the group\": { \"v\": [\"无法搜索分组\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Unable to search the group\": { \"v\": [\"無法搜尋群組\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Unable to search the group\": { \"v\": [\"無法搜尋群組\"] } } }];\nconst t52 = [{ \"l\": \"ar\", \"t\": { \"Undo changes\": { \"v\": [\"تراجَع عن التغييرات\"] } } }, { \"l\": \"ast\", \"t\": { \"Undo changes\": { \"v\": [\"Desfacer los cambeos\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": { \"Undo changes\": { \"v\": [\"Desfés els canvis\"] } } }, { \"l\": \"cs\", \"t\": { \"Undo changes\": { \"v\": [\"Vzít změny zpět\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"Undo changes\": { \"v\": [\"Vzít změny zpět\"] } } }, { \"l\": \"da\", \"t\": { \"Undo changes\": { \"v\": [\"Fortryd ændringer\"] } } }, { \"l\": \"de\", \"t\": { \"Undo changes\": { \"v\": [\"Änderungen rückgängig machen\"] } } }, { \"l\": \"de-DE\", \"t\": { \"Undo changes\": { \"v\": [\"Änderungen rückgängig machen\"] } } }, { \"l\": \"el\", \"t\": { \"Undo changes\": { \"v\": [\"Αναίρεση Αλλαγών\"] } } }, { \"l\": \"en-GB\", \"t\": { \"Undo changes\": { \"v\": [\"Undo changes\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"Undo changes\": { \"v\": [\"Deshacer cambios\"] } } }, { \"l\": \"es-AR\", \"t\": { \"Undo changes\": { \"v\": [\"Deshacer cambios\"] } } }, { \"l\": \"es-EC\", \"t\": { \"Undo changes\": { \"v\": [\"Deshacer cambios\"] } } }, { \"l\": \"es-MX\", \"t\": { \"Undo changes\": { \"v\": [\"Deshacer cambios\"] } } }, { \"l\": \"et-EE\", \"t\": { \"Undo changes\": { \"v\": [\"Pööra muudatused tagasi\"] } } }, { \"l\": \"eu\", \"t\": { \"Undo changes\": { \"v\": [\"Aldaketak desegin\"] } } }, { \"l\": \"fa\", \"t\": { \"Undo changes\": { \"v\": [\"لغو تغییرات\"] } } }, { \"l\": \"fi\", \"t\": { \"Undo changes\": { \"v\": [\"Kumoa muutokset\"] } } }, { \"l\": \"fr\", \"t\": { \"Undo changes\": { \"v\": [\"Annuler les changements\"] } } }, { \"l\": \"ga\", \"t\": { \"Undo changes\": { \"v\": [\"Cealaigh athruithe\"] } } }, { \"l\": \"gl\", \"t\": { \"Undo changes\": { \"v\": [\"Desfacer os cambios\"] } } }, { \"l\": \"he\", \"t\": { \"Undo changes\": { \"v\": [\"ביטול שינויים\"] } } }, { \"l\": \"hu\", \"t\": { \"Undo changes\": { \"v\": [\"Változtatások visszavonása\"] } } }, { \"l\": \"id\", \"t\": { \"Undo changes\": { \"v\": [\"Urungkan perubahan\"] } } }, { \"l\": \"is\", \"t\": { \"Undo changes\": { \"v\": [\"Afturkalla breytingar\"] } } }, { \"l\": \"it\", \"t\": { \"Undo changes\": { \"v\": [\"Cancella i cambiamenti\"] } } }, { \"l\": \"ja\", \"t\": { \"Undo changes\": { \"v\": [\"変更を取り消し\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"Undo changes\": { \"v\": [\"変更を取り消し\"] } } }, { \"l\": \"ko\", \"t\": { \"Undo changes\": { \"v\": [\"변경 되돌리기\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": { \"Undo changes\": { \"v\": [\"Врати ги промените\"] } } }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"Undo changes\": { \"v\": [\"Tilbakestill endringer\"] } } }, { \"l\": \"nl\", \"t\": { \"Undo changes\": { \"v\": [\"Wijzigingen ongedaan maken\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"Undo changes\": { \"v\": [\"Cofnij zmiany\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"Undo changes\": { \"v\": [\"Desfazer modificações\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"Undo changes\": { \"v\": [\"Anular alterações\"] } } }, { \"l\": \"ro\", \"t\": { \"Undo changes\": { \"v\": [\"Anularea modificărilor\"] } } }, { \"l\": \"ru\", \"t\": { \"Undo changes\": { \"v\": [\"Отменить изменения\"] } } }, { \"l\": \"sk\", \"t\": { \"Undo changes\": { \"v\": [\"Vrátiť zmeny\"] } } }, { \"l\": \"sl\", \"t\": { \"Undo changes\": { \"v\": [\"Razveljavi spremembe\"] } } }, { \"l\": \"sr\", \"t\": { \"Undo changes\": { \"v\": [\"Поништи измене\"] } } }, { \"l\": \"sv\", \"t\": { \"Undo changes\": { \"v\": [\"Ångra ändringar\"] } } }, { \"l\": \"tr\", \"t\": { \"Undo changes\": { \"v\": [\"Değişiklikleri geri al\"] } } }, { \"l\": \"uk\", \"t\": { \"Undo changes\": { \"v\": [\"Скасувати зміни\"] } } }, { \"l\": \"uz\", \"t\": { \"Undo changes\": { \"v\": [\"O'zgarishlarni bekor qilish\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"Undo changes\": { \"v\": [\"撤销更改\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"Undo changes\": { \"v\": [\"取消更改\"] } } }, { \"l\": \"zh-TW\", \"t\": { \"Undo changes\": { \"v\": [\"還原變更\"] } } }];\nconst t53 = [{ \"l\": \"ar\", \"t\": { \"User status: {status}\": { \"v\": [\"حالة المستخدِم: {status}\"] } } }, { \"l\": \"ast\", \"t\": { \"User status: {status}\": { \"v\": [\"Estáu del usuariu: {status}\"] } } }, { \"l\": \"br\", \"t\": {} }, { \"l\": \"ca\", \"t\": {} }, { \"l\": \"cs\", \"t\": { \"User status: {status}\": { \"v\": [\"Stav uživatele: {status}\"] } } }, { \"l\": \"cs-CZ\", \"t\": { \"User status: {status}\": { \"v\": [\"Stav uživatele: {status}\"] } } }, { \"l\": \"da\", \"t\": { \"User status: {status}\": { \"v\": [\"Brugerstatus: {status}\"] } } }, { \"l\": \"de\", \"t\": { \"User status: {status}\": { \"v\": [\"Benutzerstatus: {status}\"] } } }, { \"l\": \"de-DE\", \"t\": { \"User status: {status}\": { \"v\": [\"Benutzerstatus: {status}\"] } } }, { \"l\": \"el\", \"t\": { \"User status: {status}\": { \"v\": [\"Κατάσταση χρήστη: {status}\"] } } }, { \"l\": \"en-GB\", \"t\": { \"User status: {status}\": { \"v\": [\"User status: {status}\"] } } }, { \"l\": \"eo\", \"t\": {} }, { \"l\": \"es\", \"t\": { \"User status: {status}\": { \"v\": [\"Estatus del usuario: {status}\"] } } }, { \"l\": \"es-AR\", \"t\": { \"User status: {status}\": { \"v\": [\"Estado del usuario: {status}\"] } } }, { \"l\": \"es-EC\", \"t\": {} }, { \"l\": \"es-MX\", \"t\": { \"User status: {status}\": { \"v\": [\"Estado del usuario: {status}\"] } } }, { \"l\": \"et-EE\", \"t\": { \"User status: {status}\": { \"v\": [\"Kasutaja olek: {status}\"] } } }, { \"l\": \"eu\", \"t\": {} }, { \"l\": \"fa\", \"t\": { \"User status: {status}\": { \"v\": [\"وضعیت کاربر: {status}\"] } } }, { \"l\": \"fi\", \"t\": { \"User status: {status}\": { \"v\": [\"Käyttäjän tila: {status}\"] } } }, { \"l\": \"fr\", \"t\": { \"User status: {status}\": { \"v\": [\"Statut de l'utilisateur : {status}\"] } } }, { \"l\": \"ga\", \"t\": { \"User status: {status}\": { \"v\": [\"Stádas úsáideora: {status}\"] } } }, { \"l\": \"gl\", \"t\": { \"User status: {status}\": { \"v\": [\"Estado do usuario: {status}\"] } } }, { \"l\": \"he\", \"t\": {} }, { \"l\": \"hu\", \"t\": {} }, { \"l\": \"id\", \"t\": { \"User status: {status}\": { \"v\": [\"Status pengguna: {status}\"] } } }, { \"l\": \"is\", \"t\": { \"User status: {status}\": { \"v\": [\"Staða notanda: {status}\"] } } }, { \"l\": \"it\", \"t\": { \"User status: {status}\": { \"v\": [\"Stato dell'utente: {status}\"] } } }, { \"l\": \"ja\", \"t\": { \"User status: {status}\": { \"v\": [\"ユーザのステータス: {status}\"] } } }, { \"l\": \"ja-JP\", \"t\": { \"User status: {status}\": { \"v\": [\"ユーザのステータス: {status}\"] } } }, { \"l\": \"ko\", \"t\": { \"User status: {status}\": { \"v\": [\"사용자 상태: {status}\"] } } }, { \"l\": \"lt-LT\", \"t\": {} }, { \"l\": \"lv\", \"t\": {} }, { \"l\": \"mk\", \"t\": {} }, { \"l\": \"my\", \"t\": {} }, { \"l\": \"nb\", \"t\": { \"User status: {status}\": { \"v\": [\"Brukerstatus: {status}\"] } } }, { \"l\": \"nl\", \"t\": { \"User status: {status}\": { \"v\": [\"Gebruikers status: {status}\"] } } }, { \"l\": \"oc\", \"t\": {} }, { \"l\": \"pl\", \"t\": { \"User status: {status}\": { \"v\": [\"Status użytkownika: {status}\"] } } }, { \"l\": \"pt-BR\", \"t\": { \"User status: {status}\": { \"v\": [\"Status do usuário: {status}\"] } } }, { \"l\": \"pt-PT\", \"t\": { \"User status: {status}\": { \"v\": [\"Estado do utilizador: {status}\"] } } }, { \"l\": \"ro\", \"t\": { \"User status: {status}\": { \"v\": [\"Status utilizator: {status}\"] } } }, { \"l\": \"ru\", \"t\": { \"User status: {status}\": { \"v\": [\"Статус пользователя: {status}\"] } } }, { \"l\": \"sk\", \"t\": { \"User status: {status}\": { \"v\": [\"Stav užívateľa: {status}\"] } } }, { \"l\": \"sl\", \"t\": {} }, { \"l\": \"sr\", \"t\": { \"User status: {status}\": { \"v\": [\"Статус корисника: {status}\"] } } }, { \"l\": \"sv\", \"t\": { \"User status: {status}\": { \"v\": [\"Användarstatus: {status}\"] } } }, { \"l\": \"tr\", \"t\": { \"User status: {status}\": { \"v\": [\"Kullanıcı durumu: {status}\"] } } }, { \"l\": \"uk\", \"t\": { \"User status: {status}\": { \"v\": [\"Статус користувача: {status}\"] } } }, { \"l\": \"uz\", \"t\": { \"User status: {status}\": { \"v\": [\"Foydalanuvchi holati: {status}\"] } } }, { \"l\": \"zh-CN\", \"t\": { \"User status: {status}\": { \"v\": [\"用户状态:{status}\"] } } }, { \"l\": \"zh-HK\", \"t\": { \"User status: {status}\": { \"v\": [\"用戶狀態:{status}\"] } } }, { \"l\": \"zh-TW\", \"t\": {} }];\nexport {\n t26 as A,\n t29 as B,\n t19 as C,\n t34 as D,\n n as E,\n t30 as F,\n t27 as G,\n t36 as H,\n t40 as I,\n t28 as J,\n t6 as K,\n t20 as L,\n t22 as M,\n t14 as N,\n t39 as O,\n t42 as P,\n t9 as Q,\n t53 as R,\n t11 as S,\n t23 as T,\n t8 as U,\n t47 as V,\n t41 as W,\n t24 as X,\n t32 as Y,\n t12 as Z,\n t as a,\n t52 as b,\n t17 as c,\n t33 as d,\n t2 as e,\n t38 as f,\n t16 as g,\n t51 as h,\n t50 as i,\n t46 as j,\n t0 as k,\n t35 as l,\n t18 as m,\n t48 as n,\n t44 as o,\n t15 as p,\n t13 as q,\n register as r,\n t10 as s,\n t3 as t,\n t25 as u,\n t43 as v,\n t37 as w,\n t5 as x,\n t4 as y,\n t45 as z\n};\n//# sourceMappingURL=_l10n-BmKQgz1z.mjs.map\n","import '../assets/NcIconSvgWrapper-DJQ2Kuip.css';\nimport DOMPurify from \"dompurify\";\nimport Vue, { useCssVars } from \"vue\";\nimport { n as normalizeComponent } from \"./_plugin-vue2_normalizer-DU4iP6Vu.mjs\";\nconst __default__ = {\n name: \"NcIconSvgWrapper\",\n props: {\n /**\n * Make the icon directional, meaning it is langauge direction aware.\n * If the icon is placed in a right-to-left context it will be mirrored vertically.\n */\n directional: {\n type: Boolean,\n default: false\n },\n /**\n * Set if the icon should be used as inline content e.g. within text.\n * By default the icon is made a block element for use inside `icon`-slots.\n */\n inline: {\n type: Boolean,\n default: false\n },\n /**\n * Raw SVG string to render\n */\n svg: {\n type: String,\n default: \"\"\n },\n /**\n * Label of the icon, used in aria-label\n */\n name: {\n type: String,\n default: \"\"\n },\n /**\n * Raw SVG path to render. Takes precedence over the SVG string in the `svg` prop.\n */\n path: {\n type: String,\n default: \"\"\n },\n /**\n * Size of the icon to show. Only use if not using within an icon slot.\n * Defaults to 20px which is the Nextcloud icon size for all icon slots.\n *\n * @default 20\n */\n size: {\n type: [Number, String],\n default: 20,\n validator: (value) => typeof value === \"number\" || value === \"auto\"\n }\n },\n computed: {\n /**\n * Icon size used in CSS\n */\n iconSize() {\n return typeof this.size === \"number\" ? `${this.size}px` : this.size;\n },\n cleanSvg() {\n if (!this.svg || this.path) {\n return;\n }\n const svg = DOMPurify.sanitize(this.svg);\n const svgDocument = new DOMParser().parseFromString(svg, \"image/svg+xml\");\n if (svgDocument.querySelector(\"parsererror\")) {\n Vue.util.warn(\"SVG is not valid\");\n return \"\";\n }\n if (svgDocument.documentElement.id) {\n svgDocument.documentElement.removeAttribute(\"id\");\n }\n return svgDocument.documentElement.outerHTML;\n }\n }\n};\nconst __injectCSSVars__ = () => {\n useCssVars((_vm, _setup) => ({\n \"0ceed50f\": _vm.iconSize\n }));\n};\nconst __setup__ = __default__.setup;\n__default__.setup = __setup__ ? (props, ctx) => {\n __injectCSSVars__();\n return __setup__(props, ctx);\n} : __injectCSSVars__;\nconst _sfc_main = __default__;\nvar _sfc_render = function render() {\n var _vm = this, _c = _vm._self._c;\n return _c(\"span\", { staticClass: \"icon-vue\", class: {\n \"icon-vue--directional\": _vm.directional,\n \"icon-vue--inline\": _vm.inline\n }, attrs: { \"aria-hidden\": _vm.name ? void 0 : \"true\", \"aria-label\": _vm.name || void 0, \"role\": \"img\" } }, [!_vm.cleanSvg ? _c(\"svg\", { attrs: { \"viewBox\": \"0 0 24 24\", \"xmlns\": \"http://www.w3.org/2000/svg\" } }, [_c(\"path\", { attrs: { \"d\": _vm.path } })]) : _c(\"span\", { domProps: { \"innerHTML\": _vm._s(_vm.cleanSvg) } })]);\n};\nvar _sfc_staticRenderFns = [];\nvar __component__ = /* @__PURE__ */ normalizeComponent(\n _sfc_main,\n _sfc_render,\n _sfc_staticRenderFns,\n false,\n null,\n \"6a8df8b8\"\n);\nconst NcIconSvgWrapper = __component__.exports;\nexport {\n NcIconSvgWrapper as N\n};\n//# sourceMappingURL=NcIconSvgWrapper-BreCg8pX.mjs.map\n","import '../assets/NcLoadingIcon-C7S2_wmi.css';\nimport { n as normalizeComponent } from \"../chunks/_plugin-vue2_normalizer-DU4iP6Vu.mjs\";\nconst _sfc_main = {\n name: \"NcLoadingIcon\",\n props: {\n /**\n * Specify the size of the loading icon.\n */\n size: {\n type: Number,\n default: 20\n },\n /**\n * The appearance of the loading icon.\n * 'auto' adjusts to the Nextcloud color scheme,\n * 'light' and 'dark' are static.\n */\n appearance: {\n type: String,\n validator(value) {\n return [\"auto\", \"light\", \"dark\"].includes(value);\n },\n default: \"auto\"\n },\n /**\n * Specify what is loading.\n */\n name: {\n type: String,\n default: \"\"\n }\n },\n computed: {\n colors() {\n const colors = [\"#777\", \"#CCC\"];\n if (this.appearance === \"light\") {\n return colors;\n } else if (this.appearance === \"dark\") {\n return colors.reverse();\n }\n return [\"var(--color-loading-light)\", \"var(--color-loading-dark)\"];\n }\n }\n};\nvar _sfc_render = function render() {\n var _vm = this, _c = _vm._self._c;\n return _c(\"span\", { staticClass: \"material-design-icon loading-icon\", attrs: { \"aria-label\": _vm.name, \"role\": \"img\" } }, [_c(\"svg\", { attrs: { \"width\": _vm.size, \"height\": _vm.size, \"viewBox\": \"0 0 24 24\" } }, [_c(\"path\", { attrs: { \"fill\": _vm.colors[0], \"d\": \"M12,4V2A10,10 0 1,0 22,12H20A8,8 0 1,1 12,4Z\" } }), _c(\"path\", { attrs: { \"fill\": _vm.colors[1], \"d\": \"M12,4V2A10,10 0 0,1 22,12H20A8,8 0 0,0 12,4Z\" } }, [_vm.name ? _c(\"title\", [_vm._v(_vm._s(_vm.name))]) : _vm._e()])])]);\n};\nvar _sfc_staticRenderFns = [];\nvar __component__ = /* @__PURE__ */ normalizeComponent(\n _sfc_main,\n _sfc_render,\n _sfc_staticRenderFns,\n false,\n null,\n \"94ff8098\"\n);\nconst NcLoadingIcon = __component__.exports;\nexport {\n NcLoadingIcon as default\n};\n//# sourceMappingURL=NcLoadingIcon.mjs.map\n","import { ref } from \"vue\";\nimport { r as register, d as t33, a as t } from \"./_l10n-BmKQgz1z.mjs\";\nimport { N as NcButton } from \"./NcButton-DUZTtFhr.mjs\";\nimport { N as NcIconSvgWrapper } from \"./NcIconSvgWrapper-BreCg8pX.mjs\";\nimport NcLoadingIcon from \"../Components/NcLoadingIcon.mjs\";\nimport { n as normalizeComponent } from \"./_plugin-vue2_normalizer-DU4iP6Vu.mjs\";\nregister(t33);\nconst _sfc_main = {\n __name: \"NcDialogButton\",\n props: {\n /**\n * The function that will be called when the button is pressed.\n * If the function returns `false` the click is ignored and the dialog will not be closed,\n * which is the default behavior of \"reset\"-buttons.\n *\n * @type {() => unknown|false|Promise}\n */\n callback: {\n type: Function,\n required: false,\n default: () => {\n }\n },\n /**\n * The label of the button\n */\n label: {\n type: String,\n required: true\n },\n /**\n * Optional inline SVG icon for the button\n */\n icon: {\n type: String,\n required: false,\n default: void 0\n },\n /**\n * The button type, see NcButton.\n *\n * @deprecated The usage for setting the color variant is deprecated and will be removed with v9.\n * @type {'button'|'submit'|'reset'|'primary'|'secondary'|'error'|'warning'|'success'}\n */\n type: {\n type: String,\n required: false,\n default: \"secondary\",\n validator: (type) => typeof type === \"string\" && [\"button\", \"submit\", \"reset\", \"primary\", \"secondary\", \"tertiary\", \"error\", \"warning\", \"success\"].includes(type)\n },\n /**\n * See `nativeType` of `NcButton`.\n *\n * @deprecated use `type` instead - will removed with v9\n */\n nativeType: {\n type: String,\n required: false,\n default: \"button\",\n validator(value) {\n return [\"submit\", \"reset\", \"button\"].includes(value);\n }\n },\n /**\n * If the button should be shown as disabled\n */\n disabled: {\n type: Boolean,\n default: false\n },\n /**\n * The button variant, see NcButton.\n *\n * @type {'primary'|'secondary'|'tertiary'|'error'|'warning'|'success'}\n * @since 8.24.0\n */\n variant: {\n type: String,\n required: false,\n default: \"secondary\",\n validator: (type) => typeof type === \"string\" && [\"primary\", \"secondary\", \"tertiary\", \"error\", \"warning\", \"success\"].includes(type)\n }\n },\n emits: [\"click\"],\n setup(__props, { emit }) {\n const props = __props;\n const isLoading = ref(false);\n async function handleClick(e) {\n if (isLoading.value) {\n return;\n }\n isLoading.value = true;\n try {\n const fallback = props.nativeType === \"reset\" ? false : void 0;\n const result = await props.callback?.() ?? fallback;\n if (result !== false) {\n emit(\"click\", e, result);\n }\n } finally {\n isLoading.value = false;\n }\n }\n return { __sfc: true, props, emit, isLoading, handleClick, t, NcButton, NcIconSvgWrapper, NcLoadingIcon };\n }\n};\nvar _sfc_render = function render() {\n var _vm = this, _c = _vm._self._c, _setup = _vm._self._setupProxy;\n return _c(_setup.NcButton, { attrs: { \"aria-label\": _vm.label, \"disabled\": _vm.disabled, \"type\": _vm.type, \"native-type\": _vm.nativeType, \"variant\": _vm.variant }, on: { \"click\": _setup.handleClick }, scopedSlots: _vm._u([{ key: \"icon\", fn: function() {\n return [_vm._t(\"icon\", function() {\n return [_setup.isLoading ? _c(_setup.NcLoadingIcon, { attrs: {\n \"name\": _setup.t(\"Loading …\")\n /* TRANSLATORS: The button is in a loading state*/\n } }) : _vm.icon !== void 0 ? _c(_setup.NcIconSvgWrapper, { attrs: { \"svg\": _vm.icon } }) : _vm._e()];\n })];\n }, proxy: true }], null, true) }, [_vm._v(\" \" + _vm._s(_vm.label) + \" \")]);\n};\nvar _sfc_staticRenderFns = [];\nvar __component__ = /* @__PURE__ */ normalizeComponent(\n _sfc_main,\n _sfc_render,\n _sfc_staticRenderFns,\n false,\n null,\n null\n);\nconst NcDialogButton = __component__.exports;\nexport {\n NcDialogButton as N\n};\n//# sourceMappingURL=NcDialogButton-P7Ryycqk.mjs.map\n","var mdiArrowLeft = \"M20,11V13H8L13.5,18.5L12.08,19.92L4.16,12L12.08,4.08L13.5,5.5L8,11H20Z\";\nvar mdiArrowRight = \"M4,11V13H16L10.5,18.5L11.92,19.92L19.84,12L11.92,4.08L10.5,5.5L16,11H4Z\";\nvar mdiArrowTopRight = \"M5,17.59L15.59,7H9V5H19V15H17V8.41L6.41,19L5,17.59Z\";\nvar mdiCheck = \"M21,7L9,19L3.5,13.5L4.91,12.09L9,16.17L19.59,5.59L21,7Z\";\nvar mdiChevronLeft = \"M15.41,16.58L10.83,12L15.41,7.41L14,6L8,12L14,18L15.41,16.58Z\";\nvar mdiChevronRight = \"M8.59,16.58L13.17,12L8.59,7.41L10,6L16,12L10,18L8.59,16.58Z\";\nvar mdiClose = \"M19,6.41L17.59,5L12,10.59L6.41,5L5,6.41L10.59,12L5,17.59L6.41,19L12,13.41L17.59,19L19,17.59L13.41,12L19,6.41Z\";\nvar mdiCloseCircleOutline = \"M12,20C7.59,20 4,16.41 4,12C4,7.59 7.59,4 12,4C16.41,4 20,7.59 20,12C20,16.41 16.41,20 12,20M12,2C6.47,2 2,6.47 2,12C2,17.53 6.47,22 12,22C17.53,22 22,17.53 22,12C22,6.47 17.53,2 12,2M14.59,8L12,10.59L9.41,8L8,9.41L10.59,12L8,14.59L9.41,16L12,13.41L14.59,16L16,14.59L13.41,12L16,9.41L14.59,8Z\";\nvar mdiCog = \"M12,15.5A3.5,3.5 0 0,1 8.5,12A3.5,3.5 0 0,1 12,8.5A3.5,3.5 0 0,1 15.5,12A3.5,3.5 0 0,1 12,15.5M19.43,12.97C19.47,12.65 19.5,12.33 19.5,12C19.5,11.67 19.47,11.34 19.43,11L21.54,9.37C21.73,9.22 21.78,8.95 21.66,8.73L19.66,5.27C19.54,5.05 19.27,4.96 19.05,5.05L16.56,6.05C16.04,5.66 15.5,5.32 14.87,5.07L14.5,2.42C14.46,2.18 14.25,2 14,2H10C9.75,2 9.54,2.18 9.5,2.42L9.13,5.07C8.5,5.32 7.96,5.66 7.44,6.05L4.95,5.05C4.73,4.96 4.46,5.05 4.34,5.27L2.34,8.73C2.21,8.95 2.27,9.22 2.46,9.37L4.57,11C4.53,11.34 4.5,11.67 4.5,12C4.5,12.33 4.53,12.65 4.57,12.97L2.46,14.63C2.27,14.78 2.21,15.05 2.34,15.27L4.34,18.73C4.46,18.95 4.73,19.03 4.95,18.95L7.44,17.94C7.96,18.34 8.5,18.68 9.13,18.93L9.5,21.58C9.54,21.82 9.75,22 10,22H14C14.25,22 14.46,21.82 14.5,21.58L14.87,18.93C15.5,18.67 16.04,18.34 16.56,17.94L19.05,18.95C19.27,19.03 19.54,18.95 19.66,18.73L21.66,15.27C21.78,15.05 21.73,14.78 21.54,14.63L19.43,12.97Z\";\nvar mdiCogOutline = \"M12,8A4,4 0 0,1 16,12A4,4 0 0,1 12,16A4,4 0 0,1 8,12A4,4 0 0,1 12,8M12,10A2,2 0 0,0 10,12A2,2 0 0,0 12,14A2,2 0 0,0 14,12A2,2 0 0,0 12,10M10,22C9.75,22 9.54,21.82 9.5,21.58L9.13,18.93C8.5,18.68 7.96,18.34 7.44,17.94L4.95,18.95C4.73,19.03 4.46,18.95 4.34,18.73L2.34,15.27C2.21,15.05 2.27,14.78 2.46,14.63L4.57,12.97L4.5,12L4.57,11L2.46,9.37C2.27,9.22 2.21,8.95 2.34,8.73L4.34,5.27C4.46,5.05 4.73,4.96 4.95,5.05L7.44,6.05C7.96,5.66 8.5,5.32 9.13,5.07L9.5,2.42C9.54,2.18 9.75,2 10,2H14C14.25,2 14.46,2.18 14.5,2.42L14.87,5.07C15.5,5.32 16.04,5.66 16.56,6.05L19.05,5.05C19.27,4.96 19.54,5.05 19.66,5.27L21.66,8.73C21.79,8.95 21.73,9.22 21.54,9.37L19.43,11L19.5,12L19.43,13L21.54,14.63C21.73,14.78 21.79,15.05 21.66,15.27L19.66,18.73C19.54,18.95 19.27,19.04 19.05,18.95L16.56,17.95C16.04,18.34 15.5,18.68 14.87,18.93L14.5,21.58C14.46,21.82 14.25,22 14,22H10M11.25,4L10.88,6.61C9.68,6.86 8.62,7.5 7.85,8.39L5.44,7.35L4.69,8.65L6.8,10.2C6.4,11.37 6.4,12.64 6.8,13.8L4.68,15.36L5.43,16.66L7.86,15.62C8.63,16.5 9.68,17.14 10.87,17.38L11.24,20H12.76L13.13,17.39C14.32,17.14 15.37,16.5 16.14,15.62L18.57,16.66L19.32,15.36L17.2,13.81C17.6,12.64 17.6,11.37 17.2,10.2L19.31,8.65L18.56,7.35L16.15,8.39C15.38,7.5 14.32,6.86 13.12,6.62L12.75,4H11.25Z\";\nvar mdiContentCopy = \"M19,21H8V7H19M19,5H8A2,2 0 0,0 6,7V21A2,2 0 0,0 8,23H19A2,2 0 0,0 21,21V7A2,2 0 0,0 19,5M16,1H4A2,2 0 0,0 2,3V17H4V3H16V1Z\";\nvar mdiCreation = \"M19,1L17.74,3.75L15,5L17.74,6.26L19,9L20.25,6.26L23,5L20.25,3.75M9,4L6.5,9.5L1,12L6.5,14.5L9,20L11.5,14.5L17,12L11.5,9.5M19,15L17.74,17.74L15,19L17.74,20.25L19,23L20.25,20.25L23,19L20.25,17.74\";\nvar mdiDotsHorizontal = \"M16,12A2,2 0 0,1 18,10A2,2 0 0,1 20,12A2,2 0 0,1 18,14A2,2 0 0,1 16,12M10,12A2,2 0 0,1 12,10A2,2 0 0,1 14,12A2,2 0 0,1 12,14A2,2 0 0,1 10,12M4,12A2,2 0 0,1 6,10A2,2 0 0,1 8,12A2,2 0 0,1 6,14A2,2 0 0,1 4,12Z\";\nvar mdiOpenInNew = \"M14,3V5H17.59L7.76,14.83L9.17,16.24L19,6.41V10H21V3M19,19H5V5H12V3H5C3.89,3 3,3.9 3,5V19A2,2 0 0,0 5,21H19A2,2 0 0,0 21,19V12H19V19Z\";\nvar mdiToggleSwitch = \"M17,7H7A5,5 0 0,0 2,12A5,5 0 0,0 7,17H17A5,5 0 0,0 22,12A5,5 0 0,0 17,7M17,15A3,3 0 0,1 14,12A3,3 0 0,1 17,9A3,3 0 0,1 20,12A3,3 0 0,1 17,15Z\";\nvar mdiToggleSwitchOff = \"M17,7H7A5,5 0 0,0 2,12A5,5 0 0,0 7,17H17A5,5 0 0,0 22,12A5,5 0 0,0 17,7M7,15A3,3 0 0,1 4,12A3,3 0 0,1 7,9A3,3 0 0,1 10,12A3,3 0 0,1 7,15Z\";\nvar mdiUndo = \"M12.5,8C9.85,8 7.45,9 5.6,10.6L2,7V16H11L7.38,12.38C8.77,11.22 10.54,10.5 12.5,10.5C16.04,10.5 19.05,12.81 20.1,16L22.47,15.22C21.08,11.03 17.15,8 12.5,8Z\";\nexport {\n mdiCheck as a,\n mdiUndo as b,\n mdiClose as c,\n mdiArrowRight as d,\n mdiCreation as e,\n mdiToggleSwitchOff as f,\n mdiToggleSwitch as g,\n mdiCogOutline as h,\n mdiCog as i,\n mdiContentCopy as j,\n mdiOpenInNew as k,\n mdiArrowTopRight as l,\n mdiChevronRight as m,\n mdiDotsHorizontal as n,\n mdiCloseCircleOutline as o,\n mdiArrowLeft as p,\n mdiChevronLeft as q\n};\n//# sourceMappingURL=mdi-C_j0YT8c.mjs.map\n","/*!\n* tabbable 6.3.0\n* @license MIT, https://github.com/focus-trap/tabbable/blob/master/LICENSE\n*/\n// NOTE: separate `:not()` selectors has broader browser support than the newer\n// `:not([inert], [inert] *)` (Feb 2023)\n// CAREFUL: JSDom does not support `:not([inert] *)` as a selector; using it causes\n// the entire query to fail, resulting in no nodes found, which will break a lot\n// of things... so we have to rely on JS to identify nodes inside an inert container\nvar candidateSelectors = ['input:not([inert])', 'select:not([inert])', 'textarea:not([inert])', 'a[href]:not([inert])', 'button:not([inert])', '[tabindex]:not(slot):not([inert])', 'audio[controls]:not([inert])', 'video[controls]:not([inert])', '[contenteditable]:not([contenteditable=\"false\"]):not([inert])', 'details>summary:first-of-type:not([inert])', 'details:not([inert])'];\nvar candidateSelector = /* #__PURE__ */candidateSelectors.join(',');\nvar NoElement = typeof Element === 'undefined';\nvar matches = NoElement ? function () {} : Element.prototype.matches || Element.prototype.msMatchesSelector || Element.prototype.webkitMatchesSelector;\nvar getRootNode = !NoElement && Element.prototype.getRootNode ? function (element) {\n var _element$getRootNode;\n return element === null || element === void 0 ? void 0 : (_element$getRootNode = element.getRootNode) === null || _element$getRootNode === void 0 ? void 0 : _element$getRootNode.call(element);\n} : function (element) {\n return element === null || element === void 0 ? void 0 : element.ownerDocument;\n};\n\n/**\n * Determines if a node is inert or in an inert ancestor.\n * @param {Element} [node]\n * @param {boolean} [lookUp] If true and `node` is not inert, looks up at ancestors to\n * see if any of them are inert. If false, only `node` itself is considered.\n * @returns {boolean} True if inert itself or by way of being in an inert ancestor.\n * False if `node` is falsy.\n */\nvar _isInert = function isInert(node, lookUp) {\n var _node$getAttribute;\n if (lookUp === void 0) {\n lookUp = true;\n }\n // CAREFUL: JSDom does not support inert at all, so we can't use the `HTMLElement.inert`\n // JS API property; we have to check the attribute, which can either be empty or 'true';\n // if it's `null` (not specified) or 'false', it's an active element\n var inertAtt = node === null || node === void 0 ? void 0 : (_node$getAttribute = node.getAttribute) === null || _node$getAttribute === void 0 ? void 0 : _node$getAttribute.call(node, 'inert');\n var inert = inertAtt === '' || inertAtt === 'true';\n\n // NOTE: this could also be handled with `node.matches('[inert], :is([inert] *)')`\n // if it weren't for `matches()` not being a function on shadow roots; the following\n // code works for any kind of node\n // CAREFUL: JSDom does not appear to support certain selectors like `:not([inert] *)`\n // so it likely would not support `:is([inert] *)` either...\n var result = inert || lookUp && node && _isInert(node.parentNode); // recursive\n\n return result;\n};\n\n/**\n * Determines if a node's content is editable.\n * @param {Element} [node]\n * @returns True if it's content-editable; false if it's not or `node` is falsy.\n */\nvar isContentEditable = function isContentEditable(node) {\n var _node$getAttribute2;\n // CAREFUL: JSDom does not support the `HTMLElement.isContentEditable` API so we have\n // to use the attribute directly to check for this, which can either be empty or 'true';\n // if it's `null` (not specified) or 'false', it's a non-editable element\n var attValue = node === null || node === void 0 ? void 0 : (_node$getAttribute2 = node.getAttribute) === null || _node$getAttribute2 === void 0 ? void 0 : _node$getAttribute2.call(node, 'contenteditable');\n return attValue === '' || attValue === 'true';\n};\n\n/**\n * @param {Element} el container to check in\n * @param {boolean} includeContainer add container to check\n * @param {(node: Element) => boolean} filter filter candidates\n * @returns {Element[]}\n */\nvar getCandidates = function getCandidates(el, includeContainer, filter) {\n // even if `includeContainer=false`, we still have to check it for inertness because\n // if it's inert, all its children are inert\n if (_isInert(el)) {\n return [];\n }\n var candidates = Array.prototype.slice.apply(el.querySelectorAll(candidateSelector));\n if (includeContainer && matches.call(el, candidateSelector)) {\n candidates.unshift(el);\n }\n candidates = candidates.filter(filter);\n return candidates;\n};\n\n/**\n * @callback GetShadowRoot\n * @param {Element} element to check for shadow root\n * @returns {ShadowRoot|boolean} ShadowRoot if available or boolean indicating if a shadowRoot is attached but not available.\n */\n\n/**\n * @callback ShadowRootFilter\n * @param {Element} shadowHostNode the element which contains shadow content\n * @returns {boolean} true if a shadow root could potentially contain valid candidates.\n */\n\n/**\n * @typedef {Object} CandidateScope\n * @property {Element} scopeParent contains inner candidates\n * @property {Element[]} candidates list of candidates found in the scope parent\n */\n\n/**\n * @typedef {Object} IterativeOptions\n * @property {GetShadowRoot|boolean} getShadowRoot true if shadow support is enabled; falsy if not;\n * if a function, implies shadow support is enabled and either returns the shadow root of an element\n * or a boolean stating if it has an undisclosed shadow root\n * @property {(node: Element) => boolean} filter filter candidates\n * @property {boolean} flatten if true then result will flatten any CandidateScope into the returned list\n * @property {ShadowRootFilter} shadowRootFilter filter shadow roots;\n */\n\n/**\n * @param {Element[]} elements list of element containers to match candidates from\n * @param {boolean} includeContainer add container list to check\n * @param {IterativeOptions} options\n * @returns {Array.}\n */\nvar _getCandidatesIteratively = function getCandidatesIteratively(elements, includeContainer, options) {\n var candidates = [];\n var elementsToCheck = Array.from(elements);\n while (elementsToCheck.length) {\n var element = elementsToCheck.shift();\n if (_isInert(element, false)) {\n // no need to look up since we're drilling down\n // anything inside this container will also be inert\n continue;\n }\n if (element.tagName === 'SLOT') {\n // add shadow dom slot scope (slot itself cannot be focusable)\n var assigned = element.assignedElements();\n var content = assigned.length ? assigned : element.children;\n var nestedCandidates = _getCandidatesIteratively(content, true, options);\n if (options.flatten) {\n candidates.push.apply(candidates, nestedCandidates);\n } else {\n candidates.push({\n scopeParent: element,\n candidates: nestedCandidates\n });\n }\n } else {\n // check candidate element\n var validCandidate = matches.call(element, candidateSelector);\n if (validCandidate && options.filter(element) && (includeContainer || !elements.includes(element))) {\n candidates.push(element);\n }\n\n // iterate over shadow content if possible\n var shadowRoot = element.shadowRoot ||\n // check for an undisclosed shadow\n typeof options.getShadowRoot === 'function' && options.getShadowRoot(element);\n\n // no inert look up because we're already drilling down and checking for inertness\n // on the way down, so all containers to this root node should have already been\n // vetted as non-inert\n var validShadowRoot = !_isInert(shadowRoot, false) && (!options.shadowRootFilter || options.shadowRootFilter(element));\n if (shadowRoot && validShadowRoot) {\n // add shadow dom scope IIF a shadow root node was given; otherwise, an undisclosed\n // shadow exists, so look at light dom children as fallback BUT create a scope for any\n // child candidates found because they're likely slotted elements (elements that are\n // children of the web component element (which has the shadow), in the light dom, but\n // slotted somewhere _inside_ the undisclosed shadow) -- the scope is created below,\n // _after_ we return from this recursive call\n var _nestedCandidates = _getCandidatesIteratively(shadowRoot === true ? element.children : shadowRoot.children, true, options);\n if (options.flatten) {\n candidates.push.apply(candidates, _nestedCandidates);\n } else {\n candidates.push({\n scopeParent: element,\n candidates: _nestedCandidates\n });\n }\n } else {\n // there's not shadow so just dig into the element's (light dom) children\n // __without__ giving the element special scope treatment\n elementsToCheck.unshift.apply(elementsToCheck, element.children);\n }\n }\n }\n return candidates;\n};\n\n/**\n * @private\n * Determines if the node has an explicitly specified `tabindex` attribute.\n * @param {HTMLElement} node\n * @returns {boolean} True if so; false if not.\n */\nvar hasTabIndex = function hasTabIndex(node) {\n return !isNaN(parseInt(node.getAttribute('tabindex'), 10));\n};\n\n/**\n * Determine the tab index of a given node.\n * @param {HTMLElement} node\n * @returns {number} Tab order (negative, 0, or positive number).\n * @throws {Error} If `node` is falsy.\n */\nvar getTabIndex = function getTabIndex(node) {\n if (!node) {\n throw new Error('No node provided');\n }\n if (node.tabIndex < 0) {\n // in Chrome,
,